/* * Copyright (C) 2006-2008 The Android Open Source Project * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package com.android.server.am; import static android.Manifest.permission.CHANGE_CONFIGURATION; import static android.Manifest.permission.CHANGE_DEVICE_IDLE_TEMP_WHITELIST; import static android.Manifest.permission.INTERACT_ACROSS_USERS; import static android.Manifest.permission.INTERACT_ACROSS_USERS_FULL; import static android.Manifest.permission.INTERNAL_SYSTEM_WINDOW; import static android.Manifest.permission.MANAGE_ACTIVITY_STACKS; import static android.Manifest.permission.READ_FRAME_BUFFER; import static android.Manifest.permission.REMOVE_TASKS; import static android.Manifest.permission.START_TASKS_FROM_RECENTS; import static android.app.ActivityManager.DOCKED_STACK_CREATE_MODE_TOP_OR_LEFT; import static android.app.ActivityManager.LOCK_TASK_MODE_NONE; import static android.app.ActivityManager.RESIZE_MODE_PRESERVE_WINDOW; import static android.app.ActivityManager.StackId.INVALID_STACK_ID; import static android.app.WindowConfiguration.ACTIVITY_TYPE_STANDARD; import static android.app.WindowConfiguration.ACTIVITY_TYPE_UNDEFINED; import static android.app.WindowConfiguration.WINDOWING_MODE_FREEFORM; import static android.app.WindowConfiguration.WINDOWING_MODE_FULLSCREEN; import static android.app.WindowConfiguration.WINDOWING_MODE_FULLSCREEN_OR_SPLIT_SCREEN_SECONDARY; import static android.app.WindowConfiguration.WINDOWING_MODE_PINNED; import static android.app.WindowConfiguration.WINDOWING_MODE_SPLIT_SCREEN_PRIMARY; import static android.app.WindowConfiguration.WINDOWING_MODE_UNDEFINED; import static android.content.pm.PackageManager.FEATURE_ACTIVITIES_ON_SECONDARY_DISPLAYS; import static android.content.pm.PackageManager.FEATURE_FREEFORM_WINDOW_MANAGEMENT; import static android.content.pm.PackageManager.FEATURE_LEANBACK_ONLY; import static android.content.pm.PackageManager.FEATURE_PICTURE_IN_PICTURE; import static android.content.pm.PackageManager.GET_PROVIDERS; import static android.content.pm.PackageManager.MATCH_ANY_USER; import static android.content.pm.PackageManager.MATCH_DEBUG_TRIAGED_MISSING; import static android.content.pm.PackageManager.MATCH_DIRECT_BOOT_AWARE; import static android.content.pm.PackageManager.MATCH_DIRECT_BOOT_UNAWARE; import static android.content.pm.PackageManager.MATCH_SYSTEM_ONLY; import static android.content.pm.PackageManager.MATCH_UNINSTALLED_PACKAGES; import static android.content.pm.PackageManager.PERMISSION_GRANTED; import static android.content.res.Configuration.UI_MODE_TYPE_TELEVISION; import static android.net.NetworkPolicyManager.isProcStateAllowedWhileIdleOrPowerSaveMode; import static android.net.NetworkPolicyManager.isProcStateAllowedWhileOnRestrictBackground; import static android.os.Build.VERSION_CODES.N; import static android.os.IServiceManager.DUMP_FLAG_PRIORITY_CRITICAL; import static android.os.IServiceManager.DUMP_FLAG_PRIORITY_HIGH; import static android.os.IServiceManager.DUMP_FLAG_PRIORITY_NORMAL; import static android.os.IServiceManager.DUMP_FLAG_PROTO; import static android.os.Process.BLUETOOTH_UID; import static android.os.Process.FIRST_APPLICATION_UID; import static android.os.Process.FIRST_ISOLATED_UID; import static android.os.Process.LAST_ISOLATED_UID; import static android.os.Process.NFC_UID; import static android.os.Process.PHONE_UID; import static android.os.Process.PROC_CHAR; import static android.os.Process.PROC_OUT_LONG; import static android.os.Process.PROC_PARENS; import static android.os.Process.PROC_SPACE_TERM; import static android.os.Process.ProcessStartResult; import static android.os.Process.ROOT_UID; import static android.os.Process.SCHED_FIFO; import static android.os.Process.SCHED_OTHER; import static android.os.Process.SCHED_RESET_ON_FORK; import static android.os.Process.SHELL_UID; import static android.os.Process.SIGNAL_QUIT; import static android.os.Process.SIGNAL_USR1; import static android.os.Process.SYSTEM_UID; import static android.os.Process.THREAD_GROUP_BG_NONINTERACTIVE; import static android.os.Process.THREAD_GROUP_DEFAULT; import static android.os.Process.THREAD_GROUP_TOP_APP; import static android.os.Process.THREAD_PRIORITY_BACKGROUND; import static android.os.Process.THREAD_PRIORITY_FOREGROUND; import static android.os.Process.getFreeMemory; import static android.os.Process.getTotalMemory; import static android.os.Process.isThreadInProcess; import static android.os.Process.killProcess; import static android.os.Process.killProcessQuiet; import static android.os.Process.myPid; import static android.os.Process.myUid; import static android.os.Process.readProcFile; import static android.os.Process.removeAllProcessGroups; import static android.os.Process.sendSignal; import static android.os.Process.setProcessGroup; import static android.os.Process.setThreadPriority; import static android.os.Process.setThreadScheduler; import static android.os.Process.startWebView; import static android.os.Process.zygoteProcess; import static android.provider.Settings.Global.ALWAYS_FINISH_ACTIVITIES; import static android.provider.Settings.Global.DEBUG_APP; import static android.provider.Settings.Global.DEVELOPMENT_ENABLE_FREEFORM_WINDOWS_SUPPORT; import static android.provider.Settings.Global.DEVELOPMENT_FORCE_RESIZABLE_ACTIVITIES; import static android.provider.Settings.Global.DEVELOPMENT_FORCE_RTL; import static android.provider.Settings.Global.NETWORK_ACCESS_TIMEOUT_MS; import static android.provider.Settings.Global.WAIT_FOR_DEBUGGER; import static android.provider.Settings.System.FONT_SCALE; import static android.service.voice.VoiceInteractionSession.SHOW_SOURCE_APPLICATION; import static android.text.format.DateUtils.DAY_IN_MILLIS; import static android.view.Display.DEFAULT_DISPLAY; import static android.view.Display.INVALID_DISPLAY; import static com.android.internal.util.XmlUtils.readBooleanAttribute; import static com.android.internal.util.XmlUtils.readIntAttribute; import static com.android.internal.util.XmlUtils.readLongAttribute; import static com.android.internal.util.XmlUtils.writeBooleanAttribute; import static com.android.internal.util.XmlUtils.writeIntAttribute; import static com.android.internal.util.XmlUtils.writeLongAttribute; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_ALL; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_ANR; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_BACKGROUND_CHECK; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_BACKUP; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_BROADCAST; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_BROADCAST_BACKGROUND; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_BROADCAST_LIGHT; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_CLEANUP; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_CONFIGURATION; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_FOCUS; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_IMMERSIVE; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_LOCKTASK; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_LRU; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_MU; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_NETWORK; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_OOM_ADJ; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_OOM_ADJ_REASON; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_PERMISSIONS_REVIEW; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_POWER; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_PROCESSES; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_PROCESS_OBSERVERS; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_PROVIDER; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_PSS; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_SERVICE; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_STACK; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_SWITCH; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_TASKS; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_UID_OBSERVERS; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_URI_PERMISSION; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_USAGE_STATS; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_VISIBILITY; import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_WHITELISTS; import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_BACKUP; import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_BROADCAST; import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_CLEANUP; import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_CONFIGURATION; import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_FOCUS; import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_IMMERSIVE; import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_LOCKTASK; import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_LRU; import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_MU; import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_NETWORK; import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_OOM_ADJ; import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_POWER; import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_PROCESSES; import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_PROCESS_OBSERVERS; import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_PROVIDER; import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_PSS; import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_RECENTS; import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_SERVICE; import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_STACK; import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_SWITCH; import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_UID_OBSERVERS; import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_URI_PERMISSION; import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_VISIBILITY; import static com.android.server.am.ActivityManagerDebugConfig.TAG_AM; import static com.android.server.am.ActivityManagerDebugConfig.TAG_WITH_CLASS_NAME; import static com.android.server.am.ActivityStackSupervisor.DEFER_RESUME; import static com.android.server.am.ActivityStackSupervisor.MATCH_TASK_IN_STACKS_ONLY; import static com.android.server.am.ActivityStackSupervisor.MATCH_TASK_IN_STACKS_OR_RECENT_TASKS; import static com.android.server.am.ActivityStackSupervisor.ON_TOP; import static com.android.server.am.ActivityStackSupervisor.PRESERVE_WINDOWS; import static com.android.server.am.ActivityStackSupervisor.REMOVE_FROM_RECENTS; import static com.android.server.am.TaskRecord.INVALID_TASK_ID; import static com.android.server.am.TaskRecord.LOCK_TASK_AUTH_DONT_LOCK; import static com.android.server.am.TaskRecord.REPARENT_KEEP_STACK_AT_FRONT; import static com.android.server.am.TaskRecord.REPARENT_LEAVE_STACK_IN_PLACE; import static com.android.server.wm.AppTransition.TRANSIT_ACTIVITY_OPEN; import static com.android.server.wm.AppTransition.TRANSIT_NONE; import static com.android.server.wm.AppTransition.TRANSIT_TASK_IN_PLACE; import static com.android.server.wm.AppTransition.TRANSIT_TASK_OPEN; import static com.android.server.wm.AppTransition.TRANSIT_TASK_TO_FRONT; import static org.xmlpull.v1.XmlPullParser.END_DOCUMENT; import static org.xmlpull.v1.XmlPullParser.START_TAG; import android.Manifest; import android.Manifest.permission; import android.annotation.NonNull; import android.annotation.Nullable; import android.annotation.UserIdInt; import android.app.Activity; import android.app.ActivityManager; import android.app.ActivityManager.RunningTaskInfo; import android.app.ActivityManager.StackInfo; import android.app.ActivityManager.TaskSnapshot; import android.app.ActivityManagerInternal; import android.app.ActivityManagerInternal.SleepToken; import android.app.ActivityOptions; import android.app.ActivityThread; import android.app.AlertDialog; import android.app.AppGlobals; import android.app.AppOpsManager; import android.app.ApplicationErrorReport; import android.app.ApplicationThreadConstants; import android.app.BroadcastOptions; import android.app.ContentProviderHolder; import android.app.Dialog; import android.app.IActivityController; import android.app.IActivityManager; import android.app.IApplicationThread; import android.app.IInstrumentationWatcher; import android.app.INotificationManager; import android.app.IProcessObserver; import android.app.IServiceConnection; import android.app.IStopUserCallback; import android.app.ITaskStackListener; import android.app.IUiAutomationConnection; import android.app.IUidObserver; import android.app.IUserSwitchObserver; import android.app.Instrumentation; import android.app.Notification; import android.app.NotificationManager; import android.app.PendingIntent; import android.app.PictureInPictureParams; import android.app.ProfilerInfo; import android.app.RemoteAction; import android.app.WaitResult; import android.app.WindowConfiguration.ActivityType; import android.app.WindowConfiguration.WindowingMode; import android.app.admin.DevicePolicyManager; import android.app.assist.AssistContent; import android.app.assist.AssistStructure; import android.app.backup.IBackupManager; import android.app.usage.UsageEvents; import android.app.usage.UsageStatsManagerInternal; import android.appwidget.AppWidgetManager; import android.content.ActivityNotFoundException; import android.content.BroadcastReceiver; import android.content.ClipData; import android.content.ComponentCallbacks2; import android.content.ComponentName; import android.content.ContentProvider; import android.content.ContentResolver; import android.content.Context; import android.content.DialogInterface; import android.content.IContentProvider; import android.content.IIntentReceiver; import android.content.IIntentSender; import android.content.Intent; import android.content.IntentFilter; import android.content.pm.ActivityInfo; import android.content.pm.ApplicationInfo; import android.content.pm.ConfigurationInfo; import android.content.pm.IPackageDataObserver; import android.content.pm.IPackageManager; import android.content.pm.InstrumentationInfo; import android.content.pm.PackageInfo; import android.content.pm.PackageManager; import android.content.pm.PackageManagerInternal; import android.content.pm.PackageManager.NameNotFoundException; import android.content.pm.ParceledListSlice; import android.content.pm.PathPermission; import android.content.pm.PermissionInfo; import android.content.pm.ProviderInfo; import android.content.pm.ResolveInfo; import android.content.pm.SELinuxUtil; import android.content.pm.ServiceInfo; import android.content.pm.UserInfo; import android.content.res.CompatibilityInfo; import android.content.res.Configuration; import android.content.res.Resources; import android.database.ContentObserver; import android.graphics.Bitmap; import android.graphics.Point; import android.graphics.Rect; import android.location.LocationManager; import android.media.audiofx.AudioEffect; import android.metrics.LogMaker; import android.net.Proxy; import android.net.ProxyInfo; import android.net.Uri; import android.os.BatteryStats; import android.os.Binder; import android.os.Build; import android.os.Bundle; import android.os.Debug; import android.os.DropBoxManager; import android.os.Environment; import android.os.FactoryTest; import android.os.FileObserver; import android.os.FileUtils; import android.os.Handler; import android.os.IBinder; import android.os.IDeviceIdentifiersPolicyService; import android.os.IPermissionController; import android.os.IProcessInfoService; import android.os.IProgressListener; import android.os.LocaleList; import android.os.Looper; import android.os.Message; import android.os.Parcel; import android.os.ParcelFileDescriptor; import android.os.PersistableBundle; import android.os.PowerManager; import android.os.PowerManagerInternal; import android.os.Process; import android.os.RemoteCallbackList; import android.os.RemoteException; import android.os.ResultReceiver; import android.os.ServiceManager; import android.os.ShellCallback; import android.os.StrictMode; import android.os.SystemClock; import android.os.SystemProperties; import android.os.Trace; import android.os.TransactionTooLargeException; import android.os.UpdateLock; import android.os.UserHandle; import android.os.UserManager; import android.os.WorkSource; import android.os.storage.IStorageManager; import android.os.storage.StorageManager; import android.os.storage.StorageManagerInternal; import android.provider.Downloads; import android.provider.Settings; import android.service.voice.IVoiceInteractionSession; import android.service.voice.VoiceInteractionManagerInternal; import android.service.voice.VoiceInteractionSession; import android.telecom.TelecomManager; import android.text.TextUtils; import android.text.format.DateUtils; import android.text.format.Time; import android.text.style.SuggestionSpan; import android.util.ArrayMap; import android.util.ArraySet; import android.util.AtomicFile; import android.util.StatsLog; import android.util.TimingsTraceLog; import android.util.DebugUtils; import android.util.DisplayMetrics; import android.util.EventLog; import android.util.Log; import android.util.Pair; import android.util.PrintWriterPrinter; import android.util.Slog; import android.util.SparseArray; import android.util.SparseIntArray; import android.util.TimeUtils; import android.util.Xml; import android.util.proto.ProtoOutputStream; import android.view.Gravity; import android.view.LayoutInflater; import android.view.View; import android.view.WindowManager; import com.android.internal.R; import com.android.internal.annotations.GuardedBy; import com.android.internal.annotations.VisibleForTesting; import com.android.internal.app.AssistUtils; import com.android.internal.app.DumpHeapActivity; import com.android.internal.app.IAppOpsCallback; import com.android.internal.app.IAppOpsService; import com.android.internal.app.IVoiceInteractor; import com.android.internal.app.ProcessMap; import com.android.internal.app.SystemUserHomeActivity; import com.android.internal.app.procstats.ProcessStats; import com.android.internal.logging.MetricsLogger; import com.android.internal.logging.nano.MetricsProto.MetricsEvent; import com.android.internal.messages.nano.SystemMessageProto.SystemMessage; import com.android.internal.notification.SystemNotificationChannels; import com.android.internal.os.BackgroundThread; import com.android.internal.os.BatteryStatsImpl; import com.android.internal.os.BinderInternal; import com.android.internal.os.IResultReceiver; import com.android.internal.os.ProcessCpuTracker; import com.android.internal.os.TransferPipe; import com.android.internal.os.Zygote; import com.android.internal.policy.IKeyguardDismissCallback; import com.android.internal.telephony.TelephonyIntents; import com.android.internal.util.ArrayUtils; import com.android.internal.util.DumpUtils; import com.android.internal.util.FastPrintWriter; import com.android.internal.util.FastXmlSerializer; import com.android.internal.util.MemInfoReader; import com.android.internal.util.Preconditions; import com.android.server.AppOpsService; import com.android.server.AttributeCache; import com.android.server.DeviceIdleController; import com.android.server.IntentResolver; import com.android.server.LocalServices; import com.android.server.LockGuard; import com.android.server.NetworkManagementInternal; import com.android.server.RescueParty; import com.android.server.ServiceThread; import com.android.server.SystemConfig; import com.android.server.SystemService; import com.android.server.SystemServiceManager; import com.android.server.ThreadPriorityBooster; import com.android.server.Watchdog; import com.android.server.am.ActivityStack.ActivityState; import com.android.server.am.proto.ActivityManagerServiceProto; import com.android.server.am.proto.BroadcastProto; import com.android.server.am.proto.StickyBroadcastProto; import com.android.server.firewall.IntentFirewall; import com.android.server.job.JobSchedulerInternal; import com.android.server.pm.Installer; import com.android.server.pm.Installer.InstallerException; import com.android.server.utils.PriorityDump; import com.android.server.vr.VrManagerInternal; import com.android.server.wm.PinnedStackWindowController; import com.android.server.wm.WindowManagerService; import com.google.android.collect.Lists; import com.google.android.collect.Maps; import org.xmlpull.v1.XmlPullParser; import org.xmlpull.v1.XmlPullParserException; import org.xmlpull.v1.XmlSerializer; import java.io.File; import java.io.FileDescriptor; import java.io.FileInputStream; import java.io.FileNotFoundException; import java.io.FileOutputStream; import java.io.IOException; import java.io.InputStreamReader; import java.io.PrintWriter; import java.io.StringWriter; import java.io.UnsupportedEncodingException; import java.lang.ref.WeakReference; import java.nio.charset.StandardCharsets; import java.text.DateFormat; import java.text.SimpleDateFormat; import java.util.ArrayList; import java.util.Arrays; import java.util.Collections; import java.util.Comparator; import java.util.Date; import java.util.HashMap; import java.util.HashSet; import java.util.Iterator; import java.util.List; import java.util.Locale; import java.util.Map; import java.util.Objects; import java.util.Set; import java.util.concurrent.CountDownLatch; import java.util.concurrent.atomic.AtomicBoolean; import java.util.concurrent.atomic.AtomicLong; import dalvik.system.VMRuntime; import libcore.io.IoUtils; import libcore.util.EmptyArray; public class ActivityManagerService extends IActivityManager.Stub implements Watchdog.Monitor, BatteryStatsImpl.BatteryCallback { /** * Priority we boost main thread and RT of top app to. */ public static final int TOP_APP_PRIORITY_BOOST = -10; private static final String TAG = TAG_WITH_CLASS_NAME ? "ActivityManagerService" : TAG_AM; private static final String TAG_BACKUP = TAG + POSTFIX_BACKUP; private static final String TAG_BROADCAST = TAG + POSTFIX_BROADCAST; private static final String TAG_CLEANUP = TAG + POSTFIX_CLEANUP; private static final String TAG_CONFIGURATION = TAG + POSTFIX_CONFIGURATION; private static final String TAG_FOCUS = TAG + POSTFIX_FOCUS; private static final String TAG_IMMERSIVE = TAG + POSTFIX_IMMERSIVE; private static final String TAG_LOCKTASK = TAG + POSTFIX_LOCKTASK; private static final String TAG_LRU = TAG + POSTFIX_LRU; private static final String TAG_MU = TAG + POSTFIX_MU; private static final String TAG_NETWORK = TAG + POSTFIX_NETWORK; private static final String TAG_OOM_ADJ = TAG + POSTFIX_OOM_ADJ; private static final String TAG_POWER = TAG + POSTFIX_POWER; private static final String TAG_PROCESS_OBSERVERS = TAG + POSTFIX_PROCESS_OBSERVERS; private static final String TAG_PROCESSES = TAG + POSTFIX_PROCESSES; private static final String TAG_PROVIDER = TAG + POSTFIX_PROVIDER; private static final String TAG_PSS = TAG + POSTFIX_PSS; private static final String TAG_RECENTS = TAG + POSTFIX_RECENTS; private static final String TAG_SERVICE = TAG + POSTFIX_SERVICE; private static final String TAG_STACK = TAG + POSTFIX_STACK; private static final String TAG_SWITCH = TAG + POSTFIX_SWITCH; private static final String TAG_UID_OBSERVERS = TAG + POSTFIX_UID_OBSERVERS; private static final String TAG_URI_PERMISSION = TAG + POSTFIX_URI_PERMISSION; private static final String TAG_VISIBILITY = TAG + POSTFIX_VISIBILITY; // Mock "pretend we're idle now" broadcast action to the job scheduler; declared // here so that while the job scheduler can depend on AMS, the other way around // need not be the case. public static final String ACTION_TRIGGER_IDLE = "com.android.server.ACTION_TRIGGER_IDLE"; /** Control over CPU and battery monitoring */ // write battery stats every 30 minutes. static final long BATTERY_STATS_TIME = 30 * 60 * 1000; static final boolean MONITOR_CPU_USAGE = true; // don't sample cpu less than every 5 seconds. static final long MONITOR_CPU_MIN_TIME = 5 * 1000; // wait possibly forever for next cpu sample. static final long MONITOR_CPU_MAX_TIME = 0x0fffffff; static final boolean MONITOR_THREAD_CPU_USAGE = false; // The flags that are set for all calls we make to the package manager. static final int STOCK_PM_FLAGS = PackageManager.GET_SHARED_LIBRARY_FILES; static final String SYSTEM_DEBUGGABLE = "ro.debuggable"; // Amount of time after a call to stopAppSwitches() during which we will // prevent further untrusted switches from happening. static final long APP_SWITCH_DELAY_TIME = 5*1000; // How long we wait for a launched process to attach to the activity manager // before we decide it's never going to come up for real. static final int PROC_START_TIMEOUT = 10*1000; // How long we wait for an attached process to publish its content providers // before we decide it must be hung. static final int CONTENT_PROVIDER_PUBLISH_TIMEOUT = 10*1000; // How long we wait for a launched process to attach to the activity manager // before we decide it's never going to come up for real, when the process was // started with a wrapper for instrumentation (such as Valgrind) because it // could take much longer than usual. static final int PROC_START_TIMEOUT_WITH_WRAPPER = 1200*1000; // How long we allow a receiver to run before giving up on it. static final int BROADCAST_FG_TIMEOUT = 10*1000; static final int BROADCAST_BG_TIMEOUT = 60*1000; // How long we wait until we timeout on key dispatching. static final int KEY_DISPATCHING_TIMEOUT = 5*1000; // How long we wait until we timeout on key dispatching during instrumentation. static final int INSTRUMENTATION_KEY_DISPATCHING_TIMEOUT = 60*1000; // How long to wait in getAssistContextExtras for the activity and foreground services // to respond with the result. static final int PENDING_ASSIST_EXTRAS_TIMEOUT = 500; // How long top wait when going through the modern assist (which doesn't need to block // on getting this result before starting to launch its UI). static final int PENDING_ASSIST_EXTRAS_LONG_TIMEOUT = 2000; // How long to wait in getAutofillAssistStructure() for the activity to respond with the result. static final int PENDING_AUTOFILL_ASSIST_STRUCTURE_TIMEOUT = 2000; // Maximum number of persisted Uri grants a package is allowed static final int MAX_PERSISTED_URI_GRANTS = 128; static final int MY_PID = myPid(); static final String[] EMPTY_STRING_ARRAY = new String[0]; // How many bytes to write into the dropbox log before truncating static final int DROPBOX_MAX_SIZE = 192 * 1024; // Assumes logcat entries average around 100 bytes; that's not perfect stack traces count // as one line, but close enough for now. static final int RESERVED_BYTES_PER_LOGCAT_LINE = 100; // Access modes for handleIncomingUser. static final int ALLOW_NON_FULL = 0; static final int ALLOW_NON_FULL_IN_PROFILE = 1; static final int ALLOW_FULL_ONLY = 2; // Necessary ApplicationInfo flags to mark an app as persistent private static final int PERSISTENT_MASK = ApplicationInfo.FLAG_SYSTEM|ApplicationInfo.FLAG_PERSISTENT; // Intent sent when remote bugreport collection has been completed private static final String INTENT_REMOTE_BUGREPORT_FINISHED = "com.android.internal.intent.action.REMOTE_BUGREPORT_FINISHED"; // Used to indicate that an app transition should be animated. static final boolean ANIMATE = true; // Determines whether to take full screen screenshots static final boolean TAKE_FULLSCREEN_SCREENSHOTS = true; /** * Default value for {@link Settings.Global#NETWORK_ACCESS_TIMEOUT_MS}. */ private static final long NETWORK_ACCESS_TIMEOUT_DEFAULT_MS = 200; // 0.2 sec /** * State indicating that there is no need for any blocking for network. */ @VisibleForTesting static final int NETWORK_STATE_NO_CHANGE = 0; /** * State indicating that the main thread needs to be informed about the network wait. */ @VisibleForTesting static final int NETWORK_STATE_BLOCK = 1; /** * State indicating that any threads waiting for network state to get updated can be unblocked. */ @VisibleForTesting static final int NETWORK_STATE_UNBLOCK = 2; // Max character limit for a notification title. If the notification title is larger than this // the notification will not be legible to the user. private static final int MAX_BUGREPORT_TITLE_SIZE = 50; private static final int NATIVE_DUMP_TIMEOUT_MS = 2000; // 2 seconds; /** All system services */ SystemServiceManager mSystemServiceManager; AssistUtils mAssistUtils; private Installer mInstaller; /** Run all ActivityStacks through this */ final ActivityStackSupervisor mStackSupervisor; private final KeyguardController mKeyguardController; final ActivityStarter mActivityStarter; final TaskChangeNotificationController mTaskChangeNotificationController; final InstrumentationReporter mInstrumentationReporter = new InstrumentationReporter(); final ArrayList mActiveInstrumentation = new ArrayList<>(); public final IntentFirewall mIntentFirewall; // Whether we should show our dialogs (ANR, crash, etc) or just perform their // default action automatically. Important for devices without direct input // devices. private boolean mShowDialogs = true; private final VrController mVrController; // VR Vr2d Display Id. int mVr2dDisplayId = INVALID_DISPLAY; // Whether we should use SCHED_FIFO for UI and RenderThreads. private boolean mUseFifoUiScheduling = false; BroadcastQueue mFgBroadcastQueue; BroadcastQueue mBgBroadcastQueue; // Convenient for easy iteration over the queues. Foreground is first // so that dispatch of foreground broadcasts gets precedence. final BroadcastQueue[] mBroadcastQueues = new BroadcastQueue[2]; BroadcastStats mLastBroadcastStats; BroadcastStats mCurBroadcastStats; BroadcastQueue broadcastQueueForIntent(Intent intent) { final boolean isFg = (intent.getFlags() & Intent.FLAG_RECEIVER_FOREGROUND) != 0; if (DEBUG_BROADCAST_BACKGROUND) Slog.i(TAG_BROADCAST, "Broadcast intent " + intent + " on " + (isFg ? "foreground" : "background") + " queue"); return (isFg) ? mFgBroadcastQueue : mBgBroadcastQueue; } /** * The last resumed activity. This is identical to the current resumed activity most * of the time but could be different when we're pausing one activity before we resume * another activity. */ private ActivityRecord mLastResumedActivity; /** * If non-null, we are tracking the time the user spends in the currently focused app. */ private AppTimeTracker mCurAppTimeTracker; /** * List of intents that were used to start the most recent tasks. */ private final RecentTasks mRecentTasks; /** * For addAppTask: cached of the last activity component that was added. */ ComponentName mLastAddedTaskComponent; /** * For addAppTask: cached of the last activity uid that was added. */ int mLastAddedTaskUid; /** * For addAppTask: cached of the last ActivityInfo that was added. */ ActivityInfo mLastAddedTaskActivity; /** * The package name of the DeviceOwner. This package is not permitted to have its data cleared. */ String mDeviceOwnerName; /** * The controller for all operations related to locktask. */ final LockTaskController mLockTaskController; final UserController mUserController; final AppErrors mAppErrors; /** * Dump of the activity state at the time of the last ANR. Cleared after * {@link WindowManagerService#LAST_ANR_LIFETIME_DURATION_MSECS} */ String mLastANRState; /** * Indicates the maximum time spent waiting for the network rules to get updated. */ @VisibleForTesting long mWaitForNetworkTimeoutMs; /** * Helper class which parses out priority arguments and dumps sections according to their * priority. If priority arguments are omitted, function calls the legacy dump command. */ private final PriorityDump.PriorityDumper mPriorityDumper = new PriorityDump.PriorityDumper() { @Override public void dumpCritical(FileDescriptor fd, PrintWriter pw, String[] args, boolean asProto) { if (asProto) return; doDump(fd, pw, new String[]{"activities"}, asProto); } @Override public void dumpNormal(FileDescriptor fd, PrintWriter pw, String[] args, boolean asProto) { if (asProto) { doDump(fd, pw, new String[0], asProto); } else { doDump(fd, pw, new String[]{"settings"}, asProto); doDump(fd, pw, new String[]{"intents"}, asProto); doDump(fd, pw, new String[]{"broadcasts"}, asProto); doDump(fd, pw, new String[]{"providers"}, asProto); doDump(fd, pw, new String[]{"permissions"}, asProto); doDump(fd, pw, new String[]{"services"}, asProto); doDump(fd, pw, new String[]{"recents"}, asProto); doDump(fd, pw, new String[]{"lastanr"}, asProto); doDump(fd, pw, new String[]{"starter"}, asProto); if (mAssociations.size() > 0) { doDump(fd, pw, new String[]{"associations"}, asProto); } doDump(fd, pw, new String[]{"processes"}, asProto); } } @Override public void dump(FileDescriptor fd, PrintWriter pw, String[] args, boolean asProto) { doDump(fd, pw, args, asProto); } }; public boolean canShowErrorDialogs() { return mShowDialogs && !mSleeping && !mShuttingDown && !mKeyguardController.isKeyguardShowing(DEFAULT_DISPLAY) && !mUserController.hasUserRestriction(UserManager.DISALLOW_SYSTEM_ERROR_DIALOGS, mUserController.getCurrentUserId()) && !(UserManager.isDeviceInDemoMode(mContext) && mUserController.getCurrentUser().isDemo()); } private static ThreadPriorityBooster sThreadPriorityBooster = new ThreadPriorityBooster( THREAD_PRIORITY_FOREGROUND, LockGuard.INDEX_ACTIVITY); static void boostPriorityForLockedSection() { sThreadPriorityBooster.boost(); } static void resetPriorityAfterLockedSection() { sThreadPriorityBooster.reset(); } public class PendingAssistExtras extends Binder implements Runnable { public final ActivityRecord activity; public boolean isHome; public final Bundle extras; public final Intent intent; public final String hint; public final IResultReceiver receiver; public final int userHandle; public boolean haveResult = false; public Bundle result = null; public AssistStructure structure = null; public AssistContent content = null; public Bundle receiverExtras; public PendingAssistExtras(ActivityRecord _activity, Bundle _extras, Intent _intent, String _hint, IResultReceiver _receiver, Bundle _receiverExtras, int _userHandle) { activity = _activity; extras = _extras; intent = _intent; hint = _hint; receiver = _receiver; receiverExtras = _receiverExtras; userHandle = _userHandle; } @Override public void run() { Slog.w(TAG, "getAssistContextExtras failed: timeout retrieving from " + activity); synchronized (this) { haveResult = true; notifyAll(); } pendingAssistExtrasTimedOut(this); } } final ArrayList mPendingAssistExtras = new ArrayList(); /** * Process management. */ final ProcessList mProcessList = new ProcessList(); /** * All of the applications we currently have running organized by name. * The keys are strings of the application package name (as * returned by the package manager), and the keys are ApplicationRecord * objects. */ final ProcessMap mProcessNames = new ProcessMap(); /** * Tracking long-term execution of processes to look for abuse and other * bad app behavior. */ final ProcessStatsService mProcessStats; /** * The currently running isolated processes. */ final SparseArray mIsolatedProcesses = new SparseArray(); /** * Counter for assigning isolated process uids, to avoid frequently reusing the * same ones. */ int mNextIsolatedProcessUid = 0; /** * The currently running heavy-weight process, if any. */ ProcessRecord mHeavyWeightProcess = null; /** * Non-persistent appId whitelist for background restrictions */ int[] mBackgroundAppIdWhitelist = new int[] { BLUETOOTH_UID }; /** * Broadcast actions that will always be deliverable to unlaunched/background apps */ ArraySet mBackgroundLaunchBroadcasts; /** * All of the processes we currently have running organized by pid. * The keys are the pid running the application. * *

