1// Copyright 2012 the V8 project authors. All rights reserved. 2// Use of this source code is governed by a BSD-style license that can be 3// found in the LICENSE file. 4 5/** \mainpage V8 API Reference Guide 6 * 7 * V8 is Google's open source JavaScript engine. 8 * 9 * This set of documents provides reference material generated from the 10 * V8 header file, include/v8.h. 11 * 12 * For other documentation see http://code.google.com/apis/v8/ 13 */ 14 15#ifndef INCLUDE_V8_H_ 16#define INCLUDE_V8_H_ 17 18#include <stddef.h> 19#include <stdint.h> 20#include <stdio.h> 21#include <utility> 22#include <vector> 23 24#include "v8-version.h" // NOLINT(build/include) 25#include "v8config.h" // NOLINT(build/include) 26 27// We reserve the V8_* prefix for macros defined in V8 public API and 28// assume there are no name conflicts with the embedder's code. 29 30#ifdef V8_OS_WIN 31 32// Setup for Windows DLL export/import. When building the V8 DLL the 33// BUILDING_V8_SHARED needs to be defined. When building a program which uses 34// the V8 DLL USING_V8_SHARED needs to be defined. When either building the V8 35// static library or building a program which uses the V8 static library neither 36// BUILDING_V8_SHARED nor USING_V8_SHARED should be defined. 37#if defined(BUILDING_V8_SHARED) && defined(USING_V8_SHARED) 38#error both BUILDING_V8_SHARED and USING_V8_SHARED are set - please check the\ 39 build configuration to ensure that at most one of these is set 40#endif 41 42#ifdef BUILDING_V8_SHARED 43# define V8_EXPORT __declspec(dllexport) 44#elif USING_V8_SHARED 45# define V8_EXPORT __declspec(dllimport) 46#else 47# define V8_EXPORT 48#endif // BUILDING_V8_SHARED 49 50#else // V8_OS_WIN 51 52// Setup for Linux shared library export. 53#if V8_HAS_ATTRIBUTE_VISIBILITY && defined(V8_SHARED) 54# ifdef BUILDING_V8_SHARED 55# define V8_EXPORT __attribute__ ((visibility("default"))) 56# else 57# define V8_EXPORT 58# endif 59#else 60# define V8_EXPORT 61#endif 62 63#endif // V8_OS_WIN 64 65/** 66 * The v8 JavaScript engine. 67 */ 68namespace v8 { 69 70class AccessorSignature; 71class Array; 72class Boolean; 73class BooleanObject; 74class Context; 75class CpuProfiler; 76class Data; 77class Date; 78class External; 79class Function; 80class FunctionTemplate; 81class HeapProfiler; 82class ImplementationUtilities; 83class Int32; 84class Integer; 85class Isolate; 86template <class T> 87class Maybe; 88class Name; 89class Number; 90class NumberObject; 91class Object; 92class ObjectOperationDescriptor; 93class ObjectTemplate; 94class Platform; 95class Primitive; 96class Promise; 97class Proxy; 98class RawOperationDescriptor; 99class Script; 100class SharedArrayBuffer; 101class Signature; 102class StartupData; 103class StackFrame; 104class StackTrace; 105class String; 106class StringObject; 107class Symbol; 108class SymbolObject; 109class Private; 110class Uint32; 111class Utils; 112class Value; 113template <class T> class Local; 114template <class T> 115class MaybeLocal; 116template <class T> class Eternal; 117template<class T> class NonCopyablePersistentTraits; 118template<class T> class PersistentBase; 119template <class T, class M = NonCopyablePersistentTraits<T> > 120class Persistent; 121template <class T> 122class Global; 123template<class K, class V, class T> class PersistentValueMap; 124template <class K, class V, class T> 125class PersistentValueMapBase; 126template <class K, class V, class T> 127class GlobalValueMap; 128template<class V, class T> class PersistentValueVector; 129template<class T, class P> class WeakCallbackObject; 130class FunctionTemplate; 131class ObjectTemplate; 132class Data; 133template<typename T> class FunctionCallbackInfo; 134template<typename T> class PropertyCallbackInfo; 135class StackTrace; 136class StackFrame; 137class Isolate; 138class CallHandlerHelper; 139class EscapableHandleScope; 140template<typename T> class ReturnValue; 141 142namespace experimental { 143class FastAccessorBuilder; 144} // namespace experimental 145 146namespace internal { 147class Arguments; 148class Heap; 149class HeapObject; 150class Isolate; 151class Object; 152struct StreamedSource; 153template<typename T> class CustomArguments; 154class PropertyCallbackArguments; 155class FunctionCallbackArguments; 156class GlobalHandles; 157} // namespace internal 158 159 160/** 161 * General purpose unique identifier. 162 */ 163class UniqueId { 164 public: 165 explicit UniqueId(intptr_t data) 166 : data_(data) {} 167 168 bool operator==(const UniqueId& other) const { 169 return data_ == other.data_; 170 } 171 172 bool operator!=(const UniqueId& other) const { 173 return data_ != other.data_; 174 } 175 176 bool operator<(const UniqueId& other) const { 177 return data_ < other.data_; 178 } 179 180 private: 181 intptr_t data_; 182}; 183 184// --- Handles --- 185 186#define TYPE_CHECK(T, S) \ 187 while (false) { \ 188 *(static_cast<T* volatile*>(0)) = static_cast<S*>(0); \ 189 } 190 191 192/** 193 * An object reference managed by the v8 garbage collector. 194 * 195 * All objects returned from v8 have to be tracked by the garbage 196 * collector so that it knows that the objects are still alive. Also, 197 * because the garbage collector may move objects, it is unsafe to 198 * point directly to an object. Instead, all objects are stored in 199 * handles which are known by the garbage collector and updated 200 * whenever an object moves. Handles should always be passed by value 201 * (except in cases like out-parameters) and they should never be 202 * allocated on the heap. 203 * 204 * There are two types of handles: local and persistent handles. 205 * Local handles are light-weight and transient and typically used in 206 * local operations. They are managed by HandleScopes. Persistent 207 * handles can be used when storing objects across several independent 208 * operations and have to be explicitly deallocated when they're no 209 * longer used. 210 * 211 * It is safe to extract the object stored in the handle by 212 * dereferencing the handle (for instance, to extract the Object* from 213 * a Local<Object>); the value will still be governed by a handle 214 * behind the scenes and the same rules apply to these values as to 215 * their handles. 216 */ 217template <class T> 218class Local { 219 public: 220 V8_INLINE Local() : val_(0) {} 221 template <class S> 222 V8_INLINE Local(Local<S> that) 223 : val_(reinterpret_cast<T*>(*that)) { 224 /** 225 * This check fails when trying to convert between incompatible 226 * handles. For example, converting from a Local<String> to a 227 * Local<Number>. 228 */ 229 TYPE_CHECK(T, S); 230 } 231 232 /** 233 * Returns true if the handle is empty. 234 */ 235 V8_INLINE bool IsEmpty() const { return val_ == 0; } 236 237 /** 238 * Sets the handle to be empty. IsEmpty() will then return true. 239 */ 240 V8_INLINE void Clear() { val_ = 0; } 241 242 V8_INLINE T* operator->() const { return val_; } 243 244 V8_INLINE T* operator*() const { return val_; } 245 246 /** 247 * Checks whether two handles are the same. 248 * Returns true if both are empty, or if the objects 249 * to which they refer are identical. 250 * The handles' references are not checked. 251 */ 252 template <class S> 253 V8_INLINE bool operator==(const Local<S>& that) const { 254 internal::Object** a = reinterpret_cast<internal::Object**>(this->val_); 255 internal::Object** b = reinterpret_cast<internal::Object**>(that.val_); 256 if (a == 0) return b == 0; 257 if (b == 0) return false; 258 return *a == *b; 259 } 260 261 template <class S> V8_INLINE bool operator==( 262 const PersistentBase<S>& that) const { 263 internal::Object** a = reinterpret_cast<internal::Object**>(this->val_); 264 internal::Object** b = reinterpret_cast<internal::Object**>(that.val_); 265 if (a == 0) return b == 0; 266 if (b == 0) return false; 267 return *a == *b; 268 } 269 270 /** 271 * Checks whether two handles are different. 272 * Returns true if only one of the handles is empty, or if 273 * the objects to which they refer are different. 274 * The handles' references are not checked. 275 */ 276 template <class S> 277 V8_INLINE bool operator!=(const Local<S>& that) const { 278 return !operator==(that); 279 } 280 281 template <class S> V8_INLINE bool operator!=( 282 const Persistent<S>& that) const { 283 return !operator==(that); 284 } 285 286 template <class S> V8_INLINE static Local<T> Cast(Local<S> that) { 287#ifdef V8_ENABLE_CHECKS 288 // If we're going to perform the type check then we have to check 289 // that the handle isn't empty before doing the checked cast. 290 if (that.IsEmpty()) return Local<T>(); 291#endif 292 return Local<T>(T::Cast(*that)); 293 } 294 295 296 template <class S> V8_INLINE Local<S> As() { 297 return Local<S>::Cast(*this); 298 } 299 300 /** 301 * Create a local handle for the content of another handle. 302 * The referee is kept alive by the local handle even when 303 * the original handle is destroyed/disposed. 304 */ 305 V8_INLINE static Local<T> New(Isolate* isolate, Local<T> that); 306 V8_INLINE static Local<T> New(Isolate* isolate, 307 const PersistentBase<T>& that); 308 309 private: 310 friend class Utils; 311 template<class F> friend class Eternal; 312 template<class F> friend class PersistentBase; 313 template<class F, class M> friend class Persistent; 314 template<class F> friend class Local; 315 template <class F> 316 friend class MaybeLocal; 317 template<class F> friend class FunctionCallbackInfo; 318 template<class F> friend class PropertyCallbackInfo; 319 friend class String; 320 friend class Object; 321 friend class Context; 322 friend class Private; 323 template<class F> friend class internal::CustomArguments; 324 friend Local<Primitive> Undefined(Isolate* isolate); 325 friend Local<Primitive> Null(Isolate* isolate); 326 friend Local<Boolean> True(Isolate* isolate); 327 friend Local<Boolean> False(Isolate* isolate); 328 friend class HandleScope; 329 friend class EscapableHandleScope; 330 template <class F1, class F2, class F3> 331 friend class PersistentValueMapBase; 332 template<class F1, class F2> friend class PersistentValueVector; 333 template <class F> 334 friend class ReturnValue; 335 336 explicit V8_INLINE Local(T* that) : val_(that) {} 337 V8_INLINE static Local<T> New(Isolate* isolate, T* that); 338 T* val_; 339}; 340 341 342#if !defined(V8_IMMINENT_DEPRECATION_WARNINGS) 343// Local is an alias for Local for historical reasons. 344template <class T> 345using Handle = Local<T>; 346#endif 347 348 349/** 350 * A MaybeLocal<> is a wrapper around Local<> that enforces a check whether 351 * the Local<> is empty before it can be used. 352 * 353 * If an API method returns a MaybeLocal<>, the API method can potentially fail 354 * either because an exception is thrown, or because an exception is pending, 355 * e.g. because a previous API call threw an exception that hasn't been caught 356 * yet, or because a TerminateExecution exception was thrown. In that case, an 357 * empty MaybeLocal is returned. 358 */ 359template <class T> 360class MaybeLocal { 361 public: 362 V8_INLINE MaybeLocal() : val_(nullptr) {} 363 template <class S> 364 V8_INLINE MaybeLocal(Local<S> that) 365 : val_(reinterpret_cast<T*>(*that)) { 366 TYPE_CHECK(T, S); 367 } 368 369 V8_INLINE bool IsEmpty() const { return val_ == nullptr; } 370 371 template <class S> 372 V8_WARN_UNUSED_RESULT V8_INLINE bool ToLocal(Local<S>* out) const { 373 out->val_ = IsEmpty() ? nullptr : this->val_; 374 return !IsEmpty(); 375 } 376 377 // Will crash if the MaybeLocal<> is empty. 378 V8_INLINE Local<T> ToLocalChecked(); 379 380 template <class S> 381 V8_INLINE Local<S> FromMaybe(Local<S> default_value) const { 382 return IsEmpty() ? default_value : Local<S>(val_); 383 } 384 385 private: 386 T* val_; 387}; 388 389 390// Eternal handles are set-once handles that live for the life of the isolate. 391template <class T> class Eternal { 392 public: 393 V8_INLINE Eternal() : index_(kInitialValue) { } 394 template<class S> 395 V8_INLINE Eternal(Isolate* isolate, Local<S> handle) : index_(kInitialValue) { 396 Set(isolate, handle); 397 } 398 // Can only be safely called if already set. 399 V8_INLINE Local<T> Get(Isolate* isolate); 400 V8_INLINE bool IsEmpty() { return index_ == kInitialValue; } 401 template<class S> V8_INLINE void Set(Isolate* isolate, Local<S> handle); 402 403 private: 404 static const int kInitialValue = -1; 405 int index_; 406}; 407 408 409static const int kInternalFieldsInWeakCallback = 2; 410 411 412template <typename T> 413class WeakCallbackInfo { 414 public: 415 typedef void (*Callback)(const WeakCallbackInfo<T>& data); 416 417 WeakCallbackInfo(Isolate* isolate, T* parameter, 418 void* internal_fields[kInternalFieldsInWeakCallback], 419 Callback* callback) 420 : isolate_(isolate), parameter_(parameter), callback_(callback) { 421 for (int i = 0; i < kInternalFieldsInWeakCallback; ++i) { 422 internal_fields_[i] = internal_fields[i]; 423 } 424 } 425 426 V8_INLINE Isolate* GetIsolate() const { return isolate_; } 427 V8_INLINE T* GetParameter() const { return parameter_; } 428 V8_INLINE void* GetInternalField(int index) const; 429 430 V8_INLINE V8_DEPRECATED("use indexed version", 431 void* GetInternalField1() const) { 432 return internal_fields_[0]; 433 } 434 V8_INLINE V8_DEPRECATED("use indexed version", 435 void* GetInternalField2() const) { 436 return internal_fields_[1]; 437 } 438 439 V8_DEPRECATED("Not realiable once SetSecondPassCallback() was used.", 440 bool IsFirstPass() const) { 441 return callback_ != nullptr; 442 } 443 444 // When first called, the embedder MUST Reset() the Global which triggered the 445 // callback. The Global itself is unusable for anything else. No v8 other api 446 // calls may be called in the first callback. Should additional work be 447 // required, the embedder must set a second pass callback, which will be 448 // called after all the initial callbacks are processed. 449 // Calling SetSecondPassCallback on the second pass will immediately crash. 450 void SetSecondPassCallback(Callback callback) const { *callback_ = callback; } 451 452 private: 453 Isolate* isolate_; 454 T* parameter_; 455 Callback* callback_; 456 void* internal_fields_[kInternalFieldsInWeakCallback]; 457}; 458 459 460// kParameter will pass a void* parameter back to the callback, kInternalFields 461// will pass the first two internal fields back to the callback, kFinalizer 462// will pass a void* parameter back, but is invoked before the object is 463// actually collected, so it can be resurrected. In the last case, it is not 464// possible to request a second pass callback. 465enum class WeakCallbackType { kParameter, kInternalFields, kFinalizer }; 466 467/** 468 * An object reference that is independent of any handle scope. Where 469 * a Local handle only lives as long as the HandleScope in which it was 470 * allocated, a PersistentBase handle remains valid until it is explicitly 471 * disposed. 472 * 473 * A persistent handle contains a reference to a storage cell within 474 * the v8 engine which holds an object value and which is updated by 475 * the garbage collector whenever the object is moved. A new storage 476 * cell can be created using the constructor or PersistentBase::Reset and 477 * existing handles can be disposed using PersistentBase::Reset. 478 * 479 */ 480template <class T> class PersistentBase { 481 public: 482 /** 483 * If non-empty, destroy the underlying storage cell 484 * IsEmpty() will return true after this call. 485 */ 486 V8_INLINE void Reset(); 487 /** 488 * If non-empty, destroy the underlying storage cell 489 * and create a new one with the contents of other if other is non empty 490 */ 491 template <class S> 492 V8_INLINE void Reset(Isolate* isolate, const Local<S>& other); 493 494 /** 495 * If non-empty, destroy the underlying storage cell 496 * and create a new one with the contents of other if other is non empty 497 */ 498 template <class S> 499 V8_INLINE void Reset(Isolate* isolate, const PersistentBase<S>& other); 500 501 V8_INLINE bool IsEmpty() const { return val_ == NULL; } 502 V8_INLINE void Empty() { val_ = 0; } 503 504 V8_INLINE Local<T> Get(Isolate* isolate) const { 505 return Local<T>::New(isolate, *this); 506 } 507 508 template <class S> 509 V8_INLINE bool operator==(const PersistentBase<S>& that) const { 510 internal::Object** a = reinterpret_cast<internal::Object**>(this->val_); 511 internal::Object** b = reinterpret_cast<internal::Object**>(that.val_); 512 if (a == NULL) return b == NULL; 513 if (b == NULL) return false; 514 return *a == *b; 515 } 516 517 template <class S> 518 V8_INLINE bool operator==(const Local<S>& that) const { 519 internal::Object** a = reinterpret_cast<internal::Object**>(this->val_); 520 internal::Object** b = reinterpret_cast<internal::Object**>(that.val_); 521 if (a == NULL) return b == NULL; 522 if (b == NULL) return false; 523 return *a == *b; 524 } 525 526 template <class S> 527 V8_INLINE bool operator!=(const PersistentBase<S>& that) const { 528 return !operator==(that); 529 } 530 531 template <class S> 532 V8_INLINE bool operator!=(const Local<S>& that) const { 533 return !operator==(that); 534 } 535 536 /** 537 * Install a finalization callback on this object. 538 * NOTE: There is no guarantee as to *when* or even *if* the callback is 539 * invoked. The invocation is performed solely on a best effort basis. 540 * As always, GC-based finalization should *not* be relied upon for any 541 * critical form of resource management! 542 */ 543 template <typename P> 544 V8_INLINE void SetWeak(P* parameter, 545 typename WeakCallbackInfo<P>::Callback callback, 546 WeakCallbackType type); 547 548 /** 549 * Turns this handle into a weak phantom handle without finalization callback. 550 * The handle will be reset automatically when the garbage collector detects 551 * that the object is no longer reachable. 552 * A related function Isolate::NumberOfPhantomHandleResetsSinceLastCall 553 * returns how many phantom handles were reset by the garbage collector. 554 */ 555 V8_INLINE void SetWeak(); 556 557 template<typename P> 558 V8_INLINE P* ClearWeak(); 559 560 // TODO(dcarney): remove this. 561 V8_INLINE void ClearWeak() { ClearWeak<void>(); } 562 563 /** 564 * Allows the embedder to tell the v8 garbage collector that a certain object 565 * is alive. Only allowed when the embedder is asked to trace its heap by 566 * EmbedderHeapTracer. 567 */ 568 V8_INLINE void RegisterExternalReference(Isolate* isolate) const; 569 570 /** 571 * Marks the reference to this object independent. Garbage collector is free 572 * to ignore any object groups containing this object. Weak callback for an 573 * independent handle should not assume that it will be preceded by a global 574 * GC prologue callback or followed by a global GC epilogue callback. 575 */ 576 V8_INLINE void MarkIndependent(); 577 578 /** 579 * Marks the reference to this object partially dependent. Partially dependent 580 * handles only depend on other partially dependent handles and these 581 * dependencies are provided through object groups. It provides a way to build 582 * smaller object groups for young objects that represent only a subset of all 583 * external dependencies. This mark is automatically cleared after each 584 * garbage collection. 585 */ 586 V8_INLINE V8_DEPRECATED( 587 "deprecated optimization, do not use partially dependent groups", 588 void MarkPartiallyDependent()); 589 590 /** 591 * Marks the reference to this object as active. The scavenge garbage 592 * collection should not reclaim the objects marked as active. 593 * This bit is cleared after the each garbage collection pass. 594 */ 595 V8_INLINE void MarkActive(); 596 597 V8_INLINE bool IsIndependent() const; 598 599 /** Checks if the handle holds the only reference to an object. */ 600 V8_INLINE bool IsNearDeath() const; 601 602 /** Returns true if the handle's reference is weak. */ 603 V8_INLINE bool IsWeak() const; 604 605 /** 606 * Assigns a wrapper class ID to the handle. See RetainedObjectInfo interface 607 * description in v8-profiler.h for details. 608 */ 609 V8_INLINE void SetWrapperClassId(uint16_t class_id); 610 611 /** 612 * Returns the class ID previously assigned to this handle or 0 if no class ID 613 * was previously assigned. 614 */ 615 V8_INLINE uint16_t WrapperClassId() const; 616 617 private: 618 friend class Isolate; 619 friend class Utils; 620 template<class F> friend class Local; 621 template<class F1, class F2> friend class Persistent; 622 template <class F> 623 friend class Global; 624 template<class F> friend class PersistentBase; 625 template<class F> friend class ReturnValue; 626 template <class F1, class F2, class F3> 627 friend class PersistentValueMapBase; 628 template<class F1, class F2> friend class PersistentValueVector; 629 friend class Object; 630 631 explicit V8_INLINE PersistentBase(T* val) : val_(val) {} 632 PersistentBase(const PersistentBase& other) = delete; // NOLINT 633 void operator=(const PersistentBase&) = delete; 634 V8_INLINE static T* New(Isolate* isolate, T* that); 635 636 T* val_; 637}; 638 639 640/** 641 * Default traits for Persistent. This class does not allow 642 * use of the copy constructor or assignment operator. 643 * At present kResetInDestructor is not set, but that will change in a future 644 * version. 645 */ 646template<class T> 647class NonCopyablePersistentTraits { 648 public: 649 typedef Persistent<T, NonCopyablePersistentTraits<T> > NonCopyablePersistent; 650 static const bool kResetInDestructor = false; 651 template<class S, class M> 652 V8_INLINE static void Copy(const Persistent<S, M>& source, 653 NonCopyablePersistent* dest) { 654 Uncompilable<Object>(); 655 } 656 // TODO(dcarney): come up with a good compile error here. 657 template<class O> V8_INLINE static void Uncompilable() { 658 TYPE_CHECK(O, Primitive); 659 } 660}; 661 662 663/** 664 * Helper class traits to allow copying and assignment of Persistent. 665 * This will clone the contents of storage cell, but not any of the flags, etc. 666 */ 667template<class T> 668struct CopyablePersistentTraits { 669 typedef Persistent<T, CopyablePersistentTraits<T> > CopyablePersistent; 670 static const bool kResetInDestructor = true; 671 template<class S, class M> 672 static V8_INLINE void Copy(const Persistent<S, M>& source, 673 CopyablePersistent* dest) { 674 // do nothing, just allow copy 675 } 676}; 677 678 679/** 680 * A PersistentBase which allows copy and assignment. 681 * 682 * Copy, assignment and destructor bevavior is controlled by the traits 683 * class M. 684 * 685 * Note: Persistent class hierarchy is subject to future changes. 686 */ 687template <class T, class M> class Persistent : public PersistentBase<T> { 688 public: 689 /** 690 * A Persistent with no storage cell. 691 */ 692 V8_INLINE Persistent() : PersistentBase<T>(0) { } 693 /** 694 * Construct a Persistent from a Local. 695 * When the Local is non-empty, a new storage cell is created 696 * pointing to the same object, and no flags are set. 697 */ 698 template <class S> 699 V8_INLINE Persistent(Isolate* isolate, Local<S> that) 700 : PersistentBase<T>(PersistentBase<T>::New(isolate, *that)) { 701 TYPE_CHECK(T, S); 702 } 703 /** 704 * Construct a Persistent from a Persistent. 705 * When the Persistent is non-empty, a new storage cell is created 706 * pointing to the same object, and no flags are set. 707 */ 708 template <class S, class M2> 709 V8_INLINE Persistent(Isolate* isolate, const Persistent<S, M2>& that) 710 : PersistentBase<T>(PersistentBase<T>::New(isolate, *that)) { 711 TYPE_CHECK(T, S); 712 } 713 /** 714 * The copy constructors and assignment operator create a Persistent 715 * exactly as the Persistent constructor, but the Copy function from the 716 * traits class is called, allowing the setting of flags based on the 717 * copied Persistent. 718 */ 719 V8_INLINE Persistent(const Persistent& that) : PersistentBase<T>(0) { 720 Copy(that); 721 } 722 template <class S, class M2> 723 V8_INLINE Persistent(const Persistent<S, M2>& that) : PersistentBase<T>(0) { 724 Copy(that); 725 } 726 V8_INLINE Persistent& operator=(const Persistent& that) { // NOLINT 727 Copy(that); 728 return *this; 729 } 730 template <class S, class M2> 731 V8_INLINE Persistent& operator=(const Persistent<S, M2>& that) { // NOLINT 732 Copy(that); 733 return *this; 734 } 735 /** 736 * The destructor will dispose the Persistent based on the 737 * kResetInDestructor flags in the traits class. Since not calling dispose 738 * can result in a memory leak, it is recommended to always set this flag. 739 */ 740 V8_INLINE ~Persistent() { 741 if (M::kResetInDestructor) this->Reset(); 742 } 743 744 // TODO(dcarney): this is pretty useless, fix or remove 745 template <class S> 746 V8_INLINE static Persistent<T>& Cast(Persistent<S>& that) { // NOLINT 747#ifdef V8_ENABLE_CHECKS 748 // If we're going to perform the type check then we have to check 749 // that the handle isn't empty before doing the checked cast. 750 if (!that.IsEmpty()) T::Cast(*that); 751#endif 752 return reinterpret_cast<Persistent<T>&>(that); 753 } 754 755 // TODO(dcarney): this is pretty useless, fix or remove 756 template <class S> V8_INLINE Persistent<S>& As() { // NOLINT 757 return Persistent<S>::Cast(*this); 758 } 759 760 private: 761 friend class Isolate; 762 friend class Utils; 763 template<class F> friend class Local; 764 template<class F1, class F2> friend class Persistent; 765 template<class F> friend class ReturnValue; 766 767 explicit V8_INLINE Persistent(T* that) : PersistentBase<T>(that) {} 768 V8_INLINE T* operator*() const { return this->val_; } 769 template<class S, class M2> 770 V8_INLINE void Copy(const Persistent<S, M2>& that); 771}; 772 773 774/** 775 * A PersistentBase which has move semantics. 776 * 777 * Note: Persistent class hierarchy is subject to future changes. 778 */ 779template <class T> 780class Global : public PersistentBase<T> { 781 public: 782 /** 783 * A Global with no storage cell. 784 */ 785 V8_INLINE Global() : PersistentBase<T>(nullptr) {} 786 /** 787 * Construct a Global from a Local. 788 * When the Local is non-empty, a new storage cell is created 789 * pointing to the same object, and no flags are set. 790 */ 791 template <class S> 792 V8_INLINE Global(Isolate* isolate, Local<S> that) 793 : PersistentBase<T>(PersistentBase<T>::New(isolate, *that)) { 794 TYPE_CHECK(T, S); 795 } 796 /** 797 * Construct a Global from a PersistentBase. 798 * When the Persistent is non-empty, a new storage cell is created 799 * pointing to the same object, and no flags are set. 800 */ 801 template <class S> 802 V8_INLINE Global(Isolate* isolate, const PersistentBase<S>& that) 803 : PersistentBase<T>(PersistentBase<T>::New(isolate, that.val_)) { 804 TYPE_CHECK(T, S); 805 } 806 /** 807 * Move constructor. 808 */ 809 V8_INLINE Global(Global&& other) : PersistentBase<T>(other.val_) { // NOLINT 810 other.val_ = nullptr; 811 } 812 V8_INLINE ~Global() { this->Reset(); } 813 /** 814 * Move via assignment. 815 */ 816 template <class S> 817 V8_INLINE Global& operator=(Global<S>&& rhs) { // NOLINT 818 TYPE_CHECK(T, S); 819 if (this != &rhs) { 820 this->Reset(); 821 this->val_ = rhs.val_; 822 rhs.val_ = nullptr; 823 } 824 return *this; 825 } 826 /** 827 * Pass allows returning uniques from functions, etc. 828 */ 829 Global Pass() { return static_cast<Global&&>(*this); } // NOLINT 830 831 /* 832 * For compatibility with Chromium's base::Bind (base::Passed). 833 */ 834 typedef void MoveOnlyTypeForCPP03; 835 836 private: 837 template <class F> 838 friend class ReturnValue; 839 Global(const Global&) = delete; 840 void operator=(const Global&) = delete; 841 V8_INLINE T* operator*() const { return this->val_; } 842}; 843 844 845// UniquePersistent is an alias for Global for historical reason. 846template <class T> 847using UniquePersistent = Global<T>; 848 849 850 /** 851 * A stack-allocated class that governs a number of local handles. 852 * After a handle scope has been created, all local handles will be 853 * allocated within that handle scope until either the handle scope is 854 * deleted or another handle scope is created. If there is already a 855 * handle scope and a new one is created, all allocations will take 856 * place in the new handle scope until it is deleted. After that, 857 * new handles will again be allocated in the original handle scope. 858 * 859 * After the handle scope of a local handle has been deleted the 860 * garbage collector will no longer track the object stored in the 861 * handle and may deallocate it. The behavior of accessing a handle 862 * for which the handle scope has been deleted is undefined. 863 */ 864class V8_EXPORT HandleScope { 865 public: 866 explicit HandleScope(Isolate* isolate); 867 868 ~HandleScope(); 869 870 /** 871 * Counts the number of allocated handles. 872 */ 873 static int NumberOfHandles(Isolate* isolate); 874 875 V8_INLINE Isolate* GetIsolate() const { 876 return reinterpret_cast<Isolate*>(isolate_); 877 } 878 879 protected: 880 V8_INLINE HandleScope() {} 881 882 void Initialize(Isolate* isolate); 883 884 static internal::Object** CreateHandle(internal::Isolate* isolate, 885 internal::Object* value); 886 887 private: 888 // Uses heap_object to obtain the current Isolate. 889 static internal::Object** CreateHandle(internal::HeapObject* heap_object, 890 internal::Object* value); 891 892 // Make it hard to create heap-allocated or illegal handle scopes by 893 // disallowing certain operations. 894 HandleScope(const HandleScope&); 895 void operator=(const HandleScope&); 896 void* operator new(size_t size); 897 void operator delete(void*, size_t); 898 899 internal::Isolate* isolate_; 900 internal::Object** prev_next_; 901 internal::Object** prev_limit_; 902 903 // Local::New uses CreateHandle with an Isolate* parameter. 904 template<class F> friend class Local; 905 906 // Object::GetInternalField and Context::GetEmbedderData use CreateHandle with 907 // a HeapObject* in their shortcuts. 908 friend class Object; 909 friend class Context; 910}; 911 912 913/** 914 * A HandleScope which first allocates a handle in the current scope 915 * which will be later filled with the escape value. 916 */ 917class V8_EXPORT EscapableHandleScope : public HandleScope { 918 public: 919 explicit EscapableHandleScope(Isolate* isolate); 920 V8_INLINE ~EscapableHandleScope() {} 921 922 /** 923 * Pushes the value into the previous scope and returns a handle to it. 924 * Cannot be called twice. 925 */ 926 template <class T> 927 V8_INLINE Local<T> Escape(Local<T> value) { 928 internal::Object** slot = 929 Escape(reinterpret_cast<internal::Object**>(*value)); 930 return Local<T>(reinterpret_cast<T*>(slot)); 931 } 932 933 private: 934 internal::Object** Escape(internal::Object** escape_value); 935 936 // Make it hard to create heap-allocated or illegal handle scopes by 937 // disallowing certain operations. 938 EscapableHandleScope(const EscapableHandleScope&); 939 void operator=(const EscapableHandleScope&); 940 void* operator new(size_t size); 941 void operator delete(void*, size_t); 942 943 internal::Object** escape_slot_; 944}; 945 946class V8_EXPORT SealHandleScope { 947 public: 948 SealHandleScope(Isolate* isolate); 949 ~SealHandleScope(); 950 951 private: 952 // Make it hard to create heap-allocated or illegal handle scopes by 953 // disallowing certain operations. 954 SealHandleScope(const SealHandleScope&); 955 void operator=(const SealHandleScope&); 956 void* operator new(size_t size); 957 void operator delete(void*, size_t); 958 959 internal::Isolate* isolate_; 960 internal::Object** prev_limit_; 961 int prev_sealed_level_; 962}; 963 964 965// --- Special objects --- 966 967 968/** 969 * The superclass of values and API object templates. 970 */ 971class V8_EXPORT Data { 972 private: 973 Data(); 974}; 975 976 977/** 978 * The optional attributes of ScriptOrigin. 979 */ 980class ScriptOriginOptions { 981 public: 982 V8_INLINE ScriptOriginOptions(bool is_embedder_debug_script = false, 983 bool is_shared_cross_origin = false, 984 bool is_opaque = false) 985 : flags_((is_embedder_debug_script ? kIsEmbedderDebugScript : 0) | 986 (is_shared_cross_origin ? kIsSharedCrossOrigin : 0) | 987 (is_opaque ? kIsOpaque : 0)) {} 988 V8_INLINE ScriptOriginOptions(int flags) 989 : flags_(flags & 990 (kIsEmbedderDebugScript | kIsSharedCrossOrigin | kIsOpaque)) {} 991 bool IsEmbedderDebugScript() const { 992 return (flags_ & kIsEmbedderDebugScript) != 0; 993 } 994 bool IsSharedCrossOrigin() const { 995 return (flags_ & kIsSharedCrossOrigin) != 0; 996 } 997 bool IsOpaque() const { return (flags_ & kIsOpaque) != 0; } 998 int Flags() const { return flags_; } 999 1000 private: 1001 enum { 1002 kIsEmbedderDebugScript = 1, 1003 kIsSharedCrossOrigin = 1 << 1, 1004 kIsOpaque = 1 << 2 1005 }; 1006 const int flags_; 1007}; 1008 1009/** 1010 * The origin, within a file, of a script. 1011 */ 1012class ScriptOrigin { 1013 public: 1014 V8_INLINE ScriptOrigin( 1015 Local<Value> resource_name, 1016 Local<Integer> resource_line_offset = Local<Integer>(), 1017 Local<Integer> resource_column_offset = Local<Integer>(), 1018 Local<Boolean> resource_is_shared_cross_origin = Local<Boolean>(), 1019 Local<Integer> script_id = Local<Integer>(), 1020 Local<Boolean> resource_is_embedder_debug_script = Local<Boolean>(), 1021 Local<Value> source_map_url = Local<Value>(), 1022 Local<Boolean> resource_is_opaque = Local<Boolean>()); 1023 V8_INLINE Local<Value> ResourceName() const; 1024 V8_INLINE Local<Integer> ResourceLineOffset() const; 1025 V8_INLINE Local<Integer> ResourceColumnOffset() const; 1026 /** 1027 * Returns true for embedder's debugger scripts 1028 */ 1029 V8_INLINE Local<Integer> ScriptID() const; 1030 V8_INLINE Local<Value> SourceMapUrl() const; 1031 V8_INLINE ScriptOriginOptions Options() const { return options_; } 1032 1033 private: 1034 Local<Value> resource_name_; 1035 Local<Integer> resource_line_offset_; 1036 Local<Integer> resource_column_offset_; 1037 ScriptOriginOptions options_; 1038 Local<Integer> script_id_; 1039 Local<Value> source_map_url_; 1040}; 1041 1042 1043/** 1044 * A compiled JavaScript script, not yet tied to a Context. 1045 */ 1046class V8_EXPORT UnboundScript { 1047 public: 1048 /** 1049 * Binds the script to the currently entered context. 1050 */ 1051 Local<Script> BindToCurrentContext(); 1052 1053 int GetId(); 1054 Local<Value> GetScriptName(); 1055 1056 /** 1057 * Data read from magic sourceURL comments. 1058 */ 1059 Local<Value> GetSourceURL(); 1060 /** 1061 * Data read from magic sourceMappingURL comments. 1062 */ 1063 Local<Value> GetSourceMappingURL(); 1064 1065 /** 1066 * Returns zero based line number of the code_pos location in the script. 1067 * -1 will be returned if no information available. 1068 */ 1069 int GetLineNumber(int code_pos); 1070 1071 static const int kNoScriptId = 0; 1072}; 1073 1074 1075/** 1076 * A compiled JavaScript script, tied to a Context which was active when the 1077 * script was compiled. 1078 */ 1079class V8_EXPORT Script { 1080 public: 1081 /** 1082 * A shorthand for ScriptCompiler::Compile(). 1083 */ 1084 static V8_DEPRECATE_SOON( 1085 "Use maybe version", 1086 Local<Script> Compile(Local<String> source, 1087 ScriptOrigin* origin = nullptr)); 1088 static V8_WARN_UNUSED_RESULT MaybeLocal<Script> Compile( 1089 Local<Context> context, Local<String> source, 1090 ScriptOrigin* origin = nullptr); 1091 1092 static Local<Script> V8_DEPRECATE_SOON("Use maybe version", 1093 Compile(Local<String> source, 1094 Local<String> file_name)); 1095 1096 /** 1097 * Runs the script returning the resulting value. It will be run in the 1098 * context in which it was created (ScriptCompiler::CompileBound or 1099 * UnboundScript::BindToCurrentContext()). 1100 */ 1101 V8_DEPRECATE_SOON("Use maybe version", Local<Value> Run()); 1102 V8_WARN_UNUSED_RESULT MaybeLocal<Value> Run(Local<Context> context); 1103 1104 /** 1105 * Returns the corresponding context-unbound script. 1106 */ 1107 Local<UnboundScript> GetUnboundScript(); 1108}; 1109 1110 1111/** 1112 * For compiling scripts. 1113 */ 1114class V8_EXPORT ScriptCompiler { 1115 public: 1116 /** 1117 * Compilation data that the embedder can cache and pass back to speed up 1118 * future compilations. The data is produced if the CompilerOptions passed to 1119 * the compilation functions in ScriptCompiler contains produce_data_to_cache 1120 * = true. The data to cache can then can be retrieved from 1121 * UnboundScript. 1122 */ 1123 struct V8_EXPORT CachedData { 1124 enum BufferPolicy { 1125 BufferNotOwned, 1126 BufferOwned 1127 }; 1128 1129 CachedData() 1130 : data(NULL), 1131 length(0), 1132 rejected(false), 1133 buffer_policy(BufferNotOwned) {} 1134 1135 // If buffer_policy is BufferNotOwned, the caller keeps the ownership of 1136 // data and guarantees that it stays alive until the CachedData object is 1137 // destroyed. If the policy is BufferOwned, the given data will be deleted 1138 // (with delete[]) when the CachedData object is destroyed. 1139 CachedData(const uint8_t* data, int length, 1140 BufferPolicy buffer_policy = BufferNotOwned); 1141 ~CachedData(); 1142 // TODO(marja): Async compilation; add constructors which take a callback 1143 // which will be called when V8 no longer needs the data. 1144 const uint8_t* data; 1145 int length; 1146 bool rejected; 1147 BufferPolicy buffer_policy; 1148 1149 private: 1150 // Prevent copying. Not implemented. 1151 CachedData(const CachedData&); 1152 CachedData& operator=(const CachedData&); 1153 }; 1154 1155 /** 1156 * Source code which can be then compiled to a UnboundScript or Script. 1157 */ 1158 class Source { 1159 public: 1160 // Source takes ownership of CachedData. 1161 V8_INLINE Source(Local<String> source_string, const ScriptOrigin& origin, 1162 CachedData* cached_data = NULL); 1163 V8_INLINE Source(Local<String> source_string, 1164 CachedData* cached_data = NULL); 1165 V8_INLINE ~Source(); 1166 1167 // Ownership of the CachedData or its buffers is *not* transferred to the 1168 // caller. The CachedData object is alive as long as the Source object is 1169 // alive. 1170 V8_INLINE const CachedData* GetCachedData() const; 1171 1172 private: 1173 friend class ScriptCompiler; 1174 // Prevent copying. Not implemented. 1175 Source(const Source&); 1176 Source& operator=(const Source&); 1177 1178 Local<String> source_string; 1179 1180 // Origin information 1181 Local<Value> resource_name; 1182 Local<Integer> resource_line_offset; 1183 Local<Integer> resource_column_offset; 1184 ScriptOriginOptions resource_options; 1185 Local<Value> source_map_url; 1186 1187 // Cached data from previous compilation (if a kConsume*Cache flag is 1188 // set), or hold newly generated cache data (kProduce*Cache flags) are 1189 // set when calling a compile method. 1190 CachedData* cached_data; 1191 }; 1192 1193 /** 1194 * For streaming incomplete script data to V8. The embedder should implement a 1195 * subclass of this class. 1196 */ 1197 class V8_EXPORT ExternalSourceStream { 1198 public: 1199 virtual ~ExternalSourceStream() {} 1200 1201 /** 1202 * V8 calls this to request the next chunk of data from the embedder. This 1203 * function will be called on a background thread, so it's OK to block and 1204 * wait for the data, if the embedder doesn't have data yet. Returns the 1205 * length of the data returned. When the data ends, GetMoreData should 1206 * return 0. Caller takes ownership of the data. 1207 * 1208 * When streaming UTF-8 data, V8 handles multi-byte characters split between 1209 * two data chunks, but doesn't handle multi-byte characters split between 1210 * more than two data chunks. The embedder can avoid this problem by always 1211 * returning at least 2 bytes of data. 1212 * 1213 * If the embedder wants to cancel the streaming, they should make the next 1214 * GetMoreData call return 0. V8 will interpret it as end of data (and most 1215 * probably, parsing will fail). The streaming task will return as soon as 1216 * V8 has parsed the data it received so far. 1217 */ 1218 virtual size_t GetMoreData(const uint8_t** src) = 0; 1219 1220 /** 1221 * V8 calls this method to set a 'bookmark' at the current position in 1222 * the source stream, for the purpose of (maybe) later calling 1223 * ResetToBookmark. If ResetToBookmark is called later, then subsequent 1224 * calls to GetMoreData should return the same data as they did when 1225 * SetBookmark was called earlier. 1226 * 1227 * The embedder may return 'false' to indicate it cannot provide this 1228 * functionality. 1229 */ 1230 virtual bool SetBookmark(); 1231 1232 /** 1233 * V8 calls this to return to a previously set bookmark. 1234 */ 1235 virtual void ResetToBookmark(); 1236 }; 1237 1238 1239 /** 1240 * Source code which can be streamed into V8 in pieces. It will be parsed 1241 * while streaming. It can be compiled after the streaming is complete. 1242 * StreamedSource must be kept alive while the streaming task is ran (see 1243 * ScriptStreamingTask below). 1244 */ 1245 class V8_EXPORT StreamedSource { 1246 public: 1247 enum Encoding { ONE_BYTE, TWO_BYTE, UTF8 }; 1248 1249 StreamedSource(ExternalSourceStream* source_stream, Encoding encoding); 1250 ~StreamedSource(); 1251 1252 // Ownership of the CachedData or its buffers is *not* transferred to the 1253 // caller. The CachedData object is alive as long as the StreamedSource 1254 // object is alive. 1255 const CachedData* GetCachedData() const; 1256 1257 internal::StreamedSource* impl() const { return impl_; } 1258 1259 private: 1260 // Prevent copying. Not implemented. 1261 StreamedSource(const StreamedSource&); 1262 StreamedSource& operator=(const StreamedSource&); 1263 1264 internal::StreamedSource* impl_; 1265 }; 1266 1267 /** 1268 * A streaming task which the embedder must run on a background thread to 1269 * stream scripts into V8. Returned by ScriptCompiler::StartStreamingScript. 1270 */ 1271 class ScriptStreamingTask { 1272 public: 1273 virtual ~ScriptStreamingTask() {} 1274 virtual void Run() = 0; 1275 }; 1276 1277 enum CompileOptions { 1278 kNoCompileOptions = 0, 1279 kProduceParserCache, 1280 kConsumeParserCache, 1281 kProduceCodeCache, 1282 kConsumeCodeCache 1283 }; 1284 1285 /** 1286 * Compiles the specified script (context-independent). 1287 * Cached data as part of the source object can be optionally produced to be 1288 * consumed later to speed up compilation of identical source scripts. 1289 * 1290 * Note that when producing cached data, the source must point to NULL for 1291 * cached data. When consuming cached data, the cached data must have been 1292 * produced by the same version of V8. 1293 * 1294 * \param source Script source code. 1295 * \return Compiled script object (context independent; for running it must be 1296 * bound to a context). 1297 */ 1298 static V8_DEPRECATED("Use maybe version", 1299 Local<UnboundScript> CompileUnbound( 1300 Isolate* isolate, Source* source, 1301 CompileOptions options = kNoCompileOptions)); 1302 static V8_WARN_UNUSED_RESULT MaybeLocal<UnboundScript> CompileUnboundScript( 1303 Isolate* isolate, Source* source, 1304 CompileOptions options = kNoCompileOptions); 1305 1306 /** 1307 * Compiles the specified script (bound to current context). 1308 * 1309 * \param source Script source code. 1310 * \param pre_data Pre-parsing data, as obtained by ScriptData::PreCompile() 1311 * using pre_data speeds compilation if it's done multiple times. 1312 * Owned by caller, no references are kept when this function returns. 1313 * \return Compiled script object, bound to the context that was active 1314 * when this function was called. When run it will always use this 1315 * context. 1316 */ 1317 static V8_DEPRECATED( 1318 "Use maybe version", 1319 Local<Script> Compile(Isolate* isolate, Source* source, 1320 CompileOptions options = kNoCompileOptions)); 1321 static V8_WARN_UNUSED_RESULT MaybeLocal<Script> Compile( 1322 Local<Context> context, Source* source, 1323 CompileOptions options = kNoCompileOptions); 1324 1325 /** 1326 * Returns a task which streams script data into V8, or NULL if the script 1327 * cannot be streamed. The user is responsible for running the task on a 1328 * background thread and deleting it. When ran, the task starts parsing the 1329 * script, and it will request data from the StreamedSource as needed. When 1330 * ScriptStreamingTask::Run exits, all data has been streamed and the script 1331 * can be compiled (see Compile below). 1332 * 1333 * This API allows to start the streaming with as little data as possible, and 1334 * the remaining data (for example, the ScriptOrigin) is passed to Compile. 1335 */ 1336 static ScriptStreamingTask* StartStreamingScript( 1337 Isolate* isolate, StreamedSource* source, 1338 CompileOptions options = kNoCompileOptions); 1339 1340 /** 1341 * Compiles a streamed script (bound to current context). 1342 * 1343 * This can only be called after the streaming has finished 1344 * (ScriptStreamingTask has been run). V8 doesn't construct the source string 1345 * during streaming, so the embedder needs to pass the full source here. 1346 */ 1347 static V8_DEPRECATED("Use maybe version", 1348 Local<Script> Compile(Isolate* isolate, 1349 StreamedSource* source, 1350 Local<String> full_source_string, 1351 const ScriptOrigin& origin)); 1352 static V8_WARN_UNUSED_RESULT MaybeLocal<Script> Compile( 1353 Local<Context> context, StreamedSource* source, 1354 Local<String> full_source_string, const ScriptOrigin& origin); 1355 1356 /** 1357 * Return a version tag for CachedData for the current V8 version & flags. 1358 * 1359 * This value is meant only for determining whether a previously generated 1360 * CachedData instance is still valid; the tag has no other meaing. 1361 * 1362 * Background: The data carried by CachedData may depend on the exact 1363 * V8 version number or currently compiler flags. This means when 1364 * persisting CachedData, the embedder must take care to not pass in 1365 * data from another V8 version, or the same version with different 1366 * features enabled. 1367 * 1368 * The easiest way to do so is to clear the embedder's cache on any 1369 * such change. 1370 * 1371 * Alternatively, this tag can be stored alongside the cached data and 1372 * compared when it is being used. 1373 */ 1374 static uint32_t CachedDataVersionTag(); 1375 1376 /** 1377 * Compile an ES6 module. 1378 * 1379 * This is an unfinished experimental feature, and is only exposed 1380 * here for internal testing purposes. 1381 * Only parsing works at the moment. Do not use. 1382 * 1383 * TODO(adamk): Script is likely the wrong return value for this; 1384 * should return some new Module type. 1385 */ 1386 static V8_WARN_UNUSED_RESULT MaybeLocal<Script> CompileModule( 1387 Local<Context> context, Source* source, 1388 CompileOptions options = kNoCompileOptions); 1389 1390 /** 1391 * Compile a function for a given context. This is equivalent to running 1392 * 1393 * with (obj) { 1394 * return function(args) { ... } 1395 * } 1396 * 1397 * It is possible to specify multiple context extensions (obj in the above 1398 * example). 1399 */ 1400 static V8_DEPRECATE_SOON("Use maybe version", 1401 Local<Function> CompileFunctionInContext( 1402 Isolate* isolate, Source* source, 1403 Local<Context> context, size_t arguments_count, 1404 Local<String> arguments[], 1405 size_t context_extension_count, 1406 Local<Object> context_extensions[])); 1407 static V8_WARN_UNUSED_RESULT MaybeLocal<Function> CompileFunctionInContext( 1408 Local<Context> context, Source* source, size_t arguments_count, 1409 Local<String> arguments[], size_t context_extension_count, 1410 Local<Object> context_extensions[]); 1411 1412 private: 1413 static V8_WARN_UNUSED_RESULT MaybeLocal<UnboundScript> CompileUnboundInternal( 1414 Isolate* isolate, Source* source, CompileOptions options, bool is_module); 1415}; 1416 1417 1418/** 1419 * An error message. 1420 */ 1421class V8_EXPORT Message { 1422 public: 1423 Local<String> Get() const; 1424 1425 V8_DEPRECATE_SOON("Use maybe version", Local<String> GetSourceLine() const); 1426 V8_WARN_UNUSED_RESULT MaybeLocal<String> GetSourceLine( 1427 Local<Context> context) const; 1428 1429 /** 1430 * Returns the origin for the script from where the function causing the 1431 * error originates. 1432 */ 1433 ScriptOrigin GetScriptOrigin() const; 1434 1435 /** 1436 * Returns the resource name for the script from where the function causing 1437 * the error originates. 1438 */ 1439 Local<Value> GetScriptResourceName() const; 1440 1441 /** 1442 * Exception stack trace. By default stack traces are not captured for 1443 * uncaught exceptions. SetCaptureStackTraceForUncaughtExceptions allows 1444 * to change this option. 1445 */ 1446 Local<StackTrace> GetStackTrace() const; 1447 1448 /** 1449 * Returns the number, 1-based, of the line where the error occurred. 1450 */ 1451 V8_DEPRECATE_SOON("Use maybe version", int GetLineNumber() const); 1452 V8_WARN_UNUSED_RESULT Maybe<int> GetLineNumber(Local<Context> context) const; 1453 1454 /** 1455 * Returns the index within the script of the first character where 1456 * the error occurred. 1457 */ 1458 int GetStartPosition() const; 1459 1460 /** 1461 * Returns the index within the script of the last character where 1462 * the error occurred. 1463 */ 1464 int GetEndPosition() const; 1465 1466 /** 1467 * Returns the index within the line of the first character where 1468 * the error occurred. 1469 */ 1470 V8_DEPRECATE_SOON("Use maybe version", int GetStartColumn() const); 1471 V8_WARN_UNUSED_RESULT Maybe<int> GetStartColumn(Local<Context> context) const; 1472 1473 /** 1474 * Returns the index within the line of the last character where 1475 * the error occurred. 1476 */ 1477 V8_DEPRECATED("Use maybe version", int GetEndColumn() const); 1478 V8_WARN_UNUSED_RESULT Maybe<int> GetEndColumn(Local<Context> context) const; 1479 1480 /** 1481 * Passes on the value set by the embedder when it fed the script from which 1482 * this Message was generated to V8. 1483 */ 1484 bool IsSharedCrossOrigin() const; 1485 bool IsOpaque() const; 1486 1487 // TODO(1245381): Print to a string instead of on a FILE. 1488 static void PrintCurrentStackTrace(Isolate* isolate, FILE* out); 1489 1490 static const int kNoLineNumberInfo = 0; 1491 static const int kNoColumnInfo = 0; 1492 static const int kNoScriptIdInfo = 0; 1493}; 1494 1495 1496/** 1497 * Representation of a JavaScript stack trace. The information collected is a 1498 * snapshot of the execution stack and the information remains valid after 1499 * execution continues. 1500 */ 1501class V8_EXPORT StackTrace { 1502 public: 1503 /** 1504 * Flags that determine what information is placed captured for each 1505 * StackFrame when grabbing the current stack trace. 1506 */ 1507 enum StackTraceOptions { 1508 kLineNumber = 1, 1509 kColumnOffset = 1 << 1 | kLineNumber, 1510 kScriptName = 1 << 2, 1511 kFunctionName = 1 << 3, 1512 kIsEval = 1 << 4, 1513 kIsConstructor = 1 << 5, 1514 kScriptNameOrSourceURL = 1 << 6, 1515 kScriptId = 1 << 7, 1516 kExposeFramesAcrossSecurityOrigins = 1 << 8, 1517 kOverview = kLineNumber | kColumnOffset | kScriptName | kFunctionName, 1518 kDetailed = kOverview | kIsEval | kIsConstructor | kScriptNameOrSourceURL 1519 }; 1520 1521 /** 1522 * Returns a StackFrame at a particular index. 1523 */ 1524 Local<StackFrame> GetFrame(uint32_t index) const; 1525 1526 /** 1527 * Returns the number of StackFrames. 1528 */ 1529 int GetFrameCount() const; 1530 1531 /** 1532 * Returns StackTrace as a v8::Array that contains StackFrame objects. 1533 */ 1534 Local<Array> AsArray(); 1535 1536 /** 1537 * Grab a snapshot of the current JavaScript execution stack. 1538 * 1539 * \param frame_limit The maximum number of stack frames we want to capture. 1540 * \param options Enumerates the set of things we will capture for each 1541 * StackFrame. 1542 */ 1543 static Local<StackTrace> CurrentStackTrace( 1544 Isolate* isolate, 1545 int frame_limit, 1546 StackTraceOptions options = kOverview); 1547}; 1548 1549 1550/** 1551 * A single JavaScript stack frame. 1552 */ 1553class V8_EXPORT StackFrame { 1554 public: 1555 /** 1556 * Returns the number, 1-based, of the line for the associate function call. 1557 * This method will return Message::kNoLineNumberInfo if it is unable to 1558 * retrieve the line number, or if kLineNumber was not passed as an option 1559 * when capturing the StackTrace. 1560 */ 1561 int GetLineNumber() const; 1562 1563 /** 1564 * Returns the 1-based column offset on the line for the associated function 1565 * call. 1566 * This method will return Message::kNoColumnInfo if it is unable to retrieve 1567 * the column number, or if kColumnOffset was not passed as an option when 1568 * capturing the StackTrace. 1569 */ 1570 int GetColumn() const; 1571 1572 /** 1573 * Returns the id of the script for the function for this StackFrame. 1574 * This method will return Message::kNoScriptIdInfo if it is unable to 1575 * retrieve the script id, or if kScriptId was not passed as an option when 1576 * capturing the StackTrace. 1577 */ 1578 int GetScriptId() const; 1579 1580 /** 1581 * Returns the name of the resource that contains the script for the 1582 * function for this StackFrame. 1583 */ 1584 Local<String> GetScriptName() const; 1585 1586 /** 1587 * Returns the name of the resource that contains the script for the 1588 * function for this StackFrame or sourceURL value if the script name 1589 * is undefined and its source ends with //# sourceURL=... string or 1590 * deprecated //@ sourceURL=... string. 1591 */ 1592 Local<String> GetScriptNameOrSourceURL() const; 1593 1594 /** 1595 * Returns the name of the function associated with this stack frame. 1596 */ 1597 Local<String> GetFunctionName() const; 1598 1599 /** 1600 * Returns whether or not the associated function is compiled via a call to 1601 * eval(). 1602 */ 1603 bool IsEval() const; 1604 1605 /** 1606 * Returns whether or not the associated function is called as a 1607 * constructor via "new". 1608 */ 1609 bool IsConstructor() const; 1610}; 1611 1612 1613// A StateTag represents a possible state of the VM. 1614enum StateTag { JS, GC, COMPILER, OTHER, EXTERNAL, IDLE }; 1615 1616// A RegisterState represents the current state of registers used 1617// by the sampling profiler API. 1618struct RegisterState { 1619 RegisterState() : pc(nullptr), sp(nullptr), fp(nullptr) {} 1620 void* pc; // Instruction pointer. 1621 void* sp; // Stack pointer. 1622 void* fp; // Frame pointer. 1623}; 1624 1625// The output structure filled up by GetStackSample API function. 1626struct SampleInfo { 1627 size_t frames_count; // Number of frames collected. 1628 StateTag vm_state; // Current VM state. 1629 void* external_callback_entry; // External callback address if VM is 1630 // executing an external callback. 1631}; 1632 1633/** 1634 * A JSON Parser and Stringifier. 1635 */ 1636class V8_EXPORT JSON { 1637 public: 1638 /** 1639 * Tries to parse the string |json_string| and returns it as value if 1640 * successful. 1641 * 1642 * \param json_string The string to parse. 1643 * \return The corresponding value if successfully parsed. 1644 */ 1645 static V8_DEPRECATED("Use the maybe version taking context", 1646 Local<Value> Parse(Local<String> json_string)); 1647 static V8_DEPRECATE_SOON("Use the maybe version taking context", 1648 MaybeLocal<Value> Parse(Isolate* isolate, 1649 Local<String> json_string)); 1650 static V8_WARN_UNUSED_RESULT MaybeLocal<Value> Parse( 1651 Local<Context> context, Local<String> json_string); 1652 1653 /** 1654 * Tries to stringify the JSON-serializable object |json_object| and returns 1655 * it as string if successful. 1656 * 1657 * \param json_object The JSON-serializable object to stringify. 1658 * \return The corresponding string if successfully stringified. 1659 */ 1660 static V8_WARN_UNUSED_RESULT MaybeLocal<String> Stringify( 1661 Local<Context> context, Local<Object> json_object, 1662 Local<String> gap = Local<String>()); 1663}; 1664 1665 1666/** 1667 * A map whose keys are referenced weakly. It is similar to JavaScript WeakMap 1668 * but can be created without entering a v8::Context and hence shouldn't 1669 * escape to JavaScript. 1670 */ 1671class V8_EXPORT NativeWeakMap : public Data { 1672 public: 1673 static Local<NativeWeakMap> New(Isolate* isolate); 1674 void Set(Local<Value> key, Local<Value> value); 1675 Local<Value> Get(Local<Value> key); 1676 bool Has(Local<Value> key); 1677 bool Delete(Local<Value> key); 1678}; 1679 1680 1681// --- Value --- 1682 1683 1684/** 1685 * The superclass of all JavaScript values and objects. 1686 */ 1687class V8_EXPORT Value : public Data { 1688 public: 1689 /** 1690 * Returns true if this value is the undefined value. See ECMA-262 1691 * 4.3.10. 1692 */ 1693 V8_INLINE bool IsUndefined() const; 1694 1695 /** 1696 * Returns true if this value is the null value. See ECMA-262 1697 * 4.3.11. 1698 */ 1699 V8_INLINE bool IsNull() const; 1700 1701 /** 1702 * Returns true if this value is true. 1703 */ 1704 bool IsTrue() const; 1705 1706 /** 1707 * Returns true if this value is false. 1708 */ 1709 bool IsFalse() const; 1710 1711 /** 1712 * Returns true if this value is a symbol or a string. 1713 * This is an experimental feature. 1714 */ 1715 bool IsName() const; 1716 1717 /** 1718 * Returns true if this value is an instance of the String type. 1719 * See ECMA-262 8.4. 1720 */ 1721 V8_INLINE bool IsString() const; 1722 1723 /** 1724 * Returns true if this value is a symbol. 1725 * This is an experimental feature. 1726 */ 1727 bool IsSymbol() const; 1728 1729 /** 1730 * Returns true if this value is a function. 1731 */ 1732 bool IsFunction() const; 1733 1734 /** 1735 * Returns true if this value is an array. Note that it will return false for 1736 * an Proxy for an array. 1737 */ 1738 bool IsArray() const; 1739 1740 /** 1741 * Returns true if this value is an object. 1742 */ 1743 bool IsObject() const; 1744 1745 /** 1746 * Returns true if this value is boolean. 1747 */ 1748 bool IsBoolean() const; 1749 1750 /** 1751 * Returns true if this value is a number. 1752 */ 1753 bool IsNumber() const; 1754 1755 /** 1756 * Returns true if this value is external. 1757 */ 1758 bool IsExternal() const; 1759 1760 /** 1761 * Returns true if this value is a 32-bit signed integer. 1762 */ 1763 bool IsInt32() const; 1764 1765 /** 1766 * Returns true if this value is a 32-bit unsigned integer. 1767 */ 1768 bool IsUint32() const; 1769 1770 /** 1771 * Returns true if this value is a Date. 1772 */ 1773 bool IsDate() const; 1774 1775 /** 1776 * Returns true if this value is an Arguments object. 1777 */ 1778 bool IsArgumentsObject() const; 1779 1780 /** 1781 * Returns true if this value is a Boolean object. 1782 */ 1783 bool IsBooleanObject() const; 1784 1785 /** 1786 * Returns true if this value is a Number object. 1787 */ 1788 bool IsNumberObject() const; 1789 1790 /** 1791 * Returns true if this value is a String object. 1792 */ 1793 bool IsStringObject() const; 1794 1795 /** 1796 * Returns true if this value is a Symbol object. 1797 * This is an experimental feature. 1798 */ 1799 bool IsSymbolObject() const; 1800 1801 /** 1802 * Returns true if this value is a NativeError. 1803 */ 1804 bool IsNativeError() const; 1805 1806 /** 1807 * Returns true if this value is a RegExp. 1808 */ 1809 bool IsRegExp() const; 1810 1811 /** 1812 * Returns true if this value is a Generator function. 1813 * This is an experimental feature. 1814 */ 1815 bool IsGeneratorFunction() const; 1816 1817 /** 1818 * Returns true if this value is a Generator object (iterator). 1819 * This is an experimental feature. 1820 */ 1821 bool IsGeneratorObject() const; 1822 1823 /** 1824 * Returns true if this value is a Promise. 1825 * This is an experimental feature. 1826 */ 1827 bool IsPromise() const; 1828 1829 /** 1830 * Returns true if this value is a Map. 1831 */ 1832 bool IsMap() const; 1833 1834 /** 1835 * Returns true if this value is a Set. 1836 */ 1837 bool IsSet() const; 1838 1839 /** 1840 * Returns true if this value is a Map Iterator. 1841 */ 1842 bool IsMapIterator() const; 1843 1844 /** 1845 * Returns true if this value is a Set Iterator. 1846 */ 1847 bool IsSetIterator() const; 1848 1849 /** 1850 * Returns true if this value is a WeakMap. 1851 */ 1852 bool IsWeakMap() const; 1853 1854 /** 1855 * Returns true if this value is a WeakSet. 1856 */ 1857 bool IsWeakSet() const; 1858 1859 /** 1860 * Returns true if this value is an ArrayBuffer. 1861 * This is an experimental feature. 1862 */ 1863 bool IsArrayBuffer() const; 1864 1865 /** 1866 * Returns true if this value is an ArrayBufferView. 1867 * This is an experimental feature. 1868 */ 1869 bool IsArrayBufferView() const; 1870 1871 /** 1872 * Returns true if this value is one of TypedArrays. 1873 * This is an experimental feature. 1874 */ 1875 bool IsTypedArray() const; 1876 1877 /** 1878 * Returns true if this value is an Uint8Array. 1879 * This is an experimental feature. 1880 */ 1881 bool IsUint8Array() const; 1882 1883 /** 1884 * Returns true if this value is an Uint8ClampedArray. 1885 * This is an experimental feature. 1886 */ 1887 bool IsUint8ClampedArray() const; 1888 1889 /** 1890 * Returns true if this value is an Int8Array. 1891 * This is an experimental feature. 1892 */ 1893 bool IsInt8Array() const; 1894 1895 /** 1896 * Returns true if this value is an Uint16Array. 1897 * This is an experimental feature. 1898 */ 1899 bool IsUint16Array() const; 1900 1901 /** 1902 * Returns true if this value is an Int16Array. 1903 * This is an experimental feature. 1904 */ 1905 bool IsInt16Array() const; 1906 1907 /** 1908 * Returns true if this value is an Uint32Array. 1909 * This is an experimental feature. 1910 */ 1911 bool IsUint32Array() const; 1912 1913 /** 1914 * Returns true if this value is an Int32Array. 1915 * This is an experimental feature. 1916 */ 1917 bool IsInt32Array() const; 1918 1919 /** 1920 * Returns true if this value is a Float32Array. 1921 * This is an experimental feature. 1922 */ 1923 bool IsFloat32Array() const; 1924 1925 /** 1926 * Returns true if this value is a Float64Array. 1927 * This is an experimental feature. 1928 */ 1929 bool IsFloat64Array() const; 1930 1931 /** 1932 * Returns true if this value is a SIMD Float32x4. 1933 * This is an experimental feature. 1934 */ 1935 bool IsFloat32x4() const; 1936 1937 /** 1938 * Returns true if this value is a DataView. 1939 * This is an experimental feature. 1940 */ 1941 bool IsDataView() const; 1942 1943 /** 1944 * Returns true if this value is a SharedArrayBuffer. 1945 * This is an experimental feature. 1946 */ 1947 bool IsSharedArrayBuffer() const; 1948 1949 /** 1950 * Returns true if this value is a JavaScript Proxy. 1951 */ 1952 bool IsProxy() const; 1953 1954 1955 V8_WARN_UNUSED_RESULT MaybeLocal<Boolean> ToBoolean( 1956 Local<Context> context) const; 1957 V8_WARN_UNUSED_RESULT MaybeLocal<Number> ToNumber( 1958 Local<Context> context) const; 1959 V8_WARN_UNUSED_RESULT MaybeLocal<String> ToString( 1960 Local<Context> context) const; 1961 V8_WARN_UNUSED_RESULT MaybeLocal<String> ToDetailString( 1962 Local<Context> context) const; 1963 V8_WARN_UNUSED_RESULT MaybeLocal<Object> ToObject( 1964 Local<Context> context) const; 1965 V8_WARN_UNUSED_RESULT MaybeLocal<Integer> ToInteger( 1966 Local<Context> context) const; 1967 V8_WARN_UNUSED_RESULT MaybeLocal<Uint32> ToUint32( 1968 Local<Context> context) const; 1969 V8_WARN_UNUSED_RESULT MaybeLocal<Int32> ToInt32(Local<Context> context) const; 1970 1971 V8_DEPRECATE_SOON("Use maybe version", 1972 Local<Boolean> ToBoolean(Isolate* isolate) const); 1973 V8_DEPRECATE_SOON("Use maybe version", 1974 Local<Number> ToNumber(Isolate* isolate) const); 1975 V8_DEPRECATE_SOON("Use maybe version", 1976 Local<String> ToString(Isolate* isolate) const); 1977 V8_DEPRECATED("Use maybe version", 1978 Local<String> ToDetailString(Isolate* isolate) const); 1979 V8_DEPRECATE_SOON("Use maybe version", 1980 Local<Object> ToObject(Isolate* isolate) const); 1981 V8_DEPRECATE_SOON("Use maybe version", 1982 Local<Integer> ToInteger(Isolate* isolate) const); 1983 V8_DEPRECATED("Use maybe version", 1984 Local<Uint32> ToUint32(Isolate* isolate) const); 1985 V8_DEPRECATE_SOON("Use maybe version", 1986 Local<Int32> ToInt32(Isolate* isolate) const); 1987 1988 inline V8_DEPRECATE_SOON("Use maybe version", 1989 Local<Boolean> ToBoolean() const); 1990 inline V8_DEPRECATED("Use maybe version", Local<Number> ToNumber() const); 1991 inline V8_DEPRECATE_SOON("Use maybe version", Local<String> ToString() const); 1992 inline V8_DEPRECATED("Use maybe version", 1993 Local<String> ToDetailString() const); 1994 inline V8_DEPRECATE_SOON("Use maybe version", Local<Object> ToObject() const); 1995 inline V8_DEPRECATE_SOON("Use maybe version", 1996 Local<Integer> ToInteger() const); 1997 inline V8_DEPRECATED("Use maybe version", Local<Uint32> ToUint32() const); 1998 inline V8_DEPRECATED("Use maybe version", Local<Int32> ToInt32() const); 1999 2000 /** 2001 * Attempts to convert a string to an array index. 2002 * Returns an empty handle if the conversion fails. 2003 */ 2004 V8_DEPRECATED("Use maybe version", Local<Uint32> ToArrayIndex() const); 2005 V8_WARN_UNUSED_RESULT MaybeLocal<Uint32> ToArrayIndex( 2006 Local<Context> context) const; 2007 2008 V8_WARN_UNUSED_RESULT Maybe<bool> BooleanValue(Local<Context> context) const; 2009 V8_WARN_UNUSED_RESULT Maybe<double> NumberValue(Local<Context> context) const; 2010 V8_WARN_UNUSED_RESULT Maybe<int64_t> IntegerValue( 2011 Local<Context> context) const; 2012 V8_WARN_UNUSED_RESULT Maybe<uint32_t> Uint32Value( 2013 Local<Context> context) const; 2014 V8_WARN_UNUSED_RESULT Maybe<int32_t> Int32Value(Local<Context> context) const; 2015 2016 V8_DEPRECATE_SOON("Use maybe version", bool BooleanValue() const); 2017 V8_DEPRECATE_SOON("Use maybe version", double NumberValue() const); 2018 V8_DEPRECATE_SOON("Use maybe version", int64_t IntegerValue() const); 2019 V8_DEPRECATE_SOON("Use maybe version", uint32_t Uint32Value() const); 2020 V8_DEPRECATE_SOON("Use maybe version", int32_t Int32Value() const); 2021 2022 /** JS == */ 2023 V8_DEPRECATE_SOON("Use maybe version", bool Equals(Local<Value> that) const); 2024 V8_WARN_UNUSED_RESULT Maybe<bool> Equals(Local<Context> context, 2025 Local<Value> that) const; 2026 bool StrictEquals(Local<Value> that) const; 2027 bool SameValue(Local<Value> that) const; 2028 2029 template <class T> V8_INLINE static Value* Cast(T* value); 2030 2031 Local<String> TypeOf(v8::Isolate*); 2032 2033 private: 2034 V8_INLINE bool QuickIsUndefined() const; 2035 V8_INLINE bool QuickIsNull() const; 2036 V8_INLINE bool QuickIsString() const; 2037 bool FullIsUndefined() const; 2038 bool FullIsNull() const; 2039 bool FullIsString() const; 2040}; 2041 2042 2043/** 2044 * The superclass of primitive values. See ECMA-262 4.3.2. 2045 */ 2046class V8_EXPORT Primitive : public Value { }; 2047 2048 2049/** 2050 * A primitive boolean value (ECMA-262, 4.3.14). Either the true 2051 * or false value. 2052 */ 2053class V8_EXPORT Boolean : public Primitive { 2054 public: 2055 bool Value() const; 2056 V8_INLINE static Boolean* Cast(v8::Value* obj); 2057 V8_INLINE static Local<Boolean> New(Isolate* isolate, bool value); 2058 2059 private: 2060 static void CheckCast(v8::Value* obj); 2061}; 2062 2063 2064/** 2065 * A superclass for symbols and strings. 2066 */ 2067class V8_EXPORT Name : public Primitive { 2068 public: 2069 /** 2070 * Returns the identity hash for this object. The current implementation 2071 * uses an inline property on the object to store the identity hash. 2072 * 2073 * The return value will never be 0. Also, it is not guaranteed to be 2074 * unique. 2075 */ 2076 int GetIdentityHash(); 2077 2078 V8_INLINE static Name* Cast(v8::Value* obj); 2079 private: 2080 static void CheckCast(v8::Value* obj); 2081}; 2082 2083 2084enum class NewStringType { kNormal, kInternalized }; 2085 2086 2087/** 2088 * A JavaScript string value (ECMA-262, 4.3.17). 2089 */ 2090class V8_EXPORT String : public Name { 2091 public: 2092 static const int kMaxLength = (1 << 28) - 16; 2093 2094 enum Encoding { 2095 UNKNOWN_ENCODING = 0x1, 2096 TWO_BYTE_ENCODING = 0x0, 2097 ONE_BYTE_ENCODING = 0x4 2098 }; 2099 /** 2100 * Returns the number of characters in this string. 2101 */ 2102 int Length() const; 2103 2104 /** 2105 * Returns the number of bytes in the UTF-8 encoded 2106 * representation of this string. 2107 */ 2108 int Utf8Length() const; 2109 2110 /** 2111 * Returns whether this string is known to contain only one byte data. 2112 * Does not read the string. 2113 * False negatives are possible. 2114 */ 2115 bool IsOneByte() const; 2116 2117 /** 2118 * Returns whether this string contain only one byte data. 2119 * Will read the entire string in some cases. 2120 */ 2121 bool ContainsOnlyOneByte() const; 2122 2123 /** 2124 * Write the contents of the string to an external buffer. 2125 * If no arguments are given, expects the buffer to be large 2126 * enough to hold the entire string and NULL terminator. Copies 2127 * the contents of the string and the NULL terminator into the 2128 * buffer. 2129 * 2130 * WriteUtf8 will not write partial UTF-8 sequences, preferring to stop 2131 * before the end of the buffer. 2132 * 2133 * Copies up to length characters into the output buffer. 2134 * Only null-terminates if there is enough space in the buffer. 2135 * 2136 * \param buffer The buffer into which the string will be copied. 2137 * \param start The starting position within the string at which 2138 * copying begins. 2139 * \param length The number of characters to copy from the string. For 2140 * WriteUtf8 the number of bytes in the buffer. 2141 * \param nchars_ref The number of characters written, can be NULL. 2142 * \param options Various options that might affect performance of this or 2143 * subsequent operations. 2144 * \return The number of characters copied to the buffer excluding the null 2145 * terminator. For WriteUtf8: The number of bytes copied to the buffer 2146 * including the null terminator (if written). 2147 */ 2148 enum WriteOptions { 2149 NO_OPTIONS = 0, 2150 HINT_MANY_WRITES_EXPECTED = 1, 2151 NO_NULL_TERMINATION = 2, 2152 PRESERVE_ONE_BYTE_NULL = 4, 2153 // Used by WriteUtf8 to replace orphan surrogate code units with the 2154 // unicode replacement character. Needs to be set to guarantee valid UTF-8 2155 // output. 2156 REPLACE_INVALID_UTF8 = 8 2157 }; 2158 2159 // 16-bit character codes. 2160 int Write(uint16_t* buffer, 2161 int start = 0, 2162 int length = -1, 2163 int options = NO_OPTIONS) const; 2164 // One byte characters. 2165 int WriteOneByte(uint8_t* buffer, 2166 int start = 0, 2167 int length = -1, 2168 int options = NO_OPTIONS) const; 2169 // UTF-8 encoded characters. 2170 int WriteUtf8(char* buffer, 2171 int length = -1, 2172 int* nchars_ref = NULL, 2173 int options = NO_OPTIONS) const; 2174 2175 /** 2176 * A zero length string. 2177 */ 2178 V8_INLINE static v8::Local<v8::String> Empty(Isolate* isolate); 2179 2180 /** 2181 * Returns true if the string is external 2182 */ 2183 bool IsExternal() const; 2184 2185 /** 2186 * Returns true if the string is both external and one-byte. 2187 */ 2188 bool IsExternalOneByte() const; 2189 2190 class V8_EXPORT ExternalStringResourceBase { // NOLINT 2191 public: 2192 virtual ~ExternalStringResourceBase() {} 2193 2194 virtual bool IsCompressible() const { return false; } 2195 2196 protected: 2197 ExternalStringResourceBase() {} 2198 2199 /** 2200 * Internally V8 will call this Dispose method when the external string 2201 * resource is no longer needed. The default implementation will use the 2202 * delete operator. This method can be overridden in subclasses to 2203 * control how allocated external string resources are disposed. 2204 */ 2205 virtual void Dispose() { delete this; } 2206 2207 private: 2208 // Disallow copying and assigning. 2209 ExternalStringResourceBase(const ExternalStringResourceBase&); 2210 void operator=(const ExternalStringResourceBase&); 2211 2212 friend class v8::internal::Heap; 2213 }; 2214 2215 /** 2216 * An ExternalStringResource is a wrapper around a two-byte string 2217 * buffer that resides outside V8's heap. Implement an 2218 * ExternalStringResource to manage the life cycle of the underlying 2219 * buffer. Note that the string data must be immutable. 2220 */ 2221 class V8_EXPORT ExternalStringResource 2222 : public ExternalStringResourceBase { 2223 public: 2224 /** 2225 * Override the destructor to manage the life cycle of the underlying 2226 * buffer. 2227 */ 2228 virtual ~ExternalStringResource() {} 2229 2230 /** 2231 * The string data from the underlying buffer. 2232 */ 2233 virtual const uint16_t* data() const = 0; 2234 2235 /** 2236 * The length of the string. That is, the number of two-byte characters. 2237 */ 2238 virtual size_t length() const = 0; 2239 2240 protected: 2241 ExternalStringResource() {} 2242 }; 2243 2244 /** 2245 * An ExternalOneByteStringResource is a wrapper around an one-byte 2246 * string buffer that resides outside V8's heap. Implement an 2247 * ExternalOneByteStringResource to manage the life cycle of the 2248 * underlying buffer. Note that the string data must be immutable 2249 * and that the data must be Latin-1 and not UTF-8, which would require 2250 * special treatment internally in the engine and do not allow efficient 2251 * indexing. Use String::New or convert to 16 bit data for non-Latin1. 2252 */ 2253 2254 class V8_EXPORT ExternalOneByteStringResource 2255 : public ExternalStringResourceBase { 2256 public: 2257 /** 2258 * Override the destructor to manage the life cycle of the underlying 2259 * buffer. 2260 */ 2261 virtual ~ExternalOneByteStringResource() {} 2262 /** The string data from the underlying buffer.*/ 2263 virtual const char* data() const = 0; 2264 /** The number of Latin-1 characters in the string.*/ 2265 virtual size_t length() const = 0; 2266 protected: 2267 ExternalOneByteStringResource() {} 2268 }; 2269 2270 /** 2271 * If the string is an external string, return the ExternalStringResourceBase 2272 * regardless of the encoding, otherwise return NULL. The encoding of the 2273 * string is returned in encoding_out. 2274 */ 2275 V8_INLINE ExternalStringResourceBase* GetExternalStringResourceBase( 2276 Encoding* encoding_out) const; 2277 2278 /** 2279 * Get the ExternalStringResource for an external string. Returns 2280 * NULL if IsExternal() doesn't return true. 2281 */ 2282 V8_INLINE ExternalStringResource* GetExternalStringResource() const; 2283 2284 /** 2285 * Get the ExternalOneByteStringResource for an external one-byte string. 2286 * Returns NULL if IsExternalOneByte() doesn't return true. 2287 */ 2288 const ExternalOneByteStringResource* GetExternalOneByteStringResource() const; 2289 2290 V8_INLINE static String* Cast(v8::Value* obj); 2291 2292 // TODO(dcarney): remove with deprecation of New functions. 2293 enum NewStringType { 2294 kNormalString = static_cast<int>(v8::NewStringType::kNormal), 2295 kInternalizedString = static_cast<int>(v8::NewStringType::kInternalized) 2296 }; 2297 2298 /** Allocates a new string from UTF-8 data.*/ 2299 static V8_DEPRECATE_SOON( 2300 "Use maybe version", 2301 Local<String> NewFromUtf8(Isolate* isolate, const char* data, 2302 NewStringType type = kNormalString, 2303 int length = -1)); 2304 2305 /** Allocates a new string from UTF-8 data. Only returns an empty value when 2306 * length > kMaxLength. **/ 2307 static V8_WARN_UNUSED_RESULT MaybeLocal<String> NewFromUtf8( 2308 Isolate* isolate, const char* data, v8::NewStringType type, 2309 int length = -1); 2310 2311 /** Allocates a new string from Latin-1 data.*/ 2312 static V8_DEPRECATED( 2313 "Use maybe version", 2314 Local<String> NewFromOneByte(Isolate* isolate, const uint8_t* data, 2315 NewStringType type = kNormalString, 2316 int length = -1)); 2317 2318 /** Allocates a new string from Latin-1 data. Only returns an empty value 2319 * when length > kMaxLength. **/ 2320 static V8_WARN_UNUSED_RESULT MaybeLocal<String> NewFromOneByte( 2321 Isolate* isolate, const uint8_t* data, v8::NewStringType type, 2322 int length = -1); 2323 2324 /** Allocates a new string from UTF-16 data.