NOTE: This object is protected by its own lock, NOT the global * activity manager lock! */ final SparseArray mPidsSelfLocked = new SparseArray(); /** * All of the processes that have been forced to be important. The key * is the pid of the caller who requested it (we hold a death * link on it). */ abstract class ImportanceToken implements IBinder.DeathRecipient { final int pid; final IBinder token; final String reason; ImportanceToken(int _pid, IBinder _token, String _reason) { pid = _pid; token = _token; reason = _reason; } @Override public String toString() { return "ImportanceToken { " + Integer.toHexString(System.identityHashCode(this)) + " " + reason + " " + pid + " " + token + " }"; } } final SparseArray mImportantProcesses = new SparseArray(); /** * List of records for processes that someone had tried to start before the * system was ready. We don't start them at that point, but ensure they * are started by the time booting is complete. */ final ArrayList mProcessesOnHold = new ArrayList(); /** * List of persistent applications that are in the process * of being started. */ final ArrayList mPersistentStartingProcesses = new ArrayList(); /** * Processes that are being forcibly torn down. */ final ArrayList mRemovedProcesses = new ArrayList(); /** * List of running applications, sorted by recent usage. * The first entry in the list is the least recently used. */ final ArrayList mLruProcesses = new ArrayList(); /** * Where in mLruProcesses that the processes hosting activities start. */ int mLruProcessActivityStart = 0; /** * Where in mLruProcesses that the processes hosting services start. * This is after (lower index) than mLruProcessesActivityStart. */ int mLruProcessServiceStart = 0; /** * List of processes that should gc as soon as things are idle. */ final ArrayList mProcessesToGc = new ArrayList(); /** * Processes we want to collect PSS data from. */ final ArrayList mPendingPssProcesses = new ArrayList(); private boolean mBinderTransactionTrackingEnabled = false; /** * Last time we requested PSS data of all processes. */ long mLastFullPssTime = SystemClock.uptimeMillis(); /** * If set, the next time we collect PSS data we should do a full collection * with data from native processes and the kernel. */ boolean mFullPssPending = false; /** * This is the process holding what we currently consider to be * the "home" activity. */ ProcessRecord mHomeProcess; /** * This is the process holding the activity the user last visited that * is in a different process from the one they are currently in. */ ProcessRecord mPreviousProcess; /** * The time at which the previous process was last visible. */ long mPreviousProcessVisibleTime; /** * Track all uids that have actively running processes. */ final SparseArray mActiveUids = new SparseArray<>(); /** * This is for verifying the UID report flow. */ static final boolean VALIDATE_UID_STATES = true; final SparseArray mValidateUids = new SparseArray<>(); /** * Packages that the user has asked to have run in screen size * compatibility mode instead of filling the screen. */ final CompatModePackages mCompatModePackages; /** * Set of IntentSenderRecord objects that are currently active. */ final HashMap> mIntentSenderRecords = new HashMap>(); /** * Fingerprints (hashCode()) of stack traces that we've * already logged DropBox entries for. Guarded by itself. If * something (rogue user app) forces this over * MAX_DUP_SUPPRESSED_STACKS entries, the contents are cleared. */ private final HashSet mAlreadyLoggedViolatedStacks = new HashSet(); private static final int MAX_DUP_SUPPRESSED_STACKS = 5000; /** * Strict Mode background batched logging state. * * The string buffer is guarded by itself, and its lock is also * used to determine if another batched write is already * in-flight. */ private final StringBuilder mStrictModeBuffer = new StringBuilder(); /** * Keeps track of all IIntentReceivers that have been registered for broadcasts. * Hash keys are the receiver IBinder, hash value is a ReceiverList. */ final HashMap mRegisteredReceivers = new HashMap<>(); /** * Resolver for broadcast intents to registered receivers. * Holds BroadcastFilter (subclass of IntentFilter). */ final IntentResolver mReceiverResolver = new IntentResolver() { @Override protected boolean allowFilterResult( BroadcastFilter filter, List dest) { IBinder target = filter.receiverList.receiver.asBinder(); for (int i = dest.size() - 1; i >= 0; i--) { if (dest.get(i).receiverList.receiver.asBinder() == target) { return false; } } return true; } @Override protected BroadcastFilter newResult(BroadcastFilter filter, int match, int userId) { if (userId == UserHandle.USER_ALL || filter.owningUserId == UserHandle.USER_ALL || userId == filter.owningUserId) { return super.newResult(filter, match, userId); } return null; } @Override protected BroadcastFilter[] newArray(int size) { return new BroadcastFilter[size]; } @Override protected boolean isPackageForFilter(String packageName, BroadcastFilter filter) { return packageName.equals(filter.packageName); } }; /** * State of all active sticky broadcasts per user. Keys are the action of the * sticky Intent, values are an ArrayList of all broadcasted intents with * that action (which should usually be one). The SparseArray is keyed * by the user ID the sticky is for, and can include UserHandle.USER_ALL * for stickies that are sent to all users. */ final SparseArray>> mStickyBroadcasts = new SparseArray>>(); final ActiveServices mServices; final static class Association { final int mSourceUid; final String mSourceProcess; final int mTargetUid; final ComponentName mTargetComponent; final String mTargetProcess; int mCount; long mTime; int mNesting; long mStartTime; // states of the source process when the bind occurred. int mLastState = ActivityManager.MAX_PROCESS_STATE + 1; long mLastStateUptime; long[] mStateTimes = new long[ActivityManager.MAX_PROCESS_STATE - ActivityManager.MIN_PROCESS_STATE+1]; Association(int sourceUid, String sourceProcess, int targetUid, ComponentName targetComponent, String targetProcess) { mSourceUid = sourceUid; mSourceProcess = sourceProcess; mTargetUid = targetUid; mTargetComponent = targetComponent; mTargetProcess = targetProcess; } } /** * When service association tracking is enabled, this is all of the associations we * have seen. Mapping is target uid -> target component -> source uid -> source process name * -> association data. */ final SparseArray>>> mAssociations = new SparseArray<>(); boolean mTrackingAssociations; /** * Backup/restore process management */ String mBackupAppName = null; BackupRecord mBackupTarget = null; final ProviderMap mProviderMap; /** * List of content providers who have clients waiting for them. The * application is currently being launched and the provider will be * removed from this list once it is published. */ final ArrayList mLaunchingProviders = new ArrayList(); /** * File storing persisted {@link #mGrantedUriPermissions}. */ private final AtomicFile mGrantFile; /** XML constants used in {@link #mGrantFile} */ private static final String TAG_URI_GRANTS = "uri-grants"; private static final String TAG_URI_GRANT = "uri-grant"; private static final String ATTR_USER_HANDLE = "userHandle"; private static final String ATTR_SOURCE_USER_ID = "sourceUserId"; private static final String ATTR_TARGET_USER_ID = "targetUserId"; private static final String ATTR_SOURCE_PKG = "sourcePkg"; private static final String ATTR_TARGET_PKG = "targetPkg"; private static final String ATTR_URI = "uri"; private static final String ATTR_MODE_FLAGS = "modeFlags"; private static final String ATTR_CREATED_TIME = "createdTime"; private static final String ATTR_PREFIX = "prefix"; /** * Global set of specific {@link Uri} permissions that have been granted. * This optimized lookup structure maps from {@link UriPermission#targetUid} * to {@link UriPermission#uri} to {@link UriPermission}. */ @GuardedBy("this") private final SparseArray> mGrantedUriPermissions = new SparseArray>(); public static class GrantUri { public final int sourceUserId; public final Uri uri; public boolean prefix; public GrantUri(int sourceUserId, Uri uri, boolean prefix) { this.sourceUserId = sourceUserId; this.uri = uri; this.prefix = prefix; } @Override public int hashCode() { int hashCode = 1; hashCode = 31 * hashCode + sourceUserId; hashCode = 31 * hashCode + uri.hashCode(); hashCode = 31 * hashCode + (prefix ? 1231 : 1237); return hashCode; } @Override public boolean equals(Object o) { if (o instanceof GrantUri) { GrantUri other = (GrantUri) o; return uri.equals(other.uri) && (sourceUserId == other.sourceUserId) && prefix == other.prefix; } return false; } @Override public String toString() { String result = uri.toString() + " [user " + sourceUserId + "]"; if (prefix) result += " [prefix]"; return result; } public String toSafeString() { String result = uri.toSafeString() + " [user " + sourceUserId + "]"; if (prefix) result += " [prefix]"; return result; } public static GrantUri resolve(int defaultSourceUserHandle, Uri uri) { return new GrantUri(ContentProvider.getUserIdFromUri(uri, defaultSourceUserHandle), ContentProvider.getUriWithoutUserId(uri), false); } } CoreSettingsObserver mCoreSettingsObserver; FontScaleSettingObserver mFontScaleSettingObserver; private final class FontScaleSettingObserver extends ContentObserver { private final Uri mFontScaleUri = Settings.System.getUriFor(FONT_SCALE); public FontScaleSettingObserver() { super(mHandler); ContentResolver resolver = mContext.getContentResolver(); resolver.registerContentObserver(mFontScaleUri, false, this, UserHandle.USER_ALL); } @Override public void onChange(boolean selfChange, Uri uri, @UserIdInt int userId) { if (mFontScaleUri.equals(uri)) { updateFontScaleIfNeeded(userId); } } } /** * Thread-local storage used to carry caller permissions over through * indirect content-provider access. */ private class Identity { public final IBinder token; public final int pid; public final int uid; Identity(IBinder _token, int _pid, int _uid) { token = _token; pid = _pid; uid = _uid; } } private static final ThreadLocal sCallerIdentity = new ThreadLocal(); /** * All information we have collected about the runtime performance of * any user id that can impact battery performance. */ final BatteryStatsService mBatteryStatsService; /** * Information about component usage */ UsageStatsManagerInternal mUsageStatsService; /** * Access to DeviceIdleController service. */ DeviceIdleController.LocalService mLocalDeviceIdleController; /** * Set of app ids that are whitelisted for device idle and thus background check. */ int[] mDeviceIdleWhitelist = new int[0]; /** * Set of app ids that are temporarily allowed to escape bg check due to high-pri message */ int[] mDeviceIdleTempWhitelist = new int[0]; static final class PendingTempWhitelist { final int targetUid; final long duration; final String tag; PendingTempWhitelist(int _targetUid, long _duration, String _tag) { targetUid = _targetUid; duration = _duration; tag = _tag; } } final SparseArray mPendingTempWhitelist = new SparseArray<>(); /** * Information about and control over application operations */ final AppOpsService mAppOpsService; /** Current sequencing integer of the configuration, for skipping old configurations. */ private int mConfigurationSeq; /** * Temp object used when global and/or display override configuration is updated. It is also * sent to outer world instead of {@link #getGlobalConfiguration} because we don't trust * anyone... */ private Configuration mTempConfig = new Configuration(); private final UpdateConfigurationResult mTmpUpdateConfigurationResult = new UpdateConfigurationResult(); private static final class UpdateConfigurationResult { // Configuration changes that were updated. int changes; // If the activity was relaunched to match the new configuration. boolean activityRelaunched; void reset() { changes = 0; activityRelaunched = false; } } boolean mSuppressResizeConfigChanges; /** * Hardware-reported OpenGLES version. */ final int GL_ES_VERSION; /** * List of initialization arguments to pass to all processes when binding applications to them. * For example, references to the commonly used services. */ HashMap mAppBindArgs; HashMap mIsolatedAppBindArgs; /** * Temporary to avoid allocations. Protected by main lock. */ final StringBuilder mStringBuilder = new StringBuilder(256); /** * Used to control how we initialize the service. */ ComponentName mTopComponent; String mTopAction = Intent.ACTION_MAIN; String mTopData; volatile boolean mProcessesReady = false; volatile boolean mSystemReady = false; volatile boolean mOnBattery = false; volatile int mFactoryTest; @GuardedBy("this") boolean mBooting = false; @GuardedBy("this") boolean mCallFinishBooting = false; @GuardedBy("this") boolean mBootAnimationComplete = false; @GuardedBy("this") boolean mLaunchWarningShown = false; @GuardedBy("this") boolean mCheckedForSetup = false; final Context mContext; /** * This Context is themable and meant for UI display (AlertDialogs, etc.). The theme can * change at runtime. Use mContext for non-UI purposes. */ final Context mUiContext; /** * The time at which we will allow normal application switches again, * after a call to {@link #stopAppSwitches()}. */ long mAppSwitchesAllowedTime; /** * This is set to true after the first switch after mAppSwitchesAllowedTime * is set; any switches after that will clear the time. */ boolean mDidAppSwitch; /** * Last time (in uptime) at which we checked for power usage. */ long mLastPowerCheckUptime; /** * Set while we are wanting to sleep, to prevent any * activities from being started/resumed. * * TODO(b/33594039): Clarify the actual state transitions represented by mSleeping. * * Currently mSleeping is set to true when transitioning into the sleep state, and remains true * while in the sleep state until there is a pending transition out of sleep, in which case * mSleeping is set to false, and remains false while awake. * * Whether mSleeping can quickly toggled between true/false without the device actually * display changing states is undefined. */ private boolean mSleeping = false; /** * The process state used for processes that are running the top activities. * This changes between TOP and TOP_SLEEPING to following mSleeping. */ int mTopProcessState = ActivityManager.PROCESS_STATE_TOP; /** * Set while we are running a voice interaction. This overrides * sleeping while it is active. */ IVoiceInteractionSession mRunningVoice; /** * For some direct access we need to power manager. */ PowerManagerInternal mLocalPowerManager; /** * We want to hold a wake lock while running a voice interaction session, since * this may happen with the screen off and we need to keep the CPU running to * be able to continue to interact with the user. */ PowerManager.WakeLock mVoiceWakeLock; /** * State of external calls telling us if the device is awake or asleep. */ private int mWakefulness = PowerManagerInternal.WAKEFULNESS_AWAKE; /** * Set if we are shutting down the system, similar to sleeping. */ boolean mShuttingDown = false; /** * Current sequence id for oom_adj computation traversal. */ int mAdjSeq = 0; /** * Current sequence id for process LRU updating. */ int mLruSeq = 0; /** * Keep track of the non-cached/empty process we last found, to help * determine how to distribute cached/empty processes next time. */ int mNumNonCachedProcs = 0; /** * Keep track of the number of cached hidden procs, to balance oom adj * distribution between those and empty procs. */ int mNumCachedHiddenProcs = 0; /** * Keep track of the number of service processes we last found, to * determine on the next iteration which should be B services. */ int mNumServiceProcs = 0; int mNewNumAServiceProcs = 0; int mNewNumServiceProcs = 0; /** * Allow the current computed overall memory level of the system to go down? * This is set to false when we are killing processes for reasons other than * memory management, so that the now smaller process list will not be taken as * an indication that memory is tighter. */ boolean mAllowLowerMemLevel = false; /** * The last computed memory level, for holding when we are in a state that * processes are going away for other reasons. */ int mLastMemoryLevel = ProcessStats.ADJ_MEM_FACTOR_NORMAL; /** * The last total number of process we have, to determine if changes actually look * like a shrinking number of process due to lower RAM. */ int mLastNumProcesses; /** * The uptime of the last time we performed idle maintenance. */ long mLastIdleTime = SystemClock.uptimeMillis(); /** * Total time spent with RAM that has been added in the past since the last idle time. */ long mLowRamTimeSinceLastIdle = 0; /** * If RAM is currently low, when that horrible situation started. */ long mLowRamStartTime = 0; /** * For reporting to battery stats the current top application. */ private String mCurResumedPackage = null; private int mCurResumedUid = -1; /** * For reporting to battery stats the apps currently running foreground * service. The ProcessMap is package/uid tuples; each of these contain * an array of the currently foreground processes. */ final ProcessMap> mForegroundPackages = new ProcessMap>(); /** * Set if the systemServer made a call to enterSafeMode. */ boolean mSafeMode; /** * If true, we are running under a test environment so will sample PSS from processes * much more rapidly to try to collect better data when the tests are rapidly * running through apps. */ boolean mTestPssMode = false; String mDebugApp = null; boolean mWaitForDebugger = false; boolean mDebugTransient = false; String mOrigDebugApp = null; boolean mOrigWaitForDebugger = false; boolean mAlwaysFinishActivities = false; boolean mForceResizableActivities; /** * Flag that indicates if multi-window is enabled. * * For any particular form of multi-window to be enabled, generic multi-window must be enabled * in {@link com.android.internal.R.bool#config_supportsMultiWindow} config or * {@link Settings.Global#DEVELOPMENT_FORCE_RESIZABLE_ACTIVITIES} development option set. * At least one of the forms of multi-window must be enabled in order for this flag to be * initialized to 'true'. * * @see #mSupportsSplitScreenMultiWindow * @see #mSupportsFreeformWindowManagement * @see #mSupportsPictureInPicture * @see #mSupportsMultiDisplay */ boolean mSupportsMultiWindow; boolean mSupportsSplitScreenMultiWindow; boolean mSupportsFreeformWindowManagement; boolean mSupportsPictureInPicture; boolean mSupportsMultiDisplay; boolean mSupportsLeanbackOnly; IActivityController mController = null; boolean mControllerIsAMonkey = false; String mProfileApp = null; ProcessRecord mProfileProc = null; ProfilerInfo mProfilerInfo = null; int mProfileType = 0; final ProcessMap> mMemWatchProcesses = new ProcessMap<>(); String mMemWatchDumpProcName; String mMemWatchDumpFile; int mMemWatchDumpPid; int mMemWatchDumpUid; String mTrackAllocationApp = null; String mNativeDebuggingApp = null; final long[] mTmpLong = new long[2]; private final ArraySet mTmpBroadcastQueue = new ArraySet(); /** * A global counter for generating sequence numbers. * This value will be used when incrementing sequence numbers in individual uidRecords. * * Having a global counter ensures that seq numbers are monotonically increasing for a * particular uid even when the uidRecord is re-created. */ @GuardedBy("this") @VisibleForTesting long mProcStateSeqCounter = 0; private final Injector mInjector; static final class ProcessChangeItem { static final int CHANGE_ACTIVITIES = 1<<0; int changes; int uid; int pid; int processState; boolean foregroundActivities; } static final class UidObserverRegistration { final int uid; final String pkg; final int which; final int cutpoint; final SparseIntArray lastProcStates; UidObserverRegistration(int _uid, String _pkg, int _which, int _cutpoint) { uid = _uid; pkg = _pkg; which = _which; cutpoint = _cutpoint; if (cutpoint >= ActivityManager.MIN_PROCESS_STATE) { lastProcStates = new SparseIntArray(); } else { lastProcStates = null; } } } final RemoteCallbackList mProcessObservers = new RemoteCallbackList<>(); ProcessChangeItem[] mActiveProcessChanges = new ProcessChangeItem[5]; final ArrayList mPendingProcessChanges = new ArrayList<>(); final ArrayList mAvailProcessChanges = new ArrayList<>(); final RemoteCallbackList mUidObservers = new RemoteCallbackList<>(); UidRecord.ChangeItem[] mActiveUidChanges = new UidRecord.ChangeItem[5]; final ArrayList mPendingUidChanges = new ArrayList<>(); final ArrayList mAvailUidChanges = new ArrayList<>(); OomAdjObserver mCurOomAdjObserver; int mCurOomAdjUid; interface OomAdjObserver { void onOomAdjMessage(String msg); } /** * Runtime CPU use collection thread. This object's lock is used to * perform synchronization with the thread (notifying it to run). */ final Thread mProcessCpuThread; /** * Used to collect per-process CPU use for ANRs, battery stats, etc. * Must acquire this object's lock when accessing it. * NOTE: this lock will be held while doing long operations (trawling * through all processes in /proc), so it should never be acquired by * any critical paths such as when holding the main activity manager lock. */ final ProcessCpuTracker mProcessCpuTracker = new ProcessCpuTracker( MONITOR_THREAD_CPU_USAGE); final AtomicLong mLastCpuTime = new AtomicLong(0); final AtomicBoolean mProcessCpuMutexFree = new AtomicBoolean(true); final CountDownLatch mProcessCpuInitLatch = new CountDownLatch(1); long mLastWriteTime = 0; /** * Used to retain an update lock when the foreground activity is in * immersive mode. */ final UpdateLock mUpdateLock = new UpdateLock("immersive"); /** * Set to true after the system has finished booting. */ boolean mBooted = false; WindowManagerService mWindowManager; final ActivityThread mSystemThread; private final class AppDeathRecipient implements IBinder.DeathRecipient { final ProcessRecord mApp; final int mPid; final IApplicationThread mAppThread; AppDeathRecipient(ProcessRecord app, int pid, IApplicationThread thread) { if (DEBUG_ALL) Slog.v( TAG, "New death recipient " + this + " for thread " + thread.asBinder()); mApp = app; mPid = pid; mAppThread = thread; } @Override public void binderDied() { if (DEBUG_ALL) Slog.v( TAG, "Death received in " + this + " for thread " + mAppThread.asBinder()); synchronized(ActivityManagerService.this) { appDiedLocked(mApp, mPid, mAppThread, true); } } } static final int SHOW_ERROR_UI_MSG = 1; static final int SHOW_NOT_RESPONDING_UI_MSG = 2; static final int SHOW_FACTORY_ERROR_UI_MSG = 3; static final int UPDATE_CONFIGURATION_MSG = 4; static final int GC_BACKGROUND_PROCESSES_MSG = 5; static final int WAIT_FOR_DEBUGGER_UI_MSG = 6; static final int SERVICE_TIMEOUT_MSG = 12; static final int UPDATE_TIME_ZONE = 13; static final int SHOW_UID_ERROR_UI_MSG = 14; static final int SHOW_FINGERPRINT_ERROR_UI_MSG = 15; static final int PROC_START_TIMEOUT_MSG = 20; static final int DO_PENDING_ACTIVITY_LAUNCHES_MSG = 21; static final int KILL_APPLICATION_MSG = 22; static final int FINALIZE_PENDING_INTENT_MSG = 23; static final int POST_HEAVY_NOTIFICATION_MSG = 24; static final int CANCEL_HEAVY_NOTIFICATION_MSG = 25; static final int SHOW_STRICT_MODE_VIOLATION_UI_MSG = 26; static final int CHECK_EXCESSIVE_POWER_USE_MSG = 27; static final int CLEAR_DNS_CACHE_MSG = 28; static final int UPDATE_HTTP_PROXY_MSG = 29; static final int SHOW_COMPAT_MODE_DIALOG_UI_MSG = 30; static final int DISPATCH_PROCESSES_CHANGED_UI_MSG = 31; static final int DISPATCH_PROCESS_DIED_UI_MSG = 32; static final int REPORT_MEM_USAGE_MSG = 33; static final int IMMERSIVE_MODE_LOCK_MSG = 37; static final int PERSIST_URI_GRANTS_MSG = 38; static final int REQUEST_ALL_PSS_MSG = 39; static final int UPDATE_TIME_PREFERENCE_MSG = 41; static final int ENTER_ANIMATION_COMPLETE_MSG = 44; static final int FINISH_BOOTING_MSG = 45; static final int SEND_LOCALE_TO_MOUNT_DAEMON_MSG = 47; static final int DISMISS_DIALOG_UI_MSG = 48; static final int NOTIFY_CLEARTEXT_NETWORK_MSG = 49; static final int POST_DUMP_HEAP_NOTIFICATION_MSG = 50; static final int DELETE_DUMPHEAP_MSG = 51; static final int DISPATCH_UIDS_CHANGED_UI_MSG = 53; static final int REPORT_TIME_TRACKER_MSG = 54; static final int SHUTDOWN_UI_AUTOMATION_CONNECTION_MSG = 56; static final int CONTENT_PROVIDER_PUBLISH_TIMEOUT_MSG = 57; static final int IDLE_UIDS_MSG = 58; static final int LOG_STACK_STATE = 60; static final int VR_MODE_CHANGE_MSG = 61; static final int SHOW_UNSUPPORTED_DISPLAY_SIZE_DIALOG_MSG = 62; static final int HANDLE_TRUST_STORAGE_UPDATE_MSG = 63; static final int NOTIFY_VR_SLEEPING_MSG = 65; static final int SERVICE_FOREGROUND_TIMEOUT_MSG = 66; static final int DISPATCH_PENDING_INTENT_CANCEL_MSG = 67; static final int PUSH_TEMP_WHITELIST_UI_MSG = 68; static final int SERVICE_FOREGROUND_CRASH_MSG = 69; static final int DISPATCH_OOM_ADJ_OBSERVER_MSG = 70; static final int NOTIFY_VR_KEYGUARD_MSG = 74; static final int FIRST_ACTIVITY_STACK_MSG = 100; static final int FIRST_BROADCAST_QUEUE_MSG = 200; static final int FIRST_COMPAT_MODE_MSG = 300; static final int FIRST_SUPERVISOR_STACK_MSG = 100; static ServiceThread sKillThread = null; static KillHandler sKillHandler = null; CompatModeDialog mCompatModeDialog; UnsupportedDisplaySizeDialog mUnsupportedDisplaySizeDialog; long mLastMemUsageReportTime = 0; /** * Flag whether the current user is a "monkey", i.e. whether * the UI is driven by a UI automation tool. */ private boolean mUserIsMonkey; /** The dimensions of the thumbnails in the Recents UI. */ int mThumbnailWidth; int mThumbnailHeight; float mFullscreenThumbnailScale; final ServiceThread mHandlerThread; final MainHandler mHandler; final Handler mUiHandler; final ActivityManagerConstants mConstants; PackageManagerInternal mPackageManagerInt; // VoiceInteraction session ID that changes for each new request except when // being called for multiwindow assist in a single session. private int mViSessionId = 1000; final boolean mPermissionReviewRequired; private static String sTheRealBuildSerial = Build.UNKNOWN; /** * Current global configuration information. Contains general settings for the entire system, * also corresponds to the merged configuration of the default display. */ Configuration getGlobalConfiguration() { return mStackSupervisor.getConfiguration(); } final class KillHandler extends Handler { static final int KILL_PROCESS_GROUP_MSG = 4000; public KillHandler(Looper looper) { super(looper, null, true); } @Override public void handleMessage(Message msg) { switch (msg.what) { case KILL_PROCESS_GROUP_MSG: { Trace.traceBegin(Trace.TRACE_TAG_ACTIVITY_MANAGER, "killProcessGroup"); Process.killProcessGroup(msg.arg1 /* uid */, msg.arg2 /* pid */); Trace.traceEnd(Trace.TRACE_TAG_ACTIVITY_MANAGER); } break; default: super.handleMessage(msg); } } } final class UiHandler extends Handler { public UiHandler() { super(com.android.server.UiThread.get().getLooper(), null, true); } @Override public void handleMessage(Message msg) { switch (msg.what) { case SHOW_ERROR_UI_MSG: { mAppErrors.handleShowAppErrorUi(msg); ensureBootCompleted(); } break; case SHOW_NOT_RESPONDING_UI_MSG: { mAppErrors.handleShowAnrUi(msg); ensureBootCompleted(); } break; case SHOW_STRICT_MODE_VIOLATION_UI_MSG: { HashMap data = (HashMap) msg.obj; synchronized (ActivityManagerService.this) { ProcessRecord proc = (ProcessRecord) data.get("app"); if (proc == null) { Slog.e(TAG, "App not found when showing strict mode dialog."); break; } if (proc.crashDialog != null) { Slog.e(TAG, "App already has strict mode dialog: " + proc); return; } AppErrorResult res = (AppErrorResult) data.get("result"); if (mShowDialogs && !mSleeping && !mShuttingDown) { Dialog d = new StrictModeViolationDialog(mUiContext, ActivityManagerService.this, res, proc); d.show(); proc.crashDialog = d; } else { // The device is asleep, so just pretend that the user // saw a crash dialog and hit "force quit". res.set(0); } } ensureBootCompleted(); } break; case SHOW_FACTORY_ERROR_UI_MSG: { Dialog d = new FactoryErrorDialog( mUiContext, msg.getData().getCharSequence("msg")); d.show(); ensureBootCompleted(); } break; case WAIT_FOR_DEBUGGER_UI_MSG: { synchronized (ActivityManagerService.this) { ProcessRecord app = (ProcessRecord)msg.obj; if (msg.arg1 != 0) { if (!app.waitedForDebugger) { Dialog d = new AppWaitingForDebuggerDialog( ActivityManagerService.this, mUiContext, app); app.waitDialog = d; app.waitedForDebugger = true; d.show(); } } else { if (app.waitDialog != null) { app.waitDialog.dismiss(); app.waitDialog = null; } } } } break; case SHOW_UID_ERROR_UI_MSG: { if (mShowDialogs) { AlertDialog d = new BaseErrorDialog(mUiContext); d.getWindow().setType(WindowManager.LayoutParams.TYPE_SYSTEM_ERROR); d.setCancelable(false); d.setTitle(mUiContext.getText(R.string.android_system_label)); d.setMessage(mUiContext.getText(R.string.system_error_wipe_data)); d.setButton(DialogInterface.BUTTON_POSITIVE, mUiContext.getText(R.string.ok), obtainMessage(DISMISS_DIALOG_UI_MSG, d)); d.show(); } } break; case SHOW_FINGERPRINT_ERROR_UI_MSG: { if (mShowDialogs) { AlertDialog d = new BaseErrorDialog(mUiContext); d.getWindow().setType(WindowManager.LayoutParams.TYPE_SYSTEM_ERROR); d.setCancelable(false); d.setTitle(mUiContext.getText(R.string.android_system_label)); d.setMessage(mUiContext.getText(R.string.system_error_manufacturer)); d.setButton(DialogInterface.BUTTON_POSITIVE, mUiContext.getText(R.string.ok), obtainMessage(DISMISS_DIALOG_UI_MSG, d)); d.show(); } } break; case SHOW_COMPAT_MODE_DIALOG_UI_MSG: { synchronized (ActivityManagerService.this) { ActivityRecord ar = (ActivityRecord) msg.obj; if (mCompatModeDialog != null) { if (mCompatModeDialog.mAppInfo.packageName.equals( ar.info.applicationInfo.packageName)) { return; } mCompatModeDialog.dismiss(); mCompatModeDialog = null; } if (ar != null && false) { if (mCompatModePackages.getPackageAskCompatModeLocked( ar.packageName)) { int mode = mCompatModePackages.computeCompatModeLocked( ar.info.applicationInfo); if (mode == ActivityManager.COMPAT_MODE_DISABLED || mode == ActivityManager.COMPAT_MODE_ENABLED) { mCompatModeDialog = new CompatModeDialog( ActivityManagerService.this, mUiContext, ar.info.applicationInfo); mCompatModeDialog.show(); } } } } break; } case SHOW_UNSUPPORTED_DISPLAY_SIZE_DIALOG_MSG: { synchronized (ActivityManagerService.this) { final ActivityRecord ar = (ActivityRecord) msg.obj; if (mUnsupportedDisplaySizeDialog != null) { mUnsupportedDisplaySizeDialog.dismiss(); mUnsupportedDisplaySizeDialog = null; } if (ar != null && mCompatModePackages.getPackageNotifyUnsupportedZoomLocked( ar.packageName)) { // TODO(multi-display): Show dialog on appropriate display. mUnsupportedDisplaySizeDialog = new UnsupportedDisplaySizeDialog( ActivityManagerService.this, mUiContext, ar.info.applicationInfo); mUnsupportedDisplaySizeDialog.show(); } } break; } case DISMISS_DIALOG_UI_MSG: { final Dialog d = (Dialog) msg.obj; d.dismiss(); break; } case DISPATCH_PROCESSES_CHANGED_UI_MSG: { dispatchProcessesChanged(); break; } case DISPATCH_PROCESS_DIED_UI_MSG: { final int pid = msg.arg1; final int uid = msg.arg2; dispatchProcessDied(pid, uid); break; } case DISPATCH_UIDS_CHANGED_UI_MSG: { dispatchUidsChanged(); } break; case DISPATCH_OOM_ADJ_OBSERVER_MSG: { dispatchOomAdjObserver((String)msg.obj); } break; case PUSH_TEMP_WHITELIST_UI_MSG: { pushTempWhitelist(); } break; } } } final class MainHandler extends Handler { public MainHandler(Looper looper) { super(looper, null, true); } @Override public void handleMessage(Message msg) { switch (msg.what) { case UPDATE_CONFIGURATION_MSG: { final ContentResolver resolver = mContext.getContentResolver(); Settings.System.putConfigurationForUser(resolver, (Configuration) msg.obj, msg.arg1); } break; case GC_BACKGROUND_PROCESSES_MSG: { synchronized (ActivityManagerService.this) { performAppGcsIfAppropriateLocked(); } } break; case SERVICE_TIMEOUT_MSG: { mServices.serviceTimeout((ProcessRecord)msg.obj); } break; case SERVICE_FOREGROUND_TIMEOUT_MSG: { mServices.serviceForegroundTimeout((ServiceRecord)msg.obj); } break; case SERVICE_FOREGROUND_CRASH_MSG: { mServices.serviceForegroundCrash((ProcessRecord)msg.obj); } break; case DISPATCH_PENDING_INTENT_CANCEL_MSG: { RemoteCallbackList callbacks = (RemoteCallbackList)msg.obj; int N = callbacks.beginBroadcast(); for (int i = 0; i < N; i++) { try { callbacks.getBroadcastItem(i).send(Activity.RESULT_CANCELED, null); } catch (RemoteException e) { } } callbacks.finishBroadcast(); } break; case UPDATE_TIME_ZONE: { synchronized (ActivityManagerService.this) { for (int i = mLruProcesses.size() - 1 ; i >= 0 ; i--) { ProcessRecord r = mLruProcesses.get(i); if (r.thread != null) { try { r.thread.updateTimeZone(); } catch (RemoteException ex) { Slog.w(TAG, "Failed to update time zone for: " + r.info.processName); } } } } } break; case CLEAR_DNS_CACHE_MSG: { synchronized (ActivityManagerService.this) { for (int i = mLruProcesses.size() - 1 ; i >= 0 ; i--) { ProcessRecord r = mLruProcesses.get(i); if (r.thread != null) { try { r.thread.clearDnsCache(); } catch (RemoteException ex) { Slog.w(TAG, "Failed to clear dns cache for: " + r.info.processName); } } } } } break; case UPDATE_HTTP_PROXY_MSG: { ProxyInfo proxy = (ProxyInfo)msg.obj; String host = ""; String port = ""; String exclList = ""; Uri pacFileUrl = Uri.EMPTY; if (proxy != null) { host = proxy.getHost(); port = Integer.toString(proxy.getPort()); exclList = proxy.getExclusionListAsString(); pacFileUrl = proxy.getPacFileUrl(); } synchronized (ActivityManagerService.this) { for (int i = mLruProcesses.size() - 1 ; i >= 0 ; i--) { ProcessRecord r = mLruProcesses.get(i); // Don't dispatch to isolated processes as they can't access // ConnectivityManager and don't have network privileges anyway. if (r.thread != null && !r.isolated) { try { r.thread.setHttpProxy(host, port, exclList, pacFileUrl); } catch (RemoteException ex) { Slog.w(TAG, "Failed to update http proxy for: " + r.info.processName); } } } } } break; case PROC_START_TIMEOUT_MSG: { ProcessRecord app = (ProcessRecord)msg.obj; synchronized (ActivityManagerService.this) { processStartTimedOutLocked(app); } } break; case CONTENT_PROVIDER_PUBLISH_TIMEOUT_MSG: { ProcessRecord app = (ProcessRecord)msg.obj; synchronized (ActivityManagerService.this) { processContentProviderPublishTimedOutLocked(app); } } break; case DO_PENDING_ACTIVITY_LAUNCHES_MSG: { synchronized (ActivityManagerService.this) { mActivityStarter.doPendingActivityLaunchesLocked(true); } } break; case KILL_APPLICATION_MSG: { synchronized (ActivityManagerService.this) { final int appId = msg.arg1; final int userId = msg.arg2; Bundle bundle = (Bundle)msg.obj; String pkg = bundle.getString("pkg"); String reason = bundle.getString("reason"); forceStopPackageLocked(pkg, appId, false, false, true, false, false, userId, reason); } } break; case FINALIZE_PENDING_INTENT_MSG: { ((PendingIntentRecord)msg.obj).completeFinalize(); } break; case POST_HEAVY_NOTIFICATION_MSG: { INotificationManager inm = NotificationManager.getService(); if (inm == null) { return; } ActivityRecord root = (ActivityRecord)msg.obj; ProcessRecord process = root.app; if (process == null) { return; } try { Context context = mContext.createPackageContext(process.info.packageName, 0); String text = mContext.getString(R.string.heavy_weight_notification, context.getApplicationInfo().loadLabel(context.getPackageManager())); Notification notification = new Notification.Builder(context, SystemNotificationChannels.HEAVY_WEIGHT_APP) .setSmallIcon(com.android.internal.R.drawable.stat_sys_adb) .setWhen(0) .setOngoing(true) .setTicker(text) .setColor(mContext.getColor( com.android.internal.R.color.system_notification_accent_color)) .setContentTitle(text) .setContentText( mContext.getText(R.string.heavy_weight_notification_detail)) .setContentIntent(PendingIntent.getActivityAsUser(mContext, 0, root.intent, PendingIntent.FLAG_CANCEL_CURRENT, null, new UserHandle(root.userId))) .build(); try { inm.enqueueNotificationWithTag("android", "android", null, SystemMessage.NOTE_HEAVY_WEIGHT_NOTIFICATION, notification, root.userId); } catch (RuntimeException e) { Slog.w(ActivityManagerService.TAG, "Error showing notification for heavy-weight app", e); } catch (RemoteException e) { } } catch (NameNotFoundException e) { Slog.w(TAG, "Unable to create context for heavy notification", e); } } break; case CANCEL_HEAVY_NOTIFICATION_MSG: { INotificationManager inm = NotificationManager.getService(); if (inm == null) { return; } try { inm.cancelNotificationWithTag("android", null, SystemMessage.NOTE_HEAVY_WEIGHT_NOTIFICATION, msg.arg1); } catch (RuntimeException e) { Slog.w(ActivityManagerService.TAG, "Error canceling notification for service", e); } catch (RemoteException e) { } } break; case CHECK_EXCESSIVE_POWER_USE_MSG: { synchronized (ActivityManagerService.this) { checkExcessivePowerUsageLocked(); removeMessages(CHECK_EXCESSIVE_POWER_USE_MSG); Message nmsg = obtainMessage(CHECK_EXCESSIVE_POWER_USE_MSG); sendMessageDelayed(nmsg, mConstants.POWER_CHECK_INTERVAL); } } break; case REPORT_MEM_USAGE_MSG: { final ArrayList memInfos = (ArrayList)msg.obj; Thread thread = new Thread() { @Override public void run() { reportMemUsage(memInfos); } }; thread.start(); break; } case IMMERSIVE_MODE_LOCK_MSG: { final boolean nextState = (msg.arg1 != 0); if (mUpdateLock.isHeld() != nextState) { if (DEBUG_IMMERSIVE) Slog.d(TAG_IMMERSIVE, "Applying new update lock state '" + nextState + "' for " + (ActivityRecord)msg.obj); if (nextState) { mUpdateLock.acquire(); } else { mUpdateLock.release(); } } break; } case PERSIST_URI_GRANTS_MSG: { writeGrantedUriPermissions(); break; } case REQUEST_ALL_PSS_MSG: { synchronized (ActivityManagerService.this) { requestPssAllProcsLocked(SystemClock.uptimeMillis(), true, false); } break; } case UPDATE_TIME_PREFERENCE_MSG: { // The user's time format preference might have changed. // For convenience we re-use the Intent extra values. synchronized (ActivityManagerService.this) { for (int i = mLruProcesses.size() - 1; i >= 0; i--) { ProcessRecord r = mLruProcesses.get(i); if (r.thread != null) { try { r.thread.updateTimePrefs(msg.arg1); } catch (RemoteException ex) { Slog.w(TAG, "Failed to update preferences for: " + r.info.processName); } } } } break; } case ENTER_ANIMATION_COMPLETE_MSG: { synchronized (ActivityManagerService.this) { ActivityRecord r = ActivityRecord.forTokenLocked((IBinder) msg.obj); if (r != null && r.app != null && r.app.thread != null) { try { r.app.thread.scheduleEnterAnimationComplete(r.appToken); } catch (RemoteException e) { } } } break; } case FINISH_BOOTING_MSG: { if (msg.arg1 != 0) { Trace.traceBegin(Trace.TRACE_TAG_ACTIVITY_MANAGER, "FinishBooting"); finishBooting(); Trace.traceEnd(Trace.TRACE_TAG_ACTIVITY_MANAGER); } if (msg.arg2 != 0) { enableScreenAfterBoot(); } break; } case SEND_LOCALE_TO_MOUNT_DAEMON_MSG: { try { Locale l = (Locale) msg.obj; IBinder service = ServiceManager.getService("mount"); IStorageManager storageManager = IStorageManager.Stub.asInterface(service); Log.d(TAG, "Storing locale " + l.toLanguageTag() + " for decryption UI"); storageManager.setField(StorageManager.SYSTEM_LOCALE_KEY, l.toLanguageTag()); } catch (RemoteException e) { Log.e(TAG, "Error storing locale for decryption UI", e); } break; } case NOTIFY_CLEARTEXT_NETWORK_MSG: { final int uid = msg.arg1; final byte[] firstPacket = (byte[]) msg.obj; synchronized (mPidsSelfLocked) { for (int i = 0; i < mPidsSelfLocked.size(); i++) { final ProcessRecord p = mPidsSelfLocked.valueAt(i); if (p.uid == uid) { try { p.thread.notifyCleartextNetwork(firstPacket); } catch (RemoteException ignored) { } } } } break; } case POST_DUMP_HEAP_NOTIFICATION_MSG: { final String procName; final int uid; final long memLimit; final String reportPackage; synchronized (ActivityManagerService.this) { procName = mMemWatchDumpProcName; uid = mMemWatchDumpUid; Pair val = mMemWatchProcesses.get(procName, uid); if (val == null) { val = mMemWatchProcesses.get(procName, 0); } if (val != null) { memLimit = val.first; reportPackage = val.second; } else { memLimit = 0; reportPackage = null; } } if (procName == null) { return; } if (DEBUG_PSS) Slog.d(TAG_PSS, "Showing dump heap notification from " + procName + "/" + uid); INotificationManager inm = NotificationManager.getService(); if (inm == null) { return; } String text = mContext.getString(R.string.dump_heap_notification, procName); Intent deleteIntent = new Intent(); deleteIntent.setAction(DumpHeapActivity.ACTION_DELETE_DUMPHEAP); Intent intent = new Intent(); intent.setClassName("android", DumpHeapActivity.class.getName()); intent.putExtra(DumpHeapActivity.KEY_PROCESS, procName); intent.putExtra(DumpHeapActivity.KEY_SIZE, memLimit); if (reportPackage != null) { intent.putExtra(DumpHeapActivity.KEY_DIRECT_LAUNCH, reportPackage); } int userId = UserHandle.getUserId(uid); Notification notification = new Notification.Builder(mContext, SystemNotificationChannels.DEVELOPER) .setSmallIcon(com.android.internal.R.drawable.stat_sys_adb) .setWhen(0) .setOngoing(true) .setAutoCancel(true) .setTicker(text) .setColor(mContext.getColor( com.android.internal.R.color.system_notification_accent_color)) .setContentTitle(text) .setContentText( mContext.getText(R.string.dump_heap_notification_detail)) .setContentIntent(PendingIntent.getActivityAsUser(mContext, 0, intent, PendingIntent.FLAG_CANCEL_CURRENT, null, new UserHandle(userId))) .setDeleteIntent(PendingIntent.getBroadcastAsUser(mContext, 0, deleteIntent, 0, UserHandle.SYSTEM)) .build(); try { inm.enqueueNotificationWithTag("android", "android", null, SystemMessage.NOTE_DUMP_HEAP_NOTIFICATION, notification, userId); } catch (RuntimeException e) { Slog.w(ActivityManagerService.TAG, "Error showing notification for dump heap", e); } catch (RemoteException e) { } } break; case DELETE_DUMPHEAP_MSG: { revokeUriPermission(ActivityThread.currentActivityThread().getApplicationThread(), null, DumpHeapActivity.JAVA_URI, Intent.FLAG_GRANT_READ_URI_PERMISSION | Intent.FLAG_GRANT_WRITE_URI_PERMISSION, UserHandle.myUserId()); synchronized (ActivityManagerService.this) { mMemWatchDumpFile = null; mMemWatchDumpProcName = null; mMemWatchDumpPid = -1; mMemWatchDumpUid = -1; } } break; case REPORT_TIME_TRACKER_MSG: { AppTimeTracker tracker = (AppTimeTracker)msg.obj; tracker.deliverResult(mContext); } break; case SHUTDOWN_UI_AUTOMATION_CONNECTION_MSG: { IUiAutomationConnection connection = (IUiAutomationConnection) msg.obj; try { connection.shutdown(); } catch (RemoteException e) { Slog.w(TAG, "Error shutting down UiAutomationConnection"); } // Only a UiAutomation can set this flag and now that // it is finished we make sure it is reset to its default. mUserIsMonkey = false; } break; case IDLE_UIDS_MSG: { idleUids(); } break; case VR_MODE_CHANGE_MSG: { if (!mVrController.onVrModeChanged((ActivityRecord) msg.obj)) { return; } synchronized (ActivityManagerService.this) { final boolean disableNonVrUi = mVrController.shouldDisableNonVrUiLocked(); mWindowManager.disableNonVrUi(disableNonVrUi); if (disableNonVrUi) { // If we are in a VR mode where Picture-in-Picture mode is unsupported, // then remove the pinned stack. mStackSupervisor.removeStacksInWindowingModes(WINDOWING_MODE_PINNED); } } } break; case NOTIFY_VR_SLEEPING_MSG: { notifyVrManagerOfSleepState(msg.arg1 != 0); } break; case NOTIFY_VR_KEYGUARD_MSG: { notifyVrManagerOfKeyguardState(msg.arg1 != 0); } break; case HANDLE_TRUST_STORAGE_UPDATE_MSG: { synchronized (ActivityManagerService.this) { for (int i = mLruProcesses.size() - 1 ; i >= 0 ; i--) { ProcessRecord r = mLruProcesses.get(i); if (r.thread != null) { try { r.thread.handleTrustStorageUpdate(); } catch (RemoteException ex) { Slog.w(TAG, "Failed to handle trust storage update for: " + r.info.processName); } } } } } break; } } }; static final int COLLECT_PSS_BG_MSG = 1; final Handler mBgHandler = new Handler(BackgroundThread.getHandler().getLooper()) { @Override public void handleMessage(Message msg) { switch (msg.what) { case COLLECT_PSS_BG_MSG: { long start = SystemClock.uptimeMillis(); MemInfoReader memInfo = null; synchronized (ActivityManagerService.this) { if (mFullPssPending) { mFullPssPending = false; memInfo = new MemInfoReader(); } } if (memInfo != null) { updateCpuStatsNow(); long nativeTotalPss = 0; final List stats; synchronized (mProcessCpuTracker) { stats = mProcessCpuTracker.getStats( (st)-> { return st.vsize > 0 && st.uid < FIRST_APPLICATION_UID; }); } final int N = stats.size(); for (int j = 0; j < N; j++) { synchronized (mPidsSelfLocked) { if (mPidsSelfLocked.indexOfKey(stats.get(j).pid) >= 0) { // This is one of our own processes; skip it. continue; } } nativeTotalPss += Debug.getPss(stats.get(j).pid, null, null); } memInfo.readMemInfo(); synchronized (ActivityManagerService.this) { if (DEBUG_PSS) Slog.d(TAG_PSS, "Collected native and kernel memory in " + (SystemClock.uptimeMillis()-start) + "ms"); final long cachedKb = memInfo.getCachedSizeKb(); final long freeKb = memInfo.getFreeSizeKb(); final long zramKb = memInfo.getZramTotalSizeKb(); final long kernelKb = memInfo.getKernelUsedSizeKb(); EventLogTags.writeAmMeminfo(cachedKb*1024, freeKb*1024, zramKb*1024, kernelKb*1024, nativeTotalPss*1024); mProcessStats.addSysMemUsageLocked(cachedKb, freeKb, zramKb, kernelKb, nativeTotalPss); } } int num = 0; long[] tmp = new long[2]; do { ProcessRecord proc; int procState; int pid; long lastPssTime; synchronized (ActivityManagerService.this) { if (mPendingPssProcesses.size() <= 0) { if (mTestPssMode || DEBUG_PSS) Slog.d(TAG_PSS, "Collected PSS of " + num + " processes in " + (SystemClock.uptimeMillis() - start) + "ms"); mPendingPssProcesses.clear(); return; } proc = mPendingPssProcesses.remove(0); procState = proc.pssProcState; lastPssTime = proc.lastPssTime; if (proc.thread != null && procState == proc.setProcState && (lastPssTime+ProcessList.PSS_SAFE_TIME_FROM_STATE_CHANGE) < SystemClock.uptimeMillis()) { pid = proc.pid; } else { proc = null; pid = 0; } } if (proc != null) { long pss = Debug.getPss(pid, tmp, null); synchronized (ActivityManagerService.this) { if (pss != 0 && proc.thread != null && proc.setProcState == procState && proc.pid == pid && proc.lastPssTime == lastPssTime) { num++; recordPssSampleLocked(proc, procState, pss, tmp[0], tmp[1], SystemClock.uptimeMillis()); } } } } while (true); } } } }; public void setSystemProcess() { try { ServiceManager.addService(Context.ACTIVITY_SERVICE, this, /* allowIsolated= */ true, DUMP_FLAG_PRIORITY_CRITICAL | DUMP_FLAG_PRIORITY_NORMAL | DUMP_FLAG_PROTO); ServiceManager.addService(ProcessStats.SERVICE_NAME, mProcessStats); ServiceManager.addService("meminfo", new MemBinder(this), /* allowIsolated= */ false, DUMP_FLAG_PRIORITY_HIGH | DUMP_FLAG_PRIORITY_NORMAL); ServiceManager.addService("gfxinfo", new GraphicsBinder(this)); ServiceManager.addService("dbinfo", new DbBinder(this)); if (MONITOR_CPU_USAGE) { ServiceManager.addService("cpuinfo", new CpuBinder(this), /* allowIsolated= */ false, DUMP_FLAG_PRIORITY_CRITICAL); } ServiceManager.addService("permission", new PermissionController(this)); ServiceManager.addService("processinfo", new ProcessInfoService(this)); ApplicationInfo info = mContext.getPackageManager().getApplicationInfo( "android", STOCK_PM_FLAGS | MATCH_SYSTEM_ONLY); mSystemThread.installSystemApplicationInfo(info, getClass().getClassLoader()); synchronized (this) { ProcessRecord app = newProcessRecordLocked(info, info.processName, false, 0); app.persistent = true; app.pid = MY_PID; app.maxAdj = ProcessList.SYSTEM_ADJ; app.makeActive(mSystemThread.getApplicationThread(), mProcessStats); synchronized (mPidsSelfLocked) { mPidsSelfLocked.put(app.pid, app); } updateLruProcessLocked(app, false, null); updateOomAdjLocked(); } } catch (PackageManager.NameNotFoundException e) { throw new RuntimeException( "Unable to find android system package", e); } } public void setWindowManager(WindowManagerService wm) { synchronized (this) { mWindowManager = wm; mStackSupervisor.setWindowManager(wm); mLockTaskController.setWindowManager(wm); } } public void setUsageStatsManager(UsageStatsManagerInternal usageStatsManager) { mUsageStatsService = usageStatsManager; } public void startObservingNativeCrashes() { final NativeCrashListener ncl = new NativeCrashListener(this); ncl.start(); } public IAppOpsService getAppOpsService() { return mAppOpsService; } static class MemBinder extends Binder { ActivityManagerService mActivityManagerService; private final PriorityDump.PriorityDumper mPriorityDumper = new PriorityDump.PriorityDumper() { @Override public void dumpNormal(FileDescriptor fd, PrintWriter pw, String[] args, boolean asProto) { if (asProto) return; mActivityManagerService.dumpApplicationMemoryUsage(fd, pw, " ", args, false, null); } }; MemBinder(ActivityManagerService activityManagerService) { mActivityManagerService = activityManagerService; } @Override protected void dump(FileDescriptor fd, PrintWriter pw, String[] args) { if (!DumpUtils.checkDumpAndUsageStatsPermission(mActivityManagerService.mContext, "meminfo", pw)) return; PriorityDump.dump(mPriorityDumper, fd, pw, args); } } static class GraphicsBinder extends Binder { ActivityManagerService mActivityManagerService; GraphicsBinder(ActivityManagerService activityManagerService) { mActivityManagerService = activityManagerService; } @Override protected void dump(FileDescriptor fd, PrintWriter pw, String[] args) { if (!DumpUtils.checkDumpAndUsageStatsPermission(mActivityManagerService.mContext, "gfxinfo", pw)) return; mActivityManagerService.dumpGraphicsHardwareUsage(fd, pw, args); } } static class DbBinder extends Binder { ActivityManagerService mActivityManagerService; DbBinder(ActivityManagerService activityManagerService) { mActivityManagerService = activityManagerService; } @Override protected void dump(FileDescriptor fd, PrintWriter pw, String[] args) { if (!DumpUtils.checkDumpAndUsageStatsPermission(mActivityManagerService.mContext, "dbinfo", pw)) return; mActivityManagerService.dumpDbInfo(fd, pw, args); } } static class CpuBinder extends Binder { ActivityManagerService mActivityManagerService; private final PriorityDump.PriorityDumper mPriorityDumper = new PriorityDump.PriorityDumper() { @Override public void dumpCritical(FileDescriptor fd, PrintWriter pw, String[] args, boolean asProto) { if (asProto) return; if (!DumpUtils.checkDumpAndUsageStatsPermission(mActivityManagerService.mContext, "cpuinfo", pw)) return; synchronized (mActivityManagerService.mProcessCpuTracker) { pw.print(mActivityManagerService.mProcessCpuTracker.printCurrentLoad()); pw.print(mActivityManagerService.mProcessCpuTracker.printCurrentState( SystemClock.uptimeMillis())); } } }; CpuBinder(ActivityManagerService activityManagerService) { mActivityManagerService = activityManagerService; } @Override protected void dump(FileDescriptor fd, PrintWriter pw, String[] args) { PriorityDump.dump(mPriorityDumper, fd, pw, args); } } public static final class Lifecycle extends SystemService { private final ActivityManagerService mService; public Lifecycle(Context context) { super(context); mService = new ActivityManagerService(context); } @Override public void onStart() { mService.start(); } @Override public void onCleanupUser(int userId) { mService.mBatteryStatsService.onCleanupUser(userId); } public ActivityManagerService getService() { return mService; } } @VisibleForTesting public ActivityManagerService(Injector injector) { mInjector = injector; mContext = mInjector.getContext(); mUiContext = null; GL_ES_VERSION = 0; mActivityStarter = null; mAppErrors = null; mAppOpsService = mInjector.getAppOpsService(null, null); mBatteryStatsService = null; mCompatModePackages = null; mConstants = null; mGrantFile = null; mHandler = null; mHandlerThread = null; mIntentFirewall = null; mKeyguardController = null; mPermissionReviewRequired = false; mProcessCpuThread = null; mProcessStats = null; mProviderMap = null; mRecentTasks = null; mServices = null; mStackSupervisor = null; mSystemThread = null; mTaskChangeNotificationController = null; mUiHandler = injector.getUiHandler(null); mUserController = null; mVrController = null; mLockTaskController = null; } // Note: This method is invoked on the main thread but may need to attach various // handlers to other threads. So take care to be explicit about the looper. public ActivityManagerService(Context systemContext) { LockGuard.installLock(this, LockGuard.INDEX_ACTIVITY); mInjector = new Injector(); mContext = systemContext; mFactoryTest = FactoryTest.getMode(); mSystemThread = ActivityThread.currentActivityThread(); mUiContext = mSystemThread.getSystemUiContext(); Slog.i(TAG, "Memory class: " + ActivityManager.staticGetMemoryClass()); mPermissionReviewRequired = mContext.getResources().getBoolean( com.android.internal.R.bool.config_permissionReviewRequired); mHandlerThread = new ServiceThread(TAG, THREAD_PRIORITY_FOREGROUND, false /*allowIo*/); mHandlerThread.start(); mHandler = new MainHandler(mHandlerThread.getLooper()); mUiHandler = mInjector.getUiHandler(this); mConstants = new ActivityManagerConstants(this, mHandler); /* static; one-time init here */ if (sKillHandler == null) { sKillThread = new ServiceThread(TAG + ":kill", THREAD_PRIORITY_BACKGROUND, true /* allowIo */); sKillThread.start(); sKillHandler = new KillHandler(sKillThread.getLooper()); } mFgBroadcastQueue = new BroadcastQueue(this, mHandler, "foreground", BROADCAST_FG_TIMEOUT, false); mBgBroadcastQueue = new BroadcastQueue(this, mHandler, "background", BROADCAST_BG_TIMEOUT, true); mBroadcastQueues[0] = mFgBroadcastQueue; mBroadcastQueues[1] = mBgBroadcastQueue; mServices = new ActiveServices(this); mProviderMap = new ProviderMap(this); mAppErrors = new AppErrors(mUiContext, this); // TODO: Move creation of battery stats service outside of activity manager service. File dataDir = Environment.getDataDirectory(); File systemDir = new File(dataDir, "system"); systemDir.mkdirs(); mBatteryStatsService = new BatteryStatsService(systemContext, systemDir, mHandler); mBatteryStatsService.getActiveStatistics().readLocked(); mBatteryStatsService.scheduleWriteToDisk(); mOnBattery = DEBUG_POWER ? true : mBatteryStatsService.getActiveStatistics().getIsOnBattery(); mBatteryStatsService.getActiveStatistics().setCallback(this); mProcessStats = new ProcessStatsService(this, new File(systemDir, "procstats")); mAppOpsService = mInjector.getAppOpsService(new File(systemDir, "appops.xml"), mHandler); mAppOpsService.startWatchingMode(AppOpsManager.OP_RUN_IN_BACKGROUND, null, new IAppOpsCallback.Stub() { @Override public void opChanged(int op, int uid, String packageName) { if (op == AppOpsManager.OP_RUN_IN_BACKGROUND && packageName != null) { if (mAppOpsService.checkOperation(op, uid, packageName) != AppOpsManager.MODE_ALLOWED) { runInBackgroundDisabled(uid); } } } }); mGrantFile = new AtomicFile(new File(systemDir, "urigrants.xml")); mUserController = new UserController(this); mVrController = new VrController(this); GL_ES_VERSION = SystemProperties.getInt("ro.opengles.version", ConfigurationInfo.GL_ES_VERSION_UNDEFINED); if (SystemProperties.getInt("sys.use_fifo_ui", 0) != 0) { mUseFifoUiScheduling = true; } mTrackingAssociations = "1".equals(SystemProperties.get("debug.track-associations")); mTempConfig.setToDefaults(); mTempConfig.setLocales(LocaleList.getDefault()); mConfigurationSeq = mTempConfig.seq = 1; mStackSupervisor = createStackSupervisor(); mStackSupervisor.onConfigurationChanged(mTempConfig); mKeyguardController = mStackSupervisor.mKeyguardController; mCompatModePackages = new CompatModePackages(this, systemDir, mHandler); mIntentFirewall = new IntentFirewall(new IntentFirewallInterface(), mHandler); mTaskChangeNotificationController = new TaskChangeNotificationController(this, mStackSupervisor, mHandler); mActivityStarter = new ActivityStarter(this); mRecentTasks = createRecentTasks(); mStackSupervisor.setRecentTasks(mRecentTasks); mLockTaskController = new LockTaskController(mContext, mStackSupervisor, mHandler); mProcessCpuThread = new Thread("CpuTracker") { @Override public void run() { synchronized (mProcessCpuTracker) { mProcessCpuInitLatch.countDown(); mProcessCpuTracker.init(); } while (true) { try { try { synchronized(this) { final long now = SystemClock.uptimeMillis(); long nextCpuDelay = (mLastCpuTime.get()+MONITOR_CPU_MAX_TIME)-now; long nextWriteDelay = (mLastWriteTime+BATTERY_STATS_TIME)-now; //Slog.i(TAG, "Cpu delay=" + nextCpuDelay // + ", write delay=" + nextWriteDelay); if (nextWriteDelay < nextCpuDelay) { nextCpuDelay = nextWriteDelay; } if (nextCpuDelay > 0) { mProcessCpuMutexFree.set(true); this.wait(nextCpuDelay); } } } catch (InterruptedException e) { } updateCpuStatsNow(); } catch (Exception e) { Slog.e(TAG, "Unexpected exception collecting process stats", e); } } } }; Watchdog.getInstance().addMonitor(this); Watchdog.getInstance().addThread(mHandler); } protected ActivityStackSupervisor createStackSupervisor() { return new ActivityStackSupervisor(this, mHandler.getLooper()); } protected RecentTasks createRecentTasks() { return new RecentTasks(this, mStackSupervisor); } RecentTasks getRecentTasks() { return mRecentTasks; } public void setSystemServiceManager(SystemServiceManager mgr) { mSystemServiceManager = mgr; } public void setInstaller(Installer installer) { mInstaller = installer; } private void start() { removeAllProcessGroups(); mProcessCpuThread.start(); mBatteryStatsService.publish(); mAppOpsService.publish(mContext); Slog.d("AppOps", "AppOpsService published"); LocalServices.addService(ActivityManagerInternal.class, new LocalService()); // Wait for the synchronized block started in mProcessCpuThread, // so that any other acccess to mProcessCpuTracker from main thread // will be blocked during mProcessCpuTracker initialization. try { mProcessCpuInitLatch.await(); } catch (InterruptedException e) { Slog.wtf(TAG, "Interrupted wait during start", e); Thread.currentThread().interrupt(); throw new IllegalStateException("Interrupted wait during start"); } } void onUserStoppedLocked(int userId) { mRecentTasks.unloadUserDataFromMemoryLocked(userId); } public void initPowerManagement() { mStackSupervisor.initPowerManagement(); mBatteryStatsService.initPowerManagement(); mLocalPowerManager = LocalServices.getService(PowerManagerInternal.class); PowerManager pm = (PowerManager)mContext.getSystemService(Context.POWER_SERVICE); mVoiceWakeLock = pm.newWakeLock(PowerManager.PARTIAL_WAKE_LOCK, "*voice*"); mVoiceWakeLock.setReferenceCounted(false); } private ArraySet getBackgroundLaunchBroadcasts() { if (mBackgroundLaunchBroadcasts == null) { mBackgroundLaunchBroadcasts = SystemConfig.getInstance().getAllowImplicitBroadcasts(); } return mBackgroundLaunchBroadcasts; } @Override public boolean onTransact(int code, Parcel data, Parcel reply, int flags) throws RemoteException { if (code == SYSPROPS_TRANSACTION) { // We need to tell all apps about the system property change. ArrayList procs = new ArrayList(); synchronized(this) { final int NP = mProcessNames.getMap().size(); for (int ip=0; ip apps = mProcessNames.getMap().valueAt(ip); final int NA = apps.size(); for (int ia=0; ia= now - MONITOR_CPU_MIN_TIME) { return; } if (mProcessCpuMutexFree.compareAndSet(true, false)) { synchronized (mProcessCpuThread) { mProcessCpuThread.notify(); } } } void updateCpuStatsNow() { synchronized (mProcessCpuTracker) { mProcessCpuMutexFree.set(false); final long now = SystemClock.uptimeMillis(); boolean haveNewCpuStats = false; if (MONITOR_CPU_USAGE && mLastCpuTime.get() < (now-MONITOR_CPU_MIN_TIME)) { mLastCpuTime.set(now); mProcessCpuTracker.update(); if (mProcessCpuTracker.hasGoodLastStats()) { haveNewCpuStats = true; //Slog.i(TAG, mProcessCpu.printCurrentState()); //Slog.i(TAG, "Total CPU usage: " // + mProcessCpu.getTotalCpuPercent() + "%"); // Slog the cpu usage if the property is set. if ("true".equals(SystemProperties.get("events.cpu"))) { int user = mProcessCpuTracker.getLastUserTime(); int system = mProcessCpuTracker.getLastSystemTime(); int iowait = mProcessCpuTracker.getLastIoWaitTime(); int irq = mProcessCpuTracker.getLastIrqTime(); int softIrq = mProcessCpuTracker.getLastSoftIrqTime(); int idle = mProcessCpuTracker.getLastIdleTime(); int total = user + system + iowait + irq + softIrq + idle; if (total == 0) total = 1; EventLog.writeEvent(EventLogTags.CPU, ((user+system+iowait+irq+softIrq) * 100) / total, (user * 100) / total, (system * 100) / total, (iowait * 100) / total, (irq * 100) / total, (softIrq * 100) / total); } } } final BatteryStatsImpl bstats = mBatteryStatsService.getActiveStatistics(); synchronized(bstats) { synchronized(mPidsSelfLocked) { if (haveNewCpuStats) { if (bstats.startAddingCpuLocked()) { int