*/ 2325 static V8_DEPRECATE_SOON( 2326 "Use maybe version", 2327 Local<String> NewFromTwoByte(Isolate* isolate, const uint16_t* data, 2328 NewStringType type = kNormalString, 2329 int length = -1)); 2330 2331 /** Allocates a new string from UTF-16 data. Only returns an empty value when 2332 * length > kMaxLength. **/ 2333 static V8_WARN_UNUSED_RESULT MaybeLocal<String> NewFromTwoByte( 2334 Isolate* isolate, const uint16_t* data, v8::NewStringType type, 2335 int length = -1); 2336 2337 /** 2338 * Creates a new string by concatenating the left and the right strings 2339 * passed in as parameters. 2340 */ 2341 static Local<String> Concat(Local<String> left, Local<String> right); 2342 2343 /** 2344 * Creates a new external string using the data defined in the given 2345 * resource. When the external string is no longer live on V8's heap the 2346 * resource will be disposed by calling its Dispose method. The caller of 2347 * this function should not otherwise delete or modify the resource. Neither 2348 * should the underlying buffer be deallocated or modified except through the 2349 * destructor of the external string resource. 2350 */ 2351 static V8_DEPRECATED("Use maybe version", 2352 Local<String> NewExternal( 2353 Isolate* isolate, ExternalStringResource* resource)); 2354 static V8_WARN_UNUSED_RESULT MaybeLocal<String> NewExternalTwoByte( 2355 Isolate* isolate, ExternalStringResource* resource); 2356 2357 /** 2358 * Associate an external string resource with this string by transforming it 2359 * in place so that existing references to this string in the JavaScript heap 2360 * will use the external string resource. The external string resource's 2361 * character contents need to be equivalent to this string. 2362 * Returns true if the string has been changed to be an external string. 2363 * The string is not modified if the operation fails. See NewExternal for 2364 * information on the lifetime of the resource. 2365 */ 2366 bool MakeExternal(ExternalStringResource* resource); 2367 2368 /** 2369 * Creates a new external string using the one-byte data defined in the given 2370 * resource. When the external string is no longer live on V8's heap the 2371 * resource will be disposed by calling its Dispose method. The caller of 2372 * this function should not otherwise delete or modify the resource. Neither 2373 * should the underlying buffer be deallocated or modified except through the 2374 * destructor of the external string resource. 2375 */ 2376 static V8_DEPRECATE_SOON( 2377 "Use maybe version", 2378 Local<String> NewExternal(Isolate* isolate, 2379 ExternalOneByteStringResource* resource)); 2380 static V8_WARN_UNUSED_RESULT MaybeLocal<String> NewExternalOneByte( 2381 Isolate* isolate, ExternalOneByteStringResource* resource); 2382 2383 /** 2384 * Associate an external string resource with this string by transforming it 2385 * in place so that existing references to this string in the JavaScript heap 2386 * will use the external string resource. The external string resource's 2387 * character contents need to be equivalent to this string. 2388 * Returns true if the string has been changed to be an external string. 2389 * The string is not modified if the operation fails. See NewExternal for 2390 * information on the lifetime of the resource. 2391 */ 2392 bool MakeExternal(ExternalOneByteStringResource* resource); 2393 2394 /** 2395 * Returns true if this string can be made external. 2396 */ 2397 bool CanMakeExternal(); 2398 2399 /** 2400 * Converts an object to a UTF-8-encoded character array. Useful if 2401 * you want to print the object. If conversion to a string fails 2402 * (e.g. due to an exception in the toString() method of the object) 2403 * then the length() method returns 0 and the * operator returns 2404 * NULL. 2405 */ 2406 class V8_EXPORT Utf8Value { 2407 public: 2408 explicit Utf8Value(Local<v8::Value> obj); 2409 ~Utf8Value(); 2410 char* operator*() { return str_; } 2411 const char* operator*() const { return str_; } 2412 int length() const { return length_; } 2413 private: 2414 char* str_; 2415 int length_; 2416 2417 // Disallow copying and assigning. 2418 Utf8Value(const Utf8Value&); 2419 void operator=(const Utf8Value&); 2420 }; 2421 2422 /** 2423 * Converts an object to a two-byte string. 2424 * If conversion to a string fails (eg. due to an exception in the toString() 2425 * method of the object) then the length() method returns 0 and the * operator 2426 * returns NULL. 2427 */ 2428 class V8_EXPORT Value { 2429 public: 2430 explicit Value(Local<v8::Value> obj); 2431 ~Value(); 2432 uint16_t* operator*() { return str_; } 2433 const uint16_t* operator*() const { return str_; } 2434 int length() const { return length_; } 2435 private: 2436 uint16_t* str_; 2437 int length_; 2438 2439 // Disallow copying and assigning. 2440 Value(const Value&); 2441 void operator=(const Value&); 2442 }; 2443 2444 private: 2445 void VerifyExternalStringResourceBase(ExternalStringResourceBase* v, 2446 Encoding encoding) const; 2447 void VerifyExternalStringResource(ExternalStringResource* val) const; 2448 static void CheckCast(v8::Value* obj); 2449}; 2450 2451 2452/** 2453 * A JavaScript symbol (ECMA-262 edition 6) 2454 * 2455 * This is an experimental feature. Use at your own risk. 2456 */ 2457class V8_EXPORT Symbol : public Name { 2458 public: 2459 // Returns the print name string of the symbol, or undefined if none. 2460 Local<Value> Name() const; 2461 2462 // Create a symbol. If name is not empty, it will be used as the description. 2463 static Local<Symbol> New(Isolate* isolate, 2464 Local<String> name = Local<String>()); 2465 2466 // Access global symbol registry. 2467 // Note that symbols created this way are never collected, so 2468 // they should only be used for statically fixed properties. 2469 // Also, there is only one global name space for the names used as keys. 2470 // To minimize the potential for clashes, use qualified names as keys. 2471 static Local<Symbol> For(Isolate *isolate, Local<String> name); 2472 2473 // Retrieve a global symbol. Similar to |For|, but using a separate 2474 // registry that is not accessible by (and cannot clash with) JavaScript code. 2475 static Local<Symbol> ForApi(Isolate *isolate, Local<String> name); 2476 2477 // Well-known symbols 2478 static Local<Symbol> GetIterator(Isolate* isolate); 2479 static Local<Symbol> GetUnscopables(Isolate* isolate); 2480 static Local<Symbol> GetToStringTag(Isolate* isolate); 2481 static Local<Symbol> GetIsConcatSpreadable(Isolate* isolate); 2482 2483 V8_INLINE static Symbol* Cast(v8::Value* obj); 2484 2485 private: 2486 Symbol(); 2487 static void CheckCast(v8::Value* obj); 2488}; 2489 2490 2491/** 2492 * A private symbol 2493 * 2494 * This is an experimental feature. Use at your own risk. 2495 */ 2496class V8_EXPORT Private : public Data { 2497 public: 2498 // Returns the print name string of the private symbol, or undefined if none. 2499 Local<Value> Name() const; 2500 2501 // Create a private symbol. If name is not empty, it will be the description. 2502 static Local<Private> New(Isolate* isolate, 2503 Local<String> name = Local<String>()); 2504 2505 // Retrieve a global private symbol. If a symbol with this name has not 2506 // been retrieved in the same isolate before, it is created. 2507 // Note that private symbols created this way are never collected, so 2508 // they should only be used for statically fixed properties. 2509 // Also, there is only one global name space for the names used as keys. 2510 // To minimize the potential for clashes, use qualified names as keys, 2511 // e.g., "Class#property". 2512 static Local<Private> ForApi(Isolate* isolate, Local<String> name); 2513 2514 private: 2515 Private(); 2516}; 2517 2518 2519/** 2520 * A JavaScript number value (ECMA-262, 4.3.20) 2521 */ 2522class V8_EXPORT Number : public Primitive { 2523 public: 2524 double Value() const; 2525 static Local<Number> New(Isolate* isolate, double value); 2526 V8_INLINE static Number* Cast(v8::Value* obj); 2527 private: 2528 Number(); 2529 static void CheckCast(v8::Value* obj); 2530}; 2531 2532 2533/** 2534 * A JavaScript value representing a signed integer. 2535 */ 2536class V8_EXPORT Integer : public Number { 2537 public: 2538 static Local<Integer> New(Isolate* isolate, int32_t value); 2539 static Local<Integer> NewFromUnsigned(Isolate* isolate, uint32_t value); 2540 int64_t Value() const; 2541 V8_INLINE static Integer* Cast(v8::Value* obj); 2542 private: 2543 Integer(); 2544 static void CheckCast(v8::Value* obj); 2545}; 2546 2547 2548/** 2549 * A JavaScript value representing a 32-bit signed integer. 2550 */ 2551class V8_EXPORT Int32 : public Integer { 2552 public: 2553 int32_t Value() const; 2554 V8_INLINE static Int32* Cast(v8::Value* obj); 2555 2556 private: 2557 Int32(); 2558 static void CheckCast(v8::Value* obj); 2559}; 2560 2561 2562/** 2563 * A JavaScript value representing a 32-bit unsigned integer. 2564 */ 2565class V8_EXPORT Uint32 : public Integer { 2566 public: 2567 uint32_t Value() const; 2568 V8_INLINE static Uint32* Cast(v8::Value* obj); 2569 2570 private: 2571 Uint32(); 2572 static void CheckCast(v8::Value* obj); 2573}; 2574 2575 2576enum PropertyAttribute { 2577 None = 0, 2578 ReadOnly = 1 << 0, 2579 DontEnum = 1 << 1, 2580 DontDelete = 1 << 2 2581}; 2582 2583/** 2584 * Accessor[Getter|Setter] are used as callback functions when 2585 * setting|getting a particular property. See Object and ObjectTemplate's 2586 * method SetAccessor. 2587 */ 2588typedef void (*AccessorGetterCallback)( 2589 Local<String> property, 2590 const PropertyCallbackInfo<Value>& info); 2591typedef void (*AccessorNameGetterCallback)( 2592 Local<Name> property, 2593 const PropertyCallbackInfo<Value>& info); 2594 2595 2596typedef void (*AccessorSetterCallback)( 2597 Local<String> property, 2598 Local<Value> value, 2599 const PropertyCallbackInfo<void>& info); 2600typedef void (*AccessorNameSetterCallback)( 2601 Local<Name> property, 2602 Local<Value> value, 2603 const PropertyCallbackInfo<void>& info); 2604 2605 2606/** 2607 * Access control specifications. 2608 * 2609 * Some accessors should be accessible across contexts. These 2610 * accessors have an explicit access control parameter which specifies 2611 * the kind of cross-context access that should be allowed. 2612 * 2613 * TODO(dcarney): Remove PROHIBITS_OVERWRITING as it is now unused. 2614 */ 2615enum AccessControl { 2616 DEFAULT = 0, 2617 ALL_CAN_READ = 1, 2618 ALL_CAN_WRITE = 1 << 1, 2619 PROHIBITS_OVERWRITING = 1 << 2 2620}; 2621 2622/** 2623 * Property filter bits. They can be or'ed to build a composite filter. 2624 */ 2625enum PropertyFilter { 2626 ALL_PROPERTIES = 0, 2627 ONLY_WRITABLE = 1, 2628 ONLY_ENUMERABLE = 2, 2629 ONLY_CONFIGURABLE = 4, 2630 SKIP_STRINGS = 8, 2631 SKIP_SYMBOLS = 16 2632}; 2633 2634/** 2635 * Keys/Properties filter enums: 2636 * 2637 * KeyCollectionMode limits the range of collected properties. kOwnOnly limits 2638 * the collected properties to the given Object only. kIncludesPrototypes will 2639 * include all keys of the objects's prototype chain as well. 2640 */ 2641enum class KeyCollectionMode { kOwnOnly, kIncludePrototypes }; 2642 2643/** 2644 * kIncludesIndices allows for integer indices to be collected, while 2645 * kSkipIndices will exclude integer indicies from being collected. 2646 */ 2647enum class IndexFilter { kIncludeIndices, kSkipIndices }; 2648 2649/** 2650 * Integrity level for objects. 2651 */ 2652enum class IntegrityLevel { kFrozen, kSealed }; 2653 2654/** 2655 * A JavaScript object (ECMA-262, 4.3.3) 2656 */ 2657class V8_EXPORT Object : public Value { 2658 public: 2659 V8_DEPRECATE_SOON("Use maybe version", 2660 bool Set(Local<Value> key, Local<Value> value)); 2661 V8_WARN_UNUSED_RESULT Maybe<bool> Set(Local<Context> context, 2662 Local<Value> key, Local<Value> value); 2663 2664 V8_DEPRECATE_SOON("Use maybe version", 2665 bool Set(uint32_t index, Local<Value> value)); 2666 V8_WARN_UNUSED_RESULT Maybe<bool> Set(Local<Context> context, uint32_t index, 2667 Local<Value> value); 2668 2669 // Implements CreateDataProperty (ECMA-262, 7.3.4). 2670 // 2671 // Defines a configurable, writable, enumerable property with the given value 2672 // on the object unless the property already exists and is not configurable 2673 // or the object is not extensible. 2674 // 2675 // Returns true on success. 2676 V8_WARN_UNUSED_RESULT Maybe<bool> CreateDataProperty(Local<Context> context, 2677 Local<Name> key, 2678 Local<Value> value); 2679 V8_WARN_UNUSED_RESULT Maybe<bool> CreateDataProperty(Local<Context> context, 2680 uint32_t index, 2681 Local<Value> value); 2682 2683 // Implements DefineOwnProperty. 2684 // 2685 // In general, CreateDataProperty will be faster, however, does not allow 2686 // for specifying attributes. 2687 // 2688 // Returns true on success. 2689 V8_WARN_UNUSED_RESULT Maybe<bool> DefineOwnProperty( 2690 Local<Context> context, Local<Name> key, Local<Value> value, 2691 PropertyAttribute attributes = None); 2692 2693 // Sets an own property on this object bypassing interceptors and 2694 // overriding accessors or read-only properties. 2695 // 2696 // Note that if the object has an interceptor the property will be set 2697 // locally, but since the interceptor takes precedence the local property 2698 // will only be returned if the interceptor doesn't return a value. 2699 // 2700 // Note also that this only works for named properties. 2701 V8_DEPRECATED("Use CreateDataProperty / DefineOwnProperty", 2702 bool ForceSet(Local<Value> key, Local<Value> value, 2703 PropertyAttribute attribs = None)); 2704 V8_DEPRECATE_SOON("Use CreateDataProperty / DefineOwnProperty", 2705 Maybe<bool> ForceSet(Local<Context> context, 2706 Local<Value> key, Local<Value> value, 2707 PropertyAttribute attribs = None)); 2708 2709 V8_DEPRECATE_SOON("Use maybe version", Local<Value> Get(Local<Value> key)); 2710 V8_WARN_UNUSED_RESULT MaybeLocal<Value> Get(Local<Context> context, 2711 Local<Value> key); 2712 2713 V8_DEPRECATE_SOON("Use maybe version", Local<Value> Get(uint32_t index)); 2714 V8_WARN_UNUSED_RESULT MaybeLocal<Value> Get(Local<Context> context, 2715 uint32_t index); 2716 2717 /** 2718 * Gets the property attributes of a property which can be None or 2719 * any combination of ReadOnly, DontEnum and DontDelete. Returns 2720 * None when the property doesn't exist. 2721 */ 2722 V8_DEPRECATED("Use maybe version", 2723 PropertyAttribute GetPropertyAttributes(Local<Value> key)); 2724 V8_WARN_UNUSED_RESULT Maybe<PropertyAttribute> GetPropertyAttributes( 2725 Local<Context> context, Local<Value> key); 2726 2727 /** 2728 * Returns Object.getOwnPropertyDescriptor as per ES5 section 15.2.3.3. 2729 */ 2730 V8_DEPRECATED("Use maybe version", 2731 Local<Value> GetOwnPropertyDescriptor(Local<String> key)); 2732 V8_WARN_UNUSED_RESULT MaybeLocal<Value> GetOwnPropertyDescriptor( 2733 Local<Context> context, Local<String> key); 2734 2735 V8_DEPRECATE_SOON("Use maybe version", bool Has(Local<Value> key)); 2736 V8_WARN_UNUSED_RESULT Maybe<bool> Has(Local<Context> context, 2737 Local<Value> key); 2738 2739 V8_DEPRECATE_SOON("Use maybe version", bool Delete(Local<Value> key)); 2740 // TODO(dcarney): mark V8_WARN_UNUSED_RESULT 2741 Maybe<bool> Delete(Local<Context> context, Local<Value> key); 2742 2743 V8_DEPRECATED("Use maybe version", bool Has(uint32_t index)); 2744 V8_WARN_UNUSED_RESULT Maybe<bool> Has(Local<Context> context, uint32_t index); 2745 2746 V8_DEPRECATED("Use maybe version", bool Delete(uint32_t index)); 2747 // TODO(dcarney): mark V8_WARN_UNUSED_RESULT 2748 Maybe<bool> Delete(Local<Context> context, uint32_t index); 2749 2750 V8_DEPRECATED("Use maybe version", 2751 bool SetAccessor(Local<String> name, 2752 AccessorGetterCallback getter, 2753 AccessorSetterCallback setter = 0, 2754 Local<Value> data = Local<Value>(), 2755 AccessControl settings = DEFAULT, 2756 PropertyAttribute attribute = None)); 2757 V8_DEPRECATED("Use maybe version", 2758 bool SetAccessor(Local<Name> name, 2759 AccessorNameGetterCallback getter, 2760 AccessorNameSetterCallback setter = 0, 2761 Local<Value> data = Local<Value>(), 2762 AccessControl settings = DEFAULT, 2763 PropertyAttribute attribute = None)); 2764 // TODO(dcarney): mark V8_WARN_UNUSED_RESULT 2765 Maybe<bool> SetAccessor(Local<Context> context, Local<Name> name, 2766 AccessorNameGetterCallback getter, 2767 AccessorNameSetterCallback setter = 0, 2768 MaybeLocal<Value> data = MaybeLocal<Value>(), 2769 AccessControl settings = DEFAULT, 2770 PropertyAttribute attribute = None); 2771 2772 void SetAccessorProperty(Local<Name> name, Local<Function> getter, 2773 Local<Function> setter = Local<Function>(), 2774 PropertyAttribute attribute = None, 2775 AccessControl settings = DEFAULT); 2776 2777 /** 2778 * Functionality for private properties. 2779 * This is an experimental feature, use at your own risk. 2780 * Note: Private properties are not inherited. Do not rely on this, since it 2781 * may change. 2782 */ 2783 Maybe<bool> HasPrivate(Local<Context> context, Local<Private> key); 2784 Maybe<bool> SetPrivate(Local<Context> context, Local<Private> key, 2785 Local<Value> value); 2786 Maybe<bool> DeletePrivate(Local<Context> context, Local<Private> key); 2787 MaybeLocal<Value> GetPrivate(Local<Context> context, Local<Private> key); 2788 2789 /** 2790 * Returns an array containing the names of the enumerable properties 2791 * of this object, including properties from prototype objects. The 2792 * array returned by this method contains the same values as would 2793 * be enumerated by a for-in statement over this object. 2794 */ 2795 V8_DEPRECATE_SOON("Use maybe version", Local<Array> GetPropertyNames()); 2796 V8_WARN_UNUSED_RESULT MaybeLocal<Array> GetPropertyNames( 2797 Local<Context> context); 2798 V8_WARN_UNUSED_RESULT MaybeLocal<Array> GetPropertyNames( 2799 Local<Context> context, KeyCollectionMode mode, 2800 PropertyFilter property_filter, IndexFilter index_filter); 2801 2802 /** 2803 * This function has the same functionality as GetPropertyNames but 2804 * the returned array doesn't contain the names of properties from 2805 * prototype objects. 2806 */ 2807 V8_DEPRECATE_SOON("Use maybe version", Local<Array> GetOwnPropertyNames()); 2808 V8_WARN_UNUSED_RESULT MaybeLocal<Array> GetOwnPropertyNames( 2809 Local<Context> context); 2810 2811 /** 2812 * Returns an array containing the names of the filtered properties 2813 * of this object, including properties from prototype objects. The 2814 * array returned by this method contains the same values as would 2815 * be enumerated by a for-in statement over this object. 2816 */ 2817 V8_WARN_UNUSED_RESULT MaybeLocal<Array> GetOwnPropertyNames( 2818 Local<Context> context, PropertyFilter filter); 2819 2820 /** 2821 * Get the prototype object. This does not skip objects marked to 2822 * be skipped by __proto__ and it does not consult the security 2823 * handler. 2824 */ 2825 Local<Value> GetPrototype(); 2826 2827 /** 2828 * Set the prototype object. This does not skip objects marked to 2829 * be skipped by __proto__ and it does not consult the security 2830 * handler. 2831 */ 2832 V8_DEPRECATED("Use maybe version", bool SetPrototype(Local<Value> prototype)); 2833 V8_WARN_UNUSED_RESULT Maybe<bool> SetPrototype(Local<Context> context, 2834 Local<Value> prototype); 2835 2836 /** 2837 * Finds an instance of the given function template in the prototype 2838 * chain. 2839 */ 2840 Local<Object> FindInstanceInPrototypeChain(Local<FunctionTemplate> tmpl); 2841 2842 /** 2843 * Call builtin Object.prototype.toString on this object. 2844 * This is different from Value::ToString() that may call 2845 * user-defined toString function. This one does not. 2846 */ 2847 V8_DEPRECATED("Use maybe version", Local<String> ObjectProtoToString()); 2848 V8_WARN_UNUSED_RESULT MaybeLocal<String> ObjectProtoToString( 2849 Local<Context> context); 2850 2851 /** 2852 * Returns the name of the function invoked as a constructor for this object. 2853 */ 2854 Local<String> GetConstructorName(); 2855 2856 /** 2857 * Sets the integrity level of the object. 2858 */ 2859 Maybe<bool> SetIntegrityLevel(Local<Context> context, IntegrityLevel level); 2860 2861 /** Gets the number of internal fields for this Object. */ 2862 int InternalFieldCount(); 2863 2864 /** Same as above, but works for Persistents */ 2865 V8_INLINE static int InternalFieldCount( 2866 const PersistentBase<Object>& object) { 2867 return object.val_->InternalFieldCount(); 2868 } 2869 2870 /** Gets the value from an internal field. */ 2871 V8_INLINE Local<Value> GetInternalField(int index); 2872 2873 /** Sets the value in an internal field. */ 2874 void SetInternalField(int index, Local<Value> value); 2875 2876 /** 2877 * Gets a 2-byte-aligned native pointer from an internal field. This field 2878 * must have been set by SetAlignedPointerInInternalField, everything else 2879 * leads to undefined behavior. 2880 */ 2881 V8_INLINE void* GetAlignedPointerFromInternalField(int index); 2882 2883 /** Same as above, but works for Persistents */ 2884 V8_INLINE static void* GetAlignedPointerFromInternalField( 2885 const PersistentBase<Object>& object, int index) { 2886 return object.val_->GetAlignedPointerFromInternalField(index); 2887 } 2888 2889 /** 2890 * Sets a 2-byte-aligned native pointer in an internal field. To retrieve such 2891 * a field, GetAlignedPointerFromInternalField must be used, everything else 2892 * leads to undefined behavior. 2893 */ 2894 void SetAlignedPointerInInternalField(int index, void* value); 2895 2896 // Testers for local properties. 2897 V8_DEPRECATED("Use maybe version", bool HasOwnProperty(Local<String> key)); 2898 V8_WARN_UNUSED_RESULT Maybe<bool> HasOwnProperty(Local<Context> context, 2899 Local<Name> key); 2900 V8_WARN_UNUSED_RESULT Maybe<bool> HasOwnProperty(Local<Context> context, 2901 uint32_t index); 2902 V8_DEPRECATE_SOON("Use maybe version", 2903 bool HasRealNamedProperty(Local<String> key)); 2904 V8_WARN_UNUSED_RESULT Maybe<bool> HasRealNamedProperty(Local<Context> context, 2905 Local<Name> key); 2906 V8_DEPRECATE_SOON("Use maybe version", 2907 bool HasRealIndexedProperty(uint32_t index)); 2908 V8_WARN_UNUSED_RESULT Maybe<bool> HasRealIndexedProperty( 2909 Local<Context> context, uint32_t index); 2910 V8_DEPRECATE_SOON("Use maybe version", 2911 bool HasRealNamedCallbackProperty(Local<String> key)); 2912 V8_WARN_UNUSED_RESULT Maybe<bool> HasRealNamedCallbackProperty( 2913 Local<Context> context, Local<Name> key); 2914 2915 /** 2916 * If result.IsEmpty() no real property was located in the prototype chain. 2917 * This means interceptors in the prototype chain are not called. 2918 */ 2919 V8_DEPRECATED( 2920 "Use maybe version", 2921 Local<Value> GetRealNamedPropertyInPrototypeChain(Local<String> key)); 2922 V8_WARN_UNUSED_RESULT MaybeLocal<Value> GetRealNamedPropertyInPrototypeChain( 2923 Local<Context> context, Local<Name> key); 2924 2925 /** 2926 * Gets the property attributes of a real property in the prototype chain, 2927 * which can be None or any combination of ReadOnly, DontEnum and DontDelete. 2928 * Interceptors in the prototype chain are not called. 2929 */ 2930 V8_DEPRECATED( 2931 "Use maybe version", 2932 Maybe<PropertyAttribute> GetRealNamedPropertyAttributesInPrototypeChain( 2933 Local<String> key)); 2934 V8_WARN_UNUSED_RESULT Maybe<PropertyAttribute> 2935 GetRealNamedPropertyAttributesInPrototypeChain(Local<Context> context, 2936 Local<Name> key); 2937 2938 /** 2939 * If result.IsEmpty() no real property was located on the object or 2940 * in the prototype chain. 2941 * This means interceptors in the prototype chain are not called. 2942 */ 2943 V8_DEPRECATED("Use maybe version", 2944 Local<Value> GetRealNamedProperty(Local<String> key)); 2945 V8_WARN_UNUSED_RESULT MaybeLocal<Value> GetRealNamedProperty( 2946 Local<Context> context, Local<Name> key); 2947 2948 /** 2949 * Gets the property attributes of a real property which can be 2950 * None or any combination of ReadOnly, DontEnum and DontDelete. 2951 * Interceptors in the prototype chain are not called. 2952 */ 2953 V8_DEPRECATED("Use maybe version", 2954 Maybe<PropertyAttribute> GetRealNamedPropertyAttributes( 2955 Local<String> key)); 2956 V8_WARN_UNUSED_RESULT Maybe<PropertyAttribute> GetRealNamedPropertyAttributes( 2957 Local<Context> context, Local<Name> key); 2958 2959 /** Tests for a named lookup interceptor.*/ 2960 bool HasNamedLookupInterceptor(); 2961 2962 /** Tests for an index lookup interceptor.*/ 2963 bool HasIndexedLookupInterceptor(); 2964 2965 /** 2966 * Returns the identity hash for this object. The current implementation 2967 * uses a hidden property on the object to store the identity hash. 2968 * 2969 * The return value will never be 0. Also, it is not guaranteed to be 2970 * unique. 2971 */ 2972 int GetIdentityHash(); 2973 2974 /** 2975 * Clone this object with a fast but shallow copy. Values will point 2976 * to the same values as the original object. 2977 */ 2978 // TODO(dcarney): take an isolate and optionally bail out? 2979 Local<Object> Clone(); 2980 2981 /** 2982 * Returns the context in which the object was created. 2983 */ 2984 Local<Context> CreationContext(); 2985 2986 /** 2987 * Checks whether a callback is set by the 2988 * ObjectTemplate::SetCallAsFunctionHandler method. 2989 * When an Object is callable this method returns true. 2990 */ 2991 bool IsCallable(); 2992 2993 /** 2994 * True if this object is a constructor. 2995 */ 2996 bool IsConstructor(); 2997 2998 /** 2999 * Call an Object as a function if a callback is set by the 3000 * ObjectTemplate::SetCallAsFunctionHandler method. 3001 */ 3002 V8_DEPRECATED("Use maybe version", 3003 Local<Value> CallAsFunction(Local<Value> recv, int argc, 3004 Local<Value> argv[])); 3005 V8_WARN_UNUSED_RESULT MaybeLocal<Value> CallAsFunction(Local<Context> context, 3006 Local<Value> recv, 3007 int argc, 3008 Local<Value> argv[]); 3009 3010 /** 3011 * Call an Object as a constructor if a callback is set by the 3012 * ObjectTemplate::SetCallAsFunctionHandler method. 3013 * Note: This method behaves like the Function::NewInstance method. 3014 */ 3015 V8_DEPRECATED("Use maybe version", 3016 Local<Value> CallAsConstructor(int argc, Local<Value> argv[])); 3017 V8_WARN_UNUSED_RESULT MaybeLocal<Value> CallAsConstructor( 3018 Local<Context> context, int argc, Local<Value> argv[]); 3019 3020 /** 3021 * Return the isolate to which the Object belongs to. 3022 */ 3023 V8_DEPRECATE_SOON("Keep track of isolate correctly", Isolate* GetIsolate()); 3024 3025 static Local<Object> New(Isolate* isolate); 3026 3027 V8_INLINE static Object* Cast(Value* obj); 3028 3029 private: 3030 Object(); 3031 static void CheckCast(Value* obj); 3032 Local<Value> SlowGetInternalField(int index); 3033 void* SlowGetAlignedPointerFromInternalField(int index); 3034}; 3035 3036 3037/** 3038 * An instance of the built-in array constructor (ECMA-262, 15.4.2). 3039 */ 3040class V8_EXPORT Array : public Object { 3041 public: 3042 uint32_t Length() const; 3043 3044 /** 3045 * Clones an element at index |index|. Returns an empty 3046 * handle if cloning fails (for any reason). 3047 */ 3048 V8_DEPRECATED("Cloning is not supported.", 3049 Local<Object> CloneElementAt(uint32_t index)); 3050 V8_DEPRECATED("Cloning is not supported.", 3051 MaybeLocal<Object> CloneElementAt(Local<Context> context, 3052 uint32_t index)); 3053 3054 /** 3055 * Creates a JavaScript array with the given length. If the length 3056 * is negative the returned array will have length 0. 3057 */ 3058 static Local<Array> New(Isolate* isolate, int length = 0); 3059 3060 V8_INLINE static Array* Cast(Value* obj); 3061 private: 3062 Array(); 3063 static void CheckCast(Value* obj); 3064}; 3065 3066 3067/** 3068 * An instance of the built-in Map constructor (ECMA-262, 6th Edition, 23.1.1). 3069 */ 3070class V8_EXPORT Map : public Object { 3071 public: 3072 size_t Size() const; 3073 void Clear(); 3074 V8_WARN_UNUSED_RESULT MaybeLocal<Value> Get(Local<Context> context, 3075 Local<Value> key); 3076 V8_WARN_UNUSED_RESULT MaybeLocal<Map> Set(Local<Context> context, 3077 Local<Value> key, 3078 Local<Value> value); 3079 V8_WARN_UNUSED_RESULT Maybe<bool> Has(Local<Context> context, 3080 Local<Value> key); 3081 V8_WARN_UNUSED_RESULT Maybe<bool> Delete(Local<Context> context, 3082 Local<Value> key); 3083 3084 /** 3085 * Returns an array of length Size() * 2, where index N is the Nth key and 3086 * index N + 1 is the Nth value. 3087 */ 3088 Local<Array> AsArray() const; 3089 3090 /** 3091 * Creates a new empty Map. 3092 */ 3093 static Local<Map> New(Isolate* isolate); 3094 3095 V8_INLINE static Map* Cast(Value* obj); 3096 3097 private: 3098 Map(); 3099 static void CheckCast(Value* obj); 3100}; 3101 3102 3103/** 3104 * An instance of the built-in Set constructor (ECMA-262, 6th Edition, 23.2.1). 3105 */ 3106class V8_EXPORT Set : public Object { 3107 public: 3108 size_t Size() const; 3109 void Clear(); 3110 V8_WARN_UNUSED_RESULT MaybeLocal<Set> Add(Local<Context> context, 3111 Local<Value> key); 3112 V8_WARN_UNUSED_RESULT Maybe<bool> Has(Local<Context> context, 3113 Local<Value> key); 3114 V8_WARN_UNUSED_RESULT Maybe<bool> Delete(Local<Context> context, 3115 Local<Value> key); 3116 3117 /** 3118 * Returns an array of the keys in this Set. 3119 */ 3120 Local<Array> AsArray() const; 3121 3122 /** 3123 * Creates a new empty Set. 3124 */ 3125 static Local<Set> New(Isolate* isolate); 3126 3127 V8_INLINE static Set* Cast(Value* obj); 3128 3129 private: 3130 Set(); 3131 static void CheckCast(Value* obj); 3132}; 3133 3134 3135template<typename T> 3136class ReturnValue { 3137 public: 3138 template <class S> V8_INLINE ReturnValue(const ReturnValue<S>& that) 3139 : value_(that.value_) { 3140 TYPE_CHECK(T, S); 3141 } 3142 // Local setters 3143 template <typename S> 3144 V8_INLINE V8_DEPRECATE_SOON("Use Global<> instead", 3145 void Set(const Persistent<S>& handle)); 3146 template <typename S> 3147 V8_INLINE void Set(const Global<S>& handle); 3148 template <typename S> 3149 V8_INLINE void Set(const Local<S> handle); 3150 // Fast primitive setters 3151 V8_INLINE void Set(bool value); 3152 V8_INLINE void Set(double i); 3153 V8_INLINE void Set(int32_t i); 3154 V8_INLINE void Set(uint32_t i); 3155 // Fast JS primitive setters 3156 V8_INLINE void SetNull(); 3157 V8_INLINE void SetUndefined(); 3158 V8_INLINE void SetEmptyString(); 3159 // Convenience getter for Isolate 3160 V8_INLINE Isolate* GetIsolate() const; 3161 3162 // Pointer setter: Uncompilable to prevent inadvertent misuse. 3163 template <typename S> 3164 V8_INLINE void Set(S* whatever); 3165 3166 // Getter. Creates a new Local<> so it comes with a certain performance 3167 // hit. If the ReturnValue was not yet set, this will return the undefined 3168 // value. 3169 V8_INLINE Local<Value> Get() const; 3170 3171 private: 3172 template<class F> friend class ReturnValue; 3173 template<class F> friend class FunctionCallbackInfo; 3174 template<class F> friend class PropertyCallbackInfo; 3175 template <class F, class G, class H> 3176 friend class PersistentValueMapBase; 3177 V8_INLINE void SetInternal(internal::Object* value) { *value_ = value; } 3178 V8_INLINE internal::Object* GetDefaultValue(); 3179 V8_INLINE explicit ReturnValue(internal::Object** slot); 3180 internal::Object** value_; 3181}; 3182 3183 3184/** 3185 * The argument information given to function call callbacks. This 3186 * class provides access to information about the context of the call, 3187 * including the receiver, the number and values of arguments, and 3188 * the holder of the function. 3189 */ 3190template<typename T> 3191class FunctionCallbackInfo { 3192 public: 3193 V8_INLINE int Length() const; 3194 V8_INLINE Local<Value> operator[](int i) const; 3195 V8_INLINE V8_DEPRECATED("Use Data() to explicitly pass Callee instead", 3196 Local<Function> Callee() const); 3197 V8_INLINE Local<Object> This() const; 3198 V8_INLINE Local<Object> Holder() const; 3199 V8_INLINE Local<Value> NewTarget() const; 3200 V8_INLINE bool IsConstructCall() const; 3201 V8_INLINE Local<Value> Data() const; 3202 V8_INLINE Isolate* GetIsolate() const; 3203 V8_INLINE ReturnValue<T> GetReturnValue() const; 3204 // This shouldn't be public, but the arm compiler needs it. 3205 static const int kArgsLength = 8; 3206 3207 protected: 3208 friend class internal::FunctionCallbackArguments; 3209 friend class internal::CustomArguments<FunctionCallbackInfo>; 3210 static const int kHolderIndex = 0; 3211 static const int kIsolateIndex = 1; 3212 static const int kReturnValueDefaultValueIndex = 2; 3213 static const int kReturnValueIndex = 3; 3214 static const int kDataIndex = 4; 3215 static const int kCalleeIndex = 5; 3216 static const int kContextSaveIndex = 6; 3217 static const int kNewTargetIndex = 7; 3218 3219 V8_INLINE FunctionCallbackInfo(internal::Object** implicit_args, 3220 internal::Object** values, int length); 3221 internal::Object** implicit_args_; 3222 internal::Object** values_; 3223 int length_; 3224}; 3225 3226 3227/** 3228 * The information passed to a property callback about the context 3229 * of the property access. 3230 */ 3231template<typename T> 3232class PropertyCallbackInfo { 3233 public: 3234 V8_INLINE Isolate* GetIsolate() const; 3235 V8_INLINE Local<Value> Data() const; 3236 V8_INLINE Local<Object> This() const; 3237 V8_INLINE Local<Object> Holder() const; 3238 V8_INLINE ReturnValue<T> GetReturnValue() const; 3239 V8_INLINE bool ShouldThrowOnError() const; 3240 // This shouldn't be public, but the arm compiler needs it. 3241 static const int kArgsLength = 7; 3242 3243 protected: 3244 friend class MacroAssembler; 3245 friend class internal::PropertyCallbackArguments; 3246 friend class internal::CustomArguments<PropertyCallbackInfo>; 3247 static const int kShouldThrowOnErrorIndex = 0; 3248 static const int kHolderIndex = 1; 3249 static const int kIsolateIndex = 2; 3250 static const int kReturnValueDefaultValueIndex = 3; 3251 static const int kReturnValueIndex = 4; 3252 static const int kDataIndex = 5; 3253 static const int kThisIndex = 6; 3254 3255 V8_INLINE PropertyCallbackInfo(internal::Object** args) : args_(args) {} 3256 internal::Object** args_; 3257}; 3258 3259 3260typedef void (*FunctionCallback)(const FunctionCallbackInfo<Value>& info); 3261 3262enum class ConstructorBehavior { kThrow, kAllow }; 3263 3264/** 3265 * A JavaScript function object (ECMA-262, 15.3). 3266 */ 3267class V8_EXPORT Function : public Object { 3268 public: 3269 /** 3270 * Create a function in the current execution context 3271 * for a given FunctionCallback. 3272 */ 3273 static MaybeLocal<Function> New( 3274 Local<Context> context, FunctionCallback callback, 3275 Local<Value> data = Local<Value>(), int length = 0, 3276 ConstructorBehavior behavior = ConstructorBehavior::kAllow); 3277 static V8_DEPRECATE_SOON( 3278 "Use maybe version", 3279 Local<Function> New(Isolate* isolate, FunctionCallback callback, 3280 Local<Value> data = Local<Value>(), int length = 0)); 3281 3282 V8_DEPRECATED("Use maybe version", 3283 Local<Object> NewInstance(int argc, Local<Value> argv[]) const); 3284 V8_WARN_UNUSED_RESULT MaybeLocal<Object> NewInstance( 3285 Local<Context> context, int argc, Local<Value> argv[]) const; 3286 3287 V8_DEPRECATED("Use maybe version", Local<Object> NewInstance() const); 3288 V8_WARN_UNUSED_RESULT MaybeLocal<Object> NewInstance( 3289 Local<Context> context) const { 3290 return NewInstance(context, 0, nullptr); 3291 } 3292 3293 V8_DEPRECATE_SOON("Use maybe version", 3294 Local<Value> Call(Local<Value> recv, int argc, 3295 Local<Value> argv[])); 3296 V8_WARN_UNUSED_RESULT MaybeLocal<Value> Call(Local<Context> context, 3297 Local<Value> recv, int argc, 3298 Local<Value> argv[]); 3299 3300 void SetName(Local<String> name); 3301 Local<Value> GetName() const; 3302 3303 /** 3304 * Name inferred from variable or property assignment of this function. 3305 * Used to facilitate debugging and profiling of JavaScript code written 3306 * in an OO style, where many functions are anonymous but are assigned 3307 * to object properties. 3308 */ 3309 Local<Value> GetInferredName() const; 3310 3311 /** 3312 * displayName if it is set, otherwise name if it is configured, otherwise 3313 * function name, otherwise inferred name. 3314 */ 3315 Local<Value> GetDebugName() const; 3316 3317 /** 3318 * User-defined name assigned to the "displayName" property of this function. 3319 * Used to facilitate debugging and profiling of JavaScript code. 3320 */ 3321 Local<Value> GetDisplayName() const; 3322 3323 /** 3324 * Returns zero based line number of function body and 3325 * kLineOffsetNotFound if no information available. 3326 */ 3327 int GetScriptLineNumber() const; 3328 /** 3329 * Returns zero based column number of function body and 3330 * kLineOffsetNotFound if no information available. 3331 */ 3332 int GetScriptColumnNumber() const; 3333 3334 /** 3335 * Tells whether this function is builtin. 3336 */ 3337 bool IsBuiltin() const; 3338 3339 /** 3340 * Returns scriptId. 3341 */ 3342 int ScriptId() const; 3343 3344 /** 3345 * Returns the original function if this function is bound, else returns 3346 * v8::Undefined. 3347 */ 3348 Local<Value> GetBoundFunction() const; 3349 3350 ScriptOrigin GetScriptOrigin() const; 3351 V8_INLINE static Function* Cast(Value* obj); 3352 static const int kLineOffsetNotFound; 3353 3354 private: 3355 Function(); 3356 static void CheckCast(Value* obj); 3357}; 3358 3359 3360/** 3361 * An instance of the built-in Promise constructor (ES6 draft). 3362 * This API is experimental. Only works with --harmony flag. 3363 */ 3364class V8_EXPORT Promise : public Object { 3365 public: 3366 class V8_EXPORT Resolver : public Object { 3367 public: 3368 /** 3369 * Create a new resolver, along with an associated promise in pending state. 3370 */ 3371 static V8_DEPRECATE_SOON("Use maybe version", 3372 Local<Resolver> New(Isolate* isolate)); 3373 static V8_WARN_UNUSED_RESULT MaybeLocal<Resolver> New( 3374 Local<Context> context); 3375 3376 /** 3377 * Extract the associated promise. 3378 */ 3379 Local<Promise> GetPromise(); 3380 3381 /** 3382 * Resolve/reject the associated promise with a given value. 