totalUTime = 0; int totalSTime = 0; final int N = mProcessCpuTracker.countStats(); for (int i=0; i getCommonServicesLocked(boolean isolated) { // Isolated processes won't get this optimization, so that we don't // violate the rules about which services they have access to. if (isolated) { if (mIsolatedAppBindArgs == null) { mIsolatedAppBindArgs = new HashMap<>(); mIsolatedAppBindArgs.put("package", ServiceManager.getService("package")); } return mIsolatedAppBindArgs; } if (mAppBindArgs == null) { mAppBindArgs = new HashMap<>(); // Setup the application init args mAppBindArgs.put("package", ServiceManager.getService("package")); mAppBindArgs.put("window", ServiceManager.getService("window")); mAppBindArgs.put(Context.ALARM_SERVICE, ServiceManager.getService(Context.ALARM_SERVICE)); } return mAppBindArgs; } /** * Update AMS states when an activity is resumed. This should only be called by * {@link ActivityStack#setResumedActivityLocked} when an activity is resumed. */ void setResumedActivityUncheckLocked(ActivityRecord r, String reason) { final TaskRecord task = r.getTask(); if (task.isActivityTypeStandard()) { if (mCurAppTimeTracker != r.appTimeTracker) { // We are switching app tracking. Complete the current one. if (mCurAppTimeTracker != null) { mCurAppTimeTracker.stop(); mHandler.obtainMessage( REPORT_TIME_TRACKER_MSG, mCurAppTimeTracker).sendToTarget(); mStackSupervisor.clearOtherAppTimeTrackers(r.appTimeTracker); mCurAppTimeTracker = null; } if (r.appTimeTracker != null) { mCurAppTimeTracker = r.appTimeTracker; startTimeTrackingFocusedActivityLocked(); } } else { startTimeTrackingFocusedActivityLocked(); } } else { r.appTimeTracker = null; } // TODO: VI Maybe r.task.voiceInteractor || r.voiceInteractor != null // TODO: Probably not, because we don't want to resume voice on switching // back to this activity if (task.voiceInteractor != null) { startRunningVoiceLocked(task.voiceSession, r.info.applicationInfo.uid); } else { finishRunningVoiceLocked(); if (mLastResumedActivity != null) { final IVoiceInteractionSession session; final TaskRecord lastResumedActivityTask = mLastResumedActivity.getTask(); if (lastResumedActivityTask != null && lastResumedActivityTask.voiceSession != null) { session = lastResumedActivityTask.voiceSession; } else { session = mLastResumedActivity.voiceSession; } if (session != null) { // We had been in a voice interaction session, but now focused has // move to something different. Just finish the session, we can't // return to it and retain the proper state and synchronization with // the voice interaction service. finishVoiceTask(session); } } } if (mLastResumedActivity != null && r.userId != mLastResumedActivity.userId) { mUserController.sendForegroundProfileChanged(r.userId); } mLastResumedActivity = r; mWindowManager.setFocusedApp(r.appToken, true); applyUpdateLockStateLocked(r); applyUpdateVrModeLocked(r); EventLogTags.writeAmSetResumedActivity( r == null ? -1 : r.userId, r == null ? "NULL" : r.shortComponentName, reason); } @Override public void setFocusedStack(int stackId) { enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "setFocusedStack()"); if (DEBUG_FOCUS) Slog.d(TAG_FOCUS, "setFocusedStack: stackId=" + stackId); final long callingId = Binder.clearCallingIdentity(); try { synchronized (this) { final ActivityStack stack = mStackSupervisor.getStack(stackId); if (stack == null) { Slog.w(TAG, "setFocusedStack: No stack with id=" + stackId); return; } final ActivityRecord r = stack.topRunningActivityLocked(); if (mStackSupervisor.moveFocusableActivityStackToFrontLocked(r, "setFocusedStack")) { mStackSupervisor.resumeFocusedStackTopActivityLocked(); } } } finally { Binder.restoreCallingIdentity(callingId); } } @Override public void setFocusedTask(int taskId) { enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "setFocusedTask()"); if (DEBUG_FOCUS) Slog.d(TAG_FOCUS, "setFocusedTask: taskId=" + taskId); final long callingId = Binder.clearCallingIdentity(); try { synchronized (this) { final TaskRecord task = mStackSupervisor.anyTaskForIdLocked(taskId); if (task == null) { return; } final ActivityRecord r = task.topRunningActivityLocked(); if (mStackSupervisor.moveFocusableActivityStackToFrontLocked(r, "setFocusedTask")) { mStackSupervisor.resumeFocusedStackTopActivityLocked(); } } } finally { Binder.restoreCallingIdentity(callingId); } } /** Sets the task stack listener that gets callbacks when a task stack changes. */ @Override public void registerTaskStackListener(ITaskStackListener listener) throws RemoteException { enforceCallerIsRecentsOrHasPermission(MANAGE_ACTIVITY_STACKS, "registerTaskStackListener()"); mTaskChangeNotificationController.registerTaskStackListener(listener); } /** * Unregister a task stack listener so that it stops receiving callbacks. */ @Override public void unregisterTaskStackListener(ITaskStackListener listener) throws RemoteException { enforceCallerIsRecentsOrHasPermission(MANAGE_ACTIVITY_STACKS, "unregisterTaskStackListener()"); mTaskChangeNotificationController.unregisterTaskStackListener(listener); } @Override public void notifyActivityDrawn(IBinder token) { if (DEBUG_VISIBILITY) Slog.d(TAG_VISIBILITY, "notifyActivityDrawn: token=" + token); synchronized (this) { ActivityRecord r = mStackSupervisor.isInAnyStackLocked(token); if (r != null) { r.getStack().notifyActivityDrawnLocked(r); } } } final void applyUpdateLockStateLocked(ActivityRecord r) { // Modifications to the UpdateLock state are done on our handler, outside // the activity manager's locks. The new state is determined based on the // state *now* of the relevant activity record. The object is passed to // the handler solely for logging detail, not to be consulted/modified. final boolean nextState = r != null && r.immersive; mHandler.sendMessage( mHandler.obtainMessage(IMMERSIVE_MODE_LOCK_MSG, (nextState) ? 1 : 0, 0, r)); } final void applyUpdateVrModeLocked(ActivityRecord r) { // VR apps are expected to run in a main display. If an app is turning on VR for // itself, but lives in a dynamic stack, then make sure that it is moved to the main // fullscreen stack before enabling VR Mode. // TODO: The goal of this code is to keep the VR app on the main display. When the // stack implementation changes in the future, keep in mind that the use of the fullscreen // stack is a means to move the activity to the main display and a moveActivityToDisplay() // option would be a better choice here. if (r.requestedVrComponent != null && r.getDisplayId() != DEFAULT_DISPLAY) { Slog.i(TAG, "Moving " + r.shortComponentName + " from stack " + r.getStackId() + " to main stack for VR"); final ActivityStack stack = mStackSupervisor.getDefaultDisplay().getOrCreateStack( WINDOWING_MODE_FULLSCREEN, r.getActivityType(), true /* toTop */); moveTaskToStack(r.getTask().taskId, stack.mStackId, true /* toTop */); } mHandler.sendMessage( mHandler.obtainMessage(VR_MODE_CHANGE_MSG, 0, 0, r)); } private void sendNotifyVrManagerOfSleepState(boolean isSleeping) { mHandler.sendMessage( mHandler.obtainMessage(NOTIFY_VR_SLEEPING_MSG, isSleeping ? 1 : 0, 0)); } private void notifyVrManagerOfSleepState(boolean isSleeping) { final VrManagerInternal vrService = LocalServices.getService(VrManagerInternal.class); if (vrService == null) { return; } vrService.onSleepStateChanged(isSleeping); } private void sendNotifyVrManagerOfKeyguardState(boolean isShowing) { mHandler.sendMessage( mHandler.obtainMessage(NOTIFY_VR_KEYGUARD_MSG, isShowing ? 1 : 0, 0)); } private void notifyVrManagerOfKeyguardState(boolean isShowing) { final VrManagerInternal vrService = LocalServices.getService(VrManagerInternal.class); if (vrService == null) { return; } vrService.onKeyguardStateChanged(isShowing); } final void showAskCompatModeDialogLocked(ActivityRecord r) { Message msg = Message.obtain(); msg.what = SHOW_COMPAT_MODE_DIALOG_UI_MSG; msg.obj = r.getTask().askedCompatMode ? null : r; mUiHandler.sendMessage(msg); } final void showUnsupportedZoomDialogIfNeededLocked(ActivityRecord r) { final Configuration globalConfig = getGlobalConfiguration(); if (globalConfig.densityDpi != DisplayMetrics.DENSITY_DEVICE_STABLE && r.appInfo.requiresSmallestWidthDp > globalConfig.smallestScreenWidthDp) { final Message msg = Message.obtain(); msg.what = SHOW_UNSUPPORTED_DISPLAY_SIZE_DIALOG_MSG; msg.obj = r; mUiHandler.sendMessage(msg); } } private int updateLruProcessInternalLocked(ProcessRecord app, long now, int index, String what, Object obj, ProcessRecord srcApp) { app.lastActivityTime = now; if (app.activities.size() > 0) { // Don't want to touch dependent processes that are hosting activities. return index; } int lrui = mLruProcesses.lastIndexOf(app); if (lrui < 0) { Slog.wtf(TAG, "Adding dependent process " + app + " not on LRU list: " + what + " " + obj + " from " + srcApp); return index; } if (lrui >= index) { // Don't want to cause this to move dependent processes *back* in the // list as if they were less frequently used. return index; } if (lrui >= mLruProcessActivityStart) { // Don't want to touch dependent processes that are hosting activities. return index; } mLruProcesses.remove(lrui); if (index > 0) { index--; } if (DEBUG_LRU) Slog.d(TAG_LRU, "Moving dep from " + lrui + " to " + index + " in LRU list: " + app); mLruProcesses.add(index, app); return index; } static void killProcessGroup(int uid, int pid) { if (sKillHandler != null) { sKillHandler.sendMessage( sKillHandler.obtainMessage(KillHandler.KILL_PROCESS_GROUP_MSG, uid, pid)); } else { Slog.w(TAG, "Asked to kill process group before system bringup!"); Process.killProcessGroup(uid, pid); } } final void removeLruProcessLocked(ProcessRecord app) { int lrui = mLruProcesses.lastIndexOf(app); if (lrui >= 0) { if (!app.killed) { Slog.wtfStack(TAG, "Removing process that hasn't been killed: " + app); killProcessQuiet(app.pid); killProcessGroup(app.uid, app.pid); } if (lrui <= mLruProcessActivityStart) { mLruProcessActivityStart--; } if (lrui <= mLruProcessServiceStart) { mLruProcessServiceStart--; } mLruProcesses.remove(lrui); } } final void updateLruProcessLocked(ProcessRecord app, boolean activityChange, ProcessRecord client) { final boolean hasActivity = app.activities.size() > 0 || app.hasClientActivities || app.treatLikeActivity; final boolean hasService = false; // not impl yet. app.services.size() > 0; if (!activityChange && hasActivity) { // The process has activities, so we are only allowing activity-based adjustments // to move it. It should be kept in the front of the list with other // processes that have activities, and we don't want those to change their // order except due to activity operations. return; } mLruSeq++; final long now = SystemClock.uptimeMillis(); app.lastActivityTime = now; // First a quick reject: if the app is already at the position we will // put it, then there is nothing to do. if (hasActivity) { final int N = mLruProcesses.size(); if (N > 0 && mLruProcesses.get(N-1) == app) { if (DEBUG_LRU) Slog.d(TAG_LRU, "Not moving, already top activity: " + app); return; } } else { if (mLruProcessServiceStart > 0 && mLruProcesses.get(mLruProcessServiceStart-1) == app) { if (DEBUG_LRU) Slog.d(TAG_LRU, "Not moving, already top other: " + app); return; } } int lrui = mLruProcesses.lastIndexOf(app); if (app.persistent && lrui >= 0) { // We don't care about the position of persistent processes, as long as // they are in the list. if (DEBUG_LRU) Slog.d(TAG_LRU, "Not moving, persistent: " + app); return; } /* In progress: compute new position first, so we can avoid doing work if the process is not actually going to move. Not yet working. int addIndex; int nextIndex; boolean inActivity = false, inService = false; if (hasActivity) { // Process has activities, put it at the very tipsy-top. addIndex = mLruProcesses.size(); nextIndex = mLruProcessServiceStart; inActivity = true; } else if (hasService) { // Process has services, put it at the top of the service list. addIndex = mLruProcessActivityStart; nextIndex = mLruProcessServiceStart; inActivity = true; inService = true; } else { // Process not otherwise of interest, it goes to the top of the non-service area. addIndex = mLruProcessServiceStart; if (client != null) { int clientIndex = mLruProcesses.lastIndexOf(client); if (clientIndex < 0) Slog.d(TAG, "Unknown client " + client + " when updating " + app); if (clientIndex >= 0 && addIndex > clientIndex) { addIndex = clientIndex; } } nextIndex = addIndex > 0 ? addIndex-1 : addIndex; } Slog.d(TAG, "Update LRU at " + lrui + " to " + addIndex + " (act=" + mLruProcessActivityStart + "): " + app); */ if (lrui >= 0) { if (lrui < mLruProcessActivityStart) { mLruProcessActivityStart--; } if (lrui < mLruProcessServiceStart) { mLruProcessServiceStart--; } /* if (addIndex > lrui) { addIndex--; } if (nextIndex > lrui) { nextIndex--; } */ mLruProcesses.remove(lrui); } /* mLruProcesses.add(addIndex, app); if (inActivity) { mLruProcessActivityStart++; } if (inService) { mLruProcessActivityStart++; } */ int nextIndex; if (hasActivity) { final int N = mLruProcesses.size(); if (app.activities.size() == 0 && mLruProcessActivityStart < (N - 1)) { // Process doesn't have activities, but has clients with // activities... move it up, but one below the top (the top // should always have a real activity). if (DEBUG_LRU) Slog.d(TAG_LRU, "Adding to second-top of LRU activity list: " + app); mLruProcesses.add(N - 1, app); // To keep it from spamming the LRU list (by making a bunch of clients), // we will push down any other entries owned by the app. final int uid = app.info.uid; for (int i = N - 2; i > mLruProcessActivityStart; i--) { ProcessRecord subProc = mLruProcesses.get(i); if (subProc.info.uid == uid) { // We want to push this one down the list. If the process after // it is for the same uid, however, don't do so, because we don't // want them internally to be re-ordered. if (mLruProcesses.get(i - 1).info.uid != uid) { if (DEBUG_LRU) Slog.d(TAG_LRU, "Pushing uid " + uid + " swapping at " + i + ": " + mLruProcesses.get(i) + " : " + mLruProcesses.get(i - 1)); ProcessRecord tmp = mLruProcesses.get(i); mLruProcesses.set(i, mLruProcesses.get(i - 1)); mLruProcesses.set(i - 1, tmp); i--; } } else { // A gap, we can stop here. break; } } } else { // Process has activities, put it at the very tipsy-top. if (DEBUG_LRU) Slog.d(TAG_LRU, "Adding to top of LRU activity list: " + app); mLruProcesses.add(app); } nextIndex = mLruProcessServiceStart; } else if (hasService) { // Process has services, put it at the top of the service list. if (DEBUG_LRU) Slog.d(TAG_LRU, "Adding to top of LRU service list: " + app); mLruProcesses.add(mLruProcessActivityStart, app); nextIndex = mLruProcessServiceStart; mLruProcessActivityStart++; } else { // Process not otherwise of interest, it goes to the top of the non-service area. int index = mLruProcessServiceStart; if (client != null) { // If there is a client, don't allow the process to be moved up higher // in the list than that client. int clientIndex = mLruProcesses.lastIndexOf(client); if (DEBUG_LRU && clientIndex < 0) Slog.d(TAG_LRU, "Unknown client " + client + " when updating " + app); if (clientIndex <= lrui) { // Don't allow the client index restriction to push it down farther in the // list than it already is. clientIndex = lrui; } if (clientIndex >= 0 && index > clientIndex) { index = clientIndex; } } if (DEBUG_LRU) Slog.d(TAG_LRU, "Adding at " + index + " of LRU list: " + app); mLruProcesses.add(index, app); nextIndex = index-1; mLruProcessActivityStart++; mLruProcessServiceStart++; } // If the app is currently using a content provider or service, // bump those processes as well. for (int j=app.connections.size()-1; j>=0; j--) { ConnectionRecord cr = app.connections.valueAt(j); if (cr.binding != null && !cr.serviceDead && cr.binding.service != null && cr.binding.service.app != null && cr.binding.service.app.lruSeq != mLruSeq && !cr.binding.service.app.persistent) { nextIndex = updateLruProcessInternalLocked(cr.binding.service.app, now, nextIndex, "service connection", cr, app); } } for (int j=app.conProviders.size()-1; j>=0; j--) { ContentProviderRecord cpr = app.conProviders.get(j).provider; if (cpr.proc != null && cpr.proc.lruSeq != mLruSeq && !cpr.proc.persistent) { nextIndex = updateLruProcessInternalLocked(cpr.proc, now, nextIndex, "provider reference", cpr, app); } } } final ProcessRecord getProcessRecordLocked(String processName, int uid, boolean keepIfLarge) { if (uid == SYSTEM_UID) { // The system gets to run in any process. If there are multiple // processes with the same uid, just pick the first (this // should never happen). SparseArray procs = mProcessNames.getMap().get(processName); if (procs == null) return null; final int procCount = procs.size(); for (int i = 0; i < procCount; i++) { final int procUid = procs.keyAt(i); if (UserHandle.isApp(procUid) || !UserHandle.isSameUser(procUid, uid)) { // Don't use an app process or different user process for system component. continue; } return procs.valueAt(i); } } ProcessRecord proc = mProcessNames.get(processName, uid); if (false && proc != null && !keepIfLarge && proc.setProcState >= ActivityManager.PROCESS_STATE_CACHED_EMPTY && proc.lastCachedPss >= 4000) { // Turn this condition on to cause killing to happen regularly, for testing. if (proc.baseProcessTracker != null) { proc.baseProcessTracker.reportCachedKill(proc.pkgList, proc.lastCachedPss); } proc.kill(Long.toString(proc.lastCachedPss) + "k from cached", true); } else if (proc != null && !keepIfLarge && mLastMemoryLevel > ProcessStats.ADJ_MEM_FACTOR_NORMAL && proc.setProcState >= ActivityManager.PROCESS_STATE_CACHED_EMPTY) { if (DEBUG_PSS) Slog.d(TAG_PSS, "May not keep " + proc + ": pss=" + proc.lastCachedPss); if (proc.lastCachedPss >= mProcessList.getCachedRestoreThresholdKb()) { if (proc.baseProcessTracker != null) { proc.baseProcessTracker.reportCachedKill(proc.pkgList, proc.lastCachedPss); } proc.kill(Long.toString(proc.lastCachedPss) + "k from cached", true); } } return proc; } void notifyPackageUse(String packageName, int reason) { synchronized(this) { getPackageManagerInternalLocked().notifyPackageUse(packageName, reason); } } boolean isNextTransitionForward() { int transit = mWindowManager.getPendingAppTransition(); return transit == TRANSIT_ACTIVITY_OPEN || transit == TRANSIT_TASK_OPEN || transit == TRANSIT_TASK_TO_FRONT; } int startIsolatedProcess(String entryPoint, String[] entryPointArgs, String processName, String abiOverride, int uid, Runnable crashHandler) { synchronized(this) { ApplicationInfo info = new ApplicationInfo(); // In general the ApplicationInfo.uid isn't neccesarily equal to ProcessRecord.uid. // For isolated processes, the former contains the parent's uid and the latter the // actual uid of the isolated process. // In the special case introduced by this method (which is, starting an isolated // process directly from the SystemServer without an actual parent app process) the // closest thing to a parent's uid is SYSTEM_UID. // The only important thing here is to keep AI.uid != PR.uid, in order to trigger // the |isolated| logic in the ProcessRecord constructor. info.uid = SYSTEM_UID; info.processName = processName; info.className = entryPoint; info.packageName = "android"; info.seInfoUser = SELinuxUtil.COMPLETE_STR; ProcessRecord proc = startProcessLocked(processName, info /* info */, false /* knownToBeDead */, 0 /* intentFlags */, "" /* hostingType */, null /* hostingName */, true /* allowWhileBooting */, true /* isolated */, uid, true /* keepIfLarge */, abiOverride, entryPoint, entryPointArgs, crashHandler); return proc != null ? proc.pid : 0; } } final ProcessRecord startProcessLocked(String processName, ApplicationInfo info, boolean knownToBeDead, int intentFlags, String hostingType, ComponentName hostingName, boolean allowWhileBooting, boolean isolated, boolean keepIfLarge) { return startProcessLocked(processName, info, knownToBeDead, intentFlags, hostingType, hostingName, allowWhileBooting, isolated, 0 /* isolatedUid */, keepIfLarge, null /* ABI override */, null /* entryPoint */, null /* entryPointArgs */, null /* crashHandler */); } final ProcessRecord startProcessLocked(String processName, ApplicationInfo info, boolean knownToBeDead, int intentFlags, String hostingType, ComponentName hostingName, boolean allowWhileBooting, boolean isolated, int isolatedUid, boolean keepIfLarge, String abiOverride, String entryPoint, String[] entryPointArgs, Runnable crashHandler) { long startTime = SystemClock.elapsedRealtime(); ProcessRecord app; if (!isolated) { app = getProcessRecordLocked(processName, info.uid, keepIfLarge); checkTime(startTime, "startProcess: after getProcessRecord"); if ((intentFlags & Intent.FLAG_FROM_BACKGROUND) != 0) { // If we are in the background, then check to see if this process // is bad. If so, we will just silently fail. if (mAppErrors.isBadProcessLocked(info)) { if (DEBUG_PROCESSES) Slog.v(TAG, "Bad process: " + info.uid + "/" + info.processName); return null; } } else { // When the user is explicitly starting a process, then clear its // crash count so that we won't make it bad until they see at // least one crash dialog again, and make the process good again // if it had been bad. if (DEBUG_PROCESSES) Slog.v(TAG, "Clearing bad process: " + info.uid + "/" + info.processName); mAppErrors.resetProcessCrashTimeLocked(info); if (mAppErrors.isBadProcessLocked(info)) { EventLog.writeEvent(EventLogTags.AM_PROC_GOOD, UserHandle.getUserId(info.uid), info.uid, info.processName); mAppErrors.clearBadProcessLocked(info); if (app != null) { app.bad = false; } } } } else { // If this is an isolated process, it can't re-use an existing process. app = null; } // We don't have to do anything more if: // (1) There is an existing application record; and // (2) The caller doesn't think it is dead, OR there is no thread // object attached to it so we know it couldn't have crashed; and // (3) There is a pid assigned to it, so it is either starting or // already running. if (DEBUG_PROCESSES) Slog.v(TAG_PROCESSES, "startProcess: name=" + processName + " app=" + app + " knownToBeDead=" + knownToBeDead + " thread=" + (app != null ? app.thread : null) + " pid=" + (app != null ? app.pid : -1)); if (app != null && app.pid > 0) { if ((!knownToBeDead && !app.killed) || app.thread == null) { // We already have the app running, or are waiting for it to // come up (we have a pid but not yet its thread), so keep it. if (DEBUG_PROCESSES) Slog.v(TAG_PROCESSES, "App already running: " + app); // If this is a new package in the process, add the package to the list app.addPackage(info.packageName, info.versionCode, mProcessStats); checkTime(startTime, "startProcess: done, added package to proc"); return app; } // An application record is attached to a previous process, // clean it up now. if (DEBUG_PROCESSES || DEBUG_CLEANUP) Slog.v(TAG_PROCESSES, "App died: " + app); checkTime(startTime, "startProcess: bad proc running, killing"); killProcessGroup(app.uid, app.pid); handleAppDiedLocked(app, true, true); checkTime(startTime, "startProcess: done killing old proc"); } String hostingNameStr = hostingName != null ? hostingName.flattenToShortString() : null; if (app == null) { checkTime(startTime, "startProcess: creating new process record"); app = newProcessRecordLocked(info, processName, isolated, isolatedUid); if (app == null) { Slog.w(TAG, "Failed making new process record for " + processName + "/" + info.uid + " isolated=" + isolated); return null; } app.crashHandler = crashHandler; app.isolatedEntryPoint = entryPoint; app.isolatedEntryPointArgs = entryPointArgs; checkTime(startTime, "startProcess: done creating new process record"); } else { // If this is a new package in the process, add the package to the list app.addPackage(info.packageName, info.versionCode, mProcessStats); checkTime(startTime, "startProcess: added package to existing proc"); } // If the system is not ready yet, then hold off on starting this // process until it is. if (!mProcessesReady && !isAllowedWhileBooting(info) && !allowWhileBooting) { if (!mProcessesOnHold.contains(app)) { mProcessesOnHold.add(app); } if (DEBUG_PROCESSES) Slog.v(TAG_PROCESSES, "System not ready, putting on hold: " + app); checkTime(startTime, "startProcess: returning with proc on hold"); return app; } checkTime(startTime, "startProcess: stepping in to startProcess"); startProcessLocked(app, hostingType, hostingNameStr, abiOverride); checkTime(startTime, "startProcess: done starting proc!"); return (app.pid != 0) ? app : null; } boolean isAllowedWhileBooting(ApplicationInfo ai) { return (ai.flags&ApplicationInfo.FLAG_PERSISTENT) != 0; } private final void startProcessLocked(ProcessRecord app, String hostingType, String hostingNameStr) { startProcessLocked(app, hostingType, hostingNameStr, null /* abiOverride */); } private final void startProcessLocked(ProcessRecord app, String hostingType, String hostingNameStr, String abiOverride) { long startTime = SystemClock.elapsedRealtime(); if (app.pid > 0 && app.pid != MY_PID) { checkTime(startTime, "startProcess: removing from pids map"); synchronized (mPidsSelfLocked) { mPidsSelfLocked.remove(app.pid); mHandler.removeMessages(PROC_START_TIMEOUT_MSG, app); } checkTime(startTime, "startProcess: done removing from pids map"); app.setPid(0); } if (DEBUG_PROCESSES && mProcessesOnHold.contains(app)) Slog.v(TAG_PROCESSES, "startProcessLocked removing on hold: " + app); mProcessesOnHold.remove(app); checkTime(startTime, "startProcess: starting to update cpu stats"); updateCpuStats(); checkTime(startTime, "startProcess: done updating cpu stats"); try { try { final int userId = UserHandle.getUserId(app.uid); AppGlobals.getPackageManager().checkPackageStartable(app.info.packageName, userId); } catch (RemoteException e) { throw e.rethrowAsRuntimeException(); } int uid = app.uid; int[] gids = null; int mountExternal = Zygote.MOUNT_EXTERNAL_NONE; if (!app.isolated) { int[] permGids = null; try { checkTime(startTime, "startProcess: getting gids from package manager"); final IPackageManager pm = AppGlobals.getPackageManager(); permGids = pm.getPackageGids(app.info.packageName, MATCH_DEBUG_TRIAGED_MISSING, app.userId); StorageManagerInternal storageManagerInternal = LocalServices.getService( StorageManagerInternal.class); mountExternal = storageManagerInternal.getExternalStorageMountMode(uid, app.info.packageName); } catch (RemoteException e) { throw e.rethrowAsRuntimeException(); } /* * Add shared application and profile GIDs so applications can share some * resources like shared libraries and access user-wide resources */ if (ArrayUtils.isEmpty(permGids)) { gids = new int[3]; } else { gids = new int[permGids.length + 3]; System.arraycopy(permGids, 0, gids, 3, permGids.length); } gids[0] = UserHandle.getSharedAppGid(UserHandle.getAppId(uid)); gids[1] = UserHandle.getCacheAppGid(UserHandle.getAppId(uid)); gids[2] = UserHandle.getUserGid(UserHandle.getUserId(uid)); } checkTime(startTime, "startProcess: building args"); if (mFactoryTest != FactoryTest.FACTORY_TEST_OFF) { if (mFactoryTest == FactoryTest.FACTORY_TEST_LOW_LEVEL && mTopComponent != null && app.processName.equals(mTopComponent.getPackageName())) { uid = 0; } if (mFactoryTest == FactoryTest.FACTORY_TEST_HIGH_LEVEL && (app.info.flags&ApplicationInfo.FLAG_FACTORY_TEST) != 0) { uid = 0; } } int runtimeFlags = 0; if ((app.info.flags & ApplicationInfo.FLAG_DEBUGGABLE) != 0) { runtimeFlags |= Zygote.DEBUG_ENABLE_JDWP; runtimeFlags |= Zygote.DEBUG_JAVA_DEBUGGABLE; // Also turn on CheckJNI for debuggable apps. It's quite // awkward to turn on otherwise. runtimeFlags |= Zygote.DEBUG_ENABLE_CHECKJNI; } // Run the app in safe mode if its manifest requests so or the // system is booted in safe mode. if ((app.info.flags & ApplicationInfo.FLAG_VM_SAFE_MODE) != 0 || mSafeMode == true) { runtimeFlags |= Zygote.DEBUG_ENABLE_SAFEMODE; } if ("1".equals(SystemProperties.get("debug.checkjni"))) { runtimeFlags |= Zygote.DEBUG_ENABLE_CHECKJNI; } String genDebugInfoProperty = SystemProperties.get("debug.generate-debug-info"); if ("true".equals(genDebugInfoProperty)) { runtimeFlags |= Zygote.DEBUG_GENERATE_DEBUG_INFO; } if ("1".equals(SystemProperties.get("debug.jni.logging"))) { runtimeFlags |= Zygote.DEBUG_ENABLE_JNI_LOGGING; } if ("1".equals(SystemProperties.get("debug.assert"))) { runtimeFlags |= Zygote.DEBUG_ENABLE_ASSERT; } if (mNativeDebuggingApp != null && mNativeDebuggingApp.equals(app.processName)) { // Enable all debug flags required by the native debugger. runtimeFlags |= Zygote.DEBUG_ALWAYS_JIT; // Don't interpret anything runtimeFlags |= Zygote.DEBUG_GENERATE_DEBUG_INFO; // Generate debug info runtimeFlags |= Zygote.DEBUG_NATIVE_DEBUGGABLE; // Disbale optimizations mNativeDebuggingApp = null; } if (app.info.isPrivilegedApp() && !SystemProperties.getBoolean("pm.dexopt.priv-apps", true)) { runtimeFlags |= Zygote.DISABLE_VERIFIER; runtimeFlags |= Zygote.ONLY_USE_SYSTEM_OAT_FILES; } String invokeWith = null; if ((app.info.flags & ApplicationInfo.FLAG_DEBUGGABLE) != 0) { // Debuggable apps may include a wrapper script with their library directory. String wrapperFileName = app.info.nativeLibraryDir + "/wrap.sh"; StrictMode.ThreadPolicy oldPolicy = StrictMode.allowThreadDiskReads(); try { if (new File(wrapperFileName).exists()) { invokeWith = "/system/bin/logwrapper " + wrapperFileName; } } finally { StrictMode.setThreadPolicy(oldPolicy); } } String requiredAbi = (abiOverride != null) ? abiOverride : app.info.primaryCpuAbi; if (requiredAbi == null) { requiredAbi = Build.SUPPORTED_ABIS[0]; } String instructionSet = null; if (app.info.primaryCpuAbi != null) { instructionSet = VMRuntime.getInstructionSet(app.info.primaryCpuAbi); } app.gids = gids; app.requiredAbi = requiredAbi; app.instructionSet = instructionSet; // the per-user SELinux context must be set if (TextUtils.isEmpty(app.info.seInfoUser)) { Slog.wtf(TAG, "SELinux tag not defined", new IllegalStateException("SELinux tag not defined for " + app.info.packageName + " (uid " + app.uid + ")")); } final String seInfo = app.info.seInfo + (TextUtils.isEmpty(app.info.seInfoUser) ? "" : app.info.seInfoUser); // Start the process. It will either succeed and return a result containing // the PID of the new process, or else throw a RuntimeException. final String entryPoint = "android.app.ActivityThread"; Trace.traceBegin(Trace.TRACE_TAG_ACTIVITY_MANAGER, "Start proc: " + app.processName); checkTime(startTime, "startProcess: asking zygote to start proc"); ProcessStartResult startResult; if (hostingType.equals("webview_service")) { startResult = startWebView(entryPoint, app.processName, uid, uid, gids, runtimeFlags, mountExternal, app.info.targetSdkVersion, seInfo, requiredAbi, instructionSet, app.info.dataDir, null, null); } else { startResult = Process.start(entryPoint, app.processName, uid, uid, gids, runtimeFlags, mountExternal, app.info.targetSdkVersion, seInfo, requiredAbi, instructionSet, app.info.dataDir, invokeWith, null); } checkTime(startTime, "startProcess: returned from zygote!"); Trace.traceEnd(Trace.TRACE_TAG_ACTIVITY_MANAGER); mBatteryStatsService.noteProcessStart(app.processName, app.info.uid); checkTime(startTime, "startProcess: done updating battery stats"); EventLog.writeEvent(EventLogTags.AM_PROC_START, UserHandle.getUserId(uid), startResult.pid, uid, app.processName, hostingType, hostingNameStr != null ? hostingNameStr : ""); try { AppGlobals.getPackageManager().logAppProcessStartIfNeeded(app.processName, app.uid, seInfo, app.info.sourceDir, startResult.pid); } catch (RemoteException ex) { // Ignore } if (app.persistent) { Watchdog.getInstance().processStarted(app.processName, startResult.pid); } checkTime(startTime, "startProcess: building log message"); StringBuilder buf = mStringBuilder; buf.setLength(0); buf.append("Start proc "); buf.append(startResult.pid); buf.append(':'); buf.append(app.processName); buf.append('/'); UserHandle.formatUid(buf, uid); if (app.isolatedEntryPoint != null) { buf.append(" ["); buf.append(app.isolatedEntryPoint); buf.append("]"); } buf.append(" for "); buf.append(hostingType); if (hostingNameStr != null) { buf.append(" "); buf.append(hostingNameStr); } Slog.i(TAG, buf.toString()); app.setPid(startResult.pid); app.usingWrapper = startResult.usingWrapper; app.removed = false; app.killed = false; app.killedByAm = false; checkTime(startTime, "startProcess: starting to update pids map"); ProcessRecord oldApp; synchronized (mPidsSelfLocked) { oldApp = mPidsSelfLocked.get(startResult.pid); } // If there is already an app occupying that pid that hasn't been cleaned up if (oldApp != null && !app.isolated) { // Clean up anything relating to this pid first Slog.w(TAG, "Reusing pid " + startResult.pid + " while app is still mapped to it"); cleanUpApplicationRecordLocked(oldApp, false, false, -1, true /*replacingPid*/); } synchronized (mPidsSelfLocked) { this.mPidsSelfLocked.put(startResult.pid, app); Message msg = mHandler.obtainMessage(PROC_START_TIMEOUT_MSG); msg.obj = app; mHandler.sendMessageDelayed(msg, startResult.usingWrapper ? PROC_START_TIMEOUT_WITH_WRAPPER : PROC_START_TIMEOUT); } checkTime(startTime, "startProcess: done updating pids map"); } catch (RuntimeException e) { Slog.e(TAG, "Failure starting process " + app.processName, e); // Something went very wrong while trying to start this process; one // common case is when the package is frozen due to an active // upgrade. To recover, clean up any active bookkeeping related to // starting this process. (We already invoked this method once when // the package was initially frozen through KILL_APPLICATION_MSG, so // it doesn't hurt to use it again.) forceStopPackageLocked(app.info.packageName, UserHandle.getAppId(app.uid), false, false, true, false, false, UserHandle.getUserId(app.userId), "start failure"); } } void updateUsageStats(ActivityRecord component, boolean resumed) { if (DEBUG_SWITCH) Slog.d(TAG_SWITCH, "updateUsageStats: comp=" + component + "res=" + resumed); final BatteryStatsImpl stats = mBatteryStatsService.getActiveStatistics(); if (resumed) { if (mUsageStatsService != null) { mUsageStatsService.reportEvent(component.realActivity, component.userId, UsageEvents.Event.MOVE_TO_FOREGROUND); } synchronized (stats) { stats.noteActivityResumedLocked(component.app.uid); } } else { if (mUsageStatsService != null) { mUsageStatsService.reportEvent(component.realActivity, component.userId, UsageEvents.Event.MOVE_TO_BACKGROUND); } synchronized (stats) { stats.noteActivityPausedLocked(component.app.uid); } } } Intent getHomeIntent() { Intent intent = new Intent(mTopAction, mTopData != null ? Uri.parse(mTopData) : null); intent.setComponent(mTopComponent); intent.addFlags(Intent.FLAG_DEBUG_TRIAGED_MISSING); if (mFactoryTest != FactoryTest.FACTORY_TEST_LOW_LEVEL) { intent.addCategory(Intent.CATEGORY_HOME); } return intent; } boolean startHomeActivityLocked(int userId, String reason) { if (mFactoryTest == FactoryTest.FACTORY_TEST_LOW_LEVEL && mTopAction == null) { // We are running in factory test mode, but unable to find // the factory test app, so just sit around displaying the // error message and don't try to start anything. return false; } Intent intent = getHomeIntent(); ActivityInfo aInfo = resolveActivityInfo(intent, STOCK_PM_FLAGS, userId); if (aInfo != null) { intent.setComponent(new ComponentName(aInfo.applicationInfo.packageName, aInfo.name)); // Don't do this if the home app is currently being // instrumented. aInfo = new ActivityInfo(aInfo); aInfo.applicationInfo = getAppInfoForUser(aInfo.applicationInfo, userId); ProcessRecord app = getProcessRecordLocked(aInfo.processName, aInfo.applicationInfo.uid, true); if (app == null || app.instr == null) { intent.setFlags(intent.getFlags() | Intent.FLAG_ACTIVITY_NEW_TASK); final int resolvedUserId = UserHandle.getUserId(aInfo.applicationInfo.uid); // For ANR debugging to verify if the user activity is the one that actually // launched. final String myReason = reason + ":" + userId + ":" + resolvedUserId; mActivityStarter.startHomeActivityLocked(intent, aInfo, myReason); } } else { Slog.wtf(TAG, "No home screen found for " + intent, new Throwable()); } return true; } private ActivityInfo resolveActivityInfo(Intent intent, int flags, int userId) { ActivityInfo ai = null; ComponentName comp = intent.getComponent(); try { if (comp != null) { // Factory test. ai = AppGlobals.getPackageManager().getActivityInfo(comp, flags, userId); } else { ResolveInfo info = AppGlobals.getPackageManager().resolveIntent( intent, intent.resolveTypeIfNeeded(mContext.getContentResolver()), flags, userId); if (info != null) { ai = info.activityInfo; } } } catch (RemoteException e) { // ignore } return ai; } /** * Starts the "new version setup screen" if appropriate. */ void startSetupActivityLocked() { // Only do this once per boot. if (mCheckedForSetup) { return; } // We will show this screen if the current one is a different // version than the last one shown, and we are not running in // low-level factory test mode. final ContentResolver resolver = mContext.getContentResolver(); if (mFactoryTest != FactoryTest.FACTORY_TEST_LOW_LEVEL && Settings.Global.getInt(resolver, Settings.Global.DEVICE_PROVISIONED, 0) != 0) { mCheckedForSetup = true; // See if we should be showing the platform update setup UI. final Intent intent = new Intent(Intent.ACTION_UPGRADE_SETUP); final List ris = mContext.getPackageManager().queryIntentActivities(intent, PackageManager.MATCH_SYSTEM_ONLY | PackageManager.GET_META_DATA); if (!ris.isEmpty()) { final ResolveInfo ri = ris.get(0); String vers = ri.activityInfo.metaData != null ? ri.activityInfo.metaData.getString(Intent.METADATA_SETUP_VERSION) : null; if (vers == null && ri.activityInfo.applicationInfo.metaData != null) { vers = ri.activityInfo.applicationInfo.metaData.getString( Intent.METADATA_SETUP_VERSION); } String lastVers = Settings.Secure.getString( resolver, Settings.Secure.LAST_SETUP_SHOWN); if (vers != null && !vers.equals(lastVers)) { intent.setFlags(Intent.FLAG_ACTIVITY_NEW_TASK); intent.setComponent(new ComponentName( ri.activityInfo.packageName, ri.activityInfo.name)); mActivityStarter.startActivityLocked(null, intent, null /*ephemeralIntent*/, null, ri.activityInfo, null /*rInfo*/, null, null, null, null, 0, 0, 0, null, 0, 0, 0, null, false, false, null, null, "startSetupActivity"); } } } } CompatibilityInfo compatibilityInfoForPackageLocked(ApplicationInfo ai) { return mCompatModePackages.compatibilityInfoForPackageLocked(ai); } void enforceNotIsolatedCaller(String caller) { if (UserHandle.isIsolated(Binder.getCallingUid())) { throw new SecurityException("Isolated process not allowed to call " + caller); } } @Override public int getFrontActivityScreenCompatMode() { enforceNotIsolatedCaller("getFrontActivityScreenCompatMode"); synchronized (this) { return mCompatModePackages.getFrontActivityScreenCompatModeLocked(); } } @Override public void setFrontActivityScreenCompatMode(int mode) { enforceCallingPermission(android.Manifest.permission.SET_SCREEN_COMPATIBILITY, "setFrontActivityScreenCompatMode"); synchronized (this) { mCompatModePackages.setFrontActivityScreenCompatModeLocked(mode); } } @Override public int getPackageScreenCompatMode(String packageName) { enforceNotIsolatedCaller("getPackageScreenCompatMode"); synchronized (this) { return mCompatModePackages.getPackageScreenCompatModeLocked(packageName); } } @Override public void setPackageScreenCompatMode(String packageName, int mode) { enforceCallingPermission(android.Manifest.permission.SET_SCREEN_COMPATIBILITY, "setPackageScreenCompatMode"); synchronized (this) { mCompatModePackages.setPackageScreenCompatModeLocked(packageName, mode); } } @Override public boolean getPackageAskScreenCompat(String packageName) { enforceNotIsolatedCaller("getPackageAskScreenCompat"); synchronized (this) { return mCompatModePackages.getPackageAskCompatModeLocked(packageName); } } @Override public void setPackageAskScreenCompat(String packageName, boolean ask) { enforceCallingPermission(android.Manifest.permission.SET_SCREEN_COMPATIBILITY, "setPackageAskScreenCompat"); synchronized (this) { mCompatModePackages.setPackageAskCompatModeLocked(packageName, ask); } } private boolean hasUsageStatsPermission(String callingPackage) { final int mode = mAppOpsService.checkOperation(AppOpsManager.OP_GET_USAGE_STATS, Binder.getCallingUid(), callingPackage); if (mode == AppOpsManager.MODE_DEFAULT) { return checkCallingPermission(Manifest.permission.PACKAGE_USAGE_STATS) == PackageManager.PERMISSION_GRANTED; } return mode == AppOpsManager.MODE_ALLOWED; } @Override public int getPackageProcessState(String packageName, String callingPackage) { if (!hasUsageStatsPermission(callingPackage)) { enforceCallingPermission(android.Manifest.permission.PACKAGE_USAGE_STATS, "getPackageProcessState"); } int procState = ActivityManager.PROCESS_STATE_NONEXISTENT; synchronized (this) { for (int i=mLruProcesses.size()-1; i>=0; i--) { final ProcessRecord proc = mLruProcesses.get(i); if (procState > proc.setProcState) { if (proc.pkgList.containsKey(packageName) || (proc.pkgDeps != null && proc.pkgDeps.contains(packageName))) { procState = proc.setProcState; } } } } return procState; } @Override public boolean setProcessMemoryTrimLevel(String process, int userId, int level) throws RemoteException { synchronized (this) { final ProcessRecord app = findProcessLocked(process, userId, "setProcessMemoryTrimLevel"); if (app == null) { throw new IllegalArgumentException("Unknown process: " + process); } if (app.thread == null) { throw new IllegalArgumentException("Process has no app thread"); } if (app.trimMemoryLevel >= level) { throw new IllegalArgumentException( "Unable to set a higher trim level than current level"); } if (!(level < ComponentCallbacks2.TRIM_MEMORY_UI_HIDDEN || app.curProcState > ActivityManager.PROCESS_STATE_IMPORTANT_FOREGROUND)) { throw new IllegalArgumentException("Unable to set a background trim level " + "on a foreground process"); } app.thread.scheduleTrimMemory(level); app.trimMemoryLevel = level; return true; } } private void dispatchProcessesChanged() { int N; synchronized (this) { N = mPendingProcessChanges.size(); if (mActiveProcessChanges.length < N) { mActiveProcessChanges = new ProcessChangeItem[N]; } mPendingProcessChanges.toArray(mActiveProcessChanges); mPendingProcessChanges.clear(); if (DEBUG_PROCESS_OBSERVERS) Slog.i(TAG_PROCESS_OBSERVERS, "*** Delivering " + N + " process changes"); } int i = mProcessObservers.beginBroadcast(); while (i > 0) { i--; final IProcessObserver observer = mProcessObservers.getBroadcastItem(i); if (observer != null) { try { for (int j=0; j 0) { i--; final IProcessObserver observer = mProcessObservers.getBroadcastItem(i); if (observer != null) { try { observer.onProcessDied(pid, uid); } catch (RemoteException e) { } } } mProcessObservers.finishBroadcast(); } @VisibleForTesting void dispatchUidsChanged() { int N; synchronized (this) { N = mPendingUidChanges.size(); if (mActiveUidChanges.length < N) { mActiveUidChanges = new UidRecord.ChangeItem[N]; } for (int i=0; i 0) { i--; dispatchUidsChangedForObserver(mUidObservers.getBroadcastItem(i), (UidObserverRegistration) mUidObservers.getBroadcastCookie(i), N); } mUidObservers.finishBroadcast(); if (VALIDATE_UID_STATES && mUidObservers.getRegisteredCallbackCount() > 0) { for (int j = 0; j < N; ++j) { final UidRecord.ChangeItem item = mActiveUidChanges[j]; if ((item.change & UidRecord.CHANGE_GONE) != 0) { mValidateUids.remove(item.uid); } else { UidRecord validateUid = mValidateUids.get(item.uid); if (validateUid == null) { validateUid = new UidRecord(item.uid); mValidateUids.put(item.uid, validateUid); } if ((item.change & UidRecord.CHANGE_IDLE) != 0) { validateUid.idle = true; } else if ((item.change & UidRecord.CHANGE_ACTIVE) != 0) { validateUid.idle = false; } validateUid.curProcState = validateUid.setProcState = item.processState; validateUid.lastDispatchedProcStateSeq = item.procStateSeq; } } } synchronized (this) { for (int j = 0; j < N; j++) { mAvailUidChanges.add(mActiveUidChanges[j]); } } } private void dispatchUidsChangedForObserver(IUidObserver observer, UidObserverRegistration reg, int changesSize) { if (observer == null) { return; } try { for (int j = 0; j < changesSize; j++) { UidRecord.ChangeItem item = mActiveUidChanges[j]; final int change = item.change; if (change == UidRecord.CHANGE_PROCSTATE && (reg.which & ActivityManager.UID_OBSERVER_PROCSTATE) == 0) { // No-op common case: no significant change, the observer is not // interested in all proc state changes. continue; } if ((change & UidRecord.CHANGE_IDLE) != 0) { if ((reg.which & ActivityManager.UID_OBSERVER_IDLE) != 0) { if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS, "UID idle uid=" + item.uid); observer.onUidIdle(item.uid, item.ephemeral); } } else if ((change & UidRecord.CHANGE_ACTIVE) != 0) { if ((reg.which & ActivityManager.UID_OBSERVER_ACTIVE) != 0) { if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS, "UID active uid=" + item.uid); observer.onUidActive(item.uid); } } if ((reg.which & ActivityManager.UID_OBSERVER_CACHED) != 0) { if ((change & UidRecord.CHANGE_CACHED) != 0) { if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS, "UID cached uid=" + item.uid); observer.onUidCachedChanged(item.uid, true); } else if ((change & UidRecord.CHANGE_UNCACHED) != 0) { if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS, "UID active uid=" + item.uid); observer.onUidCachedChanged(item.uid, false); } } if ((change & UidRecord.CHANGE_GONE) != 0) { if ((reg.which & ActivityManager.UID_OBSERVER_GONE) != 0) { if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS, "UID gone uid=" + item.uid); observer.onUidGone(item.uid, item.ephemeral); } if (reg.lastProcStates != null) { reg.lastProcStates.delete(item.uid); } } else { if ((reg.which & ActivityManager.UID_OBSERVER_PROCSTATE) != 0) { if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS, "UID CHANGED uid=" + item.uid + ": " + item.processState); boolean doReport = true; if (reg.cutpoint >= ActivityManager.MIN_PROCESS_STATE) { final int lastState = reg.lastProcStates.get(item.uid, ActivityManager.PROCESS_STATE_UNKNOWN); if (lastState != ActivityManager.PROCESS_STATE_UNKNOWN) { final boolean lastAboveCut = lastState <= reg.cutpoint; final boolean newAboveCut = item.processState <= reg.cutpoint; doReport = lastAboveCut != newAboveCut; } else { doReport = item.processState != ActivityManager.PROCESS_STATE_NONEXISTENT; } } if (doReport) { if (reg.lastProcStates != null) { reg.lastProcStates.put(item.uid, item.processState); } observer.onUidStateChanged(item.uid, item.processState, item.procStateSeq); } } } } } catch (RemoteException e) { } } void dispatchOomAdjObserver(String msg) { OomAdjObserver observer; synchronized (this) { observer = mCurOomAdjObserver; } if (observer != null) { observer.onOomAdjMessage(msg); } } void setOomAdjObserver(int uid, OomAdjObserver observer) { synchronized (this) { mCurOomAdjUid = uid; mCurOomAdjObserver = observer; } } void clearOomAdjObserver() { synchronized (this) { mCurOomAdjUid = -1; mCurOomAdjObserver = null; } } void reportOomAdjMessageLocked(String tag, String msg) { Slog.d(tag, msg); if (mCurOomAdjObserver != null) { mUiHandler.obtainMessage(DISPATCH_OOM_ADJ_OBSERVER_MSG, msg).sendToTarget(); } } @Override public final int startActivity(IApplicationThread caller, String callingPackage, Intent intent, String resolvedType, IBinder resultTo, String resultWho, int requestCode, int startFlags, ProfilerInfo profilerInfo, Bundle bOptions) { return startActivityAsUser(caller, callingPackage, intent, resolvedType, resultTo, resultWho, requestCode, startFlags, profilerInfo, bOptions, UserHandle.getCallingUserId()); } @Override public final int startActivityAsUser(IApplicationThread caller, String callingPackage, Intent intent, String resolvedType, IBinder resultTo, String resultWho, int requestCode, int startFlags, ProfilerInfo profilerInfo, Bundle bOptions, int userId) { enforceNotIsolatedCaller("startActivity"); userId = mUserController.handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(), userId, false, ALLOW_FULL_ONLY, "startActivity", null); // TODO: Switch to user app stacks here. return mActivityStarter.startActivityMayWait(caller, -1, callingPackage, intent, resolvedType, null, null, resultTo, resultWho, requestCode, startFlags, profilerInfo, null, null, bOptions, false, userId, null, "startActivityAsUser"); } @Override public final int startActivityAsCaller(IApplicationThread caller, String callingPackage, Intent intent, String resolvedType, IBinder resultTo, String resultWho, int requestCode, int startFlags, ProfilerInfo profilerInfo, Bundle bOptions, boolean ignoreTargetSecurity, int userId) { // This is very dangerous -- it allows you to perform a start activity (including // permission grants) as any app that may launch one of your own activities. So // we will only allow this to be done from activities that are part of the core framework, // and then only when they are running as the system. final ActivityRecord sourceRecord; final int targetUid; final String targetPackage; synchronized (this) { if (resultTo == null) { throw new SecurityException("Must be called from an activity"); } sourceRecord = mStackSupervisor.isInAnyStackLocked(resultTo); if (sourceRecord == null) { throw new SecurityException("Called with bad activity token: " + resultTo); } if (!sourceRecord.info.packageName.equals("android")) { throw new SecurityException( "Must be called from an activity that is declared in the android package"); } if (sourceRecord.app == null) { throw new SecurityException("Called without a process attached to activity"); } if (UserHandle.getAppId(sourceRecord.app.uid) != SYSTEM_UID) { // This is still okay, as long as this activity is running under the // uid of the original calling activity. if (sourceRecord.app.uid != sourceRecord.launchedFromUid) { throw new SecurityException( "Calling activity in uid " + sourceRecord.app.uid + " must be system uid or original calling uid " + sourceRecord.launchedFromUid); } } if (ignoreTargetSecurity) { if (intent.getComponent() == null) { throw new SecurityException( "Component must be specified with ignoreTargetSecurity"); } if (intent.getSelector() != null) { throw new SecurityException( "Selector not allowed with ignoreTargetSecurity"); } } targetUid = sourceRecord.launchedFromUid; targetPackage = sourceRecord.launchedFromPackage; } if (userId == UserHandle.USER_NULL) { userId = UserHandle.getUserId(sourceRecord.app.uid); } // TODO: Switch to user app stacks here. try { int ret = mActivityStarter.startActivityMayWait(null, targetUid, targetPackage, intent, resolvedType, null, null, resultTo, resultWho, requestCode, startFlags, null, null, null, bOptions, ignoreTargetSecurity, userId, null, "startActivityAsCaller"); return ret; } catch (SecurityException e) { // XXX need to figure out how to propagate to original app. // A SecurityException here is generally actually a fault of the original // calling activity (such as a fairly granting permissions), so propagate it // back to them. /* StringBuilder msg = new StringBuilder(); msg.append("While launching"); msg.append(intent.toString()); msg.append(": "); msg.append(e.getMessage()); */ throw e; } } @Override public final WaitResult startActivityAndWait(IApplicationThread caller, String callingPackage, Intent intent, String resolvedType, IBinder resultTo, String resultWho, int requestCode, int startFlags, ProfilerInfo profilerInfo, Bundle bOptions, int userId) { enforceNotIsolatedCaller("startActivityAndWait"); userId = mUserController.handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(), userId, false, ALLOW_FULL_ONLY, "startActivityAndWait", null); WaitResult res = new WaitResult(); // TODO: Switch to user app stacks here. mActivityStarter.startActivityMayWait(caller, -1, callingPackage, intent, resolvedType, null, null, resultTo, resultWho, requestCode, startFlags, profilerInfo, res, null, bOptions, false, userId, null, "startActivityAndWait"); return res; } @Override public final int startActivityWithConfig(IApplicationThread caller, String callingPackage, Intent intent, String resolvedType, IBinder resultTo, String resultWho, int requestCode, int startFlags, Configuration config, Bundle bOptions, int userId) { enforceNotIsolatedCaller("startActivityWithConfig"); userId = mUserController.handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(), userId, false, ALLOW_FULL_ONLY, "startActivityWithConfig", null); // TODO: Switch to user app stacks here. int ret = mActivityStarter.startActivityMayWait(caller, -1, callingPackage, intent, resolvedType, null, null, resultTo, resultWho, requestCode, startFlags, null, null, config, bOptions, false, userId, null, "startActivityWithConfig"); return ret; } @Override public int startActivityIntentSender(IApplicationThread caller, IIntentSender target, IBinder whitelistToken, Intent fillInIntent, String resolvedType, IBinder resultTo, String resultWho, int requestCode, int flagsMask, int flagsValues, Bundle bOptions) throws TransactionTooLargeException { enforceNotIsolatedCaller("startActivityIntentSender"); // Refuse possible leaked file descriptors if (fillInIntent != null && fillInIntent.hasFileDescriptors()) { throw new IllegalArgumentException("File descriptors passed in Intent"); } if (!(target instanceof PendingIntentRecord)) { throw new IllegalArgumentException("Bad PendingIntent object"); } PendingIntentRecord pir = (PendingIntentRecord)target; synchronized (this) { // If this is coming from the currently resumed activity, it is // effectively saying that app switches are allowed at this point. final ActivityStack stack = getFocusedStack(); if (stack.mResumedActivity != null && stack.mResumedActivity.info.applicationInfo.uid == Binder.getCallingUid()) { mAppSwitchesAllowedTime = 0; } } int ret = pir.sendInner(0, fillInIntent, resolvedType, whitelistToken, null, null, resultTo, resultWho, requestCode, flagsMask, flagsValues, bOptions); return ret; } @Override public int startVoiceActivity(String callingPackage, int callingPid, int callingUid, Intent intent, String resolvedType, IVoiceInteractionSession session, IVoiceInteractor interactor, int startFlags, ProfilerInfo profilerInfo, Bundle bOptions, int userId) { if (checkCallingPermission(Manifest.permission.BIND_VOICE_INTERACTION) != PackageManager.PERMISSION_GRANTED) { String msg = "Permission Denial: startVoiceActivity() from pid=" + Binder.getCallingPid() + ", uid=" + Binder.getCallingUid() + " requires " + android.Manifest.permission.BIND_VOICE_INTERACTION; Slog.w(TAG, msg); throw new SecurityException(msg); } if (session == null || interactor == null) { throw new NullPointerException("null session or interactor"); } userId = mUserController.handleIncomingUser(callingPid, callingUid, userId, false, ALLOW_FULL_ONLY, "startVoiceActivity", null); // TODO: Switch to user app stacks here. return mActivityStarter.startActivityMayWait(null, callingUid, callingPackage, intent, resolvedType, session, interactor, null, null, 0, startFlags, profilerInfo, null, null, bOptions, false, userId, null, "startVoiceActivity"); } @Override public int startAssistantActivity(String callingPackage, int callingPid, int callingUid, Intent intent, String resolvedType, Bundle bOptions, int userId) { if (checkCallingPermission(Manifest.permission.BIND_VOICE_INTERACTION) != PackageManager.PERMISSION_GRANTED) { final String msg = "Permission Denial: startAssistantActivity() from pid=" + Binder.getCallingPid() + ", uid=" + Binder.getCallingUid() + " requires " + Manifest.permission.BIND_VOICE_INTERACTION; Slog.w(TAG, msg); throw new SecurityException(msg); } userId = mUserController.handleIncomingUser(callingPid, callingUid, userId, false, ALLOW_FULL_ONLY, "startAssistantActivity", null); return mActivityStarter.startActivityMayWait(null, callingUid, callingPackage, intent, resolvedType, null, null, null, null, 0, 0, null, null, null, bOptions, false, userId, null, "startAssistantActivity"); } @Override public void startLocalVoiceInteraction(IBinder callingActivity, Bundle options) throws RemoteException { Slog.i(TAG, "Activity tried to startVoiceInteraction"); synchronized (this) { ActivityRecord activity = getFocusedStack().topActivity(); if (ActivityRecord.forTokenLocked(callingActivity) != activity) { throw new SecurityException("Only focused activity can call startVoiceInteraction"); } if (mRunningVoice != null || activity.getTask().voiceSession != null || activity.voiceSession != null) { Slog.w(TAG, "Already in a voice interaction, cannot start new voice interaction"); return; } if (activity.pendingVoiceInteractionStart) { Slog.w(TAG, "Pending start of voice interaction already."); return; } activity.pendingVoiceInteractionStart = true; } LocalServices.getService(VoiceInteractionManagerInternal.class) .startLocalVoiceInteraction(callingActivity, options); } @Override public void stopLocalVoiceInteraction(IBinder callingActivity) throws RemoteException { LocalServices.getService(VoiceInteractionManagerInternal.class) .stopLocalVoiceInteraction(callingActivity); } @Override public boolean supportsLocalVoiceInteraction() throws RemoteException { return LocalServices.getService(VoiceInteractionManagerInternal.class) .supportsLocalVoiceInteraction(); } void onLocalVoiceInteractionStartedLocked(IBinder activity, IVoiceInteractionSession voiceSession, IVoiceInteractor voiceInteractor) { ActivityRecord activityToCallback = ActivityRecord.forTokenLocked(activity); if (activityToCallback == null) return; activityToCallback.setVoiceSessionLocked(voiceSession); // Inform the activity try { activityToCallback.app.thread.scheduleLocalVoiceInteractionStarted(activity, voiceInteractor); long token = Binder.clearCallingIdentity(); try { startRunningVoiceLocked(voiceSession, activityToCallback.appInfo.uid); } finally { Binder.restoreCallingIdentity(token); } // TODO: VI Should we cache the activity so that it's easier to find later // rather than scan through all the stacks and activities? } catch (RemoteException re) { activityToCallback.clearVoiceSessionLocked(); // TODO: VI Should this terminate the voice session? } } @Override public void setVoiceKeepAwake(IVoiceInteractionSession session, boolean keepAwake) { synchronized (this) { if (mRunningVoice != null && mRunningVoice.asBinder() == session.asBinder()) { if (keepAwake) { mVoiceWakeLock.acquire(); } else { mVoiceWakeLock.release(); } } } } @Override public boolean startNextMatchingActivity(IBinder callingActivity, Intent intent, Bundle bOptions) { // Refuse possible leaked file descriptors if (intent != null && intent.hasFileDescriptors() == true) { throw new IllegalArgumentException("File descriptors passed in Intent"); } ActivityOptions options = ActivityOptions.fromBundle(bOptions); synchronized (this) { final ActivityRecord r = ActivityRecord.isInStackLocked(callingActivity); if (r == null) { ActivityOptions.abort(options); return false; } if (r.app == null || r.app.thread == null) { // The caller is not running... d'oh! ActivityOptions.abort(options); return false; } intent = new Intent(intent); // The caller is not allowed to change the data. intent.setDataAndType(r.intent.getData(), r.intent.getType()); // And we are resetting to find the next component... intent.setComponent(null); final boolean debug = ((intent.getFlags() & Intent.FLAG_DEBUG_LOG_RESOLUTION) != 0); ActivityInfo aInfo = null; try { List resolves = AppGlobals.getPackageManager().queryIntentActivities( intent, r.resolvedType, PackageManager.MATCH_DEFAULT_ONLY | STOCK_PM_FLAGS, UserHandle.getCallingUserId()).getList(); // Look for the original activity in the list... final int N = resolves != null ? resolves.size() : 0; for (int i=0; i activities = new ArrayList<>(proc.activities); for (int i = 0; i < activities.size(); i++) { ActivityRecord r = activities.get(i); if (!r.finishing && r.isInStackLocked()) { r.getStack().finishActivityLocked(r, Activity.RESULT_CANCELED, null, "finish-heavy", true); } } mHandler.sendMessage(mHandler.obtainMessage(CANCEL_HEAVY_NOTIFICATION_MSG, proc.userId, 0)); mHeavyWeightProcess = null; } } @Override public void crashApplication(int uid, int initialPid, String packageName, int userId, String message) { if (checkCallingPermission(android.Manifest.permission.FORCE_STOP_PACKAGES) != PackageManager.PERMISSION_GRANTED) { String msg = "Permission Denial: crashApplication() from pid=" + Binder.getCallingPid() + ", uid=" + Binder.getCallingUid() + " requires " + android.Manifest.permission.FORCE_STOP_PACKAGES; Slog.w(TAG, msg); throw new SecurityException(msg); } synchronized(this) { mAppErrors.scheduleAppCrashLocked(uid, initialPid, packageName, userId, message); } } @Override public final void finishSubActivity(IBinder token, String resultWho, int requestCode) { synchronized(this) { final long origId = Binder.clearCallingIdentity(); ActivityRecord r = ActivityRecord.isInStackLocked(token); if (r != null) { r.getStack().finishSubActivityLocked(r, resultWho, requestCode); } Binder.restoreCallingIdentity(origId); } } @Override public boolean finishActivityAffinity(IBinder token) { synchronized(this) { final long origId = Binder.clearCallingIdentity(); try { ActivityRecord r = ActivityRecord.isInStackLocked(token); if (r == null) { return false; } // Do not allow task to finish if last task in lockTask mode. Launchable priv-apps // can finish. final TaskRecord task = r.getTask(); if (mLockTaskController.activityBlockedFromFinish(r)) { return false; } return task.getStack().finishActivityAffinityLocked(r); } finally { Binder.restoreCallingIdentity(origId); } } } @Override public void finishVoiceTask(IVoiceInteractionSession session) { synchronized (this) { final long origId = Binder.clearCallingIdentity(); try { // TODO: VI Consider treating local voice interactions and voice tasks // differently here mStackSupervisor.finishVoiceTask(session); } finally { Binder.restoreCallingIdentity(origId); } } } @Override public boolean releaseActivityInstance(IBinder token) { synchronized(this) { final long origId = Binder.clearCallingIdentity(); try { ActivityRecord r = ActivityRecord.isInStackLocked(token); if (r == null) { return false; } return r.getStack().safelyDestroyActivityLocked(r, "app-req"); } finally { Binder.restoreCallingIdentity(origId); } } } @Override public void releaseSomeActivities(IApplicationThread appInt) { synchronized(this) { final long origId = Binder.clearCallingIdentity(); try { ProcessRecord app = getRecordForAppLocked(appInt); mStackSupervisor.releaseSomeActivitiesLocked(app, "low-mem"); } finally { Binder.restoreCallingIdentity(origId); } } } @Override public boolean willActivityBeVisible(IBinder token) { synchronized(this) { ActivityStack stack = ActivityRecord.getStackLocked(token); if (stack != null) { return stack.willActivityBeVisibleLocked(token); } return false; } } @Override public void overridePendingTransition(IBinder token, String packageName, int enterAnim, int exitAnim) { synchronized(this) { ActivityRecord self = ActivityRecord.isInStackLocked(token); if (self == null) { return; } final long origId = Binder.clearCallingIdentity(); if (self.state == ActivityState.RESUMED || self.state == ActivityState.PAUSING) { mWindowManager.overridePendingAppTransition(packageName, enterAnim, exitAnim, null); } Binder.restoreCallingIdentity(origId); } } /** * Main function for removing an existing process from the activity manager * as a result of that process going away. Clears out all connections * to the process. */ private final void handleAppDiedLocked(ProcessRecord app, boolean restarting, boolean allowRestart) { int pid = app.pid; boolean kept = cleanUpApplicationRecordLocked(app, restarting, allowRestart, -1, false /*replacingPid*/); if (!kept && !restarting) { removeLruProcessLocked(app); if (pid > 0) { ProcessList.remove(pid); } } if (mProfileProc == app) { clearProfilerLocked(); } // Remove this application's activities from active lists. boolean hasVisibleActivities = mStackSupervisor.handleAppDiedLocked(app); app.activities.clear(); if (app.instr != null) { Slog.w(TAG, "Crash of app " + app.processName + " running instrumentation " + app.instr.mClass); Bundle info = new