3383 * Ignored if the promise is no longer pending. 3384 */ 3385 V8_DEPRECATE_SOON("Use maybe version", void Resolve(Local<Value> value)); 3386 // TODO(dcarney): mark V8_WARN_UNUSED_RESULT 3387 Maybe<bool> Resolve(Local<Context> context, Local<Value> value); 3388 3389 V8_DEPRECATE_SOON("Use maybe version", void Reject(Local<Value> value)); 3390 // TODO(dcarney): mark V8_WARN_UNUSED_RESULT 3391 Maybe<bool> Reject(Local<Context> context, Local<Value> value); 3392 3393 V8_INLINE static Resolver* Cast(Value* obj); 3394 3395 private: 3396 Resolver(); 3397 static void CheckCast(Value* obj); 3398 }; 3399 3400 /** 3401 * Register a resolution/rejection handler with a promise. 3402 * The handler is given the respective resolution/rejection value as 3403 * an argument. If the promise is already resolved/rejected, the handler is 3404 * invoked at the end of turn. 3405 */ 3406 V8_DEPRECATED("Use maybe version of Then", 3407 Local<Promise> Chain(Local<Function> handler)); 3408 V8_DEPRECATED("Use Then", 3409 V8_WARN_UNUSED_RESULT MaybeLocal<Promise> Chain( 3410 Local<Context> context, Local<Function> handler)); 3411 3412 V8_DEPRECATED("Use maybe version", 3413 Local<Promise> Catch(Local<Function> handler)); 3414 V8_WARN_UNUSED_RESULT MaybeLocal<Promise> Catch(Local<Context> context, 3415 Local<Function> handler); 3416 3417 V8_DEPRECATED("Use maybe version", 3418 Local<Promise> Then(Local<Function> handler)); 3419 V8_WARN_UNUSED_RESULT MaybeLocal<Promise> Then(Local<Context> context, 3420 Local<Function> handler); 3421 3422 /** 3423 * Returns true if the promise has at least one derived promise, and 3424 * therefore resolve/reject handlers (including default handler). 3425 */ 3426 bool HasHandler(); 3427 3428 V8_INLINE static Promise* Cast(Value* obj); 3429 3430 private: 3431 Promise(); 3432 static void CheckCast(Value* obj); 3433}; 3434 3435 3436/** 3437 * An instance of the built-in Proxy constructor (ECMA-262, 6th Edition, 3438 * 26.2.1). 3439 */ 3440class V8_EXPORT Proxy : public Object { 3441 public: 3442 Local<Object> GetTarget(); 3443 Local<Value> GetHandler(); 3444 bool IsRevoked(); 3445 void Revoke(); 3446 3447 /** 3448 * Creates a new empty Map. 3449 */ 3450 static MaybeLocal<Proxy> New(Local<Context> context, 3451 Local<Object> local_target, 3452 Local<Object> local_handler); 3453 3454 V8_INLINE static Proxy* Cast(Value* obj); 3455 3456 private: 3457 Proxy(); 3458 static void CheckCast(Value* obj); 3459}; 3460 3461 3462#ifndef V8_ARRAY_BUFFER_INTERNAL_FIELD_COUNT 3463// The number of required internal fields can be defined by embedder. 3464#define V8_ARRAY_BUFFER_INTERNAL_FIELD_COUNT 2 3465#endif 3466 3467 3468enum class ArrayBufferCreationMode { kInternalized, kExternalized }; 3469 3470 3471/** 3472 * An instance of the built-in ArrayBuffer constructor (ES6 draft 15.13.5). 3473 * This API is experimental and may change significantly. 3474 */ 3475class V8_EXPORT ArrayBuffer : public Object { 3476 public: 3477 /** 3478 * A thread-safe allocator that V8 uses to allocate |ArrayBuffer|'s memory. 3479 * The allocator is a global V8 setting. It has to be set via 3480 * Isolate::CreateParams. 3481 * 3482 * Memory allocated through this allocator by V8 is accounted for as external 3483 * memory by V8. Note that V8 keeps track of the memory for all internalized 3484 * |ArrayBuffer|s. Responsibility for tracking external memory (using 3485 * Isolate::AdjustAmountOfExternalAllocatedMemory) is handed over to the 3486 * embedder upon externalization and taken over upon internalization (creating 3487 * an internalized buffer from an existing buffer). 3488 * 3489 * Note that it is unsafe to call back into V8 from any of the allocator 3490 * functions. 3491 * 3492 * This API is experimental and may change significantly. 3493 */ 3494 class V8_EXPORT Allocator { // NOLINT 3495 public: 3496 virtual ~Allocator() {} 3497 3498 /** 3499 * Allocate |length| bytes. Return NULL if allocation is not successful. 3500 * Memory should be initialized to zeroes. 3501 */ 3502 virtual void* Allocate(size_t length) = 0; 3503 3504 /** 3505 * Allocate |length| bytes. Return NULL if allocation is not successful. 3506 * Memory does not have to be initialized. 3507 */ 3508 virtual void* AllocateUninitialized(size_t length) = 0; 3509 /** 3510 * Free the memory block of size |length|, pointed to by |data|. 3511 * That memory is guaranteed to be previously allocated by |Allocate|. 3512 */ 3513 virtual void Free(void* data, size_t length) = 0; 3514 }; 3515 3516 /** 3517 * The contents of an |ArrayBuffer|. Externalization of |ArrayBuffer| 3518 * returns an instance of this class, populated, with a pointer to data 3519 * and byte length. 3520 * 3521 * The Data pointer of ArrayBuffer::Contents is always allocated with 3522 * Allocator::Allocate that is set via Isolate::CreateParams. 3523 * 3524 * This API is experimental and may change significantly. 3525 */ 3526 class V8_EXPORT Contents { // NOLINT 3527 public: 3528 Contents() : data_(NULL), byte_length_(0) {} 3529 3530 void* Data() const { return data_; } 3531 size_t ByteLength() const { return byte_length_; } 3532 3533 private: 3534 void* data_; 3535 size_t byte_length_; 3536 3537 friend class ArrayBuffer; 3538 }; 3539 3540 3541 /** 3542 * Data length in bytes. 3543 */ 3544 size_t ByteLength() const; 3545 3546 /** 3547 * Create a new ArrayBuffer. Allocate |byte_length| bytes. 3548 * Allocated memory will be owned by a created ArrayBuffer and 3549 * will be deallocated when it is garbage-collected, 3550 * unless the object is externalized. 3551 */ 3552 static Local<ArrayBuffer> New(Isolate* isolate, size_t byte_length); 3553 3554 /** 3555 * Create a new ArrayBuffer over an existing memory block. 3556 * The created array buffer is by default immediately in externalized state. 3557 * The memory block will not be reclaimed when a created ArrayBuffer 3558 * is garbage-collected. 3559 */ 3560 static Local<ArrayBuffer> New( 3561 Isolate* isolate, void* data, size_t byte_length, 3562 ArrayBufferCreationMode mode = ArrayBufferCreationMode::kExternalized); 3563 3564 /** 3565 * Returns true if ArrayBuffer is externalized, that is, does not 3566 * own its memory block. 3567 */ 3568 bool IsExternal() const; 3569 3570 /** 3571 * Returns true if this ArrayBuffer may be neutered. 3572 */ 3573 bool IsNeuterable() const; 3574 3575 /** 3576 * Neuters this ArrayBuffer and all its views (typed arrays). 3577 * Neutering sets the byte length of the buffer and all typed arrays to zero, 3578 * preventing JavaScript from ever accessing underlying backing store. 3579 * ArrayBuffer should have been externalized and must be neuterable. 3580 */ 3581 void Neuter(); 3582 3583 /** 3584 * Make this ArrayBuffer external. The pointer to underlying memory block 3585 * and byte length are returned as |Contents| structure. After ArrayBuffer 3586 * had been etxrenalized, it does no longer owns the memory block. The caller 3587 * should take steps to free memory when it is no longer needed. 3588 * 3589 * The memory block is guaranteed to be allocated with |Allocator::Allocate| 3590 * that has been set via Isolate::CreateParams. 3591 */ 3592 Contents Externalize(); 3593 3594 /** 3595 * Get a pointer to the ArrayBuffer's underlying memory block without 3596 * externalizing it. If the ArrayBuffer is not externalized, this pointer 3597 * will become invalid as soon as the ArrayBuffer became garbage collected. 3598 * 3599 * The embedder should make sure to hold a strong reference to the 3600 * ArrayBuffer while accessing this pointer. 3601 * 3602 * The memory block is guaranteed to be allocated with |Allocator::Allocate|. 3603 */ 3604 Contents GetContents(); 3605 3606 V8_INLINE static ArrayBuffer* Cast(Value* obj); 3607 3608 static const int kInternalFieldCount = V8_ARRAY_BUFFER_INTERNAL_FIELD_COUNT; 3609 3610 private: 3611 ArrayBuffer(); 3612 static void CheckCast(Value* obj); 3613}; 3614 3615 3616#ifndef V8_ARRAY_BUFFER_VIEW_INTERNAL_FIELD_COUNT 3617// The number of required internal fields can be defined by embedder. 3618#define V8_ARRAY_BUFFER_VIEW_INTERNAL_FIELD_COUNT 2 3619#endif 3620 3621 3622/** 3623 * A base class for an instance of one of "views" over ArrayBuffer, 3624 * including TypedArrays and DataView (ES6 draft 15.13). 3625 * 3626 * This API is experimental and may change significantly. 3627 */ 3628class V8_EXPORT ArrayBufferView : public Object { 3629 public: 3630 /** 3631 * Returns underlying ArrayBuffer. 3632 */ 3633 Local<ArrayBuffer> Buffer(); 3634 /** 3635 * Byte offset in |Buffer|. 3636 */ 3637 size_t ByteOffset(); 3638 /** 3639 * Size of a view in bytes. 3640 */ 3641 size_t ByteLength(); 3642 3643 /** 3644 * Copy the contents of the ArrayBufferView's buffer to an embedder defined 3645 * memory without additional overhead that calling ArrayBufferView::Buffer 3646 * might incur. 3647 * 3648 * Will write at most min(|byte_length|, ByteLength) bytes starting at 3649 * ByteOffset of the underling buffer to the memory starting at |dest|. 3650 * Returns the number of bytes actually written. 3651 */ 3652 size_t CopyContents(void* dest, size_t byte_length); 3653 3654 /** 3655 * Returns true if ArrayBufferView's backing ArrayBuffer has already been 3656 * allocated. 3657 */ 3658 bool HasBuffer() const; 3659 3660 V8_INLINE static ArrayBufferView* Cast(Value* obj); 3661 3662 static const int kInternalFieldCount = 3663 V8_ARRAY_BUFFER_VIEW_INTERNAL_FIELD_COUNT; 3664 3665 private: 3666 ArrayBufferView(); 3667 static void CheckCast(Value* obj); 3668}; 3669 3670 3671/** 3672 * A base class for an instance of TypedArray series of constructors 3673 * (ES6 draft 15.13.6). 3674 * This API is experimental and may change significantly. 3675 */ 3676class V8_EXPORT TypedArray : public ArrayBufferView { 3677 public: 3678 /** 3679 * Number of elements in this typed array 3680 * (e.g. for Int16Array, |ByteLength|/2). 3681 */ 3682 size_t Length(); 3683 3684 V8_INLINE static TypedArray* Cast(Value* obj); 3685 3686 private: 3687 TypedArray(); 3688 static void CheckCast(Value* obj); 3689}; 3690 3691 3692/** 3693 * An instance of Uint8Array constructor (ES6 draft 15.13.6). 3694 * This API is experimental and may change significantly. 3695 */ 3696class V8_EXPORT Uint8Array : public TypedArray { 3697 public: 3698 static Local<Uint8Array> New(Local<ArrayBuffer> array_buffer, 3699 size_t byte_offset, size_t length); 3700 static Local<Uint8Array> New(Local<SharedArrayBuffer> shared_array_buffer, 3701 size_t byte_offset, size_t length); 3702 V8_INLINE static Uint8Array* Cast(Value* obj); 3703 3704 private: 3705 Uint8Array(); 3706 static void CheckCast(Value* obj); 3707}; 3708 3709 3710/** 3711 * An instance of Uint8ClampedArray constructor (ES6 draft 15.13.6). 3712 * This API is experimental and may change significantly. 3713 */ 3714class V8_EXPORT Uint8ClampedArray : public TypedArray { 3715 public: 3716 static Local<Uint8ClampedArray> New(Local<ArrayBuffer> array_buffer, 3717 size_t byte_offset, size_t length); 3718 static Local<Uint8ClampedArray> New( 3719 Local<SharedArrayBuffer> shared_array_buffer, size_t byte_offset, 3720 size_t length); 3721 V8_INLINE static Uint8ClampedArray* Cast(Value* obj); 3722 3723 private: 3724 Uint8ClampedArray(); 3725 static void CheckCast(Value* obj); 3726}; 3727 3728/** 3729 * An instance of Int8Array constructor (ES6 draft 15.13.6). 3730 * This API is experimental and may change significantly. 3731 */ 3732class V8_EXPORT Int8Array : public TypedArray { 3733 public: 3734 static Local<Int8Array> New(Local<ArrayBuffer> array_buffer, 3735 size_t byte_offset, size_t length); 3736 static Local<Int8Array> New(Local<SharedArrayBuffer> shared_array_buffer, 3737 size_t byte_offset, size_t length); 3738 V8_INLINE static Int8Array* Cast(Value* obj); 3739 3740 private: 3741 Int8Array(); 3742 static void CheckCast(Value* obj); 3743}; 3744 3745 3746/** 3747 * An instance of Uint16Array constructor (ES6 draft 15.13.6). 3748 * This API is experimental and may change significantly. 3749 */ 3750class V8_EXPORT Uint16Array : public TypedArray { 3751 public: 3752 static Local<Uint16Array> New(Local<ArrayBuffer> array_buffer, 3753 size_t byte_offset, size_t length); 3754 static Local<Uint16Array> New(Local<SharedArrayBuffer> shared_array_buffer, 3755 size_t byte_offset, size_t length); 3756 V8_INLINE static Uint16Array* Cast(Value* obj); 3757 3758 private: 3759 Uint16Array(); 3760 static void CheckCast(Value* obj); 3761}; 3762 3763 3764/** 3765 * An instance of Int16Array constructor (ES6 draft 15.13.6). 3766 * This API is experimental and may change significantly. 3767 */ 3768class V8_EXPORT Int16Array : public TypedArray { 3769 public: 3770 static Local<Int16Array> New(Local<ArrayBuffer> array_buffer, 3771 size_t byte_offset, size_t length); 3772 static Local<Int16Array> New(Local<SharedArrayBuffer> shared_array_buffer, 3773 size_t byte_offset, size_t length); 3774 V8_INLINE static Int16Array* Cast(Value* obj); 3775 3776 private: 3777 Int16Array(); 3778 static void CheckCast(Value* obj); 3779}; 3780 3781 3782/** 3783 * An instance of Uint32Array constructor (ES6 draft 15.13.6). 3784 * This API is experimental and may change significantly. 3785 */ 3786class V8_EXPORT Uint32Array : public TypedArray { 3787 public: 3788 static Local<Uint32Array> New(Local<ArrayBuffer> array_buffer, 3789 size_t byte_offset, size_t length); 3790 static Local<Uint32Array> New(Local<SharedArrayBuffer> shared_array_buffer, 3791 size_t byte_offset, size_t length); 3792 V8_INLINE static Uint32Array* Cast(Value* obj); 3793 3794 private: 3795 Uint32Array(); 3796 static void CheckCast(Value* obj); 3797}; 3798 3799 3800/** 3801 * An instance of Int32Array constructor (ES6 draft 15.13.6). 3802 * This API is experimental and may change significantly. 3803 */ 3804class V8_EXPORT Int32Array : public TypedArray { 3805 public: 3806 static Local<Int32Array> New(Local<ArrayBuffer> array_buffer, 3807 size_t byte_offset, size_t length); 3808 static Local<Int32Array> New(Local<SharedArrayBuffer> shared_array_buffer, 3809 size_t byte_offset, size_t length); 3810 V8_INLINE static Int32Array* Cast(Value* obj); 3811 3812 private: 3813 Int32Array(); 3814 static void CheckCast(Value* obj); 3815}; 3816 3817 3818/** 3819 * An instance of Float32Array constructor (ES6 draft 15.13.6). 3820 * This API is experimental and may change significantly. 3821 */ 3822class V8_EXPORT Float32Array : public TypedArray { 3823 public: 3824 static Local<Float32Array> New(Local<ArrayBuffer> array_buffer, 3825 size_t byte_offset, size_t length); 3826 static Local<Float32Array> New(Local<SharedArrayBuffer> shared_array_buffer, 3827 size_t byte_offset, size_t length); 3828 V8_INLINE static Float32Array* Cast(Value* obj); 3829 3830 private: 3831 Float32Array(); 3832 static void CheckCast(Value* obj); 3833}; 3834 3835 3836/** 3837 * An instance of Float64Array constructor (ES6 draft 15.13.6). 3838 * This API is experimental and may change significantly. 3839 */ 3840class V8_EXPORT Float64Array : public TypedArray { 3841 public: 3842 static Local<Float64Array> New(Local<ArrayBuffer> array_buffer, 3843 size_t byte_offset, size_t length); 3844 static Local<Float64Array> New(Local<SharedArrayBuffer> shared_array_buffer, 3845 size_t byte_offset, size_t length); 3846 V8_INLINE static Float64Array* Cast(Value* obj); 3847 3848 private: 3849 Float64Array(); 3850 static void CheckCast(Value* obj); 3851}; 3852 3853 3854/** 3855 * An instance of DataView constructor (ES6 draft 15.13.7). 3856 * This API is experimental and may change significantly. 3857 */ 3858class V8_EXPORT DataView : public ArrayBufferView { 3859 public: 3860 static Local<DataView> New(Local<ArrayBuffer> array_buffer, 3861 size_t byte_offset, size_t length); 3862 static Local<DataView> New(Local<SharedArrayBuffer> shared_array_buffer, 3863 size_t byte_offset, size_t length); 3864 V8_INLINE static DataView* Cast(Value* obj); 3865 3866 private: 3867 DataView(); 3868 static void CheckCast(Value* obj); 3869}; 3870 3871 3872/** 3873 * An instance of the built-in SharedArrayBuffer constructor. 3874 * This API is experimental and may change significantly. 3875 */ 3876class V8_EXPORT SharedArrayBuffer : public Object { 3877 public: 3878 /** 3879 * The contents of an |SharedArrayBuffer|. Externalization of 3880 * |SharedArrayBuffer| returns an instance of this class, populated, with a 3881 * pointer to data and byte length. 3882 * 3883 * The Data pointer of SharedArrayBuffer::Contents is always allocated with 3884 * |ArrayBuffer::Allocator::Allocate| by the allocator specified in 3885 * v8::Isolate::CreateParams::array_buffer_allocator. 3886 * 3887 * This API is experimental and may change significantly. 3888 */ 3889 class V8_EXPORT Contents { // NOLINT 3890 public: 3891 Contents() : data_(NULL), byte_length_(0) {} 3892 3893 void* Data() const { return data_; } 3894 size_t ByteLength() const { return byte_length_; } 3895 3896 private: 3897 void* data_; 3898 size_t byte_length_; 3899 3900 friend class SharedArrayBuffer; 3901 }; 3902 3903 3904 /** 3905 * Data length in bytes. 3906 */ 3907 size_t ByteLength() const; 3908 3909 /** 3910 * Create a new SharedArrayBuffer. Allocate |byte_length| bytes. 3911 * Allocated memory will be owned by a created SharedArrayBuffer and 3912 * will be deallocated when it is garbage-collected, 3913 * unless the object is externalized. 3914 */ 3915 static Local<SharedArrayBuffer> New(Isolate* isolate, size_t byte_length); 3916 3917 /** 3918 * Create a new SharedArrayBuffer over an existing memory block. The created 3919 * array buffer is immediately in externalized state unless otherwise 3920 * specified. The memory block will not be reclaimed when a created 3921 * SharedArrayBuffer is garbage-collected. 3922 */ 3923 static Local<SharedArrayBuffer> New( 3924 Isolate* isolate, void* data, size_t byte_length, 3925 ArrayBufferCreationMode mode = ArrayBufferCreationMode::kExternalized); 3926 3927 /** 3928 * Returns true if SharedArrayBuffer is externalized, that is, does not 3929 * own its memory block. 3930 */ 3931 bool IsExternal() const; 3932 3933 /** 3934 * Make this SharedArrayBuffer external. The pointer to underlying memory 3935 * block and byte length are returned as |Contents| structure. After 3936 * SharedArrayBuffer had been etxrenalized, it does no longer owns the memory 3937 * block. The caller should take steps to free memory when it is no longer 3938 * needed. 3939 * 3940 * The memory block is guaranteed to be allocated with |Allocator::Allocate| 3941 * by the allocator specified in 3942 * v8::Isolate::CreateParams::array_buffer_allocator. 3943 * 3944 */ 3945 Contents Externalize(); 3946 3947 /** 3948 * Get a pointer to the ArrayBuffer's underlying memory block without 3949 * externalizing it. If the ArrayBuffer is not externalized, this pointer 3950 * will become invalid as soon as the ArrayBuffer became garbage collected. 3951 * 3952 * The embedder should make sure to hold a strong reference to the 3953 * ArrayBuffer while accessing this pointer. 3954 * 3955 * The memory block is guaranteed to be allocated with |Allocator::Allocate| 3956 * by the allocator specified in 3957 * v8::Isolate::CreateParams::array_buffer_allocator. 3958 */ 3959 Contents GetContents(); 3960 3961 V8_INLINE static SharedArrayBuffer* Cast(Value* obj); 3962 3963 static const int kInternalFieldCount = V8_ARRAY_BUFFER_INTERNAL_FIELD_COUNT; 3964 3965 private: 3966 SharedArrayBuffer(); 3967 static void CheckCast(Value* obj); 3968}; 3969 3970 3971/** 3972 * An instance of the built-in Date constructor (ECMA-262, 15.9). 3973 */ 3974class V8_EXPORT Date : public Object { 3975 public: 3976 static V8_DEPRECATE_SOON("Use maybe version.", 3977 Local<Value> New(Isolate* isolate, double time)); 3978 static V8_WARN_UNUSED_RESULT MaybeLocal<Value> New(Local<Context> context, 3979 double time); 3980 3981 /** 3982 * A specialization of Value::NumberValue that is more efficient 3983 * because we know the structure of this object. 3984 */ 3985 double ValueOf() const; 3986 3987 V8_INLINE static Date* Cast(v8::Value* obj); 3988 3989 /** 3990 * Notification that the embedder has changed the time zone, 3991 * daylight savings time, or other date / time configuration 3992 * parameters. V8 keeps a cache of various values used for 3993 * date / time computation. This notification will reset 3994 * those cached values for the current context so that date / 3995 * time configuration changes would be reflected in the Date 3996 * object. 3997 * 3998 * This API should not be called more than needed as it will 3999 * negatively impact the performance of date operations. 4000 */ 4001 static void DateTimeConfigurationChangeNotification(Isolate* isolate); 4002 4003 private: 4004 static void CheckCast(v8::Value* obj); 4005}; 4006 4007 4008/** 4009 * A Number object (ECMA-262, 4.3.21). 4010 */ 4011class V8_EXPORT NumberObject : public Object { 4012 public: 4013 static Local<Value> New(Isolate* isolate, double value); 4014 4015 double ValueOf() const; 4016 4017 V8_INLINE static NumberObject* Cast(v8::Value* obj); 4018 4019 private: 4020 static void CheckCast(v8::Value* obj); 4021}; 4022 4023 4024/** 4025 * A Boolean object (ECMA-262, 4.3.15). 4026 */ 4027class V8_EXPORT BooleanObject : public Object { 4028 public: 4029 static Local<Value> New(Isolate* isolate, bool value); 4030 V8_DEPRECATED("Pass an isolate", static Local<Value> New(bool value)); 4031 4032 bool ValueOf() const; 4033 4034 V8_INLINE static BooleanObject* Cast(v8::Value* obj); 4035 4036 private: 4037 static void CheckCast(v8::Value* obj); 4038}; 4039 4040 4041/** 4042 * A String object (ECMA-262, 4.3.18). 4043 */ 4044class V8_EXPORT StringObject : public Object { 4045 public: 4046 static Local<Value> New(Local<String> value); 4047 4048 Local<String> ValueOf() const; 4049 4050 V8_INLINE static StringObject* Cast(v8::Value* obj); 4051 4052 private: 4053 static void CheckCast(v8::Value* obj); 4054}; 4055 4056 4057/** 4058 * A Symbol object (ECMA-262 edition 6). 4059 * 4060 * This is an experimental feature. Use at your own risk. 4061 */ 4062class V8_EXPORT SymbolObject : public Object { 4063 public: 4064 static Local<Value> New(Isolate* isolate, Local<Symbol> value); 4065 4066 Local<Symbol> ValueOf() const; 4067 4068 V8_INLINE static SymbolObject* Cast(v8::Value* obj); 4069 4070 private: 4071 static void CheckCast(v8::Value* obj); 4072}; 4073 4074 4075/** 4076 * An instance of the built-in RegExp constructor (ECMA-262, 15.10). 4077 */ 4078class V8_EXPORT RegExp : public Object { 4079 public: 4080 /** 4081 * Regular expression flag bits. They can be or'ed to enable a set 4082 * of flags. 4083 */ 4084 enum Flags { 4085 kNone = 0, 4086 kGlobal = 1, 4087 kIgnoreCase = 2, 4088 kMultiline = 4, 4089 kSticky = 8, 4090 kUnicode = 16 4091 }; 4092 4093 /** 4094 * Creates a regular expression from the given pattern string and 4095 * the flags bit field. May throw a JavaScript exception as 4096 * described in ECMA-262, 15.10.4.1. 4097 * 4098 * For example, 4099 * RegExp::New(v8::String::New("foo"), 4100 * static_cast<RegExp::Flags>(kGlobal | kMultiline)) 4101 * is equivalent to evaluating "/foo/gm". 4102 */ 4103 static V8_DEPRECATE_SOON("Use maybe version", 4104 Local<RegExp> New(Local<String> pattern, 4105 Flags flags)); 4106 static V8_WARN_UNUSED_RESULT MaybeLocal<RegExp> New(Local<Context> context, 4107 Local<String> pattern, 4108 Flags flags); 4109 4110 /** 4111 * Returns the value of the source property: a string representing 4112 * the regular expression. 4113 */ 4114 Local<String> GetSource() const; 4115 4116 /** 4117 * Returns the flags bit field. 4118 */ 4119 Flags GetFlags() const; 4120 4121 V8_INLINE static RegExp* Cast(v8::Value* obj); 4122 4123 private: 4124 static void CheckCast(v8::Value* obj); 4125}; 4126 4127 4128/** 4129 * A JavaScript value that wraps a C++ void*. This type of value is mainly used 4130 * to associate C++ data structures with JavaScript objects. 4131 */ 4132class V8_EXPORT External : public Value { 4133 public: 4134 static Local<External> New(Isolate* isolate, void* value); 4135 V8_INLINE static External* Cast(Value* obj); 4136 void* Value() const; 4137 private: 4138 static void CheckCast(v8::Value* obj); 4139}; 4140 4141 4142#define V8_INTRINSICS_LIST(F) F(ArrayProto_values, array_values_iterator) 4143 4144enum Intrinsic { 4145#define V8_DECL_INTRINSIC(name, iname) k##name, 4146 V8_INTRINSICS_LIST(V8_DECL_INTRINSIC) 4147#undef V8_DECL_INTRINSIC 4148}; 4149 4150 4151// --- Templates --- 4152 4153 4154/** 4155 * The superclass of object and function templates. 4156 */ 4157class V8_EXPORT Template : public Data { 4158 public: 4159 /** 4160 * Adds a property to each instance created by this template. 4161 * 4162 * The property must be defined either as a primitive value, or a template. 4163 */ 4164 void Set(Local<Name> name, Local<Data> value, 4165 PropertyAttribute attributes = None); 4166 V8_INLINE void Set(Isolate* isolate, const char* name, Local<Data> value); 4167 4168 void SetAccessorProperty( 4169 Local<Name> name, 4170 Local<FunctionTemplate> getter = Local<FunctionTemplate>(), 4171 Local<FunctionTemplate> setter = Local<FunctionTemplate>(), 4172 PropertyAttribute attribute = None, 4173 AccessControl settings = DEFAULT); 4174 4175 /** 4176 * Whenever the property with the given name is accessed on objects 4177 * created from this Template the getter and setter callbacks 4178 * are called instead of getting and setting the property directly 4179 * on the JavaScript object. 4180 * 4181 * \param name The name of the property for which an accessor is added. 4182 * \param getter The callback to invoke when getting the property. 4183 * \param setter The callback to invoke when setting the property. 4184 * \param data A piece of data that will be passed to the getter and setter 4185 * callbacks whenever they are invoked. 4186 * \param settings Access control settings for the accessor. This is a bit 4187 * field consisting of one of more of 4188 * DEFAULT = 0, ALL_CAN_READ = 1, or ALL_CAN_WRITE = 2. 4189 * The default is to not allow cross-context access. 4190 * ALL_CAN_READ means that all cross-context reads are allowed. 4191 * ALL_CAN_WRITE means that all cross-context writes are allowed. 4192 * The combination ALL_CAN_READ | ALL_CAN_WRITE can be used to allow all 4193 * cross-context access. 4194 * \param attribute The attributes of the property for which an accessor 4195 * is added. 4196 * \param signature The signature describes valid receivers for the accessor 4197 * and is used to perform implicit instance checks against them. If the 4198 * receiver is incompatible (i.e. is not an instance of the constructor as 4199 * defined by FunctionTemplate::HasInstance()), an implicit TypeError is 4200 * thrown and no callback is invoked. 4201 */ 4202 void SetNativeDataProperty( 4203 Local<String> name, AccessorGetterCallback getter, 4204 AccessorSetterCallback setter = 0, 4205 // TODO(dcarney): gcc can't handle Local below 4206 Local<Value> data = Local<Value>(), PropertyAttribute attribute = None, 4207 Local<AccessorSignature> signature = Local<AccessorSignature>(), 4208 AccessControl settings = DEFAULT); 4209 void SetNativeDataProperty( 4210 Local<Name> name, AccessorNameGetterCallback getter, 4211 AccessorNameSetterCallback setter = 0, 4212 // TODO(dcarney): gcc can't handle Local below 4213 Local<Value> data = Local<Value>(), PropertyAttribute attribute = None, 4214 Local<AccessorSignature> signature = Local<AccessorSignature>(), 4215 AccessControl settings = DEFAULT); 4216 4217 /** 4218 * During template instantiation, sets the value with the intrinsic property 4219 * from the correct context. 4220 */ 4221 void SetIntrinsicDataProperty(Local<Name> name, Intrinsic intrinsic, 4222 PropertyAttribute attribute = None); 4223 4224 private: 4225 Template(); 4226 4227 friend class ObjectTemplate; 4228 friend class FunctionTemplate; 4229}; 4230 4231 4232/** 4233 * NamedProperty[Getter|Setter] are used as interceptors on object. 4234 * See ObjectTemplate::SetNamedPropertyHandler. 4235 */ 4236typedef void (*NamedPropertyGetterCallback)( 4237 Local<String> property, 4238 const PropertyCallbackInfo<Value>& info); 4239 4240 4241/** 4242 * Returns the value if the setter intercepts the request. 4243 * Otherwise, returns an empty handle. 4244 */ 4245typedef void (*NamedPropertySetterCallback)( 4246 Local<String> property, 4247 Local<Value> value, 4248 const PropertyCallbackInfo<Value>& info); 4249 4250 4251/** 4252 * Returns a non-empty handle if the interceptor intercepts the request. 4253 * The result is an integer encoding property attributes (like v8::None, 4254 * v8::DontEnum, etc.) 4255 */ 4256typedef void (*NamedPropertyQueryCallback)( 4257 Local<String> property, 4258 const PropertyCallbackInfo<Integer>& info); 4259 4260 4261/** 4262 * Returns a non-empty handle if the deleter intercepts the request. 4263 * The return value is true if the property could be deleted and false 4264 * otherwise. 4265 */ 4266typedef void (*NamedPropertyDeleterCallback)( 4267 Local<String> property, 4268 const PropertyCallbackInfo<Boolean>& info); 4269 4270 4271/** 4272 * Returns an array containing the names of the properties the named 4273 * property getter intercepts. 4274 */ 4275typedef void (*NamedPropertyEnumeratorCallback)( 4276 const PropertyCallbackInfo<Array>& info); 4277 4278 4279// TODO(dcarney): Deprecate and remove previous typedefs, and replace 4280// GenericNamedPropertyFooCallback with just NamedPropertyFooCallback. 4281/** 4282 * GenericNamedProperty[Getter|Setter] are used as interceptors on object. 4283 * See ObjectTemplate::SetNamedPropertyHandler. 4284 */ 4285typedef void (*GenericNamedPropertyGetterCallback)( 4286 Local<Name> property, const PropertyCallbackInfo<Value>& info); 4287 4288 4289/** 4290 * Returns the value if the setter intercepts the request. 4291 * Otherwise, returns an empty handle. 4292 */ 4293typedef void (*GenericNamedPropertySetterCallback)( 4294 Local<Name> property, Local<Value> value, 4295 const PropertyCallbackInfo<Value>& info); 4296 4297 4298/** 4299 * Returns a non-empty handle if the interceptor intercepts the request. 4300 * The result is an integer encoding property attributes (like v8::None, 4301 * v8::DontEnum, etc.) 4302 */ 4303typedef void (*GenericNamedPropertyQueryCallback)( 4304 Local<Name> property, const PropertyCallbackInfo<Integer>& info); 4305 4306 4307/** 4308 * Returns a non-empty handle if the deleter intercepts the request. 4309 * The return value is true if the property could be deleted and false 4310 * otherwise. 4311 */ 4312typedef void (*GenericNamedPropertyDeleterCallback)( 4313 Local<Name> property, const PropertyCallbackInfo<Boolean>& info); 4314 4315 4316/** 4317 * Returns an array containing the names of the properties the named 4318 * property getter intercepts. 4319 */ 4320typedef void (*GenericNamedPropertyEnumeratorCallback)( 4321 const PropertyCallbackInfo<Array>& info); 4322 4323 4324/** 4325 * Returns the value of the property if the getter intercepts the 4326 * request. Otherwise, returns an empty handle. 4327 */ 4328typedef void (*IndexedPropertyGetterCallback)( 4329 uint32_t index, 4330 const PropertyCallbackInfo<Value>& info); 4331 4332 4333/** 4334 * Returns the value if the setter intercepts the request. 4335 * Otherwise, returns an empty handle. 4336 */ 4337typedef void (*IndexedPropertySetterCallback)( 4338 uint32_t index, 4339 Local<Value> value, 4340 const PropertyCallbackInfo<Value>& info); 4341 4342 4343/** 4344 * Returns a non-empty handle if the interceptor intercepts the request. 4345 * The result is an integer encoding property attributes. 4346 */ 4347typedef void (*IndexedPropertyQueryCallback)( 4348 uint32_t index, 4349 const PropertyCallbackInfo<Integer>& info); 4350 4351 4352/** 4353 * Returns a non-empty handle if the deleter intercepts the request. 4354 * The return value is true if the property could be deleted and false 4355 * otherwise. 4356 */ 4357typedef void (*IndexedPropertyDeleterCallback)( 4358 uint32_t index, 4359 const PropertyCallbackInfo<Boolean>& info); 4360 4361 4362/** 4363 * Returns an array containing the indices of the properties the 4364 * indexed property getter intercepts. 4365 */ 4366typedef void (*IndexedPropertyEnumeratorCallback)( 4367 const PropertyCallbackInfo<Array>& info); 4368 4369 4370/** 4371 * Access type specification. 4372 */ 4373enum AccessType { 4374 ACCESS_GET, 4375 ACCESS_SET, 4376 ACCESS_HAS, 4377 ACCESS_DELETE, 4378 ACCESS_KEYS 4379}; 4380 4381 4382/** 4383 * Returns true if the given context should be allowed to access the given 4384 * object. 4385 */ 4386typedef bool (*AccessCheckCallback)(Local<Context> accessing_context, 4387 Local<Object> accessed_object, 4388 Local<Value> data); 4389 4390/** 4391 * A FunctionTemplate is used to create functions at runtime. There 4392 * can only be one function created from a FunctionTemplate in a 4393 * context. The lifetime of the created function is equal to the 4394 * lifetime of the context. So in case the embedder needs to create 4395 * temporary functions that can be collected using Scripts is 4396 * preferred. 4397 * 4398 * Any modification of a FunctionTemplate after first instantiation will trigger 4399 *a crash. 4400 * 4401 * A FunctionTemplate can have properties, these properties are added to the 4402 * function object when it is created. 4403 * 4404 * A FunctionTemplate has a corresponding instance template which is 4405 * used to create object instances when the function is used as a 4406 * constructor. Properties added to the instance template are added to 4407 * each object instance. 4408 * 4409 * A FunctionTemplate can have a prototype template. The prototype template 4410 * is used to create the prototype object of the function. 4411 * 4412 * The following example shows how to use a FunctionTemplate: 4413 * 4414 * \code 4415 * v8::Local<v8::FunctionTemplate> t = v8::FunctionTemplate::New(); 4416 * t->Set("func_property", v8::Number::New(1)); 4417 * 4418 * v8::Local<v8::Template> proto_t = t->PrototypeTemplate(); 4419 * proto_t->Set("proto_method", v8::FunctionTemplate::New(InvokeCallback)); 4420 * proto_t->Set("proto_const", v8::Number::New(2)); 4421 * 4422 * v8::Local<v8::ObjectTemplate> instance_t = t->InstanceTemplate(); 4423 * instance_t->SetAccessor("instance_accessor", InstanceAccessorCallback); 4424 * instance_t->SetNamedPropertyHandler(PropertyHandlerCallback, ...); 4425 * instance_t->Set("instance_property", Number::New(3)); 4426 * 4427 * v8::Local<v8::Function> function = t->GetFunction(); 4428 * v8::Local<v8::Object> instance = function->NewInstance(); 4429 * \endcode 4430 * 4431 * Let's use "function" as the JS variable name of the function object 4432 * and "instance" for the instance object created above. The function 4433 * and the instance will have the following properties: 4434 * 4435 * \code 4436 * func_property in function == true; 4437 * function.func_property == 1; 4438 * 4439 * function.prototype.proto_method() invokes 'InvokeCallback' 4440 * function.prototype.proto_const == 2; 4441 * 4442 * instance instanceof function == true; 4443 * instance.instance_accessor calls 'InstanceAccessorCallback' 4444 * instance.instance_property == 3; 4445 * \endcode 4446 * 4447 * A FunctionTemplate can inherit from another one by calling the 4448 * FunctionTemplate::Inherit method. The following graph illustrates 4449 * the semantics of inheritance: 4450 * 4451 * \code 4452 * FunctionTemplate Parent -> Parent() . prototype -> { } 4453 * ^ ^ 4454 * | Inherit(Parent) | .__proto__ 4455 * | | 4456 * FunctionTemplate Child -> Child() . prototype -> { } 4457 * \endcode 4458 * 4459 * A FunctionTemplate 'Child' inherits from 'Parent', the prototype 4460 * object of the Child() function has __proto__ pointing to the 4461 * Parent() function's prototype object. An instance of the Child 4462 * function has all properties on Parent's instance templates. 4463 * 4464 * Let Parent be the FunctionTemplate initialized in the previous 4465 * section and create a Child FunctionTemplate by: 4466 * 4467 * \code 4468 * Local<FunctionTemplate> parent = t; 4469 * Local<FunctionTemplate> child = FunctionTemplate::New(); 4470 * child->Inherit(parent); 4471 * 4472 * Local<Function> child_function = child->GetFunction(); 4473 * Local<Object> child_instance = child_function->NewInstance(); 4474 * \endcode 4475 * 4476 * The Child function and Child instance will have the following 4477 * properties: 4478 * 4479 * \code 4480 * child_func.prototype.__proto__ == function.prototype; 4481 * child_instance.instance_accessor calls 'InstanceAccessorCallback' 4482 * child_instance.instance_property == 3; 4483 * \endcode 4484 */ 4485class V8_EXPORT FunctionTemplate : public Template { 4486 public: 4487 /** Creates a function template.*/ 4488 static Local<FunctionTemplate> New( 4489 Isolate* isolate, FunctionCallback callback = 0, 4490 Local<Value> data = Local<Value>(), 4491 Local<Signature> signature = Local<Signature>(), int length = 0, 4492 ConstructorBehavior behavior = ConstructorBehavior::kAllow); 4493 4494 /** Get a template included in the snapshot by index. */ 4495 static Local<FunctionTemplate> FromSnapshot(Isolate* isolate, size_t index); 4496 4497 /** 4498 * Creates a function template with a fast handler. If a fast handler is set, 4499 * the callback cannot be null. 4500 */ 4501 static Local<FunctionTemplate> NewWithFastHandler( 4502 Isolate* isolate, FunctionCallback callback, 4503 experimental::FastAccessorBuilder* fast_handler = nullptr, 4504 Local<Value> data = Local<Value>(), 4505 Local<Signature> signature = Local<Signature>(), int length = 0); 4506 4507 /** Returns the unique function instance in the current execution context.*/ 4508 V8_DEPRECATE_SOON("Use maybe version", Local<Function> GetFunction()); 4509 V8_WARN_UNUSED_RESULT MaybeLocal<Function> GetFunction( 4510 Local<Context> context); 4511 4512 /** 4513 * Set the call-handler callback for a FunctionTemplate. This 4514 * callback is called whenever the function created from this 4515 * FunctionTemplate is called. 4516 */ 4517 void SetCallHandler( 4518 FunctionCallback callback, Local<Value> data = Local<Value>(), 4519 experimental::FastAccessorBuilder* fast_handler = nullptr); 4520 4521 /** Set the predefined length property for the FunctionTemplate. */ 4522 void SetLength(int length); 4523 4524 /** Get the InstanceTemplate. */ 4525 Local<ObjectTemplate> InstanceTemplate(); 4526 4527 /** Causes the function template to inherit from a parent function template.*/ 4528 void Inherit(Local<FunctionTemplate> parent); 4529 4530 /** 4531 * A PrototypeTemplate is the template used to create the prototype object 4532 * of the function created by this template. 4533 */ 4534 Local<ObjectTemplate> PrototypeTemplate(); 4535 4536 /** 4537 * Set the class name of the FunctionTemplate. This is used for 4538 * printing objects created with the function created from the 4539 * FunctionTemplate as its constructor. 4540 */ 4541 void SetClassName(Local<String> name); 4542 4543 4544 /** 4545 * When set to true, no access check will be performed on the receiver of a 4546 * function call. Currently defaults to true, but this is subject to change. 4547 */ 4548 void SetAcceptAnyReceiver(bool value); 4549 4550 /** 4551 * Determines whether the __proto__ accessor ignores instances of 4552 * the function template. If instances of the function template are 4553 * ignored, __proto__ skips all instances and instead returns the 4554 * next object in the prototype chain. 4555 * 4556 * Call with a value of true to make the __proto__ accessor ignore 4557 * instances of the function template. Call with a value of false 4558 * to make the __proto__ accessor not ignore instances of the 4559 * function template. By default, instances of a function template 4560 * are not ignored. 4561 */ 4562 void SetHiddenPrototype(bool value); 4563 4564 /** 4565 * Sets the ReadOnly flag in the attributes of the 'prototype' property 4566 * of functions created from this FunctionTemplate to true. 4567 */ 4568 void ReadOnlyPrototype(); 4569 4570 /** 4571 * Removes the prototype property from functions created from this 4572 * FunctionTemplate. 4573 */ 4574 void RemovePrototype(); 4575 4576 /** 4577 * Returns true if the given object is an instance of this function 4578 * template. 4579 */ 4580 bool HasInstance(Local<Value> object); 4581 4582 private: 4583 FunctionTemplate(); 4584 friend class Context; 4585 friend class ObjectTemplate; 4586}; 4587 4588 4589enum class PropertyHandlerFlags { 4590 kNone = 0, 4591 // See ALL_CAN_READ above. 4592 kAllCanRead = 1, 4593 // Will not call into interceptor for properties on the receiver or prototype 4594 // chain. Currently only valid for named interceptors. 4595 kNonMasking = 1 << 1, 4596 // Will not call into interceptor for symbol lookup. Only meaningful for 4597 // named interceptors. 4598 kOnlyInterceptStrings = 1 << 2, 4599}; 4600 4601 4602struct NamedPropertyHandlerConfiguration { 4603 NamedPropertyHandlerConfiguration( 4604 /** Note: getter is required **/ 4605 GenericNamedPropertyGetterCallback getter = 0, 4606 GenericNamedPropertySetterCallback setter = 0, 4607 GenericNamedPropertyQueryCallback query = 0, 4608 GenericNamedPropertyDeleterCallback deleter = 0, 4609 GenericNamedPropertyEnumeratorCallback enumerator = 0, 4610 Local<Value> data = Local<Value>(), 4611 PropertyHandlerFlags flags = PropertyHandlerFlags::kNone) 4612 : getter(getter), 4613 setter(setter), 4614 query(query), 4615 deleter(deleter), 4616 enumerator(enumerator), 4617 data(data), 4618 flags(flags) {} 4619 4620 GenericNamedPropertyGetterCallback getter; 4621 GenericNamedPropertySetterCallback setter; 4622 GenericNamedPropertyQueryCallback query; 4623 GenericNamedPropertyDeleterCallback deleter; 4624 GenericNamedPropertyEnumeratorCallback enumerator; 4625 Local<Value> data; 4626 PropertyHandlerFlags flags; 4627}; 4628 4629 4630struct IndexedPropertyHandlerConfiguration { 4631 IndexedPropertyHandlerConfiguration( 4632 /** Note: getter is required **/ 4633 IndexedPropertyGetterCallback getter = 0, 4634 IndexedPropertySetterCallback setter = 0, 4635 IndexedPropertyQueryCallback query = 0, 4636 IndexedPropertyDeleterCallback deleter = 0, 4637 IndexedPropertyEnumeratorCallback enumerator = 0, 4638 Local<Value> data = Local<Value>(), 4639 PropertyHandlerFlags flags = PropertyHandlerFlags::kNone) 4640 : getter(getter), 4641 setter(setter), 4642 query(query), 4643 deleter(deleter), 4644 enumerator(enumerator), 4645 data(data), 4646 flags(flags) {} 4647 4648 IndexedPropertyGetterCallback getter; 4649 IndexedPropertySetterCallback setter; 4650 IndexedPropertyQueryCallback query; 4651 IndexedPropertyDeleterCallback deleter; 4652 IndexedPropertyEnumeratorCallback enumerator; 4653 Local<Value> data; 4654 PropertyHandlerFlags flags; 4655}; 4656 4657 4658/** 4659 * An ObjectTemplate is used to create objects at runtime. 4660 * 4661 * Properties added to an ObjectTemplate are added to each object 4662 * created from the ObjectTemplate. 4663 */ 4664class V8_EXPORT ObjectTemplate : public Template { 4665 public: 4666 /** Creates an ObjectTemplate. */ 4667 static Local<ObjectTemplate> New( 4668 Isolate* isolate, 4669 Local<FunctionTemplate> constructor = Local<FunctionTemplate>()); 4670 static V8_DEPRECATED("Use isolate version", Local<ObjectTemplate> New()); 4671 4672 /** Get a template included in the snapshot by index. */ 4673 static Local<ObjectTemplate> FromSnapshot(Isolate* isolate, size_t index); 4674 4675 /** Creates a new instance of this template.*/ 4676 V8_DEPRECATE_SOON("Use maybe version", Local<Object> NewInstance()); 4677 V8_WARN_UNUSED_RESULT MaybeLocal<Object> NewInstance(Local<Context> context); 4678 4679 /** 4680 * Sets an accessor on the object template. 4681 * 4682 * Whenever the property with the given name is accessed on objects 4683 * created from this ObjectTemplate the getter and setter callbacks 4684 * are called instead of getting and setting the property directly 4685 * on the JavaScript object. 4686 * 4687 * \param name The name of the property for which an accessor is added. 4688 * \param getter The callback to invoke when getting the property. 4689 * \param setter The callback to invoke when setting the property. 4690 * \param data A piece of data that will be passed to the getter and setter 4691 * callbacks whenever they are invoked. 4692 * \param settings Access control settings for the accessor. This is a bit 4693 * field consisting of one of more of 4694 * DEFAULT = 0, ALL_CAN_READ = 1, or ALL_CAN_WRITE = 2. 4695 * The default is to not allow cross-context access. 4696 * ALL_CAN_READ means that all cross-context reads are allowed. 4697 * ALL_CAN_WRITE means that all cross-context writes are allowed. 4698 * The combination ALL_CAN_READ | ALL_CAN_WRITE can be used to allow all 4699 * cross-context access. 4700 * \param attribute The attributes of the property for which an accessor 4701 * is added. 4702 * \param signature The signature describes valid receivers for the accessor 4703 * and is used to perform implicit instance checks against them. If the 4704 * receiver is incompatible (i.e. is not an instance of the constructor as 4705 * defined by FunctionTemplate::HasInstance()), an implicit TypeError is 4706 * thrown and no callback is invoked. 4707 */ 4708 void SetAccessor( 4709 Local<String> name, AccessorGetterCallback getter, 4710 AccessorSetterCallback setter = 0, Local<Value> data = Local<Value>(), 4711 AccessControl settings = DEFAULT, PropertyAttribute attribute = None, 4712 Local<AccessorSignature> signature = Local<AccessorSignature>()); 4713 void SetAccessor( 4714 Local<Name> name, AccessorNameGetterCallback getter, 4715 AccessorNameSetterCallback setter = 0, Local<Value> data = Local<Value>(), 4716 AccessControl settings = DEFAULT, PropertyAttribute attribute = None, 4717 Local<AccessorSignature> signature = Local<AccessorSignature>()); 4718 4719 /** 4720 * Sets a named property handler on the object template. 4721 * 4722 * Whenever a property whose name is a string is accessed on objects created 4723 * from this object template, the provided callback is invoked instead of 4724 * accessing the property directly on the JavaScript object. 4725 * 4726 * Note that new code should use the second version that can intercept 4727 * symbol-named properties as well as string-named properties. 4728 * 4729 * \param getter The callback to invoke when getting a property. 4730 * \param setter The callback to invoke when setting a property. 4731 * \param query The callback to invoke to check if a property is present, 4732 * and if present, get its attributes. 4733 * \param deleter The callback to invoke when deleting a property. 4734 * \param enumerator The callback to invoke to enumerate all the named 4735 * properties of an object. 4736 * \param data A piece of data that will be passed to the callbacks 4737 * whenever they are invoked. 4738 */ 4739 // TODO(dcarney): deprecate 4740 void SetNamedPropertyHandler(NamedPropertyGetterCallback getter, 4741 NamedPropertySetterCallback setter = 0, 4742 NamedPropertyQueryCallback query = 0, 4743 NamedPropertyDeleterCallback deleter = 0, 4744 NamedPropertyEnumeratorCallback enumerator = 0, 4745 Local<Value> data = Local<Value>()); 4746 void SetHandler(const NamedPropertyHandlerConfiguration& configuration); 4747 4748 /** 4749 * Sets an indexed property handler on the object template. 4750 * 4751 * Whenever an indexed property is accessed on objects created from 4752 * this object template, the provided callback is invoked instead of 4753 * accessing the property directly on the JavaScript object. 4754 * 4755 * \param getter The callback to invoke when getting a property. 4756 * \param setter The callback to invoke when setting a property. 4757 * \param query The callback to invoke to check if an object has a property. 4758 * \param deleter The callback to invoke when deleting a property. 4759 * \param enumerator The callback to invoke to enumerate all the indexed 4760 * properties of an object. 4761 * \param data A piece of data that will be passed to the callbacks 4762 * whenever they are invoked. 4763 */ 4764 void SetHandler(const IndexedPropertyHandlerConfiguration& configuration); 4765 // TODO(dcarney): deprecate 4766 void SetIndexedPropertyHandler( 4767 IndexedPropertyGetterCallback getter, 4768 IndexedPropertySetterCallback setter = 0, 4769 IndexedPropertyQueryCallback query = 0, 4770 IndexedPropertyDeleterCallback deleter = 0, 4771 IndexedPropertyEnumeratorCallback enumerator = 0, 4772 Local<Value> data = Local<Value>()) { 4773 SetHandler(IndexedPropertyHandlerConfiguration(getter, setter, query, 4774 deleter, enumerator, data)); 4775 } 4776 /** 4777 * Sets the callback to be used when calling instances created from 4778 * this template as a function. If no callback is set, instances 4779 * behave like normal JavaScript objects that cannot be called as a 4780 * function. 4781 */ 4782 void SetCallAsFunctionHandler(FunctionCallback callback, 4783 Local<Value> data = Local<Value>()); 4784 4785 /** 4786 * Mark object instances of the template as undetectable. 4787 * 4788 * In many ways, undetectable objects behave as though they are not 4789 * there. They behave like 'undefined' in conditionals and when 4790 * printed. However, properties can be accessed and called as on 4791 * normal objects. 4792 */ 4793 void MarkAsUndetectable(); 4794 4795 /** 4796 * Sets access check callback on the object template and enables access 4797 * checks. 4798 * 4799 * When accessing properties on instances of this object template, 4800 * the access check callback will be called to determine whether or 4801 * not to allow cross-context access to the properties. 4802 */ 4803 void SetAccessCheckCallback(AccessCheckCallback callback, 4804 Local<Value> data = Local<Value>()); 4805 4806 /** 4807 * Like SetAccessCheckCallback but invokes an interceptor on failed access 4808 * checks instead of looking up all-can-read properties. You can only use 4809 * either this method or SetAccessCheckCallback, but not both at the same 4810 * time. 4811 */ 4812 void SetAccessCheckCallbackAndHandler( 4813 AccessCheckCallback callback, 4814 const NamedPropertyHandlerConfiguration& named_handler, 4815 const IndexedPropertyHandlerConfiguration& indexed_handler, 4816 Local<Value> data = Local<Value>()); 4817 4818 /** 4819 * Gets the number of internal fields for objects generated from 4820 * this template. 4821 */ 4822 int InternalFieldCount(); 4823 4824 /** 4825 * Sets the number of internal fields for objects generated from 4826 * this template. 4827 */ 4828 void SetInternalFieldCount(int value); 4829 4830 private: 4831 ObjectTemplate(); 4832 static Local<ObjectTemplate> New(internal::Isolate* isolate, 4833 Local<FunctionTemplate> constructor); 4834 friend class FunctionTemplate; 4835}; 4836 4837 4838/** 4839 * A Signature specifies which receiver is valid for a function. 4840 */ 4841class V8_EXPORT Signature : public Data { 4842 public: 4843 static Local<Signature> New( 4844 Isolate* isolate, 4845 Local<FunctionTemplate> receiver = Local<FunctionTemplate>()); 4846 4847 private: 4848 Signature(); 4849}; 4850 4851 4852/** 4853 * An AccessorSignature specifies which receivers are valid parameters 4854 * to an accessor callback. 4855 */ 4856class V8_EXPORT AccessorSignature : public Data { 4857 public: 4858 static Local<AccessorSignature> New( 4859 Isolate* isolate, 4860 Local<FunctionTemplate> receiver = Local<FunctionTemplate>()); 4861 4862 private: 4863 AccessorSignature(); 4864}; 4865 4866 4867// --- Extensions --- 4868 4869class V8_EXPORT ExternalOneByteStringResourceImpl 4870 : public String::ExternalOneByteStringResource { 4871 public: 4872 ExternalOneByteStringResourceImpl() : data_(0), length_(0) {} 4873 ExternalOneByteStringResourceImpl(const char* data, size_t length) 4874 : data_(data), length_(length) {} 4875 const char* data() const { return data_; } 4876 size_t length() const { return length_; } 4877 4878 private: 4879 const char* data_; 4880 size_t length_; 4881}; 4882 4883/** 4884 * Ignore 4885 */ 4886class V8_EXPORT Extension { // NOLINT 4887 public: 4888 // Note that the strings passed into this constructor must live as long 4889 // as the Extension itself. 4890 Extension(const char* name, 4891 const char* source = 0, 4892 int dep_count = 0, 4893 const char** deps = 0, 4894 int source_length = -1); 4895 virtual ~Extension() { } 4896 virtual v8::Local<v8::FunctionTemplate> GetNativeFunctionTemplate( 4897 v8::Isolate* isolate, v8::Local<v8::String> name) { 4898 return v8::Local<v8::FunctionTemplate>(); 4899 } 4900 4901 const char* name() const { return name_; } 4902 size_t source_length() const { return source_length_; } 4903 const String::ExternalOneByteStringResource* source() const { 4904 return &source_; } 4905 int dependency_count() { return dep_count_; } 4906 const char** dependencies() { return deps_; } 4907 void set_auto_enable(bool value) { auto_enable_ = value; } 4908 bool auto_enable() { return auto_enable_; } 4909 4910 private: 4911 const char* name_; 4912 size_t source_length_; // expected to initialize before source_ 4913 ExternalOneByteStringResourceImpl source_; 4914 int dep_count_; 4915 const char** deps_; 4916 bool auto_enable_; 4917 4918 // Disallow copying and assigning. 4919 Extension(const Extension&); 4920 void operator=(const Extension&); 4921}; 4922 4923 4924void V8_EXPORT RegisterExtension(Extension* extension); 4925 4926 4927// --- Statics --- 4928 4929V8_INLINE Local<Primitive> Undefined(Isolate* isolate); 4930V8_INLINE Local<Primitive> Null(Isolate* isolate); 4931V8_INLINE Local<Boolean> True(Isolate* isolate); 4932V8_INLINE Local<Boolean> False(Isolate* isolate); 4933 4934/** 4935 * A set of constraints that specifies the limits of the runtime's memory use. 4936 * You must set the heap size before initializing the VM - the size cannot be 4937 * adjusted after the VM is initialized. 4938 * 4939 * If you are using threads then you should hold the V8::Locker lock while 4940 * setting the stack limit and you must set a non-default stack limit separately 4941 * for each thread. 4942 * 4943 * The arguments for set_max_semi_space_size, set_max_old_space_size, 4944 * set_max_executable_size, set_code_range_size specify limits in MB. 4945 */ 4946class V8_EXPORT ResourceConstraints { 4947 public: 4948 ResourceConstraints(); 4949 4950 /** 4951 * Configures the constraints with reasonable default values based on the 4952 * capabilities of the current device the VM is running on. 4953 * 4954 * \param physical_memory The total amount of physical memory on the current 4955 * device, in bytes. 4956 * \param virtual_memory_limit The amount of virtual memory on the current 4957 * device, in bytes, or zero, if there is no limit. 4958 */ 4959 void ConfigureDefaults(uint64_t physical_memory, 4960 uint64_t virtual_memory_limit); 4961 4962 int max_semi_space_size() const { return max_semi_space_size_; } 4963 void set_max_semi_space_size(int limit_in_mb) { 4964 max_semi_space_size_ = limit_in_mb; 4965 } 4966 int max_old_space_size() const { return max_old_space_size_; } 4967 void set_max_old_space_size(int limit_in_mb) { 4968 max_old_space_size_ = limit_in_mb; 4969 } 4970 int max_executable_size() const { return max_executable_size_; } 4971 void set_max_executable_size(int limit_in_mb) { 4972 max_executable_size_ = limit_in_mb; 4973 } 4974 uint32_t* stack_limit() const { return stack_limit_; } 4975 // Sets an address beyond which the VM's stack may not grow. 4976 void set_stack_limit(uint32_t* value) { stack_limit_ = value; } 4977 size_t code_range_size() const { return code_range_size_; } 4978 void set_code_range_size(size_t limit_in_mb) { 4979 code_range_size_ = limit_in_mb; 4980 } 4981 4982 private: 4983 int max_semi_space_size_; 4984 int max_old_space_size_; 4985 int max_executable_size_; 4986 uint32_t* stack_limit_; 4987 size_t code_range_size_; 4988}; 4989 4990 4991// --- Exceptions --- 4992 4993 4994typedef void (*FatalErrorCallback)(const char* location, const char* message); 4995 4996 4997typedef void (*MessageCallback)(Local<Message> message, Local<Value> error); 4998 4999// --- Tracing --- 5000 5001typedef void (*LogEventCallback)(const char* name, int event); 5002 5003/** 5004 * Create new error objects by calling the corresponding error object 5005 * constructor with the message. 5006 */ 5007class V8_EXPORT Exception { 5008 public: 5009 static Local<Value> RangeError(Local<String> message); 5010 static Local<Value> ReferenceError(Local<String> message); 5011 static Local<Value> SyntaxError(Local<String> message); 5012 static Local<Value> TypeError(Local<String> message); 5013 static Local<Value> Error(Local<String> message); 5014 5015 /** 5016 * Creates an error message for the given exception. 5017 * Will try to reconstruct the original stack trace from the exception value, 5018 * or capture the current stack trace if not available. 5019 */ 5020 static Local<Message> CreateMessage(Isolate* isolate, Local<Value> exception); 5021 V8_DEPRECATED("Use version with an Isolate*", 5022 static Local<Message> CreateMessage(Local<Value> exception)); 5023 5024 /** 5025 * Returns the original stack trace that was captured at the creation time 5026 * of a given exception, or an empty handle if not available. 5027 */ 5028 static Local<StackTrace> GetStackTrace(Local<Value> exception); 5029}; 5030 5031 5032// --- Counters Callbacks --- 5033 5034typedef int* (*CounterLookupCallback)(const char* name); 5035 5036typedef void* (*CreateHistogramCallback)(const char* name, 5037 int min, 5038 int max, 5039 size_t buckets); 5040 5041typedef void (*AddHistogramSampleCallback)(void* histogram, int sample); 5042 5043// --- Memory Allocation Callback --- 5044enum ObjectSpace { 5045 kObjectSpaceNewSpace = 1 << 0, 5046 kObjectSpaceOldSpace = 1 << 1, 5047 kObjectSpaceCodeSpace = 1 << 2, 5048 kObjectSpaceMapSpace = 1 << 3, 5049 kObjectSpaceLoSpace = 1 << 4, 5050 kObjectSpaceAll = kObjectSpaceNewSpace | kObjectSpaceOldSpace | 5051 kObjectSpaceCodeSpace | kObjectSpaceMapSpace | 5052 kObjectSpaceLoSpace 5053}; 5054 5055 enum AllocationAction { 5056 kAllocationActionAllocate = 1 << 0, 5057 kAllocationActionFree = 1 << 1, 5058 kAllocationActionAll = kAllocationActionAllocate | kAllocationActionFree 5059 }; 5060 5061// --- Enter/Leave Script Callback --- 5062typedef void (*BeforeCallEnteredCallback)(Isolate*); 5063typedef void (*CallCompletedCallback)(Isolate*); 5064typedef void (*DeprecatedCallCompletedCallback)(); 5065 5066// --- Promise Reject Callback --- 5067enum PromiseRejectEvent { 5068 kPromiseRejectWithNoHandler = 0, 5069 kPromiseHandlerAddedAfterReject = 1 5070}; 5071 5072class PromiseRejectMessage { 5073 public: 5074 PromiseRejectMessage(Local<Promise> promise, PromiseRejectEvent event, 5075 Local<Value> value, Local<StackTrace> stack_trace) 5076 : promise_(promise), 5077 event_(event), 5078 value_(value), 5079 stack_trace_(stack_trace) {} 5080 5081 V8_INLINE Local<Promise> GetPromise() const { return promise_; } 5082 V8_INLINE PromiseRejectEvent GetEvent() const { return event_; } 5083 V8_INLINE Local<Value> GetValue() const { return value_; } 5084 5085 V8_DEPRECATED("Use v8::Exception::CreateMessage(GetValue())->GetStackTrace()", 5086 V8_INLINE Local<StackTrace> GetStackTrace() const) { 5087 return stack_trace_; 5088 } 5089 5090 private: 5091 Local<Promise> promise_; 5092 PromiseRejectEvent event_; 5093 Local<Value> value_; 5094 Local<StackTrace> stack_trace_; 5095}; 5096 5097typedef void (*PromiseRejectCallback)(PromiseRejectMessage message); 5098 5099// --- Microtasks Callbacks --- 5100typedef void (*MicrotasksCompletedCallback)(Isolate*); 5101typedef void (*MicrotaskCallback)(void* data); 5102 5103 5104/** 5105 * Policy for running microtasks: 5106 * - explicit: microtasks are invoked with Isolate::RunMicrotasks() method; 5107 * - scoped: microtasks invocation is controlled by MicrotasksScope objects; 5108 * - auto: microtasks are invoked when the script call depth decrements 5109 * to zero. 5110 */ 5111enum class MicrotasksPolicy { kExplicit, kScoped, kAuto }; 5112 5113 5114/** 5115 * This scope is used to control microtasks when kScopeMicrotasksInvocation 5116 * is used on Isolate. In this mode every non-primitive call to V8 should be 5117 * done inside some MicrotasksScope. 5118 * Microtasks are executed when topmost MicrotasksScope marked as kRunMicrotasks 5119 * exits. 5120 * kDoNotRunMicrotasks should be used to annotate calls not intended to trigger 5121 * microtasks. 5122 */ 5123class V8_EXPORT MicrotasksScope { 5124 public: 5125 enum Type { kRunMicrotasks, kDoNotRunMicrotasks }; 5126 5127 MicrotasksScope(Isolate* isolate, Type type); 5128 ~MicrotasksScope(); 5129 5130 /** 5131 * Runs microtasks if no kRunMicrotasks scope is currently active. 5132 */ 5133 static void PerformCheckpoint(Isolate* isolate); 5134 5135 /** 5136 * Returns current depth of nested kRunMicrotasks scopes. 5137 */ 5138 static int GetCurrentDepth(Isolate* isolate); 5139 5140 /** 5141 * Returns true while microtasks are being executed. 5142 */ 5143 static bool IsRunningMicrotasks(Isolate* isolate); 5144 5145 private: 5146 internal::Isolate* const isolate_; 5147 bool run_; 5148 5149 // Prevent copying. 5150 MicrotasksScope(const MicrotasksScope&); 5151 MicrotasksScope& operator=(const MicrotasksScope&); 5152}; 5153 5154 5155// --- Failed Access Check Callback --- 5156typedef void (*FailedAccessCheckCallback)(Local<Object> target, 5157 AccessType type, 5158 Local<Value> data); 5159 5160// --- AllowCodeGenerationFromStrings callbacks --- 5161 5162/** 5163 * Callback to check if code generation from strings is allowed. See 5164 * Context::AllowCodeGenerationFromStrings. 5165 */ 5166typedef bool (*AllowCodeGenerationFromStringsCallback)(Local<Context> context); 5167 5168// --- Garbage Collection Callbacks --- 5169 5170/** 5171 * Applications can register callback functions which will be called before and 5172 * after certain garbage collection operations. Allocations are not allowed in 5173 * the callback functions, you therefore cannot manipulate objects (set or 5174 * delete properties for example) since it is possible such operations will 5175 * result in the allocation of objects. 5176 */ 5177enum GCType { 5178 kGCTypeScavenge = 1 << 0, 5179 kGCTypeMarkSweepCompact = 1 << 1, 5180 kGCTypeIncrementalMarking = 1 << 2, 5181 kGCTypeProcessWeakCallbacks = 1 << 3, 5182 kGCTypeAll = kGCTypeScavenge | kGCTypeMarkSweepCompact | 5183 kGCTypeIncrementalMarking | kGCTypeProcessWeakCallbacks 5184}; 5185 5186/** 5187 * GCCallbackFlags is used to notify additional information about the GC 5188 * callback. 5189 * - kGCCallbackFlagConstructRetainedObjectInfos: The GC callback is for 5190 * constructing retained object infos. 5191 * - kGCCallbackFlagForced: The GC callback is for a forced GC for testing. 5192 * - kGCCallbackFlagSynchronousPhantomCallbackProcessing: The GC callback 5193 * is called synchronously without getting posted to an idle task. 5194 * - kGCCallbackFlagCollectAllAvailableGarbage: The GC callback is called 5195 * in a phase where V8 is trying to collect all available garbage 5196 * (e.g., handling a low memory notification). 5197 */ 5198enum GCCallbackFlags { 5199 kNoGCCallbackFlags = 0, 5200 kGCCallbackFlagConstructRetainedObjectInfos = 1 << 1, 5201 kGCCallbackFlagForced = 1 << 2, 5202 kGCCallbackFlagSynchronousPhantomCallbackProcessing = 1 << 3, 5203 kGCCallbackFlagCollectAllAvailableGarbage = 1 << 4, 5204}; 5205 5206typedef void (*GCCallback)(GCType type, GCCallbackFlags flags); 5207 5208typedef void (*InterruptCallback)(Isolate* isolate, void* data); 5209 5210 5211/** 5212 * Collection of V8 heap information. 5213 * 5214 * Instances of this class can be passed to v8::V8::HeapStatistics to 5215 * get heap statistics from V8. 5216 */ 5217class V8_EXPORT HeapStatistics { 5218 public: 5219 HeapStatistics(); 5220 size_t total_heap_size() { return total_heap_size_; } 5221 size_t total_heap_size_executable() { return total_heap_size_executable_; } 5222 size_t total_physical_size() { return total_physical_size_; } 5223 size_t total_available_size() { return total_available_size_; } 5224 size_t used_heap_size() { return used_heap_size_; } 5225 size_t heap_size_limit() { return heap_size_limit_; } 5226 size_t malloced_memory() { return malloced_memory_; } 5227 size_t does_zap_garbage() { return does_zap_garbage_; } 5228 5229 private: 5230 size_t total_heap_size_; 5231 size_t total_heap_size_executable_; 5232 size_t total_physical_size_; 5233 size_t total_available_size_; 5234 size_t used_heap_size_; 5235 size_t heap_size_limit_; 5236 size_t malloced_memory_; 5237 bool does_zap_garbage_; 5238 5239 friend class V8; 5240 friend class Isolate; 5241}; 5242 5243 5244class V8_EXPORT HeapSpaceStatistics { 5245 public: 5246 HeapSpaceStatistics(); 5247 const char* space_name() { return space_name_; } 5248 size_t space_size() { return space_size_; } 5249 size_t space_used_size() { return space_used_size_; } 5250 size_t space_available_size() { return space_available_size_; } 5251 size_t physical_space_size() { return physical_space_size_; } 5252 5253 private: 5254 const char* space_name_; 5255 size_t space_size_; 5256 size_t space_used_size_; 5257 size_t space_available_size_; 5258 size_t physical_space_size_; 5259 5260 friend class Isolate; 5261}; 5262 5263 5264class V8_EXPORT HeapObjectStatistics { 5265 public: 5266 HeapObjectStatistics(); 5267 const char* object_type() { return object_type_; } 5268 const char* object_sub_type() { return object_sub_type_; } 5269 size_t object_count() { return object_count_; } 5270 size_t object_size() { return object_size_; } 5271 5272 private: 5273 const char* object_type_; 5274 const char* object_sub_type_; 5275 size_t object_count_; 5276 size_t object_size_; 5277 5278 friend class Isolate; 5279}; 5280 5281class V8_EXPORT HeapCodeStatistics { 5282 public: 5283 HeapCodeStatistics(); 5284 size_t code_and_metadata_size() { return code_and_metadata_size_; } 5285 size_t bytecode_and_metadata_size() { return bytecode_and_metadata_size_; } 5286 5287 private: 5288 size_t code_and_metadata_size_; 5289 size_t bytecode_and_metadata_size_; 5290 5291 friend class Isolate; 5292}; 5293 5294class RetainedObjectInfo; 5295 5296 5297/** 5298 * FunctionEntryHook is the type of the profile entry hook called at entry to 5299 * any generated function when function-level profiling is enabled. 5300 * 5301 * \param function the address of the function that's being entered. 5302 * \param return_addr_location points to a location on stack where the machine 5303 * return address resides. This can be used to identify the caller of 5304 * \p function, and/or modified to divert execution when \p function exits. 5305 * 5306 * \note the entry hook must not cause garbage collection. 5307 */ 5308typedef void (*FunctionEntryHook)(uintptr_t function, 5309 uintptr_t return_addr_location); 5310 5311/** 5312 * A JIT code event is issued each time code is added, moved or removed. 5313 * 5314 * \note removal events are not currently issued. 5315 */ 5316struct JitCodeEvent { 5317 enum EventType { 5318 CODE_ADDED, 5319 CODE_MOVED, 5320 CODE_REMOVED, 5321 CODE_ADD_LINE_POS_INFO, 5322 CODE_START_LINE_INFO_RECORDING, 5323 CODE_END_LINE_INFO_RECORDING 5324 }; 5325 // Definition of the code position type. The "POSITION" type means the place 5326 // in the source code which are of interest when making stack traces to 5327 // pin-point the source location of a stack frame as close as possible. 5328 // The "STATEMENT_POSITION" means the place at the beginning of each 5329 // statement, and is used to indicate possible break locations. 5330 enum PositionType { POSITION, STATEMENT_POSITION }; 5331 5332 // Type of event. 5333 EventType type; 5334 // Start of the instructions. 5335 void* code_start; 5336 // Size of the instructions. 5337 size_t code_len; 5338 // Script info for CODE_ADDED event. 5339 Local<UnboundScript> script; 5340 // User-defined data for *_LINE_INFO_* event. It's used to hold the source 5341 // code line information which is returned from the 5342 // CODE_START_LINE_INFO_RECORDING event. And it's passed to subsequent 5343 // CODE_ADD_LINE_POS_INFO and CODE_END_LINE_INFO_RECORDING events. 5344 void* user_data; 5345 5346 struct name_t { 5347 // Name of the object associated with the code, note that the string is not 5348 // zero-terminated. 5349 const char* str; 5350 // Number of chars in str. 5351 size_t len; 5352 }; 5353 5354 struct line_info_t { 5355 // PC offset 5356 size_t offset; 5357 // Code postion 5358 size_t pos; 5359 // The position type. 5360 PositionType position_type; 5361 }; 5362 5363 union { 5364 // Only valid for CODE_ADDED. 5365 struct name_t name; 5366 5367 // Only valid for CODE_ADD_LINE_POS_INFO 5368 struct line_info_t line_info; 5369 5370 // New location of instructions. Only valid for CODE_MOVED. 5371 void* new_code_start; 5372 }; 5373}; 5374 5375/** 5376 * Option flags passed to the SetRAILMode function. 5377 * See documentation https://developers.google.com/web/tools/chrome-devtools/ 5378 * profile/evaluate-performance/rail 5379 */ 5380enum RAILMode { 5381 // Default performance mode: V8 will optimize for both latency and 5382 // throughput in this mode. 5383 PERFORMANCE_DEFAULT, 5384 // Response performance mode: In this mode very low virtual machine latency 5385 // is provided. V8 will try to avoid JavaScript execution interruptions. 5386 // Throughput may be throttled. 5387 PERFORMANCE_RESPONSE, 5388 // Animation performance mode: In this mode low virtual machine latency is 5389 // provided. V8 will try to avoid as many JavaScript execution interruptions 5390 // as possible. Throughput may be throttled 5391 PERFORMANCE_ANIMATION, 5392 // Idle performance mode: The embedder is idle. V8 can complete deferred work 5393 // in this mode. 5394 PERFORMANCE_IDLE, 5395 // Load performance mode: In this mode high throughput is provided. V8 may 5396 // turn off latency optimizations. 5397 PERFORMANCE_LOAD 5398}; 5399 5400/** 5401 * Option flags passed to the SetJitCodeEventHandler function. 5402 */ 5403enum JitCodeEventOptions { 5404 kJitCodeEventDefault = 0, 5405 // Generate callbacks for already existent code. 5406 kJitCodeEventEnumExisting = 1 5407}; 5408 5409 5410/** 5411 * Callback function passed to SetJitCodeEventHandler. 5412 * 5413 * \param event code add, move or removal event. 5414 */ 5415typedef void (*JitCodeEventHandler)(const JitCodeEvent* event); 5416 5417 5418/** 5419 * Interface for iterating through all external resources in the heap. 5420 */ 5421class V8_EXPORT ExternalResourceVisitor { // NOLINT 5422 public: 5423 virtual ~ExternalResourceVisitor() {} 5424 virtual void VisitExternalString(Local<String> string) {} 5425}; 5426 5427 5428/** 5429 * Interface for iterating through all the persistent handles in the heap. 5430 */ 5431class V8_EXPORT PersistentHandleVisitor { // NOLINT 5432 public: 5433 virtual ~PersistentHandleVisitor() {} 5434 virtual void VisitPersistentHandle(Persistent<Value>* value, 5435 uint16_t class_id) {} 5436}; 5437 5438/** 5439 * Memory pressure level for the MemoryPressureNotification. 5440 * kNone hints V8 that there is no memory pressure. 5441 * kModerate hints V8 to speed up incremental garbage collection at the cost of 5442 * of higher latency due to garbage collection pauses. 5443 * kCritical hints V8 to free memory as soon as possible. Garbage collection 5444 * pauses at this level will be large. 5445 */ 5446enum class MemoryPressureLevel { kNone, kModerate, kCritical }; 5447 5448/** 5449 * Interface for tracing through the embedder heap. During the v8 garbage 5450 * collection, v8 collects hidden fields of all potential wrappers, and at the 5451 * end of its marking phase iterates the collection and asks the embedder to 5452 * trace through its heap and call PersistentBase::RegisterExternalReference on 5453 * each js object reachable from any of the given wrappers. 5454 * 5455 * Before the first call to the TraceWrappersFrom function TracePrologue will be 5456 * called. When the garbage collection cycle is finished, TraceEpilogue will be 5457 * called. 5458 */ 5459class V8_EXPORT EmbedderHeapTracer { 5460 public: 5461 enum ForceCompletionAction { FORCE_COMPLETION, DO_NOT_FORCE_COMPLETION }; 5462 struct AdvanceTracingActions { 5463 explicit AdvanceTracingActions(ForceCompletionAction force_completion_) 5464 : force_completion(force_completion_) {} 5465 5466 ForceCompletionAction force_completion; 5467 }; 5468 /** 5469 * V8 will call this method with internal fields of found wrappers. 5470 * Embedder is expected to store them in it's marking deque and trace 5471 * reachable wrappers from them when asked by AdvanceTracing method. 5472 */ 5473 virtual void RegisterV8References( 5474 const std::vector<std::pair<void*, void*> >& internal_fields) = 0; 5475 /** 5476 * V8 will call this method at the beginning of the gc cycle. 5477 */ 5478 virtual void TracePrologue() = 0; 5479 /** 5480 * Embedder is expected to trace its heap starting from wrappers reported by 5481 * RegisterV8References method, and call 5482 * PersistentBase::RegisterExternalReference() on all reachable wrappers. 5483 * Embedder is expected to stop tracing by the given deadline. 5484 * 5485 * Returns true if there is still work to do. 5486 */ 5487 virtual bool AdvanceTracing(double deadline_in_ms, 5488 AdvanceTracingActions actions) = 0; 5489 /** 5490 * V8 will call this method at the end of the gc cycle. Allocation is *not* 5491 * allowed in the TraceEpilogue. 5492 */ 5493 virtual void TraceEpilogue() = 0; 5494 5495 /** 5496 * Let embedder know v8 entered final marking pause (no more incremental steps 5497 * will follow). 5498 */ 5499 virtual void EnterFinalPause() {} 5500 5501 /** 5502 * Throw away all intermediate data and reset to the initial state. 5503 */ 5504 virtual void AbortTracing() {} 5505 5506 protected: 5507 virtual ~EmbedderHeapTracer() = default; 5508}; 5509 5510/** 5511 * Isolate represents an isolated instance of the V8 engine. V8 isolates have 5512 * completely separate states. Objects from one isolate must not be used in 5513 * other isolates. The embedder can create multiple isolates and use them in 5514 * parallel in multiple threads. An isolate can be entered by at most one 5515 * thread at any given time. The Locker/Unlocker API must be used to 5516 * synchronize. 5517 */ 5518class V8_EXPORT Isolate { 5519 public: 5520 /** 5521 * Initial configuration parameters for a new Isolate. 5522 */ 5523 struct CreateParams { 5524 CreateParams() 5525 : entry_hook(nullptr), 5526 code_event_handler(nullptr), 5527 snapshot_blob(nullptr), 5528 counter_lookup_callback(nullptr), 5529 create_histogram_callback(nullptr), 5530 add_histogram_sample_callback(nullptr), 5531 array_buffer_allocator(nullptr), 5532 external_references(nullptr) {} 5533 5534 /** 5535 * The optional entry_hook allows the host application to provide the 5536 * address of a function that's invoked on entry to every V8-generated 5537 * function. Note that entry_hook is invoked at the very start of each 5538 * generated function. Furthermore, if an entry_hook is given, V8 will 5539 * not use a snapshot, including custom snapshots. 5540 */ 5541 FunctionEntryHook entry_hook; 5542 5543 /** 5544 * Allows the host application to provide the address of a function that is 5545 * notified each time code is added, moved or removed. 5546 */ 5547 JitCodeEventHandler code_event_handler; 5548 5549 /** 5550 * ResourceConstraints to use for the new Isolate. 5551 */ 5552 ResourceConstraints constraints; 5553 5554 /** 5555 * Explicitly specify a startup snapshot blob. The embedder owns the blob. 5556 */ 5557 StartupData* snapshot_blob; 5558 5559 5560 /** 5561 * Enables the host application to provide a mechanism for recording 5562 * statistics counters. 5563 */ 5564 CounterLookupCallback counter_lookup_callback; 5565 5566 /** 5567 * Enables the host application to provide a mechanism for recording 5568 * histograms. The CreateHistogram function returns a 5569 * histogram which will later be passed to the AddHistogramSample 5570 * function. 5571 */ 5572 CreateHistogramCallback create_histogram_callback; 5573 AddHistogramSampleCallback add_histogram_sample_callback; 5574 5575 /** 5576 * The ArrayBuffer::Allocator to use for allocating and freeing the backing 5577 * store of ArrayBuffers. 5578 */ 5579 ArrayBuffer::Allocator* array_buffer_allocator; 5580 5581 /** 5582 * Specifies an optional nullptr-terminated array of raw addresses in the 5583 * embedder that V8 can match against during serialization and use for 5584 * deserialization. This array and its content must stay valid for the 5585 * entire lifetime of the isolate. 5586 */ 5587 intptr_t* external_references; 5588 }; 5589 5590 5591 /** 5592 * Stack-allocated class which sets the isolate for all operations 5593 * executed within a local scope. 5594 */ 5595 class V8_EXPORT Scope { 5596 public: 5597 explicit Scope(Isolate* isolate) : isolate_(isolate) { 5598 isolate->Enter(); 5599 } 5600 5601 ~Scope() { isolate_->Exit(); } 5602 5603 private: 5604 Isolate* const isolate_; 5605 5606 // Prevent copying of Scope objects. 5607 Scope(const Scope&); 5608 Scope& operator=(const Scope&); 5609 }; 5610 5611 5612 /** 5613 * Assert that no Javascript code is invoked. 5614 */ 5615 class V8_EXPORT DisallowJavascriptExecutionScope { 5616 public: 5617 enum OnFailure { CRASH_ON_FAILURE, THROW_ON_FAILURE }; 5618 5619 DisallowJavascriptExecutionScope(Isolate* isolate, OnFailure on_failure); 5620 ~DisallowJavascriptExecutionScope(); 5621 5622 private: 5623 bool on_failure_; 5624 void* internal_; 5625 5626 // Prevent copying of Scope objects. 5627 DisallowJavascriptExecutionScope(const DisallowJavascriptExecutionScope&); 5628 DisallowJavascriptExecutionScope& operator=( 5629 const DisallowJavascriptExecutionScope&); 5630 }; 5631 5632 5633 /** 5634 * Introduce exception to DisallowJavascriptExecutionScope. 5635 */ 5636 class V8_EXPORT AllowJavascriptExecutionScope { 5637 public: 5638 explicit AllowJavascriptExecutionScope(Isolate* isolate); 5639 ~AllowJavascriptExecutionScope(); 5640 5641 private: 5642 void* internal_throws_; 5643 void* internal_assert_; 5644 5645 // Prevent copying of Scope objects. 5646 AllowJavascriptExecutionScope(const AllowJavascriptExecutionScope&); 5647 AllowJavascriptExecutionScope& operator=( 5648 const AllowJavascriptExecutionScope&); 5649 }; 5650 5651 /** 5652 * Do not run microtasks while this scope is active, even if microtasks are 5653 * automatically executed otherwise. 5654 */ 5655 class V8_EXPORT SuppressMicrotaskExecutionScope { 5656 public: 5657 explicit SuppressMicrotaskExecutionScope(Isolate* isolate); 5658 ~SuppressMicrotaskExecutionScope(); 5659 5660 private: 5661 internal::Isolate* isolate_; 5662 5663 // Prevent copying of Scope objects. 5664 SuppressMicrotaskExecutionScope(const SuppressMicrotaskExecutionScope&); 5665 SuppressMicrotaskExecutionScope& operator=( 5666 const SuppressMicrotaskExecutionScope&); 5667 }; 5668 5669 /** 5670 * Types of garbage collections that can be requested via 5671 * RequestGarbageCollectionForTesting. 5672 */ 5673 enum GarbageCollectionType { 5674 kFullGarbageCollection, 5675 kMinorGarbageCollection 5676 }; 5677 5678 /** 5679 * Features reported via the SetUseCounterCallback callback. Do not change 5680 * assigned numbers of existing items; add new features to the end of this 5681 * list. 5682 */ 5683 enum UseCounterFeature { 5684 kUseAsm = 0, 5685 kBreakIterator = 1, 5686 kLegacyConst = 2, 5687 kMarkDequeOverflow = 3, 5688 kStoreBufferOverflow = 4, 5689 kSlotsBufferOverflow = 5, 5690 kObjectObserve = 6, 5691 kForcedGC = 7, 5692 kSloppyMode = 8, 5693 kStrictMode = 9, 5694 kStrongMode = 10, 5695 kRegExpPrototypeStickyGetter = 11, 5696 kRegExpPrototypeToString = 12, 5697 kRegExpPrototypeUnicodeGetter = 13, 5698 kIntlV8Parse = 14, 5699 kIntlPattern = 15, 5700 kIntlResolved = 16, 5701 kPromiseChain = 17, 5702 kPromiseAccept = 18, 5703 kPromiseDefer = 19, 5704 kHtmlCommentInExternalScript = 20, 5705 kHtmlComment = 21, 5706 kSloppyModeBlockScopedFunctionRedefinition = 22, 5707 kForInInitializer = 23, 5708 kArrayProtectorDirtied = 24, 5709 kArraySpeciesModified = 25, 5710 kArrayPrototypeConstructorModified = 26, 5711 kArrayInstanceProtoModified = 27, 5712 kArrayInstanceConstructorModified = 28, 5713 kLegacyFunctionDeclaration = 29, 5714 kRegExpPrototypeSourceGetter = 30, 5715 kRegExpPrototypeOldFlagGetter = 31, 5716 kDecimalWithLeadingZeroInStrictMode = 32, 5717 kLegacyDateParser = 33, 5718 kDefineGetterOrSetterWouldThrow = 34, 5719 5720 // If you add new values here, you'll also need to update Chromium's: 5721 // UseCounter.h, V8PerIsolateData.cpp, histograms.xml 5722 kUseCounterFeatureCount // This enum value must be last. 5723 }; 5724 5725 typedef void (*UseCounterCallback)(Isolate* isolate, 5726 UseCounterFeature feature); 5727 5728 5729 /** 5730 * Creates a new isolate. Does not change the currently entered 5731 * isolate. 5732 * 5733 * When an isolate is no longer used its resources should be freed 5734 * by calling Dispose(). Using the delete operator is not allowed. 5735 * 5736 * V8::Initialize() must have run prior to this. 5737 */ 5738 static Isolate* New(const CreateParams& params); 5739 5740 /** 5741 * Returns the entered isolate for the current thread or NULL in 5742 * case there is no current isolate. 5743 * 5744 * This method must not be invoked before V8::Initialize() was invoked. 5745 */ 5746 static Isolate* GetCurrent(); 5747 5748 /** 5749 * Custom callback used by embedders to help V8 determine if it should abort 5750 * when it throws and no internal handler is predicted to catch the 5751 * exception. If --abort-on-uncaught-exception is used on the command line, 5752 * then V8 will abort if either: 5753 * - no custom callback is set. 5754 * - the custom callback set returns true. 5755 * Otherwise, the custom callback will not be called and V8 will not abort. 5756 */ 5757 typedef bool (*AbortOnUncaughtExceptionCallback)(Isolate*); 5758 void SetAbortOnUncaughtExceptionCallback( 5759 AbortOnUncaughtExceptionCallback callback); 5760 5761 /** 5762 * Optional notification that the system is running low on memory. 5763 * V8 uses these notifications to guide heuristics. 5764 * It is allowed to call this function from another thread while 5765 * the isolate is executing long running JavaScript code. 5766 */ 5767 void MemoryPressureNotification(MemoryPressureLevel level); 5768 5769 /** 5770 * Methods below this point require holding a lock (using Locker) in 5771 * a multi-threaded environment. 5772 */ 5773 5774 /** 5775 * Sets this isolate as the entered one for the current thread. 5776 * Saves the previously entered one (if any), so that it can be 5777 * restored when exiting. Re-entering an isolate is allowed. 5778 */ 5779 void Enter(); 5780 5781 /** 5782 * Exits this isolate by restoring the previously entered one in the 5783 * current thread. The isolate may still stay the same, if it was 5784 * entered more than once. 5785 * 5786 * Requires: this == Isolate::GetCurrent(). 5787 */ 5788 void Exit(); 5789 5790 /** 5791 * Disposes the isolate. The isolate must not be entered by any 5792 * thread to be disposable. 5793 */ 5794 void Dispose(); 5795 5796 /** 5797 * Discards all V8 thread-specific data for the Isolate. Should be used 5798 * if a thread is terminating and it has used an Isolate that will outlive 5799 * the thread -- all thread-specific data for an Isolate is discarded when 5800 * an Isolate is disposed so this call is pointless if an Isolate is about 5801 * to be Disposed. 5802 */ 5803 void DiscardThreadSpecificMetadata(); 5804 5805 /** 5806 * Associate embedder-specific data with the isolate. |slot| has to be 5807 * between 0 and GetNumberOfDataSlots() - 1. 5808 */ 5809 V8_INLINE void SetData(uint32_t slot, void* data); 5810 5811 /** 5812 * Retrieve embedder-specific data from the isolate. 5813 * Returns NULL if SetData has never been called for the given |slot|. 5814 */ 5815 V8_INLINE void* GetData(uint32_t slot); 5816 5817 /** 5818 * Returns the maximum number of available embedder data slots. Valid slots 5819 * are in the range of 0 - GetNumberOfDataSlots() - 1. 5820 */ 5821 V8_INLINE static uint32_t GetNumberOfDataSlots(); 5822 5823 /** 5824 * Get statistics about the heap memory usage. 5825 */ 5826 void GetHeapStatistics(HeapStatistics* heap_statistics); 5827 5828 /** 5829 * Returns the number of spaces in the heap. 5830 */ 5831 size_t NumberOfHeapSpaces(); 5832 5833 /** 5834 * Get the memory usage of a space in the heap. 5835 * 5836 * \param space_statistics The HeapSpaceStatistics object to fill in 5837 * statistics. 5838 * \param index The index of the space to get statistics from, which ranges 5839 * from 0 to NumberOfHeapSpaces() - 1. 5840 * \returns true on success. 5841 */ 5842 bool GetHeapSpaceStatistics(HeapSpaceStatistics* space_statistics, 5843 size_t index); 5844 5845 /** 5846 * Returns the number of types of objects tracked in the heap at GC. 5847 */ 5848 size_t NumberOfTrackedHeapObjectTypes(); 5849 5850 /** 5851 * Get statistics about objects in the heap. 5852 * 5853 * \param object_statistics The HeapObjectStatistics object to fill in 5854 * statistics of objects of given type, which were live in the previous GC. 5855 * \param type_index The index of the type of object to fill details about, 5856 * which ranges from 0 to NumberOfTrackedHeapObjectTypes() - 1. 5857 * \returns true on success. 5858 */ 5859 bool GetHeapObjectStatisticsAtLastGC(HeapObjectStatistics* object_statistics, 5860 size_t type_index); 5861 5862 /** 5863 * Get statistics about code and its metadata in the heap. 5864 * 5865 * \param object_statistics The HeapCodeStatistics object to fill in 5866 * statistics of code, bytecode and their metadata. 5867 * \returns true on success. 5868 */ 5869 bool GetHeapCodeAndMetadataStatistics(HeapCodeStatistics* object_statistics); 5870 5871 /** 5872 * Get a call stack sample from the isolate. 5873 * \param state Execution state. 5874 * \param frames Caller allocated buffer to store stack frames. 5875 * \param frames_limit Maximum number of frames to capture. The buffer must 5876 * be large enough to hold the number of frames. 5877 * \param sample_info The sample info is filled up by the function 5878 * provides number of actual captured stack frames and 5879 * the current VM state. 5880 * \note GetStackSample should only be called when the JS thread is paused or 5881 * interrupted. Otherwise the behavior is undefined. 5882 */ 5883 void GetStackSample(const RegisterState& state, void** frames, 5884 size_t frames_limit, SampleInfo* sample_info); 5885 5886 /** 5887 * Adjusts the amount of registered external memory. Used to give V8 an 5888 * indication of the amount of externally allocated memory that is kept alive 5889 * by JavaScript objects. V8 uses this to decide when to perform global 5890 * garbage collections. Registering externally allocated memory will trigger 5891 * global garbage collections more often than it would otherwise in an attempt 5892 * to garbage collect the JavaScript objects that keep the externally 5893 * allocated memory alive. 5894 * 5895 * \param change_in_bytes the change in externally allocated memory that is 5896 * kept alive by JavaScript objects. 5897 * \returns the adjusted value. 5898 */ 5899 V8_INLINE int64_t 5900 AdjustAmountOfExternalAllocatedMemory(int64_t change_in_bytes); 5901 5902 /** 5903 * Returns the number of phantom handles without callbacks that were reset 5904 * by the garbage collector since the last call to this function. 5905 */ 5906 size_t NumberOfPhantomHandleResetsSinceLastCall(); 5907 5908 /** 5909 * Returns heap profiler for this isolate. Will return NULL until the isolate 5910 * is initialized. 5911 */ 5912 HeapProfiler* GetHeapProfiler(); 5913 5914 /** 5915 * Returns CPU profiler for this isolate. Will return NULL unless the isolate 5916 * is initialized. It is the embedder's responsibility to stop all CPU 5917 * profiling activities if it has started any. 5918 */ 5919 CpuProfiler* GetCpuProfiler(); 5920 5921 /** Returns true if this isolate has a current context. */ 5922 bool InContext(); 5923 5924 /** 5925 * Returns the context of the currently running JavaScript, or the context 5926 * on the top of the stack if no JavaScript is running. 5927 */ 5928 Local<Context> GetCurrentContext(); 5929 5930 /** 5931 * Returns the context of the calling JavaScript code. That is the 5932 * context of the top-most JavaScript frame. If there are no 5933 * JavaScript frames an empty handle is returned. 5934 */ 5935 V8_DEPRECATE_SOON( 5936 "Calling context concept is not compatible with tail calls, and will be " 5937 "removed.", 5938 Local<Context> GetCallingContext()); 5939 5940 /** Returns the last context entered through V8's C++ API. */ 5941 Local<Context> GetEnteredContext(); 5942 5943 /** 5944 * Schedules an exception to be thrown when returning to JavaScript. When an 5945 * exception has been scheduled it is illegal to invoke any JavaScript 5946 * operation; the caller must return immediately and only after the exception 5947 * has been handled does it become legal to invoke JavaScript operations. 5948 */ 5949 Local<Value> ThrowException(Local<Value> exception); 5950 5951 /** 5952 * Allows the host application to group objects together. If one 5953 * object in the group is alive, all objects in the group are alive. 5954 * After each garbage collection, object groups are removed. It is 5955 * intended to be used in the before-garbage-collection callback 5956 * function, for instance to simulate DOM tree connections among JS 5957 * wrapper objects. Object groups for all dependent handles need to 5958 * be provided for kGCTypeMarkSweepCompact collections, for all other 5959 * garbage collection types it is sufficient to provide object groups 5960 * for partially dependent handles only. 5961 */ 5962 template<typename T> void SetObjectGroupId(const Persistent<T>& object, 5963 UniqueId id); 5964 5965 /** 5966 * Allows the host application to declare implicit references from an object 5967 * group to an object. If the objects of the object group are alive, the child 5968 * object is alive too. After each garbage collection, all implicit references 5969 * are removed. It is intended to be used in the before-garbage-collection 5970 * callback function. 5971 */ 5972 template<typename T> void SetReferenceFromGroup(UniqueId id, 5973 const Persistent<T>& child); 5974 5975 /** 5976 * Allows the host application to declare implicit references from an object 5977 * to another object. If the parent object is alive, the child object is alive 5978 * too. After each garbage collection, all implicit references are removed. It 5979 * is intended to be used in the before-garbage-collection callback function. 5980 */ 5981 template<typename T, typename S> 5982 void SetReference(const Persistent<T>& parent, const Persistent<S>& child); 5983 5984 typedef void (*GCCallback)(Isolate* isolate, GCType type, 5985 GCCallbackFlags flags); 5986 5987 /** 5988 * Enables the host application to receive a notification before a 5989 * garbage collection. Allocations are allowed in the callback function, 5990 * but the callback is not re-entrant: if the allocation inside it will 5991 * trigger the garbage collection, the callback won't be called again. 5992 * It is possible to specify the GCType filter for your callback. But it is 5993 * not possible to register the same callback function two times with 5994 * different GCType filters. 5995 */ 5996 void AddGCPrologueCallback(GCCallback callback, 5997 GCType gc_type_filter = kGCTypeAll); 5998 5999 /** 6000 * This function removes callback which was installed by 6001 * AddGCPrologueCallback function. 6002 */ 6003 void RemoveGCPrologueCallback(GCCallback callback); 6004 6005 /** 6006 * Sets the embedder heap tracer for the isolate. 6007 */ 6008 void SetEmbedderHeapTracer(EmbedderHeapTracer* tracer); 6009 6010 /** 6011 * Enables the host application to receive a notification after a 6012 * garbage collection. Allocations are allowed in the callback function, 6013 * but the callback is not re-entrant: if the allocation inside it will 6014 * trigger the garbage collection, the callback won't be called again. 6015 * It is possible to specify the GCType filter for your callback. But it is 6016 * not possible to register the same callback function two times with 6017 * different GCType filters. 6018 */ 6019 void AddGCEpilogueCallback(GCCallback callback, 6020 GCType gc_type_filter = kGCTypeAll); 6021 6022 /** 6023 * This function removes callback which was installed by 6024 * AddGCEpilogueCallback function. 6025 */ 6026 void RemoveGCEpilogueCallback(GCCallback callback); 6027 6028 /** 6029 * Forcefully terminate the current thread of JavaScript execution 6030 * in the given isolate. 6031 * 6032 * This method can be used by any thread even if that thread has not 6033 * acquired the V8 lock with a Locker object. 6034 */ 6035 void TerminateExecution(); 6036 6037 /** 6038 * Is V8 terminating JavaScript execution. 6039 * 6040 * Returns true if JavaScript execution is currently terminating 6041 * because of a call to TerminateExecution. In that case there are 6042 * still JavaScript frames on the stack and the termination 6043 * exception is still active. 6044 */ 6045 bool IsExecutionTerminating(); 6046 6047 /** 6048 * Resume execution capability in the given isolate, whose execution 6049 * was previously forcefully terminated using TerminateExecution(). 6050 * 6051 * When execution is forcefully terminated using TerminateExecution(), 6052 * the isolate can not resume execution until all JavaScript frames 6053 * have propagated the uncatchable exception which is generated. This 6054 * method allows the program embedding the engine to handle the 6055 * termination event and resume execution capability, even if 6056 * JavaScript frames remain on the stack. 6057 * 6058 * This method can be used by any thread even if that thread has not 6059 * acquired the V8 lock with a Locker object. 6060 */ 6061 void CancelTerminateExecution(); 6062 6063 /** 6064 * Request V8 to interrupt long running JavaScript code and invoke 6065 * the given |callback| passing the given |data| to it. After |callback| 6066 * returns control will be returned to the JavaScript code. 6067 * There may be a number of interrupt requests in flight. 6068 * Can be called from another thread without acquiring a |Locker|. 6069 * Registered |callback| must not reenter interrupted Isolate. 6070 */ 6071 void RequestInterrupt(InterruptCallback callback, void* data); 6072 6073 /** 6074 * Request garbage collection in this Isolate. It is only valid to call this 6075 * function if --expose_gc was specified. 6076 * 6077 * This should only be used for testing purposes and not to enforce a garbage 6078 * collection schedule. It has strong negative impact on the garbage 6079 * collection performance. Use IdleNotificationDeadline() or 6080 * LowMemoryNotification() instead to influence the garbage collection 6081 * schedule. 6082 */ 6083 void RequestGarbageCollectionForTesting(GarbageCollectionType type); 6084 6085 /** 6086 * Set the callback to invoke for logging event. 6087 */ 6088 void SetEventLogger(LogEventCallback that); 6089 6090 /** 6091 * Adds a callback to notify the host application right before a script 6092 * is about to run. If a script re-enters the runtime during executing, the 6093 * BeforeCallEnteredCallback is invoked for each re-entrance. 6094 * Executing scripts inside the callback will re-trigger the callback. 6095 */ 6096 void AddBeforeCallEnteredCallback(BeforeCallEnteredCallback callback); 6097 6098 /** 6099 * Removes callback that was installed by AddBeforeCallEnteredCallback. 6100 */ 6101 void RemoveBeforeCallEnteredCallback(BeforeCallEnteredCallback callback); 6102 6103 /** 6104 * Adds a callback to notify the host application when a script finished 6105 * running. If a script re-enters the runtime during executing, the 6106 * CallCompletedCallback is only invoked when the outer-most script 6107 * execution ends. Executing scripts inside the callback do not trigger 6108 * further callbacks. 6109 */ 6110 void AddCallCompletedCallback(CallCompletedCallback callback); 6111 V8_DEPRECATE_SOON( 6112 "Use callback with parameter", 6113 void AddCallCompletedCallback(DeprecatedCallCompletedCallback callback)); 6114 6115 /** 6116 * Removes callback that was installed by AddCallCompletedCallback. 6117 */ 6118 void RemoveCallCompletedCallback(CallCompletedCallback callback); 6119 V8_DEPRECATE_SOON( 6120 "Use callback with parameter", 6121 void RemoveCallCompletedCallback( 6122 DeprecatedCallCompletedCallback callback)); 6123 6124 /** 6125 * Set callback to notify about promise reject with no handler, or 6126 * revocation of such a previous notification once the handler is added. 6127 */ 6128 void SetPromiseRejectCallback(PromiseRejectCallback callback); 6129 6130 /** 6131 * Experimental: Runs the Microtask Work Queue until empty 6132 * Any exceptions thrown by microtask callbacks are swallowed. 6133 */ 6134 void RunMicrotasks(); 6135 6136 /** 6137 * Experimental: Enqueues the callback to the Microtask Work Queue 6138 */ 6139 void EnqueueMicrotask(Local<Function> microtask); 6140 6141 /** 6142 * Experimental: Enqueues the callback to the Microtask Work Queue 6143 */ 6144 void EnqueueMicrotask(MicrotaskCallback microtask, void* data = NULL); 6145 6146 /** 6147 * Experimental: Controls how Microtasks are invoked. See MicrotasksPolicy 6148 * for details. 6149 */ 6150 void SetMicrotasksPolicy(MicrotasksPolicy policy); 6151 V8_DEPRECATE_SOON("Use SetMicrotasksPolicy", 6152 void SetAutorunMicrotasks(bool autorun)); 6153 6154 /** 6155 * Experimental: Returns the policy controlling how Microtasks are invoked. 6156 */ 6157 MicrotasksPolicy GetMicrotasksPolicy() const; 6158 V8_DEPRECATE_SOON("Use GetMicrotasksPolicy", 6159 bool WillAutorunMicrotasks() const); 6160 6161 /** 6162 * Experimental: adds a callback to notify the host application after 6163 * microtasks were run. The callback is triggered by explicit RunMicrotasks 6164 * call or automatic microtasks execution (see SetAutorunMicrotasks). 6165 * 6166 * Callback will trigger even if microtasks were attempted to run, 6167 * but the microtasks queue was empty and no single microtask was actually 6168 * executed. 6169 * 6170 * Executing scriptsinside the callback will not re-trigger microtasks and 6171 * the callback. 6172 */ 6173 void AddMicrotasksCompletedCallback(MicrotasksCompletedCallback callback); 6174 6175 /** 6176 * Removes callback that was installed by AddMicrotasksCompletedCallback. 6177 */ 6178 void RemoveMicrotasksCompletedCallback(MicrotasksCompletedCallback callback); 6179 6180 /** 6181 * Sets a callback for counting the number of times a feature of V8 is used. 6182 */ 6183 void SetUseCounterCallback(UseCounterCallback callback); 6184 6185 /** 6186 * Enables the host application to provide a mechanism for recording 6187 * statistics counters. 6188 */ 6189 void SetCounterFunction(CounterLookupCallback); 6190 6191 /** 6192 * Enables the host application to provide a mechanism for recording 6193 * histograms. The CreateHistogram function returns a 6194 * histogram which will later be passed to the AddHistogramSample 6195 * function. 6196 */ 6197 void SetCreateHistogramFunction(CreateHistogramCallback); 6198 void SetAddHistogramSampleFunction(AddHistogramSampleCallback); 6199 6200 /** 6201 * Optional notification that the embedder is idle. 6202 * V8 uses the notification to perform garbage collection. 6203 * This call can be used repeatedly if the embedder remains idle. 6204 * Returns true if the embedder should stop calling IdleNotificationDeadline 6205 * until real work has been done. This indicates that V8 has done 6206 * as much cleanup as it will be able to do. 6207 * 6208 * The deadline_in_seconds argument specifies the deadline V8 has to finish 6209 * garbage collection work. deadline_in_seconds is compared with 6210 * MonotonicallyIncreasingTime() and should be based on the same timebase as 6211 * that function. There is no guarantee that the actual work will be done 6212 * within the time limit. 6213 */ 6214 bool IdleNotificationDeadline(double deadline_in_seconds); 6215 6216 V8_DEPRECATED("use IdleNotificationDeadline()", 6217 bool IdleNotification(int idle_time_in_ms)); 6218 6219 /** 6220 * Optional notification that the system is running low on memory. 6221 * V8 uses these notifications to attempt to free memory. 6222 */ 6223 void LowMemoryNotification(); 6224 6225 /** 6226 * Optional notification that a context has been disposed. V8 uses 6227 * these notifications to guide the GC heuristic. Returns the number 6228 * of context disposals - including this one - since the last time 6229 * V8 had a chance to clean up. 6230 * 6231 * The optional parameter |dependant_context| specifies whether the disposed 6232 * context was depending on state from other contexts or not. 6233 */ 6234 int ContextDisposedNotification(bool dependant_context = true); 6235 6236 /** 6237 * Optional notification that the isolate switched to the foreground. 6238 * V8 uses these notifications to guide heuristics. 6239 */ 6240 void IsolateInForegroundNotification(); 6241 6242 /** 6243 * Optional notification that the isolate switched to the background. 6244 * V8 uses these notifications to guide heuristics. 6245 */ 6246 void IsolateInBackgroundNotification(); 6247 6248 /** 6249 * Optional notification to tell V8 the current performance requirements 6250 * of the embedder based on RAIL. 6251 * V8 uses these notifications to guide heuristics. 6252 * This is an unfinished experimental feature. Semantics and implementation 6253 * may change frequently. 6254 */ 6255 void SetRAILMode(RAILMode rail_mode); 6256 6257 /** 6258 * Allows the host application to provide the address of a function that is 6259 * notified each time code is added, moved or removed. 6260 * 6261 * \param options options for the JIT code event handler. 6262 * \param event_handler the JIT code event handler, which will be invoked 6263 * each time code is added, moved or removed. 6264 * \note \p event_handler won't get notified of existent code. 6265 * \note since code removal notifications are not currently issued, the 6266 * \p event_handler may get notifications of code that overlaps earlier 6267 * code notifications. This happens when code areas are reused, and the 6268 * earlier overlapping code areas should therefore be discarded. 6269 * \note the events passed to \p event_handler and the strings they point to 6270 * are not guaranteed to live past each call. The \p event_handler must 6271 * copy strings and other parameters it needs to keep around. 6272 * \note the set of events declared in JitCodeEvent::EventType is expected to 6273 * grow over time, and the JitCodeEvent structure is expected to accrue 6274 * new members. The \p event_handler function must ignore event codes 6275 * it does not recognize to maintain future compatibility. 6276 * \note Use Isolate::CreateParams to get events for code executed during 6277 * Isolate setup. 6278 */ 6279 void SetJitCodeEventHandler(JitCodeEventOptions options, 6280 JitCodeEventHandler event_handler); 6281 6282 /** 6283 * Modifies the stack limit for this Isolate. 6284 * 6285 * \param stack_limit An address beyond which the Vm's stack may not grow. 6286 * 6287 * \note If you are using threads then you should hold the V8::Locker lock 6288 * while setting the stack limit and you must set a non-default stack 6289 * limit separately for each thread. 6290 */ 6291 void SetStackLimit(uintptr_t stack_limit); 6292 6293 /** 6294 * Returns a memory range that can potentially contain jitted code. 6295 * 6296 * On Win64, embedders are advised to install function table callbacks for 6297 * these ranges, as default SEH won't be able to unwind through jitted code. 6298 * 6299 * The first page of the code range is reserved for the embedder and is 6300 * committed, writable, and executable. 6301 * 6302 * Might be empty on other platforms. 6303 * 6304 * https://code.google.com/p/v8/issues/detail?id=3598 6305 */ 6306 void GetCodeRange(void** start, size_t* length_in_bytes); 6307 6308 /** Set the callback to invoke in case of fatal errors. */ 6309 void SetFatalErrorHandler(FatalErrorCallback that); 6310 6311 /** 6312 * Set the callback to invoke to check if code generation from 6313 * strings should be allowed. 6314 */ 6315 void SetAllowCodeGenerationFromStringsCallback( 6316 AllowCodeGenerationFromStringsCallback callback); 6317 6318 /** 6319 * Check if V8 is dead and therefore unusable. This is the case after 6320 * fatal errors such as out-of-memory situations. 6321 */ 6322 bool IsDead(); 6323 6324 /** 6325 * Adds a message listener. 6326 * 6327 * The same message listener can be added more than once and in that 6328 * case it will be called more than once for each message. 6329 * 6330 * If data is specified, it will be passed to the callback when it is called. 6331 * Otherwise, the exception object will be passed to the callback instead. 6332 */ 6333 bool AddMessageListener(MessageCallback that, 6334 Local<Value> data = Local<Value>()); 6335 6336 /** 6337 * Remove all message listeners from the specified callback function. 6338 */ 6339 void RemoveMessageListeners(MessageCallback that); 6340 6341 /** Callback function for reporting failed access checks.*/ 6342 void SetFailedAccessCheckCallbackFunction(FailedAccessCheckCallback); 6343 6344 /** 6345 * Tells V8 to capture current stack trace when uncaught exception occurs 6346 * and report it to the message listeners. The option is off by default. 6347 */ 6348 void SetCaptureStackTraceForUncaughtExceptions( 6349 bool capture, int frame_limit = 10, 6350 StackTrace::StackTraceOptions options = StackTrace::kOverview); 6351 6352 /** 6353 * Iterates through all external resources referenced from current isolate 6354 * heap. GC is not invoked prior to iterating, therefore there is no 6355 * guarantee that visited objects are still alive. 6356 */ 6357 void VisitExternalResources(ExternalResourceVisitor* visitor); 6358 6359 /** 6360 * Iterates through all the persistent handles in the current isolate's heap 6361 * that have class_ids. 6362 */ 6363 void VisitHandlesWithClassIds(PersistentHandleVisitor* visitor); 6364 6365 /** 6366 * Iterates through all the persistent handles in the current isolate's heap 6367 * that have class_ids and are candidates to be marked as partially dependent 6368 * handles. This will visit handles to young objects created since the last 6369 * garbage collection but is free to visit an arbitrary superset of these 6370 * objects. 6371 */ 6372 void VisitHandlesForPartialDependence(PersistentHandleVisitor* visitor); 6373 6374 /** 6375 * Iterates through all the persistent handles in the current isolate's heap 6376 * that have class_ids and are weak to be marked as inactive if there is no 6377 * pending activity for the handle. 6378 */ 6379 void VisitWeakHandles(PersistentHandleVisitor* visitor); 6380 6381 /** 6382 * Check if this isolate is in use. 6383 * True if at least one thread Enter'ed this isolate. 6384 */ 6385 bool IsInUse(); 6386 6387 private: 6388 template <class K, class V, class Traits> 6389 friend class PersistentValueMapBase; 6390 6391 Isolate(); 6392 Isolate(const Isolate&); 6393 ~Isolate(); 6394 Isolate& operator=(const Isolate&); 6395 void* operator new(size_t size); 6396 void operator delete(void*, size_t); 6397 6398 void SetObjectGroupId(internal::Object** object, UniqueId id); 6399 void SetReferenceFromGroup(UniqueId id, internal::Object** object); 6400 void SetReference(internal::Object** parent, internal::Object** child); 6401 void ReportExternalAllocationLimitReached(); 6402}; 6403 6404class V8_EXPORT StartupData { 6405 public: 6406 const char* data; 6407 int raw_size; 6408}; 6409 6410 6411/** 6412 * EntropySource is used as a callback function when v8 needs a source 6413 * of entropy. 6414 */ 6415typedef bool (*EntropySource)(unsigned char* buffer, size_t length); 6416 6417 6418/** 6419 * ReturnAddressLocationResolver is used as a callback function when v8 is 6420 * resolving the location of a return address on the stack. Profilers that 6421 * change the return address on the stack can use this to resolve the stack 6422 * location to whereever the profiler stashed the original return address. 6423 * 6424 * \param return_addr_location points to a location on stack where a machine 6425 * return address resides. 6426 * \returns either return_addr_location, or else a pointer to the profiler's 6427 * copy of the original return address. 6428 * 6429 * \note the resolver function must not cause garbage collection. 6430 */ 6431typedef uintptr_t (*ReturnAddressLocationResolver)( 6432 uintptr_t return_addr_location); 6433 6434 6435/** 6436 * Container class for static utility functions. 6437 */ 6438class V8_EXPORT V8 { 6439 public: 6440 /** Set the callback to invoke in case of fatal errors. */ 6441 V8_INLINE static V8_DEPRECATED( 6442 "Use isolate version", 6443 void SetFatalErrorHandler(FatalErrorCallback that)); 6444 6445 /** 6446 * Set the callback to invoke to check if code generation from 6447 * strings should be allowed. 6448 */ 6449 V8_INLINE static V8_DEPRECATED( 6450 "Use isolate version", void SetAllowCodeGenerationFromStringsCallback( 6451 AllowCodeGenerationFromStringsCallback that)); 6452 6453 /** 6454 * Check if V8 is dead and therefore unusable. This is the case after 6455 * fatal errors such as out-of-memory situations. 6456 */ 6457 V8_INLINE static V8_DEPRECATED("Use isolate version", bool IsDead()); 6458 6459 /** 6460 * Hand startup data to V8, in case the embedder has chosen to build 6461 * V8 with external startup data. 6462 * 6463 * Note: 6464 * - By default the startup data is linked into the V8 library, in which 6465 * case this function is not meaningful. 6466 * - If this needs to be called, it needs to be called before V8 6467 * tries to make use of its built-ins. 6468 * - To avoid unnecessary copies of data, V8 will point directly into the 6469 * given data blob, so pretty please keep it around until V8 exit. 6470 * - Compression of the startup blob might be useful, but needs to 6471 * handled entirely on the embedders' side. 6472 * - The call will abort if the data is invalid. 6473 */ 6474 static void SetNativesDataBlob(StartupData* startup_blob); 6475 static void SetSnapshotDataBlob(StartupData* startup_blob); 6476 6477 /** 6478 * Bootstrap an isolate and a context from scratch to create a startup 6479 * snapshot. Include the side-effects of running the optional script. 6480 * Returns { NULL, 0 } on failure. 6481 * The caller acquires ownership of the data array in the return value. 6482 */ 6483 static StartupData CreateSnapshotDataBlob(const char* embedded_source = NULL); 6484 6485 /** 6486 * Bootstrap an isolate and a context from the cold startup blob, run the 6487 * warm-up script to trigger code compilation. The side effects are then 6488 * discarded. The resulting startup snapshot will include compiled code. 6489 * Returns { NULL, 0 } on failure. 6490 * The caller acquires ownership of the data array in the return value. 6491 * The argument startup blob is untouched. 6492 */ 6493 static StartupData WarmUpSnapshotDataBlob(StartupData cold_startup_blob, 6494 const char* warmup_source); 6495 6496 /** 6497 * Adds a message listener. 6498 * 6499 * The same message listener can be added more than once and in that 6500 * case it will be called more than once for each message. 6501 * 6502 * If data is specified, it will be passed to the callback when it is called. 6503 * Otherwise, the exception object will be passed to the callback instead. 6504 */ 6505 V8_INLINE static V8_DEPRECATED( 6506 "Use isolate version", 6507 bool AddMessageListener(MessageCallback that, 6508 Local<Value> data = Local<Value>())); 6509 6510 /** 6511 * Remove all message listeners from the specified callback function. 6512 */ 6513 V8_INLINE static V8_DEPRECATED( 6514 "Use isolate version", void RemoveMessageListeners(MessageCallback that)); 6515 6516 /** 6517 * Tells V8 to capture current stack trace when uncaught exception occurs 6518 * and report it to the message listeners. The option is off by default. 6519 */ 6520 V8_INLINE static V8_DEPRECATED( 6521 "Use isolate version", 6522 void SetCaptureStackTraceForUncaughtExceptions( 6523 bool capture, int frame_limit = 10, 6524 StackTrace::StackTraceOptions options = StackTrace::kOverview)); 6525 6526 /** 6527 * Sets V8 flags from a string. 6528 */ 6529 static void SetFlagsFromString(const char* str, int length); 6530 6531 /** 6532 * Sets V8 flags from the command line. 6533 */ 6534 static void SetFlagsFromCommandLine(int* argc, 6535 char** argv, 6536 bool remove_flags); 6537 6538 /** Get the version string. */ 6539 static const char* GetVersion(); 6540 6541 /** Callback function for reporting failed access checks.*/ 6542 V8_INLINE static V8_DEPRECATED( 6543 "Use isolate version", 6544 void SetFailedAccessCheckCallbackFunction(FailedAccessCheckCallback)); 6545 6546 /** 6547 * Enables the host application to receive a notification before a 6548 * garbage collection. Allocations are not allowed in the 6549 * callback function, you therefore cannot manipulate objects (set 6550 * or delete properties for example) since it is possible such 6551 * operations will result in the allocation of objects. It is possible 6552 * to specify the GCType filter for your callback. But it is not possible to 6553 * register the same callback function two times with different 6554 * GCType filters. 6555 */ 6556 static V8_DEPRECATED( 6557 "Use isolate version", 6558 void AddGCPrologueCallback(GCCallback callback, 6559 GCType gc_type_filter = kGCTypeAll)); 6560 6561 /** 6562 * This function removes callback which was installed by 6563 * AddGCPrologueCallback function. 