Bundle(); info.putString("shortMsg", "Process crashed."); finishInstrumentationLocked(app, Activity.RESULT_CANCELED, info); } mWindowManager.deferSurfaceLayout(); try { if (!restarting && hasVisibleActivities && !mStackSupervisor.resumeFocusedStackTopActivityLocked()) { // If there was nothing to resume, and we are not already restarting this process, but // there is a visible activity that is hosted by the process... then make sure all // visible activities are running, taking care of restarting this process. mStackSupervisor.ensureActivitiesVisibleLocked(null, 0, !PRESERVE_WINDOWS); } } finally { mWindowManager.continueSurfaceLayout(); } } private final int getLRURecordIndexForAppLocked(IApplicationThread thread) { final IBinder threadBinder = thread.asBinder(); // Find the application record. for (int i=mLruProcesses.size()-1; i>=0; i--) { final ProcessRecord rec = mLruProcesses.get(i); if (rec.thread != null && rec.thread.asBinder() == threadBinder) { return i; } } return -1; } final ProcessRecord getRecordForAppLocked( IApplicationThread thread) { if (thread == null) { return null; } int appIndex = getLRURecordIndexForAppLocked(thread); if (appIndex >= 0) { return mLruProcesses.get(appIndex); } // Validation: if it isn't in the LRU list, it shouldn't exist, but let's // double-check that. final IBinder threadBinder = thread.asBinder(); final ArrayMap> pmap = mProcessNames.getMap(); for (int i = pmap.size()-1; i >= 0; i--) { final SparseArray procs = pmap.valueAt(i); for (int j = procs.size()-1; j >= 0; j--) { final ProcessRecord proc = procs.valueAt(j); if (proc.thread != null && proc.thread.asBinder() == threadBinder) { Slog.wtf(TAG, "getRecordForApp: exists in name list but not in LRU list: " + proc); return proc; } } } return null; } final void doLowMemReportIfNeededLocked(ProcessRecord dyingProc) { // If there are no longer any background processes running, // and the app that died was not running instrumentation, // then tell everyone we are now low on memory. boolean haveBg = false; for (int i=mLruProcesses.size()-1; i>=0; i--) { ProcessRecord rec = mLruProcesses.get(i); if (rec.thread != null && rec.setProcState >= ActivityManager.PROCESS_STATE_CACHED_ACTIVITY) { haveBg = true; break; } } if (!haveBg) { boolean doReport = "1".equals(SystemProperties.get(SYSTEM_DEBUGGABLE, "0")); if (doReport) { long now = SystemClock.uptimeMillis(); if (now < (mLastMemUsageReportTime+5*60*1000)) { doReport = false; } else { mLastMemUsageReportTime = now; } } final ArrayList memInfos = doReport ? new ArrayList(mLruProcesses.size()) : null; EventLog.writeEvent(EventLogTags.AM_LOW_MEMORY, mLruProcesses.size()); long now = SystemClock.uptimeMillis(); for (int i=mLruProcesses.size()-1; i>=0; i--) { ProcessRecord rec = mLruProcesses.get(i); if (rec == dyingProc || rec.thread == null) { continue; } if (doReport) { memInfos.add(new ProcessMemInfo(rec.processName, rec.pid, rec.setAdj, rec.setProcState, rec.adjType, rec.makeAdjReason())); } if ((rec.lastLowMemory+mConstants.GC_MIN_INTERVAL) <= now) { // The low memory report is overriding any current // state for a GC request. Make sure to do // heavy/important/visible/foreground processes first. if (rec.setAdj <= ProcessList.HEAVY_WEIGHT_APP_ADJ) { rec.lastRequestedGc = 0; } else { rec.lastRequestedGc = rec.lastLowMemory; } rec.reportLowMemory = true; rec.lastLowMemory = now; mProcessesToGc.remove(rec); addProcessToGcListLocked(rec); } } if (doReport) { Message msg = mHandler.obtainMessage(REPORT_MEM_USAGE_MSG, memInfos); mHandler.sendMessage(msg); } scheduleAppGcsLocked(); } } final void appDiedLocked(ProcessRecord app) { appDiedLocked(app, app.pid, app.thread, false); } final void appDiedLocked(ProcessRecord app, int pid, IApplicationThread thread, boolean fromBinderDied) { // First check if this ProcessRecord is actually active for the pid. synchronized (mPidsSelfLocked) { ProcessRecord curProc = mPidsSelfLocked.get(pid); if (curProc != app) { Slog.w(TAG, "Spurious death for " + app + ", curProc for " + pid + ": " + curProc); return; } } BatteryStatsImpl stats = mBatteryStatsService.getActiveStatistics(); synchronized (stats) { stats.noteProcessDiedLocked(app.info.uid, pid); } if (!app.killed) { if (!fromBinderDied) { killProcessQuiet(pid); } killProcessGroup(app.uid, pid); app.killed = true; } // Clean up already done if the process has been re-started. if (app.pid == pid && app.thread != null && app.thread.asBinder() == thread.asBinder()) { boolean doLowMem = app.instr == null; boolean doOomAdj = doLowMem; if (!app.killedByAm) { Slog.i(TAG, "Process " + app.processName + " (pid " + pid + ") has died: " + ProcessList.makeOomAdjString(app.setAdj) + ProcessList.makeProcStateString(app.setProcState)); mAllowLowerMemLevel = true; } else { // Note that we always want to do oom adj to update our state with the // new number of procs. mAllowLowerMemLevel = false; doLowMem = false; } EventLog.writeEvent(EventLogTags.AM_PROC_DIED, app.userId, app.pid, app.processName, app.setAdj, app.setProcState); if (DEBUG_CLEANUP) Slog.v(TAG_CLEANUP, "Dying app: " + app + ", pid: " + pid + ", thread: " + thread.asBinder()); handleAppDiedLocked(app, false, true); if (doOomAdj) { updateOomAdjLocked(); } if (doLowMem) { doLowMemReportIfNeededLocked(app); } } else if (app.pid != pid) { // A new process has already been started. Slog.i(TAG, "Process " + app.processName + " (pid " + pid + ") has died and restarted (pid " + app.pid + ")."); EventLog.writeEvent(EventLogTags.AM_PROC_DIED, app.userId, app.pid, app.processName); } else if (DEBUG_PROCESSES) { Slog.d(TAG_PROCESSES, "Received spurious death notification for thread " + thread.asBinder()); } } /** * If a stack trace dump file is configured, dump process stack traces. * @param clearTraces causes the dump file to be erased prior to the new * traces being written, if true; when false, the new traces will be * appended to any existing file content. * @param firstPids of dalvik VM processes to dump stack traces for first * @param lastPids of dalvik VM processes to dump stack traces for last * @param nativePids optional list of native pids to dump stack crawls */ public static File dumpStackTraces(boolean clearTraces, ArrayList firstPids, ProcessCpuTracker processCpuTracker, SparseArray lastPids, ArrayList nativePids) { ArrayList extraPids = null; // Measure CPU usage as soon as we're called in order to get a realistic sampling // of the top users at the time of the request. if (processCpuTracker != null) { processCpuTracker.init(); try { Thread.sleep(200); } catch (InterruptedException ignored) { } processCpuTracker.update(); // We'll take the stack crawls of just the top apps using CPU. final int N = processCpuTracker.countWorkingStats(); extraPids = new ArrayList<>(); for (int i = 0; i < N && extraPids.size() < 5; i++) { ProcessCpuTracker.Stats stats = processCpuTracker.getWorkingStats(i); if (lastPids.indexOfKey(stats.pid) >= 0) { if (DEBUG_ANR) Slog.d(TAG, "Collecting stacks for extra pid " + stats.pid); extraPids.add(stats.pid); } else if (DEBUG_ANR) { Slog.d(TAG, "Skipping next CPU consuming process, not a java proc: " + stats.pid); } } } boolean useTombstonedForJavaTraces = false; File tracesFile; final String tracesDirProp = SystemProperties.get("dalvik.vm.stack-trace-dir", ""); if (tracesDirProp.isEmpty()) { // When dalvik.vm.stack-trace-dir is not set, we are using the "old" trace // dumping scheme. All traces are written to a global trace file (usually // "/data/anr/traces.txt") so the code below must take care to unlink and recreate // the file if requested. // // This mode of operation will be removed in the near future. String globalTracesPath = SystemProperties.get("dalvik.vm.stack-trace-file", null); if (globalTracesPath.isEmpty()) { Slog.w(TAG, "dumpStackTraces: no trace path configured"); return null; } tracesFile = new File(globalTracesPath); try { if (clearTraces && tracesFile.exists()) { tracesFile.delete(); } tracesFile.createNewFile(); FileUtils.setPermissions(globalTracesPath, 0666, -1, -1); // -rw-rw-rw- } catch (IOException e) { Slog.w(TAG, "Unable to prepare ANR traces file: " + tracesFile, e); return null; } } else { File tracesDir = new File(tracesDirProp); // When dalvik.vm.stack-trace-dir is set, we use the "new" trace dumping scheme. // Each set of ANR traces is written to a separate file and dumpstate will process // all such files and add them to a captured bug report if they're recent enough. maybePruneOldTraces(tracesDir); // NOTE: We should consider creating the file in native code atomically once we've // gotten rid of the old scheme of dumping and lot of the code that deals with paths // can be removed. tracesFile = createAnrDumpFile(tracesDir); if (tracesFile == null) { return null; } useTombstonedForJavaTraces = true; } dumpStackTraces(tracesFile.getAbsolutePath(), firstPids, nativePids, extraPids, useTombstonedForJavaTraces); return tracesFile; } @GuardedBy("ActivityManagerService.class") private static SimpleDateFormat sAnrFileDateFormat; private static synchronized File createAnrDumpFile(File tracesDir) { if (sAnrFileDateFormat == null) { sAnrFileDateFormat = new SimpleDateFormat("yyyy-MM-dd-HH-mm-ss-SSS"); } final String formattedDate = sAnrFileDateFormat.format(new Date()); final File anrFile = new File(tracesDir, "anr_" + formattedDate); try { if (anrFile.createNewFile()) { FileUtils.setPermissions(anrFile.getAbsolutePath(), 0600, -1, -1); // -rw------- return anrFile; } else { Slog.w(TAG, "Unable to create ANR dump file: createNewFile failed"); } } catch (IOException ioe) { Slog.w(TAG, "Exception creating ANR dump file:", ioe); } return null; } /** * Prune all trace files that are more than a day old. * * NOTE: It might make sense to move this functionality to tombstoned eventually, along with a * shift away from anr_XX and tombstone_XX to a more descriptive name. We do it here for now * since it's the system_server that creates trace files for most ANRs. */ private static void maybePruneOldTraces(File tracesDir) { final long now = System.currentTimeMillis(); final File[] traceFiles = tracesDir.listFiles(); if (traceFiles != null) { for (File file : traceFiles) { if ((now - file.lastModified()) > DAY_IN_MILLIS) { if (!file.delete()) { Slog.w(TAG, "Unable to prune stale trace file: " + file); } } } } } /** * Legacy code, do not use. Existing users will be deleted. * * @deprecated */ @Deprecated public static class DumpStackFileObserver extends FileObserver { // Keep in sync with frameworks/native/cmds/dumpstate/utils.cpp private static final int TRACE_DUMP_TIMEOUT_MS = 10000; // 10 seconds private final String mTracesPath; private boolean mClosed; public DumpStackFileObserver(String tracesPath) { super(tracesPath, FileObserver.CLOSE_WRITE); mTracesPath = tracesPath; } @Override public synchronized void onEvent(int event, String path) { mClosed = true; notify(); } public long dumpWithTimeout(int pid, long timeout) { sendSignal(pid, SIGNAL_QUIT); final long start = SystemClock.elapsedRealtime(); final long waitTime = Math.min(timeout, TRACE_DUMP_TIMEOUT_MS); synchronized (this) { try { wait(waitTime); // Wait for traces file to be closed. } catch (InterruptedException e) { Slog.wtf(TAG, e); } } // This avoids a corner case of passing a negative time to the native // trace in case we've already hit the overall timeout. final long timeWaited = SystemClock.elapsedRealtime() - start; if (timeWaited >= timeout) { return timeWaited; } if (!mClosed) { Slog.w(TAG, "Didn't see close of " + mTracesPath + " for pid " + pid + ". Attempting native stack collection."); final long nativeDumpTimeoutMs = Math.min( NATIVE_DUMP_TIMEOUT_MS, timeout - timeWaited); Debug.dumpNativeBacktraceToFileTimeout(pid, mTracesPath, (int) (nativeDumpTimeoutMs / 1000)); } final long end = SystemClock.elapsedRealtime(); mClosed = false; return (end - start); } } /** * Dump java traces for process {@code pid} to the specified file. If java trace dumping * fails, a native backtrace is attempted. Note that the timeout {@code timeoutMs} only applies * to the java section of the trace, a further {@code NATIVE_DUMP_TIMEOUT_MS} might be spent * attempting to obtain native traces in the case of a failure. Returns the total time spent * capturing traces. */ private static long dumpJavaTracesTombstoned(int pid, String fileName, long timeoutMs) { final long timeStart = SystemClock.elapsedRealtime(); if (!Debug.dumpJavaBacktraceToFileTimeout(pid, fileName, (int) (timeoutMs / 1000))) { Debug.dumpNativeBacktraceToFileTimeout(pid, fileName, (NATIVE_DUMP_TIMEOUT_MS / 1000)); } return SystemClock.elapsedRealtime() - timeStart; } private static void dumpStackTraces(String tracesFile, ArrayList firstPids, ArrayList nativePids, ArrayList extraPids, boolean useTombstonedForJavaTraces) { // We don't need any sort of inotify based monitoring when we're dumping traces via // tombstoned. Data is piped to an "intercept" FD installed in tombstoned so we're in full // control of all writes to the file in question. final DumpStackFileObserver observer; if (useTombstonedForJavaTraces) { observer = null; } else { // Use a FileObserver to detect when traces finish writing. // The order of traces is considered important to maintain for legibility. observer = new DumpStackFileObserver(tracesFile); } // We must complete all stack dumps within 20 seconds. long remainingTime = 20 * 1000; try { if (observer != null) { observer.startWatching(); } // First collect all of the stacks of the most important pids. if (firstPids != null) { int num = firstPids.size(); for (int i = 0; i < num; i++) { if (DEBUG_ANR) Slog.d(TAG, "Collecting stacks for pid " + firstPids.get(i)); final long timeTaken; if (useTombstonedForJavaTraces) { timeTaken = dumpJavaTracesTombstoned(firstPids.get(i), tracesFile, remainingTime); } else { timeTaken = observer.dumpWithTimeout(firstPids.get(i), remainingTime); } remainingTime -= timeTaken; if (remainingTime <= 0) { Slog.e(TAG, "Aborting stack trace dump (current firstPid=" + firstPids.get(i) + "); deadline exceeded."); return; } if (DEBUG_ANR) { Slog.d(TAG, "Done with pid " + firstPids.get(i) + " in " + timeTaken + "ms"); } } } // Next collect the stacks of the native pids if (nativePids != null) { for (int pid : nativePids) { if (DEBUG_ANR) Slog.d(TAG, "Collecting stacks for native pid " + pid); final long nativeDumpTimeoutMs = Math.min(NATIVE_DUMP_TIMEOUT_MS, remainingTime); final long start = SystemClock.elapsedRealtime(); Debug.dumpNativeBacktraceToFileTimeout( pid, tracesFile, (int) (nativeDumpTimeoutMs / 1000)); final long timeTaken = SystemClock.elapsedRealtime() - start; remainingTime -= timeTaken; if (remainingTime <= 0) { Slog.e(TAG, "Aborting stack trace dump (current native pid=" + pid + "); deadline exceeded."); return; } if (DEBUG_ANR) { Slog.d(TAG, "Done with native pid " + pid + " in " + timeTaken + "ms"); } } } // Lastly, dump stacks for all extra PIDs from the CPU tracker. if (extraPids != null) { for (int pid : extraPids) { if (DEBUG_ANR) Slog.d(TAG, "Collecting stacks for extra pid " + pid); final long timeTaken; if (useTombstonedForJavaTraces) { timeTaken = dumpJavaTracesTombstoned(pid, tracesFile, remainingTime); } else { timeTaken = observer.dumpWithTimeout(pid, remainingTime); } remainingTime -= timeTaken; if (remainingTime <= 0) { Slog.e(TAG, "Aborting stack trace dump (current extra pid=" + pid + "); deadline exceeded."); return; } if (DEBUG_ANR) { Slog.d(TAG, "Done with extra pid " + pid + " in " + timeTaken + "ms"); } } } } finally { if (observer != null) { observer.stopWatching(); } } } final void logAppTooSlow(ProcessRecord app, long startTime, String msg) { if (true || Build.IS_USER) { return; } String tracesPath = SystemProperties.get("dalvik.vm.stack-trace-file", null); if (tracesPath == null || tracesPath.length() == 0) { return; } StrictMode.ThreadPolicy oldPolicy = StrictMode.allowThreadDiskReads(); StrictMode.allowThreadDiskWrites(); try { final File tracesFile = new File(tracesPath); final File tracesDir = tracesFile.getParentFile(); final File tracesTmp = new File(tracesDir, "__tmp__"); try { if (tracesFile.exists()) { tracesTmp.delete(); tracesFile.renameTo(tracesTmp); } StringBuilder sb = new StringBuilder(); Time tobj = new Time(); tobj.set(System.currentTimeMillis()); sb.append(tobj.format("%Y-%m-%d %H:%M:%S")); sb.append(": "); TimeUtils.formatDuration(SystemClock.uptimeMillis()-startTime, sb); sb.append(" since "); sb.append(msg); FileOutputStream fos = new FileOutputStream(tracesFile); fos.write(sb.toString().getBytes()); if (app == null) { fos.write("\n*** No application process!".getBytes()); } fos.close(); FileUtils.setPermissions(tracesFile.getPath(), 0666, -1, -1); // -rw-rw-rw- } catch (IOException e) { Slog.w(TAG, "Unable to prepare slow app traces file: " + tracesPath, e); return; } if (app != null) { ArrayList firstPids = new ArrayList(); firstPids.add(app.pid); dumpStackTraces(tracesPath, firstPids, null, null, true /* useTombstoned */); } File lastTracesFile = null; File curTracesFile = null; for (int i=9; i>=0; i--) { String name = String.format(Locale.US, "slow%02d.txt", i); curTracesFile = new File(tracesDir, name); if (curTracesFile.exists()) { if (lastTracesFile != null) { curTracesFile.renameTo(lastTracesFile); } else { curTracesFile.delete(); } } lastTracesFile = curTracesFile; } tracesFile.renameTo(curTracesFile); if (tracesTmp.exists()) { tracesTmp.renameTo(tracesFile); } } finally { StrictMode.setThreadPolicy(oldPolicy); } } final void showLaunchWarningLocked(final ActivityRecord cur, final ActivityRecord next) { if (!mLaunchWarningShown) { mLaunchWarningShown = true; mUiHandler.post(new Runnable() { @Override public void run() { synchronized (ActivityManagerService.this) { final Dialog d = new LaunchWarningWindow(mContext, cur, next); d.show(); mUiHandler.postDelayed(new Runnable() { @Override public void run() { synchronized (ActivityManagerService.this) { d.dismiss(); mLaunchWarningShown = false; } } }, 4000); } } }); } } @Override public boolean clearApplicationUserData(final String packageName, final IPackageDataObserver observer, int userId) { enforceNotIsolatedCaller("clearApplicationUserData"); int uid = Binder.getCallingUid(); int pid = Binder.getCallingPid(); final int resolvedUserId = mUserController.handleIncomingUser(pid, uid, userId, false, ALLOW_FULL_ONLY, "clearApplicationUserData", null); final ApplicationInfo appInfo; final boolean isInstantApp; long callingId = Binder.clearCallingIdentity(); try { IPackageManager pm = AppGlobals.getPackageManager(); synchronized(this) { // Instant packages are not protected if (getPackageManagerInternalLocked().isPackageDataProtected( resolvedUserId, packageName)) { throw new SecurityException( "Cannot clear data for a protected package: " + packageName); } ApplicationInfo applicationInfo = null; try { applicationInfo = pm.getApplicationInfo(packageName, MATCH_UNINSTALLED_PACKAGES, resolvedUserId); } catch (RemoteException e) { /* ignore */ } appInfo = applicationInfo; final boolean clearingOwnUidData = appInfo != null && appInfo.uid == uid; if (!clearingOwnUidData && checkComponentPermission(permission.CLEAR_APP_USER_DATA, pid, uid, -1, true) != PackageManager.PERMISSION_GRANTED) { throw new SecurityException("PID " + pid + " does not have permission " + android.Manifest.permission.CLEAR_APP_USER_DATA + " to clear data" + " of package " + packageName); } final boolean hasInstantMetadata = getPackageManagerInternalLocked() .hasInstantApplicationMetadata(packageName, resolvedUserId); final boolean isUninstalledAppWithoutInstantMetadata = (appInfo == null && !hasInstantMetadata); isInstantApp = (appInfo != null && appInfo.isInstantApp()) || hasInstantMetadata; final boolean canAccessInstantApps = checkComponentPermission( permission.ACCESS_INSTANT_APPS, pid, uid, -1, true) == PackageManager.PERMISSION_GRANTED; if (isUninstalledAppWithoutInstantMetadata || (isInstantApp && !canAccessInstantApps)) { Slog.w(TAG, "Invalid packageName: " + packageName); if (observer != null) { try { observer.onRemoveCompleted(packageName, false); } catch (RemoteException e) { Slog.i(TAG, "Observer no longer exists."); } } return false; } if (appInfo != null) { forceStopPackageLocked(packageName, appInfo.uid, "clear data"); mRecentTasks.removeTasksByPackageName(packageName, resolvedUserId); } } final IPackageDataObserver localObserver = new IPackageDataObserver.Stub() { @Override public void onRemoveCompleted(String packageName, boolean succeeded) throws RemoteException { if (appInfo != null) { synchronized (ActivityManagerService.this) { finishForceStopPackageLocked(packageName, appInfo.uid); } } final Intent intent = new Intent(Intent.ACTION_PACKAGE_DATA_CLEARED, Uri.fromParts("package", packageName, null)); intent.addFlags(Intent.FLAG_RECEIVER_INCLUDE_BACKGROUND); intent.putExtra(Intent.EXTRA_UID, (appInfo != null) ? appInfo.uid : -1); intent.putExtra(Intent.EXTRA_USER_HANDLE, resolvedUserId); if (isInstantApp) { intent.putExtra(Intent.EXTRA_PACKAGE_NAME, packageName); broadcastIntentInPackage("android", SYSTEM_UID, intent, null, null, 0, null, null, permission.ACCESS_INSTANT_APPS, null, false, false, resolvedUserId); } else { broadcastIntentInPackage("android", SYSTEM_UID, intent, null, null, 0, null, null, null, null, false, false, resolvedUserId); } if (observer != null) { observer.onRemoveCompleted(packageName, succeeded); } } }; try { // Clear application user data pm.clearApplicationUserData(packageName, localObserver, resolvedUserId); if (appInfo != null) { synchronized (this) { // Remove all permissions granted from/to this package removeUriPermissionsForPackageLocked(packageName, resolvedUserId, true); } // Reset notification settings. INotificationManager inm = NotificationManager.getService(); inm.clearData(packageName, appInfo.uid, uid == appInfo.uid); } } catch (RemoteException e) { } } finally { Binder.restoreCallingIdentity(callingId); } return true; } @Override public void killBackgroundProcesses(final String packageName, int userId) { if (checkCallingPermission(android.Manifest.permission.KILL_BACKGROUND_PROCESSES) != PackageManager.PERMISSION_GRANTED && checkCallingPermission(android.Manifest.permission.RESTART_PACKAGES) != PackageManager.PERMISSION_GRANTED) { String msg = "Permission Denial: killBackgroundProcesses() from pid=" + Binder.getCallingPid() + ", uid=" + Binder.getCallingUid() + " requires " + android.Manifest.permission.KILL_BACKGROUND_PROCESSES; Slog.w(TAG, msg); throw new SecurityException(msg); } userId = mUserController.handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(), userId, true, ALLOW_FULL_ONLY, "killBackgroundProcesses", null); long callingId = Binder.clearCallingIdentity(); try { IPackageManager pm = AppGlobals.getPackageManager(); synchronized(this) { int appId = -1; try { appId = UserHandle.getAppId( pm.getPackageUid(packageName, MATCH_DEBUG_TRIAGED_MISSING, userId)); } catch (RemoteException e) { } if (appId == -1) { Slog.w(TAG, "Invalid packageName: " + packageName); return; } killPackageProcessesLocked(packageName, appId, userId, ProcessList.SERVICE_ADJ, false, true, true, false, "kill background"); } } finally { Binder.restoreCallingIdentity(callingId); } } @Override public void killAllBackgroundProcesses() { if (checkCallingPermission(android.Manifest.permission.KILL_BACKGROUND_PROCESSES) != PackageManager.PERMISSION_GRANTED) { final String msg = "Permission Denial: killAllBackgroundProcesses() from pid=" + Binder.getCallingPid() + ", uid=" + Binder.getCallingUid() + " requires " + android.Manifest.permission.KILL_BACKGROUND_PROCESSES; Slog.w(TAG, msg); throw new SecurityException(msg); } final long callingId = Binder.clearCallingIdentity(); try { synchronized (this) { final ArrayList procs = new ArrayList<>(); final int NP = mProcessNames.getMap().size(); for (int ip = 0; ip < NP; ip++) { final SparseArray apps = mProcessNames.getMap().valueAt(ip); final int NA = apps.size(); for (int ia = 0; ia < NA; ia++) { final ProcessRecord app = apps.valueAt(ia); if (app.persistent) { // We don't kill persistent processes. continue; } if (app.removed) { procs.add(app); } else if (app.setAdj >= ProcessList.CACHED_APP_MIN_ADJ) { app.removed = true; procs.add(app); } } } final int N = procs.size(); for (int i = 0; i < N; i++) { removeProcessLocked(procs.get(i), false, true, "kill all background"); } mAllowLowerMemLevel = true; updateOomAdjLocked(); doLowMemReportIfNeededLocked(null); } } finally { Binder.restoreCallingIdentity(callingId); } } /** * Kills all background processes, except those matching any of the * specified properties. * * @param minTargetSdk the target SDK version at or above which to preserve * processes, or {@code -1} to ignore the target SDK * @param maxProcState the process state at or below which to preserve * processes, or {@code -1} to ignore the process state */ private void killAllBackgroundProcessesExcept(int minTargetSdk, int maxProcState) { if (checkCallingPermission(android.Manifest.permission.KILL_BACKGROUND_PROCESSES) != PackageManager.PERMISSION_GRANTED) { final String msg = "Permission Denial: killAllBackgroundProcessesExcept() from pid=" + Binder.getCallingPid() + ", uid=" + Binder.getCallingUid() + " requires " + android.Manifest.permission.KILL_BACKGROUND_PROCESSES; Slog.w(TAG, msg); throw new SecurityException(msg); } final long callingId = Binder.clearCallingIdentity(); try { synchronized (this) { final ArrayList procs = new ArrayList<>(); final int NP = mProcessNames.getMap().size(); for (int ip = 0; ip < NP; ip++) { final SparseArray apps = mProcessNames.getMap().valueAt(ip); final int NA = apps.size(); for (int ia = 0; ia < NA; ia++) { final ProcessRecord app = apps.valueAt(ia); if (app.removed) { procs.add(app); } else if ((minTargetSdk < 0 || app.info.targetSdkVersion < minTargetSdk) && (maxProcState < 0 || app.setProcState > maxProcState)) { app.removed = true; procs.add(app); } } } final int N = procs.size(); for (int i = 0; i < N; i++) { removeProcessLocked(procs.get(i), false, true, "kill all background except"); } } } finally { Binder.restoreCallingIdentity(callingId); } } @Override public void forceStopPackage(final String packageName, int userId) { if (checkCallingPermission(android.Manifest.permission.FORCE_STOP_PACKAGES) != PackageManager.PERMISSION_GRANTED) { String msg = "Permission Denial: forceStopPackage() from pid=" + Binder.getCallingPid() + ", uid=" + Binder.getCallingUid() + " requires " + android.Manifest.permission.FORCE_STOP_PACKAGES; Slog.w(TAG, msg); throw new SecurityException(msg); } final int callingPid = Binder.getCallingPid(); userId = mUserController.handleIncomingUser(callingPid, Binder.getCallingUid(), userId, true, ALLOW_FULL_ONLY, "forceStopPackage", null); long callingId = Binder.clearCallingIdentity(); try { IPackageManager pm = AppGlobals.getPackageManager(); synchronized(this) { int[] users = userId == UserHandle.USER_ALL ? mUserController.getUsers() : new int[] { userId }; for (int user : users) { int pkgUid = -1; try { pkgUid = pm.getPackageUid(packageName, MATCH_DEBUG_TRIAGED_MISSING, user); } catch (RemoteException e) { } if (pkgUid == -1) { Slog.w(TAG, "Invalid packageName: " + packageName); continue; } try { pm.setPackageStoppedState(packageName, true, user); } catch (RemoteException e) { } catch (IllegalArgumentException e) { Slog.w(TAG, "Failed trying to unstop package " + packageName + ": " + e); } if (mUserController.isUserRunning(user, 0)) { forceStopPackageLocked(packageName, pkgUid, "from pid " + callingPid); finishForceStopPackageLocked(packageName, pkgUid); } } } } finally { Binder.restoreCallingIdentity(callingId); } } @Override public void addPackageDependency(String packageName) { synchronized (this) { int callingPid = Binder.getCallingPid(); if (callingPid == myPid()) { // Yeah, um, no. return; } ProcessRecord proc; synchronized (mPidsSelfLocked) { proc = mPidsSelfLocked.get(Binder.getCallingPid()); } if (proc != null) { if (proc.pkgDeps == null) { proc.pkgDeps = new ArraySet(1); } proc.pkgDeps.add(packageName); } } } /* * The pkg name and app id have to be specified. */ @Override public void killApplication(String pkg, int appId, int userId, String reason) { if (pkg == null) { return; } // Make sure the uid is valid. if (appId < 0) { Slog.w(TAG, "Invalid appid specified for pkg : " + pkg); return; } int callerUid = Binder.getCallingUid(); // Only the system server can kill an application if (UserHandle.getAppId(callerUid) == SYSTEM_UID) { // Post an aysnc message to kill the application Message msg = mHandler.obtainMessage(KILL_APPLICATION_MSG); msg.arg1 = appId; msg.arg2 = userId; Bundle bundle = new Bundle(); bundle.putString("pkg", pkg); bundle.putString("reason", reason); msg.obj = bundle; mHandler.sendMessage(msg); } else { throw new SecurityException(callerUid + " cannot kill pkg: " + pkg); } } @Override public void closeSystemDialogs(String reason) { enforceNotIsolatedCaller("closeSystemDialogs"); final int pid = Binder.getCallingPid(); final int uid = Binder.getCallingUid(); final long origId = Binder.clearCallingIdentity(); try { synchronized (this) { // Only allow this from foreground processes, so that background // applications can't abuse it to prevent system UI from being shown. if (uid >= FIRST_APPLICATION_UID) { ProcessRecord proc; synchronized (mPidsSelfLocked) { proc = mPidsSelfLocked.get(pid); } if (proc.curRawAdj > ProcessList.PERCEPTIBLE_APP_ADJ) { Slog.w(TAG, "Ignoring closeSystemDialogs " + reason + " from background process " + proc); return; } } closeSystemDialogsLocked(reason); } } finally { Binder.restoreCallingIdentity(origId); } } void closeSystemDialogsLocked(String reason) { Intent intent = new Intent(Intent.ACTION_CLOSE_SYSTEM_DIALOGS); intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY | Intent.FLAG_RECEIVER_FOREGROUND); if (reason != null) { intent.putExtra("reason", reason); } mWindowManager.closeSystemDialogs(reason); mStackSupervisor.closeSystemDialogsLocked(); broadcastIntentLocked(null, null, intent, null, null, 0, null, null, null, AppOpsManager.OP_NONE, null, false, false, -1, SYSTEM_UID, UserHandle.USER_ALL); } @Override public Debug.MemoryInfo[] getProcessMemoryInfo(int[] pids) { enforceNotIsolatedCaller("getProcessMemoryInfo"); Debug.MemoryInfo[] infos = new Debug.MemoryInfo[pids.length]; for (int i=pids.length-1; i>=0; i--) { ProcessRecord proc; int oomAdj; synchronized (this) { synchronized (mPidsSelfLocked) { proc = mPidsSelfLocked.get(pids[i]); oomAdj = proc != null ? proc.setAdj : 0; } } infos[i] = new Debug.MemoryInfo(); Debug.getMemoryInfo(pids[i], infos[i]); if (proc != null) { synchronized (this) { if (proc.thread != null && proc.setAdj == oomAdj) { // Record this for posterity if the process has been stable. proc.baseProcessTracker.addPss(infos[i].getTotalPss(), infos[i].getTotalUss(), false, proc.pkgList); } } } } return infos; } @Override public long[] getProcessPss(int[] pids) { enforceNotIsolatedCaller("getProcessPss"); long[] pss = new long[pids.length]; for (int i=pids.length-1; i>=0; i--) { ProcessRecord proc; int oomAdj; synchronized (this) { synchronized (mPidsSelfLocked) { proc = mPidsSelfLocked.get(pids[i]); oomAdj = proc != null ? proc.setAdj : 0; } } long[] tmpUss = new long[1]; pss[i] = Debug.getPss(pids[i], tmpUss, null); if (proc != null) { synchronized (this) { if (proc.thread != null && proc.setAdj == oomAdj) { // Record this for posterity if the process has been stable. proc.baseProcessTracker.addPss(pss[i], tmpUss[0], false, proc.pkgList); } } } } return pss; } @Override public void killApplicationProcess(String processName, int uid) { if (processName == null) { return; } int callerUid = Binder.getCallingUid(); // Only the system server can kill an application if (callerUid == SYSTEM_UID) { synchronized (this) { ProcessRecord app = getProcessRecordLocked(processName, uid, true); if (app != null && app.thread != null) { try { app.thread.scheduleSuicide(); } catch (RemoteException e) { // If the other end already died, then our work here is done. } } else { Slog.w(TAG, "Process/uid not found attempting kill of " + processName + " / " + uid); } } } else { throw new SecurityException(callerUid + " cannot kill app process: " + processName); } } private void forceStopPackageLocked(final String packageName, int uid, String reason) { forceStopPackageLocked(packageName, UserHandle.getAppId(uid), false, false, true, false, false, UserHandle.getUserId(uid), reason); } private void finishForceStopPackageLocked(final String packageName, int uid) { Intent intent = new Intent(Intent.ACTION_PACKAGE_RESTARTED, Uri.fromParts("package", packageName, null)); if (!mProcessesReady) { intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY | Intent.FLAG_RECEIVER_FOREGROUND); } intent.putExtra(Intent.EXTRA_UID, uid); intent.putExtra(Intent.EXTRA_USER_HANDLE, UserHandle.getUserId(uid)); broadcastIntentLocked(null, null, intent, null, null, 0, null, null, null, AppOpsManager.OP_NONE, null, false, false, MY_PID, SYSTEM_UID, UserHandle.getUserId(uid)); } private final boolean killPackageProcessesLocked(String packageName, int appId, int userId, int minOomAdj, boolean callerWillRestart, boolean allowRestart, boolean doit, boolean evenPersistent, String reason) { ArrayList procs = new ArrayList<>(); // Remove all processes this package may have touched: all with the // same UID (except for the system or root user), and all whose name // matches the package name. final int NP = mProcessNames.getMap().size(); for (int ip=0; ip apps = mProcessNames.getMap().valueAt(ip); final int NA = apps.size(); for (int ia=0; ia= 0 && UserHandle.getAppId(app.uid) != appId) { continue; } // Package has been specified, we want to hit all processes // that match it. We need to qualify this by the processes // that are running under the specified app and user ID. } else { final boolean isDep = app.pkgDeps != null && app.pkgDeps.contains(packageName); if (!isDep && UserHandle.getAppId(app.uid) != appId) { continue; } if (userId != UserHandle.USER_ALL && app.userId != userId) { continue; } if (!app.pkgList.containsKey(packageName) && !isDep) { continue; } } // Process has passed all conditions, kill it! if (!doit) { return true; } app.removed = true; procs.add(app); } } int N = procs.size(); for (int i=0; i 0; } private void cleanupDisabledPackageComponentsLocked( String packageName, int userId, boolean killProcess, String[] changedClasses) { Set disabledClasses = null; boolean packageDisabled = false; IPackageManager pm = AppGlobals.getPackageManager(); if (changedClasses == null) { // Nothing changed... return; } // Determine enable/disable state of the package and its components. int enabled = PackageManager.COMPONENT_ENABLED_STATE_DEFAULT; for (int i = changedClasses.length - 1; i >= 0; i--) { final String changedClass = changedClasses[i]; if (changedClass.equals(packageName)) { try { // Entire package setting changed enabled = pm.getApplicationEnabledSetting(packageName, (userId != UserHandle.USER_ALL) ? userId : UserHandle.USER_SYSTEM); } catch (Exception e) { // No such package/component; probably racing with uninstall. In any // event it means we have nothing further to do here. return; } packageDisabled = enabled != PackageManager.COMPONENT_ENABLED_STATE_ENABLED && enabled != PackageManager.COMPONENT_ENABLED_STATE_DEFAULT; if (packageDisabled) { // Entire package is disabled. // No need to continue to check component states. disabledClasses = null; break; } } else { try { enabled = pm.getComponentEnabledSetting( new ComponentName(packageName, changedClass), (userId != UserHandle.USER_ALL) ? userId : UserHandle.USER_SYSTEM); } catch (Exception e) { // As above, probably racing with uninstall. return; } if (enabled != PackageManager.COMPONENT_ENABLED_STATE_ENABLED && enabled != PackageManager.COMPONENT_ENABLED_STATE_DEFAULT) { if (disabledClasses == null) { disabledClasses = new ArraySet<>(changedClasses.length); } disabledClasses.add(changedClass); } } } if (!packageDisabled && disabledClasses == null) { // Nothing to do here... return; } // Clean-up disabled activities. if (mStackSupervisor.finishDisabledPackageActivitiesLocked( packageName, disabledClasses, true, false, userId) && mBooted) { mStackSupervisor.resumeFocusedStackTopActivityLocked(); mStackSupervisor.scheduleIdleLocked(); } // Clean-up disabled tasks mRecentTasks.cleanupDisabledPackageTasksLocked(packageName, disabledClasses, userId); // Clean-up disabled services. mServices.bringDownDisabledPackageServicesLocked( packageName, disabledClasses, userId, false, killProcess, true); // Clean-up disabled providers. ArrayList providers = new ArrayList<>(); mProviderMap.collectPackageProvidersLocked( packageName, disabledClasses, true, false, userId, providers); for (int i = providers.size() - 1; i >= 0; i--) { removeDyingProviderLocked(null, providers.get(i), true); } // Clean-up disabled broadcast receivers. for (int i = mBroadcastQueues.length - 1; i >= 0; i--) { mBroadcastQueues[i].cleanupDisabledPackageReceiversLocked( packageName, disabledClasses, userId, true); } } final boolean clearBroadcastQueueForUserLocked(int userId) { boolean didSomething = false; for (int i = mBroadcastQueues.length - 1; i >= 0; i--) { didSomething |= mBroadcastQueues[i].cleanupDisabledPackageReceiversLocked( null, null, userId, true); } return didSomething; } final boolean forceStopPackageLocked(String packageName, int appId, boolean callerWillRestart, boolean purgeCache, boolean doit, boolean evenPersistent, boolean uninstalling, int userId, String reason) { int i; if (userId == UserHandle.USER_ALL && packageName == null) { Slog.w(TAG, "Can't force stop all processes of all users, that is insane!"); } if (appId < 0 && packageName != null) { try { appId = UserHandle.getAppId(AppGlobals.getPackageManager() .getPackageUid(packageName, MATCH_DEBUG_TRIAGED_MISSING, 0)); } catch (RemoteException e) { } } if (doit) { if (packageName != null) { Slog.i(TAG, "Force stopping " + packageName + " appid=" + appId + " user=" + userId + ": " + reason); } else { Slog.i(TAG, "Force stopping u" + userId + ": " + reason); } mAppErrors.resetProcessCrashTimeLocked(packageName == null, appId, userId); } boolean didSomething = killPackageProcessesLocked(packageName, appId, userId, ProcessList.INVALID_ADJ, callerWillRestart, true, doit, evenPersistent, packageName == null ? ("stop user " + userId) : ("stop " + packageName)); didSomething |= mActivityStarter.clearPendingActivityLaunchesLocked(packageName); if (mStackSupervisor.finishDisabledPackageActivitiesLocked( packageName, null, doit, evenPersistent, userId)) { if (!doit) { return true; } didSomething = true; } if (mServices.bringDownDisabledPackageServicesLocked( packageName, null, userId, evenPersistent, true, doit)) { if (!doit) { return true; } didSomething = true; } if (packageName == null) { // Remove all sticky broadcasts from this user. mStickyBroadcasts.remove(userId); } ArrayList providers = new ArrayList<>(); if (mProviderMap.collectPackageProvidersLocked(packageName, null, doit, evenPersistent, userId, providers)) { if (!doit) { return true; } didSomething = true; } for (i = providers.size() - 1; i >= 0; i--) { removeDyingProviderLocked(null, providers.get(i), true); } // Remove transient permissions granted from/to this package/user removeUriPermissionsForPackageLocked(packageName, userId, false); if (doit) { for (i = mBroadcastQueues.length - 1; i >= 0; i--) { didSomething |= mBroadcastQueues[i].cleanupDisabledPackageReceiversLocked( packageName, null, userId, doit); } } if (packageName == null || uninstalling) { // Remove pending intents. For now we only do this when force // stopping users, because we have some problems when doing this // for packages -- app widgets are not currently cleaned up for // such packages, so they can be left with bad pending intents. if (mIntentSenderRecords.size() > 0) { Iterator> it = mIntentSenderRecords.values().iterator(); while (it.hasNext()) { WeakReference wpir = it.next(); if (wpir == null) { it.remove(); continue; } PendingIntentRecord pir = wpir.get(); if (pir == null) { it.remove(); continue; } if (packageName == null) { // Stopping user, remove all objects for the user. if (pir.key.userId != userId) { // Not the same user, skip it. continue; } } else { if (UserHandle.getAppId(pir.uid) != appId) { // Different app id, skip it. continue; } if (userId != UserHandle.USER_ALL && pir.key.userId != userId) { // Different user, skip it. continue; } if (!pir.key.packageName.equals(packageName)) { // Different package, skip it. continue; } } if (!doit) { return true; } didSomething = true; it.remove(); makeIntentSenderCanceledLocked(pir); if (pir.key.activity != null && pir.key.activity.pendingResults != null) { pir.key.activity.pendingResults.remove(pir.ref); } } } } if (doit) { if (purgeCache && packageName != null) { AttributeCache ac = AttributeCache.instance(); if (ac != null) { ac.removePackage(packageName); } } if (mBooted) { mStackSupervisor.resumeFocusedStackTopActivityLocked(); mStackSupervisor.scheduleIdleLocked(); } } return didSomething; } private final ProcessRecord removeProcessNameLocked(final String name, final int uid) { return removeProcessNameLocked(name, uid, null); } private final ProcessRecord removeProcessNameLocked(final String name, final int uid, final ProcessRecord expecting) { ProcessRecord old = mProcessNames.get(name, uid); // Only actually remove when the currently recorded value matches the // record that we expected; if it doesn't match then we raced with a // newly created process and we don't want to destroy the new one. if ((expecting == null) || (old == expecting)) { mProcessNames.remove(name, uid); } if (old != null && old.uidRecord != null) { old.uidRecord.numProcs--; if (old.uidRecord.numProcs == 0) { // No more processes using this uid, tell clients it is gone. if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS, "No more processes in " + old.uidRecord); enqueueUidChangeLocked(old.uidRecord, -1, UidRecord.CHANGE_GONE); EventLogTags.writeAmUidStopped(uid); mActiveUids.remove(uid); noteUidProcessState(uid, ActivityManager.PROCESS_STATE_NONEXISTENT); } old.uidRecord = null; } mIsolatedProcesses.remove(uid); return old; } private final void addProcessNameLocked(ProcessRecord proc) { // We shouldn't already have a process under this name, but just in case we // need to clean up whatever may be there now. ProcessRecord old = removeProcessNameLocked(proc.processName, proc.uid); if (old == proc && proc.persistent) { // We are re-adding a persistent process. Whatevs! Just leave it there. Slog.w(TAG, "Re-adding persistent process " + proc); } else if (old != null) { Slog.wtf(TAG, "Already have existing proc " + old + " when adding " + proc); } UidRecord uidRec = mActiveUids.get(proc.uid); if (uidRec == null) { uidRec = new UidRecord(proc.uid); // This is the first appearance of the uid, report it now! if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS, "Creating new process uid: " + uidRec); if (Arrays.binarySearch(mDeviceIdleTempWhitelist, UserHandle.getAppId(proc.uid)) >= 0 || mPendingTempWhitelist.indexOfKey(proc.uid) >= 0) { uidRec.setWhitelist = uidRec.curWhitelist = true; } uidRec.updateHasInternetPermission(); mActiveUids.put(proc.uid, uidRec); EventLogTags.writeAmUidRunning(uidRec.uid); noteUidProcessState(uidRec.uid, uidRec.curProcState); } proc.uidRecord = uidRec; // Reset render thread tid if it was already set, so new process can set it again. proc.renderThreadTid = 0; uidRec.numProcs++; mProcessNames.put(proc.processName, proc.uid, proc); if (proc.isolated) { mIsolatedProcesses.put(proc.uid, proc); } } boolean removeProcessLocked(ProcessRecord app, boolean callerWillRestart, boolean allowRestart, String reason) { final String name = app.processName; final int uid = app.uid; if (DEBUG_PROCESSES) Slog.d(TAG_PROCESSES, "Force removing proc " + app.toShortString() + " (" + name + "/" + uid + ")"); ProcessRecord old = mProcessNames.get(name, uid); if (old != app) { // This process is no longer active, so nothing to do. Slog.w(TAG, "Ignoring remove of inactive process: " + app); return false; } removeProcessNameLocked(name, uid); if (mHeavyWeightProcess == app) { mHandler.sendMessage(mHandler.obtainMessage(CANCEL_HEAVY_NOTIFICATION_MSG, mHeavyWeightProcess.userId, 0)); mHeavyWeightProcess = null; } boolean needRestart = false; if (app.pid > 0 && app.pid != MY_PID) { int pid = app.pid; synchronized (mPidsSelfLocked) { mPidsSelfLocked.remove(pid); mHandler.removeMessages(PROC_START_TIMEOUT_MSG, app); } mBatteryStatsService.noteProcessFinish(app.processName, app.info.uid); boolean willRestart = false; if (app.persistent && !app.isolated) { if (!callerWillRestart) { willRestart = true; } else { needRestart = true; } } app.kill(reason, true); if (app.isolated) { mBatteryStatsService.removeIsolatedUid(app.uid, app.info.uid); getPackageManagerInternalLocked().removeIsolatedUid(app.uid); } handleAppDiedLocked(app, willRestart, allowRestart); if (willRestart) { removeLruProcessLocked(app); addAppLocked(app.info, null, false, null /* ABI override */); } } else { mRemovedProcesses.add(app); } return needRestart; } private final void processContentProviderPublishTimedOutLocked(ProcessRecord app) { cleanupAppInLaunchingProvidersLocked(app, true); removeProcessLocked(app, false, true, "timeout publishing content providers"); } private final void processStartTimedOutLocked(ProcessRecord app) { final int pid = app.pid; boolean gone = false; synchronized (mPidsSelfLocked) { ProcessRecord knownApp = mPidsSelfLocked.get(pid); if (knownApp != null && knownApp.thread == null) { mPidsSelfLocked.remove(pid); gone = true; } } if (gone) { Slog.w(TAG, "Process " + app + " failed to attach"); EventLog.writeEvent(EventLogTags.AM_PROCESS_START_TIMEOUT, app.userId, pid, app.uid, app.processName); removeProcessNameLocked(app.processName, app.uid); if (mHeavyWeightProcess == app) { mHandler.sendMessage(mHandler.obtainMessage(CANCEL_HEAVY_NOTIFICATION_MSG, mHeavyWeightProcess.userId, 0)); mHeavyWeightProcess = null; } mBatteryStatsService.noteProcessFinish(app.processName, app.info.uid); // Take care of any launching providers waiting for this process. cleanupAppInLaunchingProvidersLocked(app, true); // Take care of any services that are waiting for the process. mServices.processStartTimedOutLocked(app); app.kill("start timeout", true); if (app.isolated) { mBatteryStatsService.removeIsolatedUid(app.uid, app.info.uid); } removeLruProcessLocked(app); if (mBackupTarget != null && mBackupTarget.app.pid == pid) { Slog.w(TAG, "Unattached app died before backup, skipping"); mHandler.post(new Runnable() { @Override public void run(){ try { IBackupManager bm = IBackupManager.Stub.asInterface( ServiceManager.getService(Context.BACKUP_SERVICE)); bm.agentDisconnected(app.info.packageName); } catch (RemoteException e) { // Can't happen; the backup manager is local } } }); } if (isPendingBroadcastProcessLocked(pid)) { Slog.w(TAG, "Unattached app died before broadcast acknowledged, skipping"); skipPendingBroadcastLocked(pid); } } else { Slog.w(TAG, "Spurious process start timeout - pid not known for " + app); } } private final boolean attachApplicationLocked(IApplicationThread thread, int pid) { // Find the application record that is being attached... either via // the pid if we are running in multiple processes, or just pull the // next app record if we are emulating process with anonymous threads. ProcessRecord app; long startTime = SystemClock.uptimeMillis(); if (pid != MY_PID && pid >= 0) { synchronized (mPidsSelfLocked) { app = mPidsSelfLocked.get(pid); } } else { app = null; } if (app == null) { Slog.w(TAG, "No pending application record for pid " + pid + " (IApplicationThread " + thread + "); dropping process"); EventLog.writeEvent(EventLogTags.AM_DROP_PROCESS, pid); if (pid > 0 && pid != MY_PID) { killProcessQuiet(pid); //TODO: killProcessGroup(app.info.uid, pid); } else { try { thread.scheduleExit(); } catch (Exception e) { // Ignore exceptions. } } return false; } // If this application record is still attached to a previous // process, clean it up now. if (app.thread != null) { handleAppDiedLocked(app, true, true); } // Tell the process all about itself. if (DEBUG_ALL) Slog.v( TAG, "Binding process pid " + pid + " to record " + app); final String processName = app.processName; try { AppDeathRecipient adr = new AppDeathRecipient( app, pid, thread); thread.asBinder().linkToDeath(adr, 0); app.deathRecipient = adr; } catch (RemoteException e) { app.resetPackageList(mProcessStats); startProcessLocked(app, "link fail", processName); return false; } EventLog.writeEvent(EventLogTags.AM_PROC_BOUND, app.userId, app.pid, app.processName); app.makeActive(thread, mProcessStats); app.curAdj = app.setAdj = app.verifiedAdj = ProcessList.INVALID_ADJ; app.curSchedGroup = app.setSchedGroup = ProcessList.SCHED_GROUP_DEFAULT; app.forcingToImportant = null; updateProcessForegroundLocked(app, false, false); app.hasShownUi = false; app.debugging = false; app.cached = false; app.killedByAm = false; app.killed = false; // We carefully use the same state that PackageManager uses for // filtering, since we use this flag to decide if we need to install // providers when user is unlocked later app.unlocked = StorageManager.isUserKeyUnlocked(app.userId); mHandler.removeMessages(PROC_START_TIMEOUT_MSG, app); boolean normalMode = mProcessesReady || isAllowedWhileBooting(app.info); List providers = normalMode ? generateApplicationProvidersLocked(app) : null; if (providers != null && checkAppInLaunchingProvidersLocked(app)) { Message msg = mHandler.obtainMessage(CONTENT_PROVIDER_PUBLISH_TIMEOUT_MSG); msg.obj = app; mHandler.sendMessageDelayed(msg, CONTENT_PROVIDER_PUBLISH_TIMEOUT); } checkTime(startTime, "attachApplicationLocked: before bindApplication"); if (!normalMode) { Slog.i(TAG, "Launching preboot mode app: " + app); } if (DEBUG_ALL) Slog.v( TAG, "New app record " + app + " thread=" + thread.asBinder() + " pid=" + pid); try { int testMode = ApplicationThreadConstants.DEBUG_OFF; if (mDebugApp != null && mDebugApp.equals(processName)) { testMode = mWaitForDebugger ? ApplicationThreadConstants.DEBUG_WAIT : ApplicationThreadConstants.DEBUG_ON; app.debugging = true; if (mDebugTransient) { mDebugApp = mOrigDebugApp; mWaitForDebugger = mOrigWaitForDebugger; } } ProfilerInfo profilerInfo = null; String agent = null; if (mProfileApp != null && mProfileApp.equals(processName)) { mProfileProc = app; profilerInfo = (mProfilerInfo != null && mProfilerInfo.profileFile != null) ? new ProfilerInfo(mProfilerInfo) : null; agent = mProfilerInfo != null ? mProfilerInfo.agent : null; } else if (app.instr != null && app.instr.mProfileFile != null) { profilerInfo = new ProfilerInfo(app.instr.mProfileFile, null, 0, false, false, null); } boolean enableTrackAllocation = false; if (mTrackAllocationApp != null && mTrackAllocationApp.equals(processName)) { enableTrackAllocation = true; mTrackAllocationApp = null; } // If the app is being launched for restore or full backup, set it up specially boolean isRestrictedBackupMode = false; if (mBackupTarget != null && mBackupAppName.equals(processName)) { isRestrictedBackupMode = mBackupTarget.appInfo.uid >= FIRST_APPLICATION_UID && ((mBackupTarget.backupMode == BackupRecord.RESTORE) || (mBackupTarget.backupMode == BackupRecord.RESTORE_FULL) || (mBackupTarget.backupMode == BackupRecord.BACKUP_FULL)); } if (app.instr != null) { notifyPackageUse(app.instr.mClass.getPackageName(), PackageManager.NOTIFY_PACKAGE_USE_INSTRUMENTATION); } if (DEBUG_CONFIGURATION) Slog.v(TAG_CONFIGURATION, "Binding proc " + processName + " with config " + getGlobalConfiguration()); ApplicationInfo appInfo = app.instr != null ? app.instr.mTargetInfo : app.info; app.compat = compatibilityInfoForPackageLocked(appInfo); if (profilerInfo != null && profilerInfo.profileFd != null) { profilerInfo.profileFd = profilerInfo.profileFd.dup(); } // We deprecated Build.SERIAL and it is not accessible to // apps that target the v2 security sandbox. Since access to // the serial is now behind a permission we push down the value. String buildSerial = appInfo.targetSandboxVersion < 2 ? sTheRealBuildSerial : Build.UNKNOWN; // Check if this is a secondary process that should be incorporated into some // currently active instrumentation. (Note we do this AFTER all of the profiling // stuff above because profiling can currently happen only in the primary // instrumentation process.) if (mActiveInstrumentation.size() > 0 && app.instr == null) { for (int i = mActiveInstrumentation.size() - 1; i >= 0 && app.instr == null; i--) { ActiveInstrumentation aInstr = mActiveInstrumentation.get(i); if (!aInstr.mFinished && aInstr.mTargetInfo.uid == app.uid) { if (aInstr.mTargetProcesses.length == 0) { // This is the wildcard mode, where every process brought up for // the target instrumentation should be included. if (aInstr.mTargetInfo.packageName.equals(app.info.packageName)) { app.instr = aInstr; aInstr.mRunningProcesses.add(app); } } else { for (String proc : aInstr.mTargetProcesses) { if (proc.equals(app.processName)) { app.instr = aInstr; aInstr.mRunningProcesses.add(app); break; } } } } } } // If we were asked to attach an agent on startup, do so now, before we're binding // application code. if (agent != null) { thread.attachAgent(agent); } checkTime(startTime, "attachApplicationLocked: immediately before bindApplication"); mStackSupervisor.mActivityMetricsLogger.notifyBindApplication(app); if (app.isolatedEntryPoint != null) { // This is an isolated process which should just call an entry point instead of // being bound to an application. thread.runIsolatedEntryPoint(app.isolatedEntryPoint, app.isolatedEntryPointArgs); } else if (app.instr != null) { thread.bindApplication(processName, appInfo, providers, app.instr.mClass, profilerInfo, app.instr.mArguments, app.instr.mWatcher, app.instr.mUiAutomationConnection, testMode, mBinderTransactionTrackingEnabled, enableTrackAllocation, isRestrictedBackupMode || !normalMode, app.persistent, new Configuration(getGlobalConfiguration()), app.compat, getCommonServicesLocked(app.isolated), mCoreSettingsObserver.getCoreSettingsLocked(), buildSerial); } else { thread.bindApplication(processName, appInfo, providers, null, profilerInfo, null, null, null, testMode, mBinderTransactionTrackingEnabled, enableTrackAllocation, isRestrictedBackupMode || !normalMode, app.persistent, new Configuration(getGlobalConfiguration()), app.compat, getCommonServicesLocked(app.isolated), mCoreSettingsObserver.getCoreSettingsLocked(), buildSerial); } checkTime(startTime, "attachApplicationLocked: immediately after bindApplication"); updateLruProcessLocked(app, false, null); checkTime(startTime, "attachApplicationLocked: after updateLruProcessLocked"); app.lastRequestedGc = app.lastLowMemory = SystemClock.uptimeMillis(); } catch (Exception e) { // todo: Yikes! What should we do? For now we will try to // start another process, but that could easily get us in // an infinite loop of restarting processes... Slog.wtf(TAG, "Exception thrown during bind of " + app, e); app.resetPackageList(mProcessStats); app.unlinkDeathRecipient(); startProcessLocked(app, "bind fail", processName); return false; } // Remove this record from the list of starting applications. mPersistentStartingProcesses.remove(app); if (DEBUG_PROCESSES && mProcessesOnHold.contains(app)) Slog.v(TAG_PROCESSES, "Attach application locked removing on hold: " + app); mProcessesOnHold.remove(app); boolean badApp = false; boolean didSomething = false; // See if the top visible activity is waiting to run in this process... if (normalMode) { try { if (mStackSupervisor.attachApplicationLocked(app)) { didSomething = true; } } catch (Exception e) { Slog.wtf(TAG, "Exception thrown launching activities in " + app, e); badApp = true; } } // Find any services that should be running in this process... if (!badApp) { try { didSomething |= mServices.attachApplicationLocked(app, processName); checkTime(startTime, "attachApplicationLocked: after mServices.attachApplicationLocked"); } catch (Exception e) { Slog.wtf(TAG, "Exception thrown starting services in " + app, e); badApp = true; } } // Check if a next-broadcast receiver is in this process... if (!badApp && isPendingBroadcastProcessLocked(pid)) { try { didSomething |= sendPendingBroadcastsLocked(app); checkTime(startTime, "attachApplicationLocked: after sendPendingBroadcastsLocked"); } catch (Exception e) { // If the app died trying to launch the receiver we declare it 'bad' Slog.wtf(TAG, "Exception thrown dispatching broadcasts in " + app, e); badApp = true; } } // Check whether the next backup agent is in this process... if (!badApp && mBackupTarget != null && mBackupTarget.app == app) { if (DEBUG_BACKUP) Slog.v(TAG_BACKUP, "New app is backup target, launching agent for " + app); notifyPackageUse(mBackupTarget.appInfo.packageName, PackageManager.NOTIFY_PACKAGE_USE_BACKUP); try { thread.scheduleCreateBackupAgent(mBackupTarget.appInfo, compatibilityInfoForPackageLocked(mBackupTarget.appInfo), mBackupTarget.backupMode); } catch (Exception e) { Slog.wtf(TAG, "Exception thrown creating backup agent in " + app, e); badApp = true; } } if (badApp) { app.kill("error during init", true); handleAppDiedLocked(app, false, true); return false; } if (!didSomething) { updateOomAdjLocked(); checkTime(startTime, "attachApplicationLocked: after updateOomAdjLocked"); } return true; } @Override public final void attachApplication(IApplicationThread thread) { synchronized (this) { int callingPid = Binder.getCallingPid(); final long origId = Binder.clearCallingIdentity(); attachApplicationLocked(thread, callingPid); Binder.restoreCallingIdentity(origId); } } @Override public final void activityIdle(IBinder token, Configuration config, boolean stopProfiling) { final long origId = Binder.clearCallingIdentity(); synchronized (this) { ActivityStack stack = ActivityRecord.getStackLocked(token); if (stack != null) { ActivityRecord r = mStackSupervisor.activityIdleInternalLocked(token, false /* fromTimeout */, false /* processPausingActivities */, config); if (stopProfiling) { if ((mProfileProc == r.app) && mProfilerInfo != null) { clearProfilerLocked(); } } } } Binder.restoreCallingIdentity(origId); } void postFinishBooting(boolean finishBooting, boolean enableScreen) { mHandler.sendMessage(mHandler.obtainMessage(FINISH_BOOTING_MSG, finishBooting ? 1 : 0, enableScreen ? 1 : 0)); } void enableScreenAfterBoot() { EventLog.writeEvent(EventLogTags.BOOT_PROGRESS_ENABLE_SCREEN, SystemClock.uptimeMillis()); mWindowManager.enableScreenAfterBoot(); synchronized (this) { updateEventDispatchingLocked(); } } @Override public void showBootMessage(final CharSequence msg, final boolean always) { if (Binder.getCallingUid() != myUid()) { throw new SecurityException(); } mWindowManager.showBootMessage(msg, always); } @Override public void keyguardGoingAway(int flags) { enforceNotIsolatedCaller("keyguardGoingAway"); final long token = Binder.clearCallingIdentity(); try { synchronized (this) { mKeyguardController.keyguardGoingAway(flags); } } finally { Binder.restoreCallingIdentity(token); } } /** * @return whther the keyguard is currently locked. */ boolean isKeyguardLocked() { return mKeyguardController.isKeyguardLocked(); } final void finishBooting() { synchronized (this) { if (!mBootAnimationComplete) { mCallFinishBooting = true; return; } mCallFinishBooting = false; } ArraySet completedIsas = new ArraySet(); for (String abi : Build.SUPPORTED_ABIS) { zygoteProcess.establishZygoteConnectionForAbi(abi); final String instructionSet = VMRuntime.getInstructionSet(abi); if (!completedIsas.contains(instructionSet)) { try { mInstaller.markBootComplete(VMRuntime.getInstructionSet(abi)); } catch (InstallerException e) { Slog.w(TAG, "Unable to mark boot complete for abi: " + abi + " (" + e.getMessage() +")"); } completedIsas.add(instructionSet); } } IntentFilter pkgFilter = new IntentFilter(); pkgFilter.addAction(Intent.ACTION_QUERY_PACKAGE_RESTART); pkgFilter.addDataScheme("package"); mContext.registerReceiver(new BroadcastReceiver() { @Override public void onReceive(Context context, Intent intent) { String[] pkgs = intent.getStringArrayExtra(Intent.EXTRA_PACKAGES); if (pkgs != null) { for (String pkg : pkgs) { synchronized (ActivityManagerService.this) { if (forceStopPackageLocked(pkg, -1, false, false, false, false, false, 0, "query restart")) { setResultCode(Activity.RESULT_OK); return; } } } } } }, pkgFilter); IntentFilter dumpheapFilter = new IntentFilter(); dumpheapFilter.addAction(DumpHeapActivity.ACTION_DELETE_DUMPHEAP); mContext.registerReceiver(new BroadcastReceiver() { @Override public void onReceive(Context context, Intent intent) { if (intent.getBooleanExtra(DumpHeapActivity.EXTRA_DELAY_DELETE, false)) { mHandler.sendEmptyMessageDelayed(POST_DUMP_HEAP_NOTIFICATION_MSG, 5*60*1000); } else { mHandler.sendEmptyMessage(POST_DUMP_HEAP_NOTIFICATION_MSG); } } }, dumpheapFilter); // Let system services know. mSystemServiceManager.startBootPhase(SystemService.PHASE_BOOT_COMPLETED); synchronized (this) { // Ensure that any processes we had put on hold are now started // up. final int NP = mProcessesOnHold.size(); if (NP > 0) { ArrayList procs = new ArrayList(mProcessesOnHold); for (int ip=0; ip= 1"); } for (int i=0; i ref; ref = mIntentSenderRecords.get(key); PendingIntentRecord rec = ref != null ? ref.get() : null; if (rec != null) { if (!cancelCurrent) { if (updateCurrent) { if (rec.key.requestIntent != null) { rec.key.requestIntent.replaceExtras(intents != null ? intents[intents.length - 1] : null); } if (intents != null) { intents[intents.length-1] = rec.key.requestIntent; rec.key.allIntents = intents; rec.key.allResolvedTypes = resolvedTypes; } else { rec.key.allIntents = null; rec.key.allResolvedTypes = null; } } return rec; } makeIntentSenderCanceledLocked(rec); mIntentSenderRecords.remove(key); } if (noCreate) { return rec; } rec = new PendingIntentRecord(this, key, callingUid); mIntentSenderRecords.put(key, rec.ref); if (type == ActivityManager.INTENT_SENDER_ACTIVITY_RESULT) { if (activity.pendingResults == null) { activity.pendingResults = new HashSet>(); } activity.pendingResults.add(rec.ref); } return rec; } @Override public int sendIntentSender(IIntentSender target, IBinder whitelistToken, int code, Intent intent, String resolvedType, IIntentReceiver finishedReceiver, String requiredPermission, Bundle options) { if (target instanceof PendingIntentRecord) { return ((PendingIntentRecord)target).sendWithResult(code, intent, resolvedType, whitelistToken, finishedReceiver, requiredPermission, options); } else { if (intent == null) { // Weird case: someone has given us their own custom IIntentSender, and now // they have someone else trying to send to it but of course this isn't // really a PendingIntent, so there is no base Intent, and the caller isn't // supplying an Intent... but we never want to dispatch a null Intent to // a receiver, so um... let's make something up. Slog.wtf(TAG, "Can't use null intent with direct IIntentSender call"); intent = new Intent(Intent.ACTION_MAIN); } try { target.send(code, intent, resolvedType, whitelistToken, null, requiredPermission, options); } catch (RemoteException e) { } // Platform code can rely on getting a result back when the send is done, but if // this intent sender is from outside of the system we can't rely on it doing that. // So instead we don't give it the result receiver, and instead just directly // report the finish immediately. if (finishedReceiver != null) { try { finishedReceiver.performReceive(intent, 0, null, null, false, false, UserHandle.getCallingUserId()); } catch (RemoteException e) { } } return 0; } } @Override public void cancelIntentSender(IIntentSender sender) { if (!