6564 */ 6565 V8_INLINE static V8_DEPRECATED( 6566 "Use isolate version", 6567 void RemoveGCPrologueCallback(GCCallback callback)); 6568 6569 /** 6570 * Enables the host application to receive a notification after a 6571 * garbage collection. Allocations are not allowed in the 6572 * callback function, you therefore cannot manipulate objects (set 6573 * or delete properties for example) since it is possible such 6574 * operations will result in the allocation of objects. It is possible 6575 * to specify the GCType filter for your callback. But it is not possible to 6576 * register the same callback function two times with different 6577 * GCType filters. 6578 */ 6579 static V8_DEPRECATED( 6580 "Use isolate version", 6581 void AddGCEpilogueCallback(GCCallback callback, 6582 GCType gc_type_filter = kGCTypeAll)); 6583 6584 /** 6585 * This function removes callback which was installed by 6586 * AddGCEpilogueCallback function. 6587 */ 6588 V8_INLINE static V8_DEPRECATED( 6589 "Use isolate version", 6590 void RemoveGCEpilogueCallback(GCCallback callback)); 6591 6592 /** 6593 * Initializes V8. This function needs to be called before the first Isolate 6594 * is created. It always returns true. 6595 */ 6596 static bool Initialize(); 6597 6598 /** 6599 * Allows the host application to provide a callback which can be used 6600 * as a source of entropy for random number generators. 6601 */ 6602 static void SetEntropySource(EntropySource source); 6603 6604 /** 6605 * Allows the host application to provide a callback that allows v8 to 6606 * cooperate with a profiler that rewrites return addresses on stack. 6607 */ 6608 static void SetReturnAddressLocationResolver( 6609 ReturnAddressLocationResolver return_address_resolver); 6610 6611 /** 6612 * Forcefully terminate the current thread of JavaScript execution 6613 * in the given isolate. 6614 * 6615 * This method can be used by any thread even if that thread has not 6616 * acquired the V8 lock with a Locker object. 6617 * 6618 * \param isolate The isolate in which to terminate the current JS execution. 6619 */ 6620 V8_INLINE static V8_DEPRECATED("Use isolate version", 6621 void TerminateExecution(Isolate* isolate)); 6622 6623 /** 6624 * Is V8 terminating JavaScript execution. 6625 * 6626 * Returns true if JavaScript execution is currently terminating 6627 * because of a call to TerminateExecution. In that case there are 6628 * still JavaScript frames on the stack and the termination 6629 * exception is still active. 6630 * 6631 * \param isolate The isolate in which to check. 6632 */ 6633 V8_INLINE static V8_DEPRECATED( 6634 "Use isolate version", 6635 bool IsExecutionTerminating(Isolate* isolate = NULL)); 6636 6637 /** 6638 * Resume execution capability in the given isolate, whose execution 6639 * was previously forcefully terminated using TerminateExecution(). 6640 * 6641 * When execution is forcefully terminated using TerminateExecution(), 6642 * the isolate can not resume execution until all JavaScript frames 6643 * have propagated the uncatchable exception which is generated. This 6644 * method allows the program embedding the engine to handle the 6645 * termination event and resume execution capability, even if 6646 * JavaScript frames remain on the stack. 6647 * 6648 * This method can be used by any thread even if that thread has not 6649 * acquired the V8 lock with a Locker object. 6650 * 6651 * \param isolate The isolate in which to resume execution capability. 6652 */ 6653 V8_INLINE static V8_DEPRECATED( 6654 "Use isolate version", void CancelTerminateExecution(Isolate* isolate)); 6655 6656 /** 6657 * Releases any resources used by v8 and stops any utility threads 6658 * that may be running. Note that disposing v8 is permanent, it 6659 * cannot be reinitialized. 6660 * 6661 * It should generally not be necessary to dispose v8 before exiting 6662 * a process, this should happen automatically. It is only necessary 6663 * to use if the process needs the resources taken up by v8. 6664 */ 6665 static bool Dispose(); 6666 6667 /** 6668 * Iterates through all external resources referenced from current isolate 6669 * heap. GC is not invoked prior to iterating, therefore there is no 6670 * guarantee that visited objects are still alive. 6671 */ 6672 V8_INLINE static V8_DEPRECATED( 6673 "Use isolate version", 6674 void VisitExternalResources(ExternalResourceVisitor* visitor)); 6675 6676 /** 6677 * Iterates through all the persistent handles in the current isolate's heap 6678 * that have class_ids. 6679 */ 6680 V8_INLINE static V8_DEPRECATED( 6681 "Use isolate version", 6682 void VisitHandlesWithClassIds(PersistentHandleVisitor* visitor)); 6683 6684 /** 6685 * Iterates through all the persistent handles in isolate's heap that have 6686 * class_ids. 6687 */ 6688 V8_INLINE static V8_DEPRECATED( 6689 "Use isolate version", 6690 void VisitHandlesWithClassIds(Isolate* isolate, 6691 PersistentHandleVisitor* visitor)); 6692 6693 /** 6694 * Iterates through all the persistent handles in the current isolate's heap 6695 * that have class_ids and are candidates to be marked as partially dependent 6696 * handles. This will visit handles to young objects created since the last 6697 * garbage collection but is free to visit an arbitrary superset of these 6698 * objects. 6699 */ 6700 V8_INLINE static V8_DEPRECATED( 6701 "Use isolate version", 6702 void VisitHandlesForPartialDependence(Isolate* isolate, 6703 PersistentHandleVisitor* visitor)); 6704 6705 /** 6706 * Initialize the ICU library bundled with V8. The embedder should only 6707 * invoke this method when using the bundled ICU. Returns true on success. 6708 * 6709 * If V8 was compiled with the ICU data in an external file, the location 6710 * of the data file has to be provided. 6711 */ 6712 V8_DEPRECATE_SOON( 6713 "Use version with default location.", 6714 static bool InitializeICU(const char* icu_data_file = nullptr)); 6715 6716 /** 6717 * Initialize the ICU library bundled with V8. The embedder should only 6718 * invoke this method when using the bundled ICU. If V8 was compiled with 6719 * the ICU data in an external file and when the default location of that 6720 * file should be used, a path to the executable must be provided. 6721 * Returns true on success. 6722 * 6723 * The default is a file called icudtl.dat side-by-side with the executable. 6724 * 6725 * Optionally, the location of the data file can be provided to override the 6726 * default. 6727 */ 6728 static bool InitializeICUDefaultLocation(const char* exec_path, 6729 const char* icu_data_file = nullptr); 6730 6731 /** 6732 * Initialize the external startup data. The embedder only needs to 6733 * invoke this method when external startup data was enabled in a build. 6734 * 6735 * If V8 was compiled with the startup data in an external file, then 6736 * V8 needs to be given those external files during startup. There are 6737 * three ways to do this: 6738 * - InitializeExternalStartupData(const char*) 6739 * This will look in the given directory for files "natives_blob.bin" 6740 * and "snapshot_blob.bin" - which is what the default build calls them. 6741 * - InitializeExternalStartupData(const char*, const char*) 6742 * As above, but will directly use the two given file names. 6743 * - Call SetNativesDataBlob, SetNativesDataBlob. 6744 * This will read the blobs from the given data structures and will 6745 * not perform any file IO. 6746 */ 6747 static void InitializeExternalStartupData(const char* directory_path); 6748 static void InitializeExternalStartupData(const char* natives_blob, 6749 const char* snapshot_blob); 6750 /** 6751 * Sets the v8::Platform to use. This should be invoked before V8 is 6752 * initialized. 6753 */ 6754 static void InitializePlatform(Platform* platform); 6755 6756 /** 6757 * Clears all references to the v8::Platform. This should be invoked after 6758 * V8 was disposed. 6759 */ 6760 static void ShutdownPlatform(); 6761 6762 private: 6763 V8(); 6764 6765 static internal::Object** GlobalizeReference(internal::Isolate* isolate, 6766 internal::Object** handle); 6767 static internal::Object** CopyPersistent(internal::Object** handle); 6768 static void DisposeGlobal(internal::Object** global_handle); 6769 static void MakeWeak(internal::Object** location, void* data, 6770 WeakCallbackInfo<void>::Callback weak_callback, 6771 WeakCallbackType type); 6772 static void MakeWeak(internal::Object** location, void* data, 6773 // Must be 0 or -1. 6774 int internal_field_index1, 6775 // Must be 1 or -1. 6776 int internal_field_index2, 6777 WeakCallbackInfo<void>::Callback weak_callback); 6778 static void MakeWeak(internal::Object*** location_addr); 6779 static void* ClearWeak(internal::Object** location); 6780 static void Eternalize(Isolate* isolate, 6781 Value* handle, 6782 int* index); 6783 static Local<Value> GetEternal(Isolate* isolate, int index); 6784 6785 static void RegisterExternallyReferencedObject(internal::Object** object, 6786 internal::Isolate* isolate); 6787 template <class K, class V, class T> 6788 friend class PersistentValueMapBase; 6789 6790 static void FromJustIsNothing(); 6791 static void ToLocalEmpty(); 6792 static void InternalFieldOutOfBounds(int index); 6793 template <class T> friend class Local; 6794 template <class T> 6795 friend class MaybeLocal; 6796 template <class T> 6797 friend class Maybe; 6798 template <class T> 6799 friend class WeakCallbackInfo; 6800 template <class T> friend class Eternal; 6801 template <class T> friend class PersistentBase; 6802 template <class T, class M> friend class Persistent; 6803 friend class Context; 6804}; 6805 6806/** 6807 * Helper class to create a snapshot data blob. 6808 */ 6809class SnapshotCreator { 6810 public: 6811 enum class FunctionCodeHandling { kClear, kKeep }; 6812 6813 /** 6814 * Create and enter an isolate, and set it up for serialization. 6815 * The isolate is either created from scratch or from an existing snapshot. 6816 * The caller keeps ownership of the argument snapshot. 6817 * \param existing_blob existing snapshot from which to create this one. 6818 * \param external_references a null-terminated array of external references 6819 * that must be equivalent to CreateParams::external_references. 6820 */ 6821 SnapshotCreator(intptr_t* external_references = nullptr, 6822 StartupData* existing_blob = nullptr); 6823 6824 ~SnapshotCreator(); 6825 6826 /** 6827 * \returns the isolate prepared by the snapshot creator. 6828 */ 6829 Isolate* GetIsolate(); 6830 6831 /** 6832 * Add a context to be included in the snapshot blob. 6833 * \returns the index of the context in the snapshot blob. 6834 */ 6835 size_t AddContext(Local<Context> context); 6836 6837 /** 6838 * Add a template to be included in the snapshot blob. 6839 * \returns the index of the template in the snapshot blob. 6840 */ 6841 size_t AddTemplate(Local<Template> template_obj); 6842 6843 /** 6844 * Created a snapshot data blob. 6845 * This must not be called from within a handle scope. 6846 * \param function_code_handling whether to include compiled function code 6847 * in the snapshot. 6848 * \returns { nullptr, 0 } on failure, and a startup snapshot on success. The 6849 * caller acquires ownership of the data array in the return value. 6850 */ 6851 StartupData CreateBlob(FunctionCodeHandling function_code_handling); 6852 6853 private: 6854 void* data_; 6855 6856 // Disallow copying and assigning. 6857 SnapshotCreator(const SnapshotCreator&); 6858 void operator=(const SnapshotCreator&); 6859}; 6860 6861/** 6862 * A simple Maybe type, representing an object which may or may not have a 6863 * value, see https://hackage.haskell.org/package/base/docs/Data-Maybe.html. 6864 * 6865 * If an API method returns a Maybe<>, the API method can potentially fail 6866 * either because an exception is thrown, or because an exception is pending, 6867 * e.g. because a previous API call threw an exception that hasn't been caught 6868 * yet, or because a TerminateExecution exception was thrown. In that case, a 6869 * "Nothing" value is returned. 6870 */ 6871template <class T> 6872class Maybe { 6873 public: 6874 V8_INLINE bool IsNothing() const { return !has_value; } 6875 V8_INLINE bool IsJust() const { return has_value; } 6876 6877 // Will crash if the Maybe<> is nothing. 6878 V8_INLINE T FromJust() const { 6879 if (V8_UNLIKELY(!IsJust())) V8::FromJustIsNothing(); 6880 return value; 6881 } 6882 6883 V8_INLINE T FromMaybe(const T& default_value) const { 6884 return has_value ? value : default_value; 6885 } 6886 6887 V8_INLINE bool operator==(const Maybe& other) const { 6888 return (IsJust() == other.IsJust()) && 6889 (!IsJust() || FromJust() == other.FromJust()); 6890 } 6891 6892 V8_INLINE bool operator!=(const Maybe& other) const { 6893 return !operator==(other); 6894 } 6895 6896 private: 6897 Maybe() : has_value(false) {} 6898 explicit Maybe(const T& t) : has_value(true), value(t) {} 6899 6900 bool has_value; 6901 T value; 6902 6903 template <class U> 6904 friend Maybe<U> Nothing(); 6905 template <class U> 6906 friend Maybe<U> Just(const U& u); 6907}; 6908 6909 6910template <class T> 6911inline Maybe<T> Nothing() { 6912 return Maybe<T>(); 6913} 6914 6915 6916template <class T> 6917inline Maybe<T> Just(const T& t) { 6918 return Maybe<T>(t); 6919} 6920 6921 6922/** 6923 * An external exception handler. 6924 */ 6925class V8_EXPORT TryCatch { 6926 public: 6927 /** 6928 * Creates a new try/catch block and registers it with v8. Note that 6929 * all TryCatch blocks should be stack allocated because the memory 6930 * location itself is compared against JavaScript try/catch blocks. 6931 */ 6932 V8_DEPRECATED("Use isolate version", TryCatch()); 6933 6934 /** 6935 * Creates a new try/catch block and registers it with v8. Note that 6936 * all TryCatch blocks should be stack allocated because the memory 6937 * location itself is compared against JavaScript try/catch blocks. 6938 */ 6939 TryCatch(Isolate* isolate); 6940 6941 /** 6942 * Unregisters and deletes this try/catch block. 6943 */ 6944 ~TryCatch(); 6945 6946 /** 6947 * Returns true if an exception has been caught by this try/catch block. 6948 */ 6949 bool HasCaught() const; 6950 6951 /** 6952 * For certain types of exceptions, it makes no sense to continue execution. 6953 * 6954 * If CanContinue returns false, the correct action is to perform any C++ 6955 * cleanup needed and then return. If CanContinue returns false and 6956 * HasTerminated returns true, it is possible to call 6957 * CancelTerminateExecution in order to continue calling into the engine. 6958 */ 6959 bool CanContinue() const; 6960 6961 /** 6962 * Returns true if an exception has been caught due to script execution 6963 * being terminated. 6964 * 6965 * There is no JavaScript representation of an execution termination 6966 * exception. Such exceptions are thrown when the TerminateExecution 6967 * methods are called to terminate a long-running script. 6968 * 6969 * If such an exception has been thrown, HasTerminated will return true, 6970 * indicating that it is possible to call CancelTerminateExecution in order 6971 * to continue calling into the engine. 6972 */ 6973 bool HasTerminated() const; 6974 6975 /** 6976 * Throws the exception caught by this TryCatch in a way that avoids 6977 * it being caught again by this same TryCatch. As with ThrowException 6978 * it is illegal to execute any JavaScript operations after calling 6979 * ReThrow; the caller must return immediately to where the exception 6980 * is caught. 6981 */ 6982 Local<Value> ReThrow(); 6983 6984 /** 6985 * Returns the exception caught by this try/catch block. If no exception has 6986 * been caught an empty handle is returned. 6987 * 6988 * The returned handle is valid until this TryCatch block has been destroyed. 6989 */ 6990 Local<Value> Exception() const; 6991 6992 /** 6993 * Returns the .stack property of the thrown object. If no .stack 6994 * property is present an empty handle is returned. 6995 */ 6996 V8_DEPRECATE_SOON("Use maybe version.", Local<Value> StackTrace() const); 6997 V8_WARN_UNUSED_RESULT MaybeLocal<Value> StackTrace( 6998 Local<Context> context) const; 6999 7000 /** 7001 * Returns the message associated with this exception. If there is 7002 * no message associated an empty handle is returned. 7003 * 7004 * The returned handle is valid until this TryCatch block has been 7005 * destroyed. 7006 */ 7007 Local<v8::Message> Message() const; 7008 7009 /** 7010 * Clears any exceptions that may have been caught by this try/catch block. 7011 * After this method has been called, HasCaught() will return false. Cancels 7012 * the scheduled exception if it is caught and ReThrow() is not called before. 7013 * 7014 * It is not necessary to clear a try/catch block before using it again; if 7015 * another exception is thrown the previously caught exception will just be 7016 * overwritten. However, it is often a good idea since it makes it easier 7017 * to determine which operation threw a given exception. 7018 */ 7019 void Reset(); 7020 7021 /** 7022 * Set verbosity of the external exception handler. 7023 * 7024 * By default, exceptions that are caught by an external exception 7025 * handler are not reported. Call SetVerbose with true on an 7026 * external exception handler to have exceptions caught by the 7027 * handler reported as if they were not caught. 7028 */ 7029 void SetVerbose(bool value); 7030 7031 /** 7032 * Set whether or not this TryCatch should capture a Message object 7033 * which holds source information about where the exception 7034 * occurred. True by default. 7035 */ 7036 void SetCaptureMessage(bool value); 7037 7038 /** 7039 * There are cases when the raw address of C++ TryCatch object cannot be 7040 * used for comparisons with addresses into the JS stack. The cases are: 7041 * 1) ARM, ARM64 and MIPS simulators which have separate JS stack. 7042 * 2) Address sanitizer allocates local C++ object in the heap when 7043 * UseAfterReturn mode is enabled. 7044 * This method returns address that can be used for comparisons with 7045 * addresses into the JS stack. When neither simulator nor ASAN's 7046 * UseAfterReturn is enabled, then the address returned will be the address 7047 * of the C++ try catch handler itself. 7048 */ 7049 static void* JSStackComparableAddress(v8::TryCatch* handler) { 7050 if (handler == NULL) return NULL; 7051 return handler->js_stack_comparable_address_; 7052 } 7053 7054 private: 7055 void ResetInternal(); 7056 7057 // Make it hard to create heap-allocated TryCatch blocks. 7058 TryCatch(const TryCatch&); 7059 void operator=(const TryCatch&); 7060 void* operator new(size_t size); 7061 void operator delete(void*, size_t); 7062 7063 v8::internal::Isolate* isolate_; 7064 v8::TryCatch* next_; 7065 void* exception_; 7066 void* message_obj_; 7067 void* js_stack_comparable_address_; 7068 bool is_verbose_ : 1; 7069 bool can_continue_ : 1; 7070 bool capture_message_ : 1; 7071 bool rethrow_ : 1; 7072 bool has_terminated_ : 1; 7073 7074 friend class v8::internal::Isolate; 7075}; 7076 7077 7078// --- Context --- 7079 7080 7081/** 7082 * A container for extension names. 7083 */ 7084class V8_EXPORT ExtensionConfiguration { 7085 public: 7086 ExtensionConfiguration() : name_count_(0), names_(NULL) { } 7087 ExtensionConfiguration(int name_count, const char* names[]) 7088 : name_count_(name_count), names_(names) { } 7089 7090 const char** begin() const { return &names_[0]; } 7091 const char** end() const { return &names_[name_count_]; } 7092 7093 private: 7094 const int name_count_; 7095 const char** names_; 7096}; 7097 7098 7099/** 7100 * A sandboxed execution context with its own set of built-in objects 7101 * and functions. 7102 */ 7103class V8_EXPORT Context { 7104 public: 7105 /** 7106 * Returns the global proxy object. 7107 * 7108 * Global proxy object is a thin wrapper whose prototype points to actual 7109 * context's global object with the properties like Object, etc. This is done 7110 * that way for security reasons (for more details see 7111 * https://wiki.mozilla.org/Gecko:SplitWindow). 7112 * 7113 * Please note that changes to global proxy object prototype most probably 7114 * would break VM---v8 expects only global object as a prototype of global 7115 * proxy object. 7116 */ 7117 Local<Object> Global(); 7118 7119 /** 7120 * Detaches the global object from its context before 7121 * the global object can be reused to create a new context. 7122 */ 7123 void DetachGlobal(); 7124 7125 /** 7126 * Creates a new context and returns a handle to the newly allocated 7127 * context. 7128 * 7129 * \param isolate The isolate in which to create the context. 7130 * 7131 * \param extensions An optional extension configuration containing 7132 * the extensions to be installed in the newly created context. 7133 * 7134 * \param global_template An optional object template from which the 7135 * global object for the newly created context will be created. 7136 * 7137 * \param global_object An optional global object to be reused for 7138 * the newly created context. This global object must have been 7139 * created by a previous call to Context::New with the same global 7140 * template. The state of the global object will be completely reset 7141 * and only object identify will remain. 7142 */ 7143 static Local<Context> New( 7144 Isolate* isolate, ExtensionConfiguration* extensions = NULL, 7145 Local<ObjectTemplate> global_template = Local<ObjectTemplate>(), 7146 Local<Value> global_object = Local<Value>(), 7147 size_t context_snapshot_index = 0); 7148 7149 /** 7150 * Sets the security token for the context. To access an object in 7151 * another context, the security tokens must match. 7152 */ 7153 void SetSecurityToken(Local<Value> token); 7154 7155 /** Restores the security token to the default value. */ 7156 void UseDefaultSecurityToken(); 7157 7158 /** Returns the security token of this context.*/ 7159 Local<Value> GetSecurityToken(); 7160 7161 /** 7162 * Enter this context. After entering a context, all code compiled 7163 * and run is compiled and run in this context. If another context 7164 * is already entered, this old context is saved so it can be 7165 * restored when the new context is exited. 7166 */ 7167 void Enter(); 7168 7169 /** 7170 * Exit this context. Exiting the current context restores the 7171 * context that was in place when entering the current context. 7172 */ 7173 void Exit(); 7174 7175 /** Returns an isolate associated with a current context. */ 7176 v8::Isolate* GetIsolate(); 7177 7178 /** 7179 * The field at kDebugIdIndex is reserved for V8 debugger implementation. 7180 * The value is propagated to the scripts compiled in given Context and 7181 * can be used for filtering scripts. 7182 */ 7183 enum EmbedderDataFields { kDebugIdIndex = 0 }; 7184 7185 /** 7186 * Gets the embedder data with the given index, which must have been set by a 7187 * previous call to SetEmbedderData with the same index. Note that index 0 7188 * currently has a special meaning for Chrome's debugger. 7189 */ 7190 V8_INLINE Local<Value> GetEmbedderData(int index); 7191 7192 /** 7193 * Gets the binding object used by V8 extras. Extra natives get a reference 7194 * to this object and can use it to "export" functionality by adding 7195 * properties. Extra natives can also "import" functionality by accessing 7196 * properties added by the embedder using the V8 API. 7197 */ 7198 Local<Object> GetExtrasBindingObject(); 7199 7200 /** 7201 * Sets the embedder data with the given index, growing the data as 7202 * needed. Note that index 0 currently has a special meaning for Chrome's 7203 * debugger. 7204 */ 7205 void SetEmbedderData(int index, Local<Value> value); 7206 7207 /** 7208 * Gets a 2-byte-aligned native pointer from the embedder data with the given 7209 * index, which must have bees set by a previous call to 7210 * SetAlignedPointerInEmbedderData with the same index. Note that index 0 7211 * currently has a special meaning for Chrome's debugger. 7212 */ 7213 V8_INLINE void* GetAlignedPointerFromEmbedderData(int index); 7214 7215 /** 7216 * Sets a 2-byte-aligned native pointer in the embedder data with the given 7217 * index, growing the data as needed. Note that index 0 currently has a 7218 * special meaning for Chrome's debugger. 7219 */ 7220 void SetAlignedPointerInEmbedderData(int index, void* value); 7221 7222 /** 7223 * Control whether code generation from strings is allowed. Calling 7224 * this method with false will disable 'eval' and the 'Function' 7225 * constructor for code running in this context. If 'eval' or the 7226 * 'Function' constructor are used an exception will be thrown. 7227 * 7228 * If code generation from strings is not allowed the 7229 * V8::AllowCodeGenerationFromStrings callback will be invoked if 7230 * set before blocking the call to 'eval' or the 'Function' 7231 * constructor. If that callback returns true, the call will be 7232 * allowed, otherwise an exception will be thrown. If no callback is 7233 * set an exception will be thrown. 7234 */ 7235 void AllowCodeGenerationFromStrings(bool allow); 7236 7237 /** 7238 * Returns true if code generation from strings is allowed for the context. 7239 * For more details see AllowCodeGenerationFromStrings(bool) documentation. 7240 */ 7241 bool IsCodeGenerationFromStringsAllowed(); 7242 7243 /** 7244 * Sets the error description for the exception that is thrown when 7245 * code generation from strings is not allowed and 'eval' or the 'Function' 7246 * constructor are called. 7247 */ 7248 void SetErrorMessageForCodeGenerationFromStrings(Local<String> message); 7249 7250 /** 7251 * Estimate the memory in bytes retained by this context. 7252 */ 7253 size_t EstimatedSize(); 7254 7255 /** 7256 * Stack-allocated class which sets the execution context for all 7257 * operations executed within a local scope. 7258 */ 7259 class Scope { 7260 public: 7261 explicit V8_INLINE Scope(Local<Context> context) : context_(context) { 7262 context_->Enter(); 7263 } 7264 V8_INLINE ~Scope() { context_->Exit(); } 7265 7266 private: 7267 Local<Context> context_; 7268 }; 7269 7270 private: 7271 friend class Value; 7272 friend class Script; 7273 friend class Object; 7274 friend class Function; 7275 7276 Local<Value> SlowGetEmbedderData(int index); 7277 void* SlowGetAlignedPointerFromEmbedderData(int index); 7278}; 7279 7280 7281/** 7282 * Multiple threads in V8 are allowed, but only one thread at a time is allowed 7283 * to use any given V8 isolate, see the comments in the Isolate class. The 7284 * definition of 'using a V8 isolate' includes accessing handles or holding onto 7285 * object pointers obtained from V8 handles while in the particular V8 isolate. 7286 * It is up to the user of V8 to ensure, perhaps with locking, that this 7287 * constraint is not violated. In addition to any other synchronization 7288 * mechanism that may be used, the v8::Locker and v8::Unlocker classes must be 7289 * used to signal thead switches to V8. 7290 * 7291 * v8::Locker is a scoped lock object. While it's active, i.e. between its 7292 * construction and destruction, the current thread is allowed to use the locked 7293 * isolate. V8 guarantees that an isolate can be locked by at most one thread at 7294 * any time. In other words, the scope of a v8::Locker is a critical section. 7295 * 7296 * Sample usage: 7297* \code 7298 * ... 7299 * { 7300 * v8::Locker locker(isolate); 7301 * v8::Isolate::Scope isolate_scope(isolate); 7302 * ... 7303 * // Code using V8 and isolate goes here. 7304 * ... 7305 * } // Destructor called here 7306 * \endcode 7307 * 7308 * If you wish to stop using V8 in a thread A you can do this either by 7309 * destroying the v8::Locker object as above or by constructing a v8::Unlocker 7310 * object: 7311 * 7312 * \code 7313 * { 7314 * isolate->Exit(); 7315 * v8::Unlocker unlocker(isolate); 7316 * ... 7317 * // Code not using V8 goes here while V8 can run in another thread. 7318 * ... 7319 * } // Destructor called here. 7320 * isolate->Enter(); 7321 * \endcode 7322 * 7323 * The Unlocker object is intended for use in a long-running callback from V8, 7324 * where you want to release the V8 lock for other threads to use. 7325 * 7326 * The v8::Locker is a recursive lock, i.e. you can lock more than once in a 7327 * given thread. This can be useful if you have code that can be called either 7328 * from code that holds the lock or from code that does not. The Unlocker is 7329 * not recursive so you can not have several Unlockers on the stack at once, and 7330 * you can not use an Unlocker in a thread that is not inside a Locker's scope. 7331 * 7332 * An unlocker will unlock several lockers if it has to and reinstate the 7333 * correct depth of locking on its destruction, e.g.: 7334 * 7335 * \code 7336 * // V8 not locked. 7337 * { 7338 * v8::Locker locker(isolate); 7339 * Isolate::Scope isolate_scope(isolate); 7340 * // V8 locked. 7341 * { 7342 * v8::Locker another_locker(isolate); 7343 * // V8 still locked (2 levels). 7344 * { 7345 * isolate->Exit(); 7346 * v8::Unlocker unlocker(isolate); 7347 * // V8 not locked. 7348 * } 7349 * isolate->Enter(); 7350 * // V8 locked again (2 levels). 7351 * } 7352 * // V8 still locked (1 level). 7353 * } 7354 * // V8 Now no longer locked. 7355 * \endcode 7356 */ 7357class V8_EXPORT Unlocker { 7358 public: 7359 /** 7360 * Initialize Unlocker for a given Isolate. 7361 */ 7362 V8_INLINE explicit Unlocker(Isolate* isolate) { Initialize(isolate); } 7363 7364 ~Unlocker(); 7365 private: 7366 void Initialize(Isolate* isolate); 7367 7368 internal::Isolate* isolate_; 7369}; 7370 7371 7372class V8_EXPORT Locker { 7373 public: 7374 /** 7375 * Initialize Locker for a given Isolate. 7376 */ 7377 V8_INLINE explicit Locker(Isolate* isolate) { Initialize(isolate); } 7378 7379 ~Locker(); 7380 7381 /** 7382 * Returns whether or not the locker for a given isolate, is locked by the 7383 * current thread. 7384 */ 7385 static bool IsLocked(Isolate* isolate); 7386 7387 /** 7388 * Returns whether v8::Locker is being used by this V8 instance. 7389 */ 7390 static bool IsActive(); 7391 7392 private: 7393 void Initialize(Isolate* isolate); 7394 7395 bool has_lock_; 7396 bool top_level_; 7397 internal::Isolate* isolate_; 7398 7399 // Disallow copying and assigning. 7400 Locker(const Locker&); 7401 void operator=(const Locker&); 7402}; 7403 7404 7405// --- Implementation --- 7406 7407 7408namespace internal { 7409 7410const int kApiPointerSize = sizeof(void*); // NOLINT 7411const int kApiIntSize = sizeof(int); // NOLINT 7412const int kApiInt64Size = sizeof(int64_t); // NOLINT 7413 7414// Tag information for HeapObject. 7415const int kHeapObjectTag = 1; 7416const int kHeapObjectTagSize = 2; 7417const intptr_t kHeapObjectTagMask = (1 << kHeapObjectTagSize) - 1; 7418 7419// Tag information for Smi. 7420const int kSmiTag = 0; 7421const int kSmiTagSize = 1; 7422const intptr_t kSmiTagMask = (1 << kSmiTagSize) - 1; 7423 7424template <size_t ptr_size> struct SmiTagging; 7425 7426template<int kSmiShiftSize> 7427V8_INLINE internal::Object* IntToSmi(int value) { 7428 int smi_shift_bits = kSmiTagSize + kSmiShiftSize; 7429 uintptr_t tagged_value = 7430 (static_cast<uintptr_t>(value) << smi_shift_bits) | kSmiTag; 7431 return reinterpret_cast<internal::Object*>(tagged_value); 7432} 7433 7434// Smi constants for 32-bit systems. 7435template <> struct SmiTagging<4> { 7436 enum { kSmiShiftSize = 0, kSmiValueSize = 31 }; 7437 static int SmiShiftSize() { return kSmiShiftSize; } 7438 static int SmiValueSize() { return kSmiValueSize; } 7439 V8_INLINE static int SmiToInt(const internal::Object* value) { 7440 int shift_bits = kSmiTagSize + kSmiShiftSize; 7441 // Throw away top 32 bits and shift down (requires >> to be sign extending). 7442 return static_cast<int>(reinterpret_cast<intptr_t>(value)) >> shift_bits; 7443 } 7444 V8_INLINE static internal::Object* IntToSmi(int value) { 7445 return internal::IntToSmi<kSmiShiftSize>(value); 7446 } 7447 V8_INLINE static bool IsValidSmi(intptr_t value) { 7448 // To be representable as an tagged small integer, the two 7449 // most-significant bits of 'value' must be either 00 or 11 due to 7450 // sign-extension. To check this we add 01 to the two 7451 // most-significant bits, and check if the most-significant bit is 0 7452 // 7453 // CAUTION: The original code below: 7454 // bool result = ((value + 0x40000000) & 0x80000000) == 0; 7455 // may lead to incorrect results according to the C language spec, and 7456 // in fact doesn't work correctly with gcc4.1.1 in some cases: The 7457 // compiler may produce undefined results in case of signed integer 7458 // overflow. The computation must be done w/ unsigned ints. 7459 return static_cast<uintptr_t>(value + 0x40000000U) < 0x80000000U; 7460 } 7461}; 7462 7463// Smi constants for 64-bit systems. 7464template <> struct SmiTagging<8> { 7465 enum { kSmiShiftSize = 31, kSmiValueSize = 32 }; 7466 static int SmiShiftSize() { return kSmiShiftSize; } 7467 static int SmiValueSize() { return kSmiValueSize; } 7468 V8_INLINE static int SmiToInt(const internal::Object* value) { 7469 int shift_bits = kSmiTagSize + kSmiShiftSize; 7470 // Shift down and throw away top 32 bits. 7471 return static_cast<int>(reinterpret_cast<intptr_t>(value) >> shift_bits); 7472 } 7473 V8_INLINE static internal::Object* IntToSmi(int value) { 7474 return internal::IntToSmi<kSmiShiftSize>(value); 7475 } 7476 V8_INLINE static bool IsValidSmi(intptr_t value) { 7477 // To be representable as a long smi, the value must be a 32-bit integer. 7478 return (value == static_cast<int32_t>(value)); 7479 } 7480}; 7481 7482typedef SmiTagging<kApiPointerSize> PlatformSmiTagging; 7483const int kSmiShiftSize = PlatformSmiTagging::kSmiShiftSize; 7484const int kSmiValueSize = PlatformSmiTagging::kSmiValueSize; 7485V8_INLINE static bool SmiValuesAre31Bits() { return kSmiValueSize == 31; } 7486V8_INLINE static bool SmiValuesAre32Bits() { return kSmiValueSize == 32; } 7487 7488/** 7489 * This class exports constants and functionality from within v8 that 7490 * is necessary to implement inline functions in the v8 api. Don't 7491 * depend on functions and constants defined here. 7492 */ 7493class Internals { 7494 public: 7495 // These values match non-compiler-dependent values defined within 7496 // the implementation of v8. 7497 static const int kHeapObjectMapOffset = 0; 7498 static const int kMapInstanceTypeAndBitFieldOffset = 7499 1 * kApiPointerSize + kApiIntSize; 7500 static const int kStringResourceOffset = 3 * kApiPointerSize; 7501 7502 static const int kOddballKindOffset = 5 * kApiPointerSize + sizeof(double); 7503 static const int kForeignAddressOffset = kApiPointerSize; 7504 static const int kJSObjectHeaderSize = 3 * kApiPointerSize; 7505 static const int kFixedArrayHeaderSize = 2 * kApiPointerSize; 7506 static const int kContextHeaderSize = 2 * kApiPointerSize; 7507 static const int kContextEmbedderDataIndex = 5; 7508 static const int kFullStringRepresentationMask = 0x07; 7509 static const int kStringEncodingMask = 0x4; 7510 static const int kExternalTwoByteRepresentationTag = 0x02; 7511 static const int kExternalOneByteRepresentationTag = 0x06; 7512 7513 static const int kIsolateEmbedderDataOffset = 0 * kApiPointerSize; 7514 static const int kExternalMemoryOffset = 4 * kApiPointerSize; 7515 static const int kExternalMemoryLimitOffset = 7516 kExternalMemoryOffset + kApiInt64Size; 7517 static const int kIsolateRootsOffset = kExternalMemoryLimitOffset + 7518 kApiInt64Size + kApiInt64Size + 7519 kApiPointerSize + kApiPointerSize; 7520 static const int kUndefinedValueRootIndex = 4; 7521 static const int kTheHoleValueRootIndex = 5; 7522 static const int kNullValueRootIndex = 6; 7523 static const int kTrueValueRootIndex = 7; 7524 static const int kFalseValueRootIndex = 8; 7525 static const int kEmptyStringRootIndex = 9; 7526 7527 static const int kNodeClassIdOffset = 1 * kApiPointerSize; 7528 static const int kNodeFlagsOffset = 1 * kApiPointerSize + 3; 7529 static const int kNodeStateMask = 0x7; 7530 static const int kNodeStateIsWeakValue = 2; 7531 static const int kNodeStateIsPendingValue = 3; 7532 static const int kNodeStateIsNearDeathValue = 4; 7533 static const int kNodeIsIndependentShift = 3; 7534 static const int kNodeIsPartiallyDependentShift = 4; 7535 static const int kNodeIsActiveShift = 4; 7536 7537 static const int kJSObjectType = 0xb7; 7538 static const int kJSApiObjectType = 0xb6; 7539 static const int kFirstNonstringType = 0x80; 7540 static const int kOddballType = 0x83; 7541 static const int kForeignType = 0x87; 7542 7543 static const int kUndefinedOddballKind = 5; 7544 static const int kNullOddballKind = 3; 7545 7546 static const uint32_t kNumIsolateDataSlots = 4; 7547 7548 V8_EXPORT static void CheckInitializedImpl(v8::Isolate* isolate); 7549 V8_INLINE static void CheckInitialized(v8::Isolate* isolate) { 7550#ifdef V8_ENABLE_CHECKS 7551 CheckInitializedImpl(isolate); 7552#endif 7553 } 7554 7555 V8_INLINE static bool HasHeapObjectTag(const internal::Object* value) { 7556 return ((reinterpret_cast<intptr_t>(value) & kHeapObjectTagMask) == 7557 kHeapObjectTag); 7558 } 7559 7560 V8_INLINE static int SmiValue(const internal::Object* value) { 7561 return PlatformSmiTagging::SmiToInt(value); 7562 } 7563 7564 V8_INLINE static internal::Object* IntToSmi(int value) { 7565 return PlatformSmiTagging::IntToSmi(value); 7566 } 7567 7568 V8_INLINE static bool IsValidSmi(intptr_t value) { 7569 return PlatformSmiTagging::IsValidSmi(value); 7570 } 7571 7572 V8_INLINE static int GetInstanceType(const internal::Object* obj) { 7573 typedef internal::Object O; 7574 O* map = ReadField<O*>(obj, kHeapObjectMapOffset); 7575 // Map::InstanceType is defined so that it will always be loaded into 7576 // the LS 8 bits of one 16-bit word, regardless of endianess. 7577 return ReadField<uint16_t>(map, kMapInstanceTypeAndBitFieldOffset) & 0xff; 7578 } 7579 7580 V8_INLINE static int GetOddballKind(const internal::Object* obj) { 7581 typedef internal::Object O; 7582 return SmiValue(ReadField<O*>(obj, kOddballKindOffset)); 7583 } 7584 7585 V8_INLINE static bool IsExternalTwoByteString(int instance_type) { 7586 int representation = (instance_type & kFullStringRepresentationMask); 7587 return representation == kExternalTwoByteRepresentationTag; 7588 } 7589 7590 V8_INLINE static uint8_t GetNodeFlag(internal::Object** obj, int shift) { 7591 uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + kNodeFlagsOffset; 7592 return *addr & static_cast<uint8_t>(1U << shift); 7593 } 7594 7595 V8_INLINE static void UpdateNodeFlag(internal::Object** obj, 7596 bool value, int shift) { 7597 uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + kNodeFlagsOffset; 7598 uint8_t mask = static_cast<uint8_t>(1U << shift); 7599 *addr = static_cast<uint8_t>((*addr & ~mask) | (value << shift)); 7600 } 7601 7602 V8_INLINE static uint8_t GetNodeState(internal::Object** obj) { 7603 uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + kNodeFlagsOffset; 7604 return *addr & kNodeStateMask; 7605 } 7606 7607 V8_INLINE static void UpdateNodeState(internal::Object** obj, 7608 uint8_t value) { 7609 uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + kNodeFlagsOffset; 7610 *addr = static_cast<uint8_t>((*addr & ~kNodeStateMask) | value); 7611 } 7612 7613 V8_INLINE static void SetEmbedderData(v8::Isolate* isolate, 7614 uint32_t slot, 7615 void* data) { 7616 uint8_t* addr = reinterpret_cast<uint8_t*>(isolate) + 7617 kIsolateEmbedderDataOffset + slot * kApiPointerSize; 7618 *reinterpret_cast<void**>(addr) = data; 7619 } 7620 7621 V8_INLINE static void* GetEmbedderData(const v8::Isolate* isolate, 7622 uint32_t slot) { 7623 const uint8_t* addr = reinterpret_cast<const uint8_t*>(isolate) + 7624 kIsolateEmbedderDataOffset + slot * kApiPointerSize; 7625 return *reinterpret_cast<void* const*>(addr); 7626 } 7627 7628 V8_INLINE static internal::Object** GetRoot(v8::Isolate* isolate, 7629 int index) { 7630 uint8_t* addr = reinterpret_cast<uint8_t*>(isolate) + kIsolateRootsOffset; 7631 return reinterpret_cast<internal::Object**>(addr + index * kApiPointerSize); 7632 } 7633 7634 template <typename T> 7635 V8_INLINE static T ReadField(const internal::Object* ptr, int offset) { 7636 const uint8_t* addr = 7637 reinterpret_cast<const uint8_t*>(ptr) + offset - kHeapObjectTag; 7638 return *reinterpret_cast<const T*>(addr); 7639 } 7640 7641 template <typename T> 7642 V8_INLINE static T ReadEmbedderData(const v8::Context* context, int index) { 7643 typedef internal::Object O; 7644 typedef internal::Internals I; 7645 O* ctx = *reinterpret_cast<O* const*>(context); 7646 int embedder_data_offset = I::kContextHeaderSize + 7647 (internal::kApiPointerSize * I::kContextEmbedderDataIndex); 7648 O* embedder_data = I::ReadField<O*>(ctx, embedder_data_offset); 7649 int value_offset = 7650 I::kFixedArrayHeaderSize + (internal::kApiPointerSize * index); 7651 return I::ReadField<T>(embedder_data, value_offset); 7652 } 7653}; 7654 7655} // namespace internal 7656 7657 7658template <class T> 7659Local<T> Local<T>::New(Isolate* isolate, Local<T> that) { 7660 return New(isolate, that.val_); 7661} 7662 7663template <class T> 7664Local<T> Local<T>::New(Isolate* isolate, const PersistentBase<T>& that) { 7665 return New(isolate, that.val_); 7666} 7667 7668 7669template <class T> 7670Local<T> Local<T>::New(Isolate* isolate, T* that) { 7671 if (that == NULL) return Local<T>(); 7672 T* that_ptr = that; 7673 internal::Object** p = reinterpret_cast<internal::Object**>(that_ptr); 7674 return Local<T>(reinterpret_cast<T*>(HandleScope::CreateHandle( 7675 reinterpret_cast<internal::Isolate*>(isolate), *p))); 7676} 7677 7678 7679template<class T> 7680template<class S> 7681void Eternal<T>::Set(Isolate* isolate, Local<S> handle) { 7682 TYPE_CHECK(T, S); 7683 V8::Eternalize(isolate, reinterpret_cast<Value*>(*handle), &this->index_); 7684} 7685 7686 7687template<class T> 7688Local<T> Eternal<T>::Get(Isolate* isolate) { 7689 return Local<T>(reinterpret_cast<T*>(*V8::GetEternal(isolate, index_))); 7690} 7691 7692 7693template <class T> 7694Local<T> MaybeLocal<T>::ToLocalChecked() { 7695 if (V8_UNLIKELY(val_ == nullptr)) V8::ToLocalEmpty(); 7696 return Local<T>(val_); 7697} 7698 7699 7700template <class T> 7701void* WeakCallbackInfo<T>::GetInternalField(int index) const { 7702#ifdef V8_ENABLE_CHECKS 7703 if (index < 0 || index >= kInternalFieldsInWeakCallback) { 7704 V8::InternalFieldOutOfBounds(index); 7705 } 7706#endif 7707 return internal_fields_[index]; 7708} 7709 7710 7711template <class T> 7712T* PersistentBase<T>::New(Isolate* isolate, T* that) { 7713 if (that == NULL) return NULL; 7714 internal::Object** p = reinterpret_cast<internal::Object**>(that); 7715 return reinterpret_cast<T*>( 7716 V8::GlobalizeReference(reinterpret_cast<internal::Isolate*>(isolate), 7717 p)); 7718} 7719 7720 7721template <class T, class M> 7722template <class S, class M2> 7723void Persistent<T, M>::Copy(const Persistent<S, M2>& that) { 7724 TYPE_CHECK(T, S); 7725 this->Reset(); 7726 if (that.IsEmpty()) return; 7727 internal::Object** p = reinterpret_cast<internal::Object**>(that.val_); 7728 this->val_ = reinterpret_cast<T*>(V8::CopyPersistent(p)); 7729 M::Copy(that, this); 7730} 7731 7732 7733template <class T> 7734bool PersistentBase<T>::IsIndependent() const { 7735 typedef internal::Internals I; 7736 if (this->IsEmpty()) return false; 7737 return I::GetNodeFlag(reinterpret_cast<internal::Object**>(this->val_), 7738 I::kNodeIsIndependentShift); 7739} 7740 7741 7742template <class T> 7743bool PersistentBase<T>::IsNearDeath() const { 7744 typedef internal::Internals I; 7745 if (this->IsEmpty()) return false; 7746 uint8_t node_state = 7747 I::GetNodeState(reinterpret_cast<internal::Object**>(this->val_)); 7748 return node_state == I::kNodeStateIsNearDeathValue || 7749 node_state == I::kNodeStateIsPendingValue; 7750} 7751 7752 7753template <class T> 7754bool PersistentBase<T>::IsWeak() const { 7755 typedef internal::Internals I; 7756 if (this->IsEmpty()) return false; 7757 return I::GetNodeState(reinterpret_cast<internal::Object**>(this->val_)) == 7758 I::kNodeStateIsWeakValue; 7759} 7760 7761 7762template <class T> 7763void PersistentBase<T>::Reset() { 7764 if (this->IsEmpty()) return; 7765 V8::DisposeGlobal(reinterpret_cast<internal::Object**>(this->val_)); 7766 val_ = 0; 7767} 7768 7769 7770template <class T> 7771template <class S> 7772void PersistentBase<T>::Reset(Isolate* isolate, const Local<S>& other) { 7773 TYPE_CHECK(T, S); 7774 Reset(); 7775 if (other.IsEmpty()) return; 7776 this->val_ = New(isolate, other.val_); 7777} 7778 7779 7780template <class T> 7781template <class S> 7782void PersistentBase<T>::Reset(Isolate* isolate, 7783 const PersistentBase<S>& other) { 7784 TYPE_CHECK(T, S); 7785 Reset(); 7786 if (other.IsEmpty()) return; 7787 this->val_ = New(isolate, other.val_); 7788} 7789 7790 7791template <class T> 7792template <typename P> 7793V8_INLINE void PersistentBase<T>::SetWeak( 7794 P* parameter, typename WeakCallbackInfo<P>::Callback callback, 7795 WeakCallbackType type) { 7796 typedef typename WeakCallbackInfo<void>::Callback Callback; 7797 V8::MakeWeak(reinterpret_cast<internal::Object**>(this->val_), parameter, 7798 reinterpret_cast<Callback>(callback), type); 7799} 7800 7801template <class T> 7802void PersistentBase<T>::SetWeak() { 7803 V8::MakeWeak(reinterpret_cast<internal::Object***>(&this->val_)); 7804} 7805 7806template <class T> 7807template <typename P> 7808P* PersistentBase<T>::ClearWeak() { 7809 return reinterpret_cast<P*>( 7810 V8::ClearWeak(reinterpret_cast<internal::Object**>(this->val_))); 7811} 7812 7813template <class T> 7814void PersistentBase<T>::RegisterExternalReference(Isolate* isolate) const { 7815 if (IsEmpty()) return; 7816 V8::RegisterExternallyReferencedObject( 7817 reinterpret_cast<internal::Object**>(this->val_), 7818 reinterpret_cast<internal::Isolate*>(isolate)); 7819} 7820 7821template <class T> 7822void PersistentBase<T>::MarkIndependent() { 7823 typedef internal::Internals I; 7824 if (this->IsEmpty()) return; 7825 I::UpdateNodeFlag(reinterpret_cast<internal::Object**>(this->val_), 7826 true, 7827 I::kNodeIsIndependentShift); 7828} 7829 7830 7831template <class T> 7832void PersistentBase<T>::MarkPartiallyDependent() { 7833 typedef internal::Internals I; 7834 if (this->IsEmpty()) return; 7835 I::UpdateNodeFlag(reinterpret_cast<internal::Object**>(this->val_), 7836 true, 7837 I::kNodeIsPartiallyDependentShift); 7838} 7839 7840 7841template <class T> 7842void PersistentBase<T>::MarkActive() { 7843 typedef internal::Internals I; 7844 if (this->IsEmpty()) return; 7845 I::UpdateNodeFlag(reinterpret_cast<internal::Object**>(this->val_), true, 7846 I::kNodeIsActiveShift); 7847} 7848 7849 7850template <class T> 7851void PersistentBase<T>::SetWrapperClassId(uint16_t class_id) { 7852 typedef internal::Internals I; 7853 if (this->IsEmpty()) return; 7854 internal::Object** obj = reinterpret_cast<internal::Object**>(this->val_); 7855 uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + I::kNodeClassIdOffset; 7856 *reinterpret_cast<uint16_t*>(addr) = class_id; 7857} 7858 7859 7860template <class T> 7861uint16_t PersistentBase<T>::WrapperClassId() const { 7862 typedef internal::Internals I; 7863 if (this->IsEmpty()) return 0; 7864 internal::Object** obj = reinterpret_cast<internal::Object**>(this->val_); 7865 uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + I::kNodeClassIdOffset; 7866 return *reinterpret_cast<uint16_t*>(addr); 7867} 7868 7869 7870template<typename T> 7871ReturnValue<T>::ReturnValue(internal::Object** slot) : value_(slot) {} 7872 7873template<typename T> 7874template<typename S> 7875void ReturnValue<T>::Set(const Persistent<S>& handle) { 7876 TYPE_CHECK(T, S); 7877 if (V8_UNLIKELY(handle.IsEmpty())) { 7878 *value_ = GetDefaultValue(); 7879 } else { 7880 *value_ = *reinterpret_cast<internal::Object**>(*handle); 7881 } 7882} 7883 7884template <typename T> 7885template <typename S> 7886void ReturnValue<T>::Set(const Global<S>& handle) { 7887 TYPE_CHECK(T, S); 7888 if (V8_UNLIKELY(handle.IsEmpty())) { 7889 *value_ = GetDefaultValue(); 7890 } else { 7891 *value_ = *reinterpret_cast<internal::Object**>(*handle); 7892 } 7893} 7894 7895template <typename T> 7896template <typename S> 7897void ReturnValue<T>::Set(const Local<S> handle) { 7898 TYPE_CHECK(T, S); 7899 if (V8_UNLIKELY(handle.IsEmpty())) { 7900 *value_ = GetDefaultValue(); 7901 } else { 7902 *value_ = *reinterpret_cast<internal::Object**>(*handle); 7903 } 7904} 7905 7906template<typename T> 7907void ReturnValue<T>::Set(double i) { 7908 TYPE_CHECK(T, Number); 7909 Set(Number::New(GetIsolate(), i)); 7910} 7911 7912template<typename T> 7913void ReturnValue<T>::Set(int32_t i) { 7914 TYPE_CHECK(T, Integer); 7915 typedef internal::Internals I; 7916 if (V8_LIKELY(I::IsValidSmi(i))) { 7917 *value_ = I::IntToSmi(i); 7918 return; 7919 } 7920 Set(Integer::New(GetIsolate(), i)); 7921} 7922 7923template<typename T> 7924void ReturnValue<T>::Set(uint32_t i) { 7925 TYPE_CHECK(T, Integer); 7926 // Can't simply use INT32_MAX here for whatever reason. 7927 bool fits_into_int32_t = (i & (1U << 31)) == 0; 7928 if (V8_LIKELY(fits_into_int32_t)) { 7929 Set(static_cast<int32_t>(i)); 7930 return; 7931 } 7932 Set(Integer::NewFromUnsigned(GetIsolate(), i)); 7933} 7934 7935template<typename T> 7936void ReturnValue<T>::Set(bool value) { 7937 TYPE_CHECK(T, Boolean); 7938 typedef internal::Internals I; 7939 int root_index; 7940 if (value) { 7941 root_index = I::kTrueValueRootIndex; 7942 } else { 7943 root_index = I::kFalseValueRootIndex; 7944 } 7945 *value_ = *I::GetRoot(GetIsolate(), root_index); 7946} 7947 7948template<typename T> 7949void ReturnValue<T>::SetNull() { 7950 TYPE_CHECK(T, Primitive); 7951 typedef internal::Internals I; 7952 *value_ = *I::GetRoot(GetIsolate(), I::kNullValueRootIndex); 7953} 7954 7955template<typename T> 7956void ReturnValue<T>::SetUndefined() { 7957 TYPE_CHECK(T, Primitive); 7958 typedef internal::Internals I; 7959 *value_ = *I::GetRoot(GetIsolate(), I::kUndefinedValueRootIndex); 7960} 7961 7962template<typename T> 7963void ReturnValue<T>::SetEmptyString() { 7964 TYPE_CHECK(T, String); 7965 typedef internal::Internals I; 7966 *value_ = *I::GetRoot(GetIsolate(), I::kEmptyStringRootIndex); 7967} 7968 7969template <typename T> 7970Isolate* ReturnValue<T>::GetIsolate() const { 7971 // Isolate is always the pointer below the default value on the stack. 7972 return *reinterpret_cast<Isolate**>(&value_[-2]); 7973} 7974 7975template <typename T> 7976Local<Value> ReturnValue<T>::Get() const { 7977 typedef internal::Internals I; 7978 if (*value_ == *I::GetRoot(GetIsolate(), I::kTheHoleValueRootIndex)) 7979 return Local<Value>(*Undefined(GetIsolate())); 7980 return Local<Value>::New(GetIsolate(), reinterpret_cast<Value*>(value_)); 7981} 7982 7983template <typename T> 7984template <typename S> 7985void ReturnValue<T>::Set(S* whatever) { 7986 // Uncompilable to prevent inadvertent misuse. 7987 TYPE_CHECK(S*, Primitive); 7988} 7989 7990template<typename T> 7991internal::Object* ReturnValue<T>::GetDefaultValue() { 7992 // Default value is always the pointer below value_ on the stack. 7993 return value_[-1]; 7994} 7995 7996template <typename T> 7997FunctionCallbackInfo<T>::FunctionCallbackInfo(internal::Object** implicit_args, 7998 internal::Object** values, 7999 int length) 8000 : implicit_args_(implicit_args), values_(values), length_(length) {} 8001 8002template<typename T> 8003Local<Value> FunctionCallbackInfo<T>::operator[](int i) const { 8004 if (i < 0 || length_ <= i) return Local<Value>(*Undefined(GetIsolate())); 8005 return Local<Value>(reinterpret_cast<Value*>(values_ - i)); 8006} 8007 8008 8009template<typename T> 8010Local<Function> FunctionCallbackInfo<T>::Callee() const { 8011 return Local<Function>(reinterpret_cast<Function*>( 8012 &implicit_args_[kCalleeIndex])); 8013} 8014 8015 8016template<typename T> 8017Local<Object> FunctionCallbackInfo<T>::This() const { 8018 return Local<Object>(reinterpret_cast<Object*>(values_ + 1)); 8019} 8020 8021 8022template<typename T> 8023Local<Object> FunctionCallbackInfo<T>::Holder() const { 8024 return Local<Object>(reinterpret_cast<Object*>( 8025 &implicit_args_[kHolderIndex])); 8026} 8027 8028template <typename T> 8029Local<Value> FunctionCallbackInfo<T>::NewTarget() const { 8030 return Local<Value>( 8031 reinterpret_cast<Value*>(&implicit_args_[kNewTargetIndex])); 8032} 8033 8034template <typename T> 8035Local<Value> FunctionCallbackInfo<T>::Data() const { 8036 return Local<Value>(reinterpret_cast<Value*>(&implicit_args_[kDataIndex])); 8037} 8038 8039 8040template<typename T> 8041Isolate* FunctionCallbackInfo<T>::GetIsolate() const { 8042 return *reinterpret_cast<Isolate**>(&implicit_args_[kIsolateIndex]); 8043} 8044 8045 8046template<typename T> 8047ReturnValue<T> FunctionCallbackInfo<T>::GetReturnValue() const { 8048 return ReturnValue<T>(&implicit_args_[kReturnValueIndex]); 8049} 8050 8051 8052template<typename T> 8053bool FunctionCallbackInfo<T>::IsConstructCall() const { 8054 return !NewTarget()->IsUndefined(); 8055} 8056 8057 8058template<typename T> 8059int FunctionCallbackInfo<T>::Length() const { 8060 return length_; 8061} 8062 8063ScriptOrigin::ScriptOrigin(Local<Value> resource_name, 8064 Local<Integer> resource_line_offset, 8065 Local<Integer> resource_column_offset, 8066 Local<Boolean> resource_is_shared_cross_origin, 8067 Local<Integer> script_id, 8068 Local<Boolean> resource_is_embedder_debug_script, 8069 Local<Value> source_map_url, 8070 Local<Boolean> resource_is_opaque) 8071 : resource_name_(resource_name), 8072 resource_line_offset_(resource_line_offset), 8073 resource_column_offset_(resource_column_offset), 8074 options_(!resource_is_embedder_debug_script.IsEmpty() && 8075 resource_is_embedder_debug_script->IsTrue(), 8076 !resource_is_shared_cross_origin.IsEmpty() && 8077 resource_is_shared_cross_origin->IsTrue(), 8078 !resource_is_opaque.IsEmpty() && resource_is_opaque->IsTrue()), 8079 script_id_(script_id), 8080 source_map_url_(source_map_url) {} 8081 8082Local<Value> ScriptOrigin::ResourceName() const { return resource_name_; } 8083 8084 8085Local<Integer> ScriptOrigin::ResourceLineOffset() const { 8086 return resource_line_offset_; 8087} 8088 8089 8090Local<Integer> ScriptOrigin::ResourceColumnOffset() const { 8091 return resource_column_offset_; 8092} 8093 8094 8095Local<Integer> ScriptOrigin::ScriptID() const { return script_id_; } 8096 8097 8098Local<Value> ScriptOrigin::SourceMapUrl() const { return source_map_url_; } 8099 8100 8101ScriptCompiler::Source::Source(Local<String> string, const ScriptOrigin& origin, 8102 CachedData* data) 8103 : source_string(string), 8104 resource_name(origin.ResourceName()), 8105 resource_line_offset(origin.ResourceLineOffset()), 8106 resource_column_offset(origin.ResourceColumnOffset()), 8107 resource_options(origin.Options()), 8108 source_map_url(origin.SourceMapUrl()), 8109 cached_data(data) {} 8110 8111 8112ScriptCompiler::Source::Source(Local<String> string, 8113 CachedData* data) 8114 : source_string(string), cached_data(data) {} 8115 8116 8117ScriptCompiler::Source::~Source() { 8118 delete cached_data; 8119} 8120 8121 8122const ScriptCompiler::CachedData* ScriptCompiler::Source::GetCachedData() 8123 const { 8124 return cached_data; 8125} 8126 8127 8128Local<Boolean> Boolean::New(Isolate* isolate, bool value) { 8129 return value ? True(isolate) : False(isolate); 8130} 8131 8132 8133void Template::Set(Isolate* isolate, const char* name, v8::Local<Data> value) { 8134 Set(v8::String::NewFromUtf8(isolate, name, NewStringType::kNormal) 8135 .ToLocalChecked(), 8136 value); 8137} 8138 8139 8140Local<Value> Object::GetInternalField(int index) { 8141#ifndef V8_ENABLE_CHECKS 8142 typedef internal::Object O; 8143 typedef internal::HeapObject HO; 8144 typedef internal::Internals I; 8145 O* obj = *reinterpret_cast<O**>(this); 8146 // Fast path: If the object is a plain JSObject, which is the common case, we 8147 // know where to find the internal fields and can return the value directly. 8148 auto instance_type = I::GetInstanceType(obj); 8149 if (instance_type == I::kJSObjectType || 8150 instance_type == I::kJSApiObjectType) { 8151 int offset = I::kJSObjectHeaderSize + (internal::kApiPointerSize * index); 8152 O* value = I::ReadField<O*>(obj, offset); 8153 O** result = HandleScope::CreateHandle(reinterpret_cast<HO*>(obj), value); 8154 return Local<Value>(reinterpret_cast<Value*>(result)); 8155 } 8156#endif 8157 return SlowGetInternalField(index); 8158} 8159 8160 8161void* Object::GetAlignedPointerFromInternalField(int index) { 8162#ifndef V8_ENABLE_CHECKS 8163 typedef internal::Object O; 8164 typedef internal::Internals I; 8165 O* obj = *reinterpret_cast<O**>(this); 8166 // Fast path: If the object is a plain JSObject, which is the common case, we 8167 // know where to find the internal fields and can return the value directly. 8168 auto instance_type = I::GetInstanceType(obj); 8169 if (V8_LIKELY(instance_type == I::kJSObjectType || 8170 instance_type == I::kJSApiObjectType)) { 8171 int offset = I::kJSObjectHeaderSize + (internal::kApiPointerSize * index); 8172 return I::ReadField<void*>(obj, offset); 8173 } 8174#endif 8175 return SlowGetAlignedPointerFromInternalField(index); 8176} 8177 8178 8179String* String::Cast(v8::Value* value) { 8180#ifdef V8_ENABLE_CHECKS 8181 CheckCast(value); 8182#endif 8183 return static_cast<String*>(value); 8184} 8185 8186 8187Local<String> String::Empty(Isolate* isolate) { 8188 typedef internal::Object* S; 8189 typedef internal::Internals I; 8190 I::CheckInitialized(isolate); 8191 S* slot = I::GetRoot(isolate, I::kEmptyStringRootIndex); 8192 return Local<String>(reinterpret_cast<String*>(slot)); 8193} 8194 8195 8196String::ExternalStringResource* String::GetExternalStringResource() const { 8197 typedef internal::Object O; 8198 typedef internal::Internals I; 8199 O* obj = *reinterpret_cast<O* const*>(this); 8200 String::ExternalStringResource* result; 8201 if (I::IsExternalTwoByteString(I::GetInstanceType(obj))) { 8202 void* value = I::ReadField<void*>(obj, I::kStringResourceOffset); 8203 result = reinterpret_cast<String::ExternalStringResource*>(value); 8204 } else { 8205 result = NULL; 8206 } 8207#ifdef V8_ENABLE_CHECKS 8208 VerifyExternalStringResource(result); 8209#endif 8210 return result; 8211} 8212 8213 8214String::ExternalStringResourceBase* String::GetExternalStringResourceBase( 8215 String::Encoding* encoding_out) const { 8216 typedef internal::Object O; 8217 typedef internal::Internals I; 8218 O* obj = *reinterpret_cast<O* const*>(this); 8219 int type = I::GetInstanceType(obj) & I::kFullStringRepresentationMask; 8220 *encoding_out = static_cast<Encoding>(type & I::kStringEncodingMask); 8221 ExternalStringResourceBase* resource = NULL; 8222 if (type == I::kExternalOneByteRepresentationTag || 8223 type == I::kExternalTwoByteRepresentationTag) { 8224 void* value = I::ReadField<void*>(obj, I::kStringResourceOffset); 8225 resource = static_cast<ExternalStringResourceBase*>(value); 8226 } 8227#ifdef V8_ENABLE_CHECKS 8228 VerifyExternalStringResourceBase(resource, *encoding_out); 8229#endif 8230 return resource; 8231} 8232 8233 8234bool Value::IsUndefined() const { 8235#ifdef V8_ENABLE_CHECKS 8236 return FullIsUndefined(); 8237#else 8238 return QuickIsUndefined(); 8239#endif 8240} 8241 8242bool Value::QuickIsUndefined() const { 8243 typedef internal::Object O; 8244 typedef internal::Internals I; 8245 O* obj = *reinterpret_cast<O* const*>(this); 8246 if (!I::HasHeapObjectTag(obj)) return false; 8247 if (I::GetInstanceType(obj) != I::kOddballType) return false; 8248 return (I::GetOddballKind(obj) == I::kUndefinedOddballKind); 8249} 8250 8251 8252bool Value::IsNull() const { 8253#ifdef V8_ENABLE_CHECKS 8254 return FullIsNull(); 8255#else 8256 return QuickIsNull(); 8257#endif 8258} 8259 8260bool Value::QuickIsNull() const { 8261 typedef internal::Object O; 8262 typedef internal::Internals I; 8263 O* obj = *reinterpret_cast<O* const*>(this); 8264 if (!I::HasHeapObjectTag(obj)) return false; 8265 if (I::GetInstanceType(obj) != I::kOddballType) return false; 8266 return (I::GetOddballKind(obj) == I::kNullOddballKind); 8267} 8268 8269 8270bool Value::IsString() const { 8271#ifdef V8_ENABLE_CHECKS 8272 return FullIsString(); 8273#else 8274 return QuickIsString(); 8275#endif 8276} 8277 8278bool Value::QuickIsString() const { 8279 typedef internal::Object O; 8280 typedef internal::Internals I; 8281 O* obj = *reinterpret_cast<O* const*>(this); 8282 if (!I::HasHeapObjectTag(obj)) return false; 8283 return (I::GetInstanceType(obj) < I::kFirstNonstringType); 8284} 8285 8286 8287template <class T> Value* Value::Cast(T* value) { 8288 return static_cast<Value*>(value); 8289} 8290 8291 8292Local<Boolean> Value::ToBoolean() const { 8293 return ToBoolean(Isolate::GetCurrent()->GetCurrentContext()) 8294 .FromMaybe(Local<Boolean>()); 8295} 8296 8297 8298Local<Number> Value::ToNumber() const { 8299 return ToNumber(Isolate::GetCurrent()->GetCurrentContext()) 8300 .FromMaybe(Local<Number>()); 8301} 8302 8303 8304Local<String> Value::ToString() const { 8305 return ToString(Isolate::GetCurrent()->GetCurrentContext()) 8306 .FromMaybe(Local<String>()); 8307} 8308 8309 8310Local<String> Value::ToDetailString() const { 8311 return ToDetailString(Isolate::GetCurrent()->GetCurrentContext()) 8312 .FromMaybe(Local<String>()); 8313} 8314 8315 8316Local<Object> Value::ToObject() const { 8317 return ToObject(Isolate::GetCurrent()->GetCurrentContext()) 8318 .FromMaybe(Local<Object>()); 8319} 8320 8321 8322Local<Integer> Value::ToInteger() const { 8323 return ToInteger(Isolate::GetCurrent()->GetCurrentContext()) 8324 .FromMaybe(Local<Integer>()); 8325} 8326 8327 8328Local<Uint32> Value::ToUint32() const { 8329 return ToUint32(Isolate::GetCurrent()->GetCurrentContext()) 8330 .FromMaybe(Local<Uint32>()); 8331} 8332 8333 8334Local<Int32> Value::ToInt32() const { 8335 return ToInt32(Isolate::GetCurrent()->GetCurrentContext()) 8336 .FromMaybe(Local<Int32>()); 8337} 8338 8339 8340Boolean* Boolean::Cast(v8::Value* value) { 8341#ifdef V8_ENABLE_CHECKS 8342 CheckCast(value); 8343#endif 8344 return static_cast<Boolean*>(value); 8345} 8346 8347 8348Name* Name::Cast(v8::Value* value) { 8349#ifdef V8_ENABLE_CHECKS 8350 CheckCast(value); 8351#endif 8352 return static_cast<Name*>(value); 8353} 8354 8355 8356Symbol* Symbol::Cast(v8::Value* value) { 8357#ifdef V8_ENABLE_CHECKS 8358 CheckCast(value); 8359#endif 8360 return static_cast<Symbol*>(value); 8361} 8362 8363 8364Number* Number::Cast(v8::Value* value) { 8365#ifdef V8_ENABLE_CHECKS 8366 CheckCast(value); 8367#endif 8368 return static_cast<Number*>(value); 8369} 8370 8371 8372Integer* Integer::Cast(v8::Value* value) { 8373#ifdef V8_ENABLE_CHECKS 8374 CheckCast(value); 8375#endif 8376 return static_cast<Integer*>(value); 8377} 8378 8379 8380Int32* Int32::Cast(v8::Value* value) { 8381#ifdef V8_ENABLE_CHECKS 8382 CheckCast(value); 8383#endif 8384 return static_cast<Int32*>(value); 8385} 8386 8387 8388Uint32* Uint32::Cast(v8::Value* value) { 8389#ifdef V8_ENABLE_CHECKS 8390 CheckCast(value); 8391#endif 8392 return static_cast<Uint32*>(value); 8393} 8394 8395 8396Date* Date::Cast(v8::Value* value) { 8397#ifdef V8_ENABLE_CHECKS 8398 CheckCast(value); 8399#endif 8400 return static_cast<Date*>(value); 8401} 8402 8403 8404StringObject* StringObject::Cast(v8::Value* value) { 8405#ifdef V8_ENABLE_CHECKS 8406 CheckCast(value); 8407#endif 8408 return static_cast<StringObject*>(value); 8409} 8410 8411 8412SymbolObject* SymbolObject::Cast(v8::Value* value) { 8413#ifdef V8_ENABLE_CHECKS 8414 CheckCast(value); 8415#endif 8416 return static_cast<SymbolObject*>(value); 8417} 8418 8419 8420NumberObject* NumberObject::Cast(v8::Value* value) { 8421#ifdef V8_ENABLE_CHECKS 8422 CheckCast(value); 8423#endif 8424 return static_cast<NumberObject*>(value); 8425} 8426 8427 8428BooleanObject* BooleanObject::Cast(v8::Value* value) { 8429#ifdef V8_ENABLE_CHECKS 8430 CheckCast(value); 8431#endif 8432 return static_cast<BooleanObject*>(value); 8433} 8434 8435 8436RegExp* RegExp::Cast(v8::Value* value) { 8437#ifdef V8_ENABLE_CHECKS 8438 CheckCast(value); 8439#endif 8440 return static_cast<RegExp*>(value); 8441} 8442 8443 8444Object* Object::Cast(v8::Value* value) { 8445#ifdef V8_ENABLE_CHECKS 8446 CheckCast(value); 8447#endif 8448 return static_cast<Object*>(value); 8449} 8450 8451 8452Array* Array::Cast(v8::Value* value) { 8453#ifdef V8_ENABLE_CHECKS 8454 CheckCast(value); 8455#endif 8456 return static_cast<Array*>(value); 8457} 8458 8459 8460Map* Map::Cast(v8::Value* value) { 8461#ifdef V8_ENABLE_CHECKS 8462 CheckCast(value); 8463#endif 8464 return static_cast<Map*>(value); 8465} 8466 8467 8468Set* Set::Cast(v8::Value* value) { 8469#ifdef V8_ENABLE_CHECKS 8470 CheckCast(value); 8471#endif 8472 return static_cast<Set*>(value); 8473} 8474 8475 8476Promise* Promise::Cast(v8::Value* value) { 8477#ifdef V8_ENABLE_CHECKS 8478 CheckCast(value); 8479#endif 8480 return static_cast<Promise*>(value); 8481} 8482 8483 8484Proxy* Proxy::Cast(v8::Value* value) { 8485#ifdef V8_ENABLE_CHECKS 8486 CheckCast(value); 8487#endif 8488 return static_cast<Proxy*>(value); 8489} 8490 8491 8492Promise::Resolver* Promise::Resolver::Cast(v8::Value* value) { 8493#ifdef V8_ENABLE_CHECKS 8494 CheckCast(value); 8495#endif 8496 return static_cast<Promise::Resolver*>(value); 8497} 8498 8499 8500ArrayBuffer* ArrayBuffer::Cast(v8::Value* value) { 8501#ifdef V8_ENABLE_CHECKS 8502 CheckCast(value); 8503#endif 8504 return static_cast<ArrayBuffer*>(value); 8505} 8506 8507 8508ArrayBufferView* ArrayBufferView::Cast(v8::Value* value) { 8509#ifdef V8_ENABLE_CHECKS 8510 CheckCast(value); 8511#endif 8512 return static_cast<ArrayBufferView*>(value); 8513} 8514 8515 8516TypedArray* TypedArray::Cast(v8::Value* value) { 8517#ifdef V8_ENABLE_CHECKS 8518 CheckCast(value); 8519#endif 8520 return static_cast<TypedArray*>(value); 8521} 8522 8523 8524Uint8Array* Uint8Array::Cast(v8::Value* value) { 8525#ifdef V8_ENABLE_CHECKS 8526 CheckCast(value); 8527#endif 8528 return static_cast<Uint8Array*>(value); 8529} 8530 8531 8532Int8Array* Int8Array::Cast(v8::Value* value) { 8533#ifdef V8_ENABLE_CHECKS 8534 CheckCast(value); 8535#endif 8536 return static_cast<Int8Array*>(value); 8537} 8538 8539 8540Uint16Array* Uint16Array::Cast(v8::Value* value) { 8541#ifdef V8_ENABLE_CHECKS 8542 CheckCast(value); 8543#endif 8544 return static_cast<Uint16Array*>(value); 8545} 8546 8547 8548Int16Array* Int16Array::Cast(v8::Value* value) { 8549#ifdef V8_ENABLE_CHECKS 8550 CheckCast(value); 8551#endif 8552 return static_cast<Int16Array*>(value); 8553} 8554 8555 8556Uint32Array* Uint32Array::Cast(v8::Value* value) { 8557#ifdef V8_ENABLE_CHECKS 8558 CheckCast(value); 8559#endif 8560 return static_cast<Uint32Array*>(value); 8561} 8562 8563 8564Int32Array* Int32Array::Cast(v8::Value* value) { 8565#ifdef V8_ENABLE_CHECKS 8566 CheckCast(value); 8567#endif 8568 return static_cast<Int32Array*>(value); 8569} 8570 8571 8572Float32Array* Float32Array::Cast(v8::Value* value) { 8573#ifdef V8_ENABLE_CHECKS 8574 CheckCast(value); 8575#endif 8576 return static_cast<Float32Array*>(value); 8577} 8578 8579 8580Float64Array* Float64Array::Cast(v8::Value* value) { 8581#ifdef V8_ENABLE_CHECKS 8582 CheckCast(value); 8583#endif 8584 return static_cast<Float64Array*>(value); 8585} 8586 8587 8588Uint8ClampedArray* Uint8ClampedArray::Cast(v8::Value* value) { 8589#ifdef V8_ENABLE_CHECKS 8590 CheckCast(value); 8591#endif 8592 return static_cast<Uint8ClampedArray*>(value); 8593} 8594 8595 8596DataView* DataView::Cast(v8::Value* value) { 8597#ifdef V8_ENABLE_CHECKS 8598 CheckCast(value); 8599#endif 8600 return static_cast<DataView*>(value); 8601} 8602 8603 8604SharedArrayBuffer* SharedArrayBuffer::Cast(v8::Value* value) { 8605#ifdef V8_ENABLE_CHECKS 8606 CheckCast(value); 8607#endif 8608 return static_cast<SharedArrayBuffer*>(value); 8609} 8610 8611 8612Function* Function::Cast(v8::Value* value) { 8613#ifdef V8_ENABLE_CHECKS 8614 CheckCast(value); 8615#endif 8616 return static_cast<Function*>(value); 8617} 8618 8619 8620External* External::Cast(v8::Value* value) { 8621#ifdef V8_ENABLE_CHECKS 8622 CheckCast(value); 8623#endif 8624 return static_cast<External*>(value); 8625} 8626 8627 8628template<typename T> 8629Isolate* PropertyCallbackInfo<T>::GetIsolate() const { 8630 return *reinterpret_cast<Isolate**>(&args_[kIsolateIndex]); 8631} 8632 8633 8634template<typename T> 8635Local<Value> PropertyCallbackInfo<T>::Data() const { 8636 return Local<Value>(reinterpret_cast<Value*>(&args_[kDataIndex])); 8637} 8638 8639 8640template<typename T> 8641Local<Object> PropertyCallbackInfo<T>::This() const { 8642 return Local<Object>(reinterpret_cast<Object*>(&args_[kThisIndex])); 8643} 8644 8645 8646template<typename T> 8647Local<Object> PropertyCallbackInfo<T>::Holder() const { 8648 return Local<Object>(reinterpret_cast<Object*>(&args_[kHolderIndex])); 8649} 8650 8651 8652template<typename T> 8653ReturnValue<T> PropertyCallbackInfo<T>::GetReturnValue() const { 8654 return ReturnValue<T>(&args_[kReturnValueIndex]); 8655} 8656 8657template <typename T> 8658bool PropertyCallbackInfo<T>::ShouldThrowOnError() const { 8659 typedef internal::Internals I; 8660 return args_[kShouldThrowOnErrorIndex] != I::IntToSmi(0); 8661} 8662 8663 8664Local<Primitive> Undefined(Isolate* isolate) { 8665 typedef internal::Object* S; 8666 typedef internal::Internals I; 8667 I::CheckInitialized(isolate); 8668 S* slot = I::GetRoot(isolate, I::kUndefinedValueRootIndex); 8669 return Local<Primitive>(reinterpret_cast<Primitive*>(slot)); 8670} 8671 8672 8673Local<Primitive> Null(Isolate* isolate) { 8674 typedef internal::Object* S; 8675 typedef internal::Internals I; 8676 I::CheckInitialized(isolate); 8677 S* slot = I::GetRoot(isolate, I::kNullValueRootIndex); 8678 return Local<Primitive>(reinterpret_cast<Primitive*>(slot)); 8679} 8680 8681 8682Local<Boolean> True(Isolate* isolate) { 8683 typedef internal::Object* S; 8684 typedef internal::Internals I; 8685 I::CheckInitialized(isolate); 8686 S* slot = I::GetRoot(isolate, I::kTrueValueRootIndex); 8687 return Local<Boolean>(reinterpret_cast<Boolean*>(slot)); 8688} 8689 8690 8691Local<Boolean> False(Isolate* isolate) { 8692 typedef internal::Object* S; 8693 typedef internal::Internals I; 8694 I::CheckInitialized(isolate); 8695 S* slot = I::GetRoot(isolate, I::kFalseValueRootIndex); 8696 return Local<Boolean>(reinterpret_cast<Boolean*>(slot)); 8697} 8698 8699 8700void Isolate::SetData(uint32_t slot, void* data) { 8701 typedef internal::Internals I; 8702 I::SetEmbedderData(this, slot, data); 8703} 8704 8705 8706void* Isolate::GetData(uint32_t slot) { 8707 typedef internal::Internals I; 8708 return I::GetEmbedderData(this, slot); 8709} 8710 8711 8712uint32_t Isolate::GetNumberOfDataSlots() { 8713 typedef internal::Internals I; 8714 return I::kNumIsolateDataSlots; 8715} 8716 8717 8718int64_t Isolate::AdjustAmountOfExternalAllocatedMemory( 8719 int64_t change_in_bytes) { 8720 typedef internal::Internals I; 8721 int64_t* external_memory = reinterpret_cast<int64_t*>( 8722 reinterpret_cast<uint8_t*>(this) + I::kExternalMemoryOffset); 8723 const int64_t external_memory_limit = *reinterpret_cast<int64_t*>( 8724 reinterpret_cast<uint8_t*>(this) + I::kExternalMemoryLimitOffset); 8725 const int64_t amount = *external_memory + change_in_bytes; 8726 *external_memory = amount; 8727 if (change_in_bytes > 0 && amount > external_memory_limit) { 8728 ReportExternalAllocationLimitReached(); 8729 } 8730 return *external_memory; 8731} 8732 8733 8734template<typename T> 8735void Isolate::SetObjectGroupId(const Persistent<T>& object, 8736 UniqueId id) { 8737 TYPE_CHECK(Value, T); 8738 SetObjectGroupId(reinterpret_cast<v8::internal::Object**>(object.val_), id); 8739} 8740 8741 8742template<typename T> 8743void Isolate::SetReferenceFromGroup(UniqueId id, 8744 const Persistent<T>& object) { 8745 TYPE_CHECK(Value, T); 8746 SetReferenceFromGroup(id, 8747 reinterpret_cast<v8::internal::Object**>(object.val_)); 8748} 8749 8750 8751template<typename T, typename S> 8752void Isolate::SetReference(const Persistent<T>& parent, 8753 const Persistent<S>& child) { 8754 TYPE_CHECK(Object, T); 8755 TYPE_CHECK(Value, S); 8756 SetReference(reinterpret_cast<v8::internal::Object**>(parent.val_), 8757 reinterpret_cast<v8::internal::Object**>(child.val_)); 8758} 8759 8760 8761Local<Value> Context::GetEmbedderData(int index) { 8762#ifndef V8_ENABLE_CHECKS 8763 typedef internal::Object O; 8764 typedef internal::HeapObject HO; 8765 typedef internal::Internals I; 8766 HO* context = *reinterpret_cast<HO**>(this); 8767 O** result = 8768 HandleScope::CreateHandle(context, I::ReadEmbedderData<O*>(this, index)); 8769 return Local<Value>(reinterpret_cast<Value*>(result)); 8770#else 8771 return SlowGetEmbedderData(index); 8772#endif 8773} 8774 8775 8776void* Context::GetAlignedPointerFromEmbedderData(int index) { 8777#ifndef V8_ENABLE_CHECKS 8778 typedef internal::Internals I; 8779 return I::ReadEmbedderData<void*>(this, index); 8780#else 8781 return SlowGetAlignedPointerFromEmbedderData(index); 8782#endif 8783} 8784 8785 8786void V8::SetAllowCodeGenerationFromStringsCallback( 8787 AllowCodeGenerationFromStringsCallback callback) { 8788 Isolate* isolate = Isolate::GetCurrent(); 8789 isolate->SetAllowCodeGenerationFromStringsCallback(callback); 8790} 8791 8792 8793bool V8::IsDead() { 8794 Isolate* isolate = Isolate::GetCurrent(); 8795 return isolate->IsDead(); 8796} 8797 8798 8799bool V8::AddMessageListener(MessageCallback that, Local<Value> data) { 8800 Isolate* isolate = Isolate::GetCurrent(); 8801 return isolate->AddMessageListener(that, data); 8802} 8803 8804 8805void V8::RemoveMessageListeners(MessageCallback that) { 8806 Isolate* isolate = Isolate::GetCurrent(); 8807 isolate->RemoveMessageListeners(that); 8808} 8809 8810 8811void V8::SetFailedAccessCheckCallbackFunction( 8812 FailedAccessCheckCallback callback) { 8813 Isolate* isolate = Isolate::GetCurrent(); 8814 isolate->SetFailedAccessCheckCallbackFunction(callback); 8815} 8816 8817 8818void V8::SetCaptureStackTraceForUncaughtExceptions( 8819 bool capture, int frame_limit, StackTrace::StackTraceOptions options) { 8820 Isolate* isolate = Isolate::GetCurrent(); 8821 isolate->SetCaptureStackTraceForUncaughtExceptions(capture, frame_limit, 8822 options); 8823} 8824 8825 8826void V8::SetFatalErrorHandler(FatalErrorCallback callback) { 8827 Isolate* isolate = Isolate::GetCurrent(); 8828 isolate->SetFatalErrorHandler(callback); 8829} 8830 8831 8832void V8::RemoveGCPrologueCallback(GCCallback callback) { 8833 Isolate* isolate = Isolate::GetCurrent(); 8834 isolate->RemoveGCPrologueCallback( 8835 reinterpret_cast<v8::Isolate::GCCallback>(callback)); 8836} 8837 8838 8839void V8::RemoveGCEpilogueCallback(GCCallback callback) { 8840 Isolate* isolate = Isolate::GetCurrent(); 8841 isolate->RemoveGCEpilogueCallback( 8842 reinterpret_cast<v8::Isolate::GCCallback>(callback)); 8843} 8844 8845void V8::TerminateExecution(Isolate* isolate) { isolate->TerminateExecution(); } 8846 8847 8848bool V8::IsExecutionTerminating(Isolate* isolate) { 8849 if (isolate == NULL) { 8850 isolate = Isolate::GetCurrent(); 8851 } 8852 return isolate->IsExecutionTerminating(); 8853} 8854 8855 8856void V8::CancelTerminateExecution(Isolate* isolate) { 8857 isolate->CancelTerminateExecution(); 8858} 8859 8860 8861void V8::VisitExternalResources(ExternalResourceVisitor* visitor) { 8862 Isolate* isolate = Isolate::GetCurrent(); 8863 isolate->VisitExternalResources(visitor); 8864} 8865 8866 8867void V8::VisitHandlesWithClassIds(PersistentHandleVisitor* visitor) { 8868 Isolate* isolate = Isolate::GetCurrent(); 8869 isolate->VisitHandlesWithClassIds(visitor); 8870} 8871 8872 8873void V8::VisitHandlesWithClassIds(Isolate* isolate, 8874 PersistentHandleVisitor* visitor) { 8875 isolate->VisitHandlesWithClassIds(visitor); 8876} 8877 8878 8879void V8::VisitHandlesForPartialDependence(Isolate* isolate, 8880 PersistentHandleVisitor* visitor) { 8881 isolate->VisitHandlesForPartialDependence(visitor); 8882} 8883 8884/** 8885 * \example shell.cc 8886 * A simple shell that takes a list of expressions on the 8887 * command-line and executes them. 8888 */ 8889 8890 8891/** 8892 * \example process.cc 8893 */ 8894 8895 8896} // namespace v8 8897 8898 8899#undef TYPE_CHECK 8900 8901 8902#endif // INCLUDE_V8_H_ 8903