(sender instanceof PendingIntentRecord)) { return; } synchronized(this) { PendingIntentRecord rec = (PendingIntentRecord)sender; try { final int uid = AppGlobals.getPackageManager().getPackageUid(rec.key.packageName, MATCH_DEBUG_TRIAGED_MISSING, UserHandle.getCallingUserId()); if (!UserHandle.isSameApp(uid, Binder.getCallingUid())) { String msg = "Permission Denial: cancelIntentSender() from pid=" + Binder.getCallingPid() + ", uid=" + Binder.getCallingUid() + " is not allowed to cancel package " + rec.key.packageName; Slog.w(TAG, msg); throw new SecurityException(msg); } } catch (RemoteException e) { throw new SecurityException(e); } cancelIntentSenderLocked(rec, true); } } void cancelIntentSenderLocked(PendingIntentRecord rec, boolean cleanActivity) { makeIntentSenderCanceledLocked(rec); mIntentSenderRecords.remove(rec.key); if (cleanActivity && rec.key.activity != null) { rec.key.activity.pendingResults.remove(rec.ref); } } void makeIntentSenderCanceledLocked(PendingIntentRecord rec) { rec.canceled = true; RemoteCallbackList callbacks = rec.detachCancelListenersLocked(); if (callbacks != null) { mHandler.obtainMessage(DISPATCH_PENDING_INTENT_CANCEL_MSG, callbacks).sendToTarget(); } } @Override public String getPackageForIntentSender(IIntentSender pendingResult) { if (!(pendingResult instanceof PendingIntentRecord)) { return null; } try { PendingIntentRecord res = (PendingIntentRecord)pendingResult; return res.key.packageName; } catch (ClassCastException e) { } return null; } @Override public void registerIntentSenderCancelListener(IIntentSender sender, IResultReceiver receiver) { if (!(sender instanceof PendingIntentRecord)) { return; } synchronized(this) { ((PendingIntentRecord)sender).registerCancelListenerLocked(receiver); } } @Override public void unregisterIntentSenderCancelListener(IIntentSender sender, IResultReceiver receiver) { if (!(sender instanceof PendingIntentRecord)) { return; } synchronized(this) { ((PendingIntentRecord)sender).unregisterCancelListenerLocked(receiver); } } @Override public int getUidForIntentSender(IIntentSender sender) { if (sender instanceof PendingIntentRecord) { try { PendingIntentRecord res = (PendingIntentRecord)sender; return res.uid; } catch (ClassCastException e) { } } return -1; } @Override public boolean isIntentSenderTargetedToPackage(IIntentSender pendingResult) { if (!(pendingResult instanceof PendingIntentRecord)) { return false; } try { PendingIntentRecord res = (PendingIntentRecord)pendingResult; if (res.key.allIntents == null) { return false; } for (int i=0; i { // Only update the saved args from the args that are set r.pictureInPictureArgs.copyOnlySet(params); final float aspectRatio = r.pictureInPictureArgs.getAspectRatio(); final List actions = r.pictureInPictureArgs.getActions(); // Adjust the source bounds by the insets for the transition down final Rect sourceBounds = new Rect(r.pictureInPictureArgs.getSourceRectHint()); mStackSupervisor.moveActivityToPinnedStackLocked(r, sourceBounds, aspectRatio, "enterPictureInPictureMode"); final PinnedActivityStack stack = r.getStack(); stack.setPictureInPictureAspectRatio(aspectRatio); stack.setPictureInPictureActions(actions); MetricsLogger.action(mContext, MetricsEvent.ACTION_PICTURE_IN_PICTURE_ENTERED, r.supportsEnterPipOnTaskSwitch); logPictureInPictureArgs(params); }; if (isKeyguardLocked()) { // If the keyguard is showing or occluded, then try and dismiss it before // entering picture-in-picture (this will prompt the user to authenticate if the // device is currently locked). try { dismissKeyguard(token, new IKeyguardDismissCallback.Stub() { @Override public void onDismissError() throws RemoteException { // Do nothing } @Override public void onDismissSucceeded() throws RemoteException { mHandler.post(enterPipRunnable); } @Override public void onDismissCancelled() throws RemoteException { // Do nothing } }); } catch (RemoteException e) { // Local call } } else { // Enter picture in picture immediately otherwise enterPipRunnable.run(); } return true; } } finally { Binder.restoreCallingIdentity(origId); } } @Override public void setPictureInPictureParams(IBinder token, final PictureInPictureParams params) { final long origId = Binder.clearCallingIdentity(); try { synchronized(this) { final ActivityRecord r = ensureValidPictureInPictureActivityParamsLocked( "setPictureInPictureParams", token, params); // Only update the saved args from the args that are set r.pictureInPictureArgs.copyOnlySet(params); if (r.inPinnedWindowingMode()) { // If the activity is already in picture-in-picture, update the pinned stack now // if it is not already expanding to fullscreen. Otherwise, the arguments will // be used the next time the activity enters PiP final PinnedActivityStack stack = r.getStack(); if (!stack.isAnimatingBoundsToFullscreen()) { stack.setPictureInPictureAspectRatio( r.pictureInPictureArgs.getAspectRatio()); stack.setPictureInPictureActions(r.pictureInPictureArgs.getActions()); } } logPictureInPictureArgs(params); } } finally { Binder.restoreCallingIdentity(origId); } } @Override public int getMaxNumPictureInPictureActions(IBinder token) { // Currently, this is a static constant, but later, we may change this to be dependent on // the context of the activity return 3; } private void logPictureInPictureArgs(PictureInPictureParams params) { if (params.hasSetActions()) { MetricsLogger.histogram(mContext, "tron_varz_picture_in_picture_actions_count", params.getActions().size()); } if (params.hasSetAspectRatio()) { LogMaker lm = new LogMaker(MetricsEvent.ACTION_PICTURE_IN_PICTURE_ASPECT_RATIO_CHANGED); lm.addTaggedData(MetricsEvent.PICTURE_IN_PICTURE_ASPECT_RATIO, params.getAspectRatio()); MetricsLogger.action(lm); } } /** * Checks the state of the system and the activity associated with the given {@param token} to * verify that picture-in-picture is supported for that activity. * * @return the activity record for the given {@param token} if all the checks pass. */ private ActivityRecord ensureValidPictureInPictureActivityParamsLocked(String caller, IBinder token, PictureInPictureParams params) { if (!mSupportsPictureInPicture) { throw new IllegalStateException(caller + ": Device doesn't support picture-in-picture mode."); } final ActivityRecord r = ActivityRecord.forTokenLocked(token); if (r == null) { throw new IllegalStateException(caller + ": Can't find activity for token=" + token); } if (!r.supportsPictureInPicture()) { throw new IllegalStateException(caller + ": Current activity does not support picture-in-picture."); } if (params.hasSetAspectRatio() && !mWindowManager.isValidPictureInPictureAspectRatio(r.getStack().mDisplayId, params.getAspectRatio())) { final float minAspectRatio = mContext.getResources().getFloat( com.android.internal.R.dimen.config_pictureInPictureMinAspectRatio); final float maxAspectRatio = mContext.getResources().getFloat( com.android.internal.R.dimen.config_pictureInPictureMaxAspectRatio); throw new IllegalArgumentException(String.format(caller + ": Aspect ratio is too extreme (must be between %f and %f).", minAspectRatio, maxAspectRatio)); } // Truncate the number of actions if necessary params.truncateActions(getMaxNumPictureInPictureActions(token)); return r; } // ========================================================= // PROCESS INFO // ========================================================= static class ProcessInfoService extends IProcessInfoService.Stub { final ActivityManagerService mActivityManagerService; ProcessInfoService(ActivityManagerService activityManagerService) { mActivityManagerService = activityManagerService; } @Override public void getProcessStatesFromPids(/*in*/ int[] pids, /*out*/ int[] states) { mActivityManagerService.getProcessStatesAndOomScoresForPIDs( /*in*/ pids, /*out*/ states, null); } @Override public void getProcessStatesAndOomScoresFromPids( /*in*/ int[] pids, /*out*/ int[] states, /*out*/ int[] scores) { mActivityManagerService.getProcessStatesAndOomScoresForPIDs( /*in*/ pids, /*out*/ states, /*out*/ scores); } } /** * For each PID in the given input array, write the current process state * for that process into the states array, or -1 to indicate that no * process with the given PID exists. If scores array is provided, write * the oom score for the process into the scores array, with INVALID_ADJ * indicating the PID doesn't exist. */ public void getProcessStatesAndOomScoresForPIDs( /*in*/ int[] pids, /*out*/ int[] states, /*out*/ int[] scores) { if (scores != null) { enforceCallingPermission(android.Manifest.permission.GET_PROCESS_STATE_AND_OOM_SCORE, "getProcessStatesAndOomScoresForPIDs()"); } if (pids == null) { throw new NullPointerException("pids"); } else if (states == null) { throw new NullPointerException("states"); } else if (pids.length != states.length) { throw new IllegalArgumentException("pids and states arrays have different lengths!"); } else if (scores != null && pids.length != scores.length) { throw new IllegalArgumentException("pids and scores arrays have different lengths!"); } synchronized (mPidsSelfLocked) { for (int i = 0; i < pids.length; i++) { ProcessRecord pr = mPidsSelfLocked.get(pids[i]); states[i] = (pr == null) ? ActivityManager.PROCESS_STATE_NONEXISTENT : pr.curProcState; if (scores != null) { scores[i] = (pr == null) ? ProcessList.INVALID_ADJ : pr.curAdj; } } } } // ========================================================= // PERMISSIONS // ========================================================= static class PermissionController extends IPermissionController.Stub { ActivityManagerService mActivityManagerService; PermissionController(ActivityManagerService activityManagerService) { mActivityManagerService = activityManagerService; } @Override public boolean checkPermission(String permission, int pid, int uid) { return mActivityManagerService.checkPermission(permission, pid, uid) == PackageManager.PERMISSION_GRANTED; } @Override public String[] getPackagesForUid(int uid) { return mActivityManagerService.mContext.getPackageManager() .getPackagesForUid(uid); } @Override public boolean isRuntimePermission(String permission) { try { PermissionInfo info = mActivityManagerService.mContext.getPackageManager() .getPermissionInfo(permission, 0); return (info.protectionLevel & PermissionInfo.PROTECTION_MASK_BASE) == PermissionInfo.PROTECTION_DANGEROUS; } catch (NameNotFoundException nnfe) { Slog.e(TAG, "No such permission: "+ permission, nnfe); } return false; } } class IntentFirewallInterface implements IntentFirewall.AMSInterface { @Override public int checkComponentPermission(String permission, int pid, int uid, int owningUid, boolean exported) { return ActivityManagerService.this.checkComponentPermission(permission, pid, uid, owningUid, exported); } @Override public Object getAMSLock() { return ActivityManagerService.this; } } int checkComponentPermission(String permission, int pid, int uid, int owningUid, boolean exported) { if (pid == MY_PID) { return PackageManager.PERMISSION_GRANTED; } return ActivityManager.checkComponentPermission(permission, uid, owningUid, exported); } /** * As the only public entry point for permissions checking, this method * can enforce the semantic that requesting a check on a null global * permission is automatically denied. (Internally a null permission * string is used when calling {@link #checkComponentPermission} in cases * when only uid-based security is needed.) * * This can be called with or without the global lock held. */ @Override public int checkPermission(String permission, int pid, int uid) { if (permission == null) { return PackageManager.PERMISSION_DENIED; } return checkComponentPermission(permission, pid, uid, -1, true); } @Override public int checkPermissionWithToken(String permission, int pid, int uid, IBinder callerToken) { if (permission == null) { return PackageManager.PERMISSION_DENIED; } // We might be performing an operation on behalf of an indirect binder // invocation, e.g. via {@link #openContentUri}. Check and adjust the // client identity accordingly before proceeding. Identity tlsIdentity = sCallerIdentity.get(); if (tlsIdentity != null && tlsIdentity.token == callerToken) { Slog.d(TAG, "checkComponentPermission() adjusting {pid,uid} to {" + tlsIdentity.pid + "," + tlsIdentity.uid + "}"); uid = tlsIdentity.uid; pid = tlsIdentity.pid; } return checkComponentPermission(permission, pid, uid, -1, true); } /** * Binder IPC calls go through the public entry point. * This can be called with or without the global lock held. */ int checkCallingPermission(String permission) { return checkPermission(permission, Binder.getCallingPid(), UserHandle.getAppId(Binder.getCallingUid())); } /** * This can be called with or without the global lock held. */ void enforceCallingPermission(String permission, String func) { if (checkCallingPermission(permission) == PackageManager.PERMISSION_GRANTED) { return; } String msg = "Permission Denial: " + func + " from pid=" + Binder.getCallingPid() + ", uid=" + Binder.getCallingUid() + " requires " + permission; Slog.w(TAG, msg); throw new SecurityException(msg); } /** * This can be called with or without the global lock held. */ void enforceCallerIsRecentsOrHasPermission(String permission, String func) { if (!mRecentTasks.isCallerRecents(Binder.getCallingUid())) { enforceCallingPermission(permission, func); } } /** * Determine if UID is holding permissions required to access {@link Uri} in * the given {@link ProviderInfo}. Final permission checking is always done * in {@link ContentProvider}. */ private final boolean checkHoldingPermissionsLocked( IPackageManager pm, ProviderInfo pi, GrantUri grantUri, int uid, final int modeFlags) { if (DEBUG_URI_PERMISSION) Slog.v(TAG_URI_PERMISSION, "checkHoldingPermissionsLocked: uri=" + grantUri + " uid=" + uid); if (UserHandle.getUserId(uid) != grantUri.sourceUserId) { if (ActivityManager.checkComponentPermission(INTERACT_ACROSS_USERS, uid, -1, true) != PERMISSION_GRANTED) { return false; } } return checkHoldingPermissionsInternalLocked(pm, pi, grantUri, uid, modeFlags, true); } private final boolean checkHoldingPermissionsInternalLocked(IPackageManager pm, ProviderInfo pi, GrantUri grantUri, int uid, final int modeFlags, boolean considerUidPermissions) { if (pi.applicationInfo.uid == uid) { return true; } else if (!pi.exported) { return false; } boolean readMet = (modeFlags & Intent.FLAG_GRANT_READ_URI_PERMISSION) == 0; boolean writeMet = (modeFlags & Intent.FLAG_GRANT_WRITE_URI_PERMISSION) == 0; try { // check if target holds top-level permissions if (!readMet && pi.readPermission != null && considerUidPermissions && (pm.checkUidPermission(pi.readPermission, uid) == PERMISSION_GRANTED)) { readMet = true; } if (!writeMet && pi.writePermission != null && considerUidPermissions && (pm.checkUidPermission(pi.writePermission, uid) == PERMISSION_GRANTED)) { writeMet = true; } // track if unprotected read/write is allowed; any denied // below removes this ability boolean allowDefaultRead = pi.readPermission == null; boolean allowDefaultWrite = pi.writePermission == null; // check if target holds any that match uri final PathPermission[] pps = pi.pathPermissions; if (pps != null) { final String path = grantUri.uri.getPath(); int i = pps.length; while (i > 0 && (!readMet || !writeMet)) { i--; PathPermission pp = pps[i]; if (pp.match(path)) { if (!readMet) { final String pprperm = pp.getReadPermission(); if (DEBUG_URI_PERMISSION) Slog.v(TAG_URI_PERMISSION, "Checking read perm for " + pprperm + " for " + pp.getPath() + ": match=" + pp.match(path) + " check=" + pm.checkUidPermission(pprperm, uid)); if (pprperm != null) { if (considerUidPermissions && pm.checkUidPermission(pprperm, uid) == PERMISSION_GRANTED) { readMet = true; } else { allowDefaultRead = false; } } } if (!writeMet) { final String ppwperm = pp.getWritePermission(); if (DEBUG_URI_PERMISSION) Slog.v(TAG_URI_PERMISSION, "Checking write perm " + ppwperm + " for " + pp.getPath() + ": match=" + pp.match(path) + " check=" + pm.checkUidPermission(ppwperm, uid)); if (ppwperm != null) { if (considerUidPermissions && pm.checkUidPermission(ppwperm, uid) == PERMISSION_GRANTED) { writeMet = true; } else { allowDefaultWrite = false; } } } } } } // grant unprotected read/write, if not blocked by // above if (allowDefaultRead) readMet = true; if (allowDefaultWrite) writeMet = true; } catch (RemoteException e) { return false; } return readMet && writeMet; } public boolean isAppStartModeDisabled(int uid, String packageName) { synchronized (this) { return getAppStartModeLocked(uid, packageName, 0, -1, false, true) == ActivityManager.APP_START_MODE_DISABLED; } } // Unified app-op and target sdk check int appRestrictedInBackgroundLocked(int uid, String packageName, int packageTargetSdk) { // Apps that target O+ are always subject to background check if (packageTargetSdk >= Build.VERSION_CODES.O) { if (DEBUG_BACKGROUND_CHECK) { Slog.i(TAG, "App " + uid + "/" + packageName + " targets O+, restricted"); } return ActivityManager.APP_START_MODE_DELAYED_RIGID; } // ...and legacy apps get an AppOp check int appop = mAppOpsService.noteOperation(AppOpsManager.OP_RUN_IN_BACKGROUND, uid, packageName); if (DEBUG_BACKGROUND_CHECK) { Slog.i(TAG, "Legacy app " + uid + "/" + packageName + " bg appop " + appop); } switch (appop) { case AppOpsManager.MODE_ALLOWED: return ActivityManager.APP_START_MODE_NORMAL; case AppOpsManager.MODE_IGNORED: return ActivityManager.APP_START_MODE_DELAYED; default: return ActivityManager.APP_START_MODE_DELAYED_RIGID; } } // Service launch is available to apps with run-in-background exemptions but // some other background operations are not. If we're doing a check // of service-launch policy, allow those callers to proceed unrestricted. int appServicesRestrictedInBackgroundLocked(int uid, String packageName, int packageTargetSdk) { // Persistent app? if (mPackageManagerInt.isPackagePersistent(packageName)) { if (DEBUG_BACKGROUND_CHECK) { Slog.i(TAG, "App " + uid + "/" + packageName + " is persistent; not restricted in background"); } return ActivityManager.APP_START_MODE_NORMAL; } // Non-persistent but background whitelisted? if (uidOnBackgroundWhitelist(uid)) { if (DEBUG_BACKGROUND_CHECK) { Slog.i(TAG, "App " + uid + "/" + packageName + " on background whitelist; not restricted in background"); } return ActivityManager.APP_START_MODE_NORMAL; } // Is this app on the battery whitelist? if (isOnDeviceIdleWhitelistLocked(uid)) { if (DEBUG_BACKGROUND_CHECK) { Slog.i(TAG, "App " + uid + "/" + packageName + " on idle whitelist; not restricted in background"); } return ActivityManager.APP_START_MODE_NORMAL; } // None of the service-policy criteria apply, so we apply the common criteria return appRestrictedInBackgroundLocked(uid, packageName, packageTargetSdk); } int getAppStartModeLocked(int uid, String packageName, int packageTargetSdk, int callingPid, boolean alwaysRestrict, boolean disabledOnly) { UidRecord uidRec = mActiveUids.get(uid); if (DEBUG_BACKGROUND_CHECK) Slog.d(TAG, "checkAllowBackground: uid=" + uid + " pkg=" + packageName + " rec=" + uidRec + " always=" + alwaysRestrict + " idle=" + (uidRec != null ? uidRec.idle : false)); if (uidRec == null || alwaysRestrict || uidRec.idle) { boolean ephemeral; if (uidRec == null) { ephemeral = getPackageManagerInternalLocked().isPackageEphemeral( UserHandle.getUserId(uid), packageName); } else { ephemeral = uidRec.ephemeral; } if (ephemeral) { // We are hard-core about ephemeral apps not running in the background. return ActivityManager.APP_START_MODE_DISABLED; } else { if (disabledOnly) { // The caller is only interested in whether app starts are completely // disabled for the given package (that is, it is an instant app). So // we don't need to go further, which is all just seeing if we should // apply a "delayed" mode for a regular app. return ActivityManager.APP_START_MODE_NORMAL; } final int startMode = (alwaysRestrict) ? appRestrictedInBackgroundLocked(uid, packageName, packageTargetSdk) : appServicesRestrictedInBackgroundLocked(uid, packageName, packageTargetSdk); if (DEBUG_BACKGROUND_CHECK) Slog.d(TAG, "checkAllowBackground: uid=" + uid + " pkg=" + packageName + " startMode=" + startMode + " onwhitelist=" + isOnDeviceIdleWhitelistLocked(uid)); if (startMode == ActivityManager.APP_START_MODE_DELAYED) { // This is an old app that has been forced into a "compatible as possible" // mode of background check. To increase compatibility, we will allow other // foreground apps to cause its services to start. if (callingPid >= 0) { ProcessRecord proc; synchronized (mPidsSelfLocked) { proc = mPidsSelfLocked.get(callingPid); } if (proc != null && !ActivityManager.isProcStateBackground(proc.curProcState)) { // Whoever is instigating this is in the foreground, so we will allow it // to go through. return ActivityManager.APP_START_MODE_NORMAL; } } } return startMode; } } return ActivityManager.APP_START_MODE_NORMAL; } boolean isOnDeviceIdleWhitelistLocked(int uid) { final int appId = UserHandle.getAppId(uid); return Arrays.binarySearch(mDeviceIdleWhitelist, appId) >= 0 || Arrays.binarySearch(mDeviceIdleTempWhitelist, appId) >= 0 || mPendingTempWhitelist.indexOfKey(uid) >= 0; } private ProviderInfo getProviderInfoLocked(String authority, int userHandle, int pmFlags) { ProviderInfo pi = null; ContentProviderRecord cpr = mProviderMap.getProviderByName(authority, userHandle); if (cpr != null) { pi = cpr.info; } else { try { pi = AppGlobals.getPackageManager().resolveContentProvider( authority, PackageManager.GET_URI_PERMISSION_PATTERNS | pmFlags, userHandle); } catch (RemoteException ex) { } } return pi; } void grantEphemeralAccessLocked(int userId, Intent intent, int targetAppId, int ephemeralAppId) { getPackageManagerInternalLocked(). grantEphemeralAccess(userId, intent, targetAppId, ephemeralAppId); } private UriPermission findUriPermissionLocked(int targetUid, GrantUri grantUri) { final ArrayMap targetUris = mGrantedUriPermissions.get(targetUid); if (targetUris != null) { return targetUris.get(grantUri); } return null; } private UriPermission findOrCreateUriPermissionLocked(String sourcePkg, String targetPkg, int targetUid, GrantUri grantUri) { ArrayMap targetUris = mGrantedUriPermissions.get(targetUid); if (targetUris == null) { targetUris = Maps.newArrayMap(); mGrantedUriPermissions.put(targetUid, targetUris); } UriPermission perm = targetUris.get(grantUri); if (perm == null) { perm = new UriPermission(sourcePkg, targetPkg, targetUid, grantUri); targetUris.put(grantUri, perm); } return perm; } private final boolean checkUriPermissionLocked(GrantUri grantUri, int uid, final int modeFlags) { final boolean persistable = (modeFlags & Intent.FLAG_GRANT_PERSISTABLE_URI_PERMISSION) != 0; final int minStrength = persistable ? UriPermission.STRENGTH_PERSISTABLE : UriPermission.STRENGTH_OWNED; // Root gets to do everything. if (uid == 0) { return true; } final ArrayMap perms = mGrantedUriPermissions.get(uid); if (perms == null) return false; // First look for exact match final UriPermission exactPerm = perms.get(grantUri); if (exactPerm != null && exactPerm.getStrength(modeFlags) >= minStrength) { return true; } // No exact match, look for prefixes final int N = perms.size(); for (int i = 0; i < N; i++) { final UriPermission perm = perms.valueAt(i); if (perm.uri.prefix && grantUri.uri.isPathPrefixMatch(perm.uri.uri) && perm.getStrength(modeFlags) >= minStrength) { return true; } } return false; } /** * @param uri This uri must NOT contain an embedded userId. * @param userId The userId in which the uri is to be resolved. */ @Override public int checkUriPermission(Uri uri, int pid, int uid, final int modeFlags, int userId, IBinder callerToken) { enforceNotIsolatedCaller("checkUriPermission"); // Another redirected-binder-call permissions check as in // {@link checkPermissionWithToken}. Identity tlsIdentity = sCallerIdentity.get(); if (tlsIdentity != null && tlsIdentity.token == callerToken) { uid = tlsIdentity.uid; pid = tlsIdentity.pid; } // Our own process gets to do everything. if (pid == MY_PID) { return PackageManager.PERMISSION_GRANTED; } synchronized (this) { return checkUriPermissionLocked(new GrantUri(userId, uri, false), uid, modeFlags) ? PackageManager.PERMISSION_GRANTED : PackageManager.PERMISSION_DENIED; } } /** * Check if the targetPkg can be granted permission to access uri by * the callingUid using the given modeFlags. Throws a security exception * if callingUid is not allowed to do this. Returns the uid of the target * if the URI permission grant should be performed; returns -1 if it is not * needed (for example targetPkg already has permission to access the URI). * If you already know the uid of the target, you can supply it in * lastTargetUid else set that to -1. */ int checkGrantUriPermissionLocked(int callingUid, String targetPkg, GrantUri grantUri, final int modeFlags, int lastTargetUid) { if (!Intent.isAccessUriMode(modeFlags)) { return -1; } if (targetPkg != null) { if (DEBUG_URI_PERMISSION) Slog.v(TAG_URI_PERMISSION, "Checking grant " + targetPkg + " permission to " + grantUri); } final IPackageManager pm = AppGlobals.getPackageManager(); // If this is not a content: uri, we can't do anything with it. if (!ContentResolver.SCHEME_CONTENT.equals(grantUri.uri.getScheme())) { if (DEBUG_URI_PERMISSION) Slog.v(TAG_URI_PERMISSION, "Can't grant URI permission for non-content URI: " + grantUri); return -1; } // Bail early if system is trying to hand out permissions directly; it // must always grant permissions on behalf of someone explicit. final int callingAppId = UserHandle.getAppId(callingUid); if ((callingAppId == SYSTEM_UID) || (callingAppId == ROOT_UID)) { if ("com.android.settings.files".equals(grantUri.uri.getAuthority())) { // Exempted authority for cropping user photos in Settings app } else { Slog.w(TAG, "For security reasons, the system cannot issue a Uri permission" + " grant to " + grantUri + "; use startActivityAsCaller() instead"); return -1; } } final String authority = grantUri.uri.getAuthority(); final ProviderInfo pi = getProviderInfoLocked(authority, grantUri.sourceUserId, MATCH_DEBUG_TRIAGED_MISSING); if (pi == null) { Slog.w(TAG, "No content provider found for permission check: " + grantUri.uri.toSafeString()); return -1; } int targetUid = lastTargetUid; if (targetUid < 0 && targetPkg != null) { try { targetUid = pm.getPackageUid(targetPkg, MATCH_DEBUG_TRIAGED_MISSING, UserHandle.getUserId(callingUid)); if (targetUid < 0) { if (DEBUG_URI_PERMISSION) Slog.v(TAG_URI_PERMISSION, "Can't grant URI permission no uid for: " + targetPkg); return -1; } } catch (RemoteException ex) { return -1; } } // If we're extending a persistable grant, then we always need to create // the grant data structure so that take/release APIs work if ((modeFlags & Intent.FLAG_GRANT_PERSISTABLE_URI_PERMISSION) != 0) { return targetUid; } if (targetUid >= 0) { // First... does the target actually need this permission? if (checkHoldingPermissionsLocked(pm, pi, grantUri, targetUid, modeFlags)) { // No need to grant the target this permission. if (DEBUG_URI_PERMISSION) Slog.v(TAG_URI_PERMISSION, "Target " + targetPkg + " already has full permission to " + grantUri); return -1; } } else { // First... there is no target package, so can anyone access it? boolean allowed = pi.exported; if ((modeFlags&Intent.FLAG_GRANT_READ_URI_PERMISSION) != 0) { if (pi.readPermission != null) { allowed = false; } } if ((modeFlags&Intent.FLAG_GRANT_WRITE_URI_PERMISSION) != 0) { if (pi.writePermission != null) { allowed = false; } } if (allowed) { return -1; } } /* There is a special cross user grant if: * - The target is on another user. * - Apps on the current user can access the uri without any uid permissions. * In this case, we grant a uri permission, even if the ContentProvider does not normally * grant uri permissions. */ boolean specialCrossUserGrant = UserHandle.getUserId(targetUid) != grantUri.sourceUserId && checkHoldingPermissionsInternalLocked(pm, pi, grantUri, callingUid, modeFlags, false /*without considering the uid permissions*/); // Second... is the provider allowing granting of URI permissions? if (!specialCrossUserGrant) { if (!pi.grantUriPermissions) { throw new SecurityException("Provider " + pi.packageName + "/" + pi.name + " does not allow granting of Uri permissions (uri " + grantUri + ")"); } if (pi.uriPermissionPatterns != null) { final int N = pi.uriPermissionPatterns.length; boolean allowed = false; for (int i=0; i { final String targetPkg; final int targetUid; final int flags; NeededUriGrants(String targetPkg, int targetUid, int flags) { this.targetPkg = targetPkg; this.targetUid = targetUid; this.flags = flags; } } /** * Like checkGrantUriPermissionLocked, but takes an Intent. */ NeededUriGrants checkGrantUriPermissionFromIntentLocked(int callingUid, String targetPkg, Intent intent, int mode, NeededUriGrants needed, int targetUserId) { if (DEBUG_URI_PERMISSION) Slog.v(TAG_URI_PERMISSION, "Checking URI perm to data=" + (intent != null ? intent.getData() : null) + " clip=" + (intent != null ? intent.getClipData() : null) + " from " + intent + "; flags=0x" + Integer.toHexString(intent != null ? intent.getFlags() : 0)); if (targetPkg == null) { throw new NullPointerException("targetPkg"); } if (intent == null) { return null; } Uri data = intent.getData(); ClipData clip = intent.getClipData(); if (data == null && clip == null) { return null; } // Default userId for uris in the intent (if they don't specify it themselves) int contentUserHint = intent.getContentUserHint(); if (contentUserHint == UserHandle.USER_CURRENT) { contentUserHint = UserHandle.getUserId(callingUid); } final IPackageManager pm = AppGlobals.getPackageManager(); int targetUid; if (needed != null) { targetUid = needed.targetUid; } else { try { targetUid = pm.getPackageUid(targetPkg, MATCH_DEBUG_TRIAGED_MISSING, targetUserId); } catch (RemoteException ex) { return null; } if (targetUid < 0) { if (DEBUG_URI_PERMISSION) Slog.v(TAG_URI_PERMISSION, "Can't grant URI permission no uid for: " + targetPkg + " on user " + targetUserId); return null; } } if (data != null) { GrantUri grantUri = GrantUri.resolve(contentUserHint, data); targetUid = checkGrantUriPermissionLocked(callingUid, targetPkg, grantUri, mode, targetUid); if (targetUid > 0) { if (needed == null) { needed = new NeededUriGrants(targetPkg, targetUid, mode); } needed.add(grantUri); } } if (clip != null) { for (int i=0; i 0) { if (needed == null) { needed = new NeededUriGrants(targetPkg, targetUid, mode); } needed.add(grantUri); } } else { Intent clipIntent = clip.getItemAt(i).getIntent(); if (clipIntent != null) { NeededUriGrants newNeeded = checkGrantUriPermissionFromIntentLocked( callingUid, targetPkg, clipIntent, mode, needed, targetUserId); if (newNeeded != null) { needed = newNeeded; } } } } } return needed; } /** * Like grantUriPermissionUncheckedLocked, but takes an Intent. */ void grantUriPermissionUncheckedFromIntentLocked(NeededUriGrants needed, UriPermissionOwner owner) { if (needed != null) { for (int i=0; i perms = mGrantedUriPermissions.get( perm.targetUid); if (perms != null) { if (DEBUG_URI_PERMISSION) Slog.v(TAG_URI_PERMISSION, "Removing " + perm.targetUid + " permission to " + perm.uri); perms.remove(perm.uri); if (perms.isEmpty()) { mGrantedUriPermissions.remove(perm.targetUid); } } } } private void revokeUriPermissionLocked(String targetPackage, int callingUid, GrantUri grantUri, final int modeFlags) { if (DEBUG_URI_PERMISSION) Slog.v(TAG_URI_PERMISSION, "Revoking all granted permissions to " + grantUri); final IPackageManager pm = AppGlobals.getPackageManager(); final String authority = grantUri.uri.getAuthority(); final ProviderInfo pi = getProviderInfoLocked(authority, grantUri.sourceUserId, MATCH_DIRECT_BOOT_AWARE | MATCH_DIRECT_BOOT_UNAWARE); if (pi == null) { Slog.w(TAG, "No content provider found for permission revoke: " + grantUri.toSafeString()); return; } // Does the caller have this permission on the URI? if (!checkHoldingPermissionsLocked(pm, pi, grantUri, callingUid, modeFlags)) { // If they don't have direct access to the URI, then revoke any // ownerless URI permissions that have been granted to them. final ArrayMap perms = mGrantedUriPermissions.get(callingUid); if (perms != null) { boolean persistChanged = false; for (int i = perms.size()-1; i >= 0; i--) { final UriPermission perm = perms.valueAt(i); if (targetPackage != null && !targetPackage.equals(perm.targetPkg)) { continue; } if (perm.uri.sourceUserId == grantUri.sourceUserId && perm.uri.uri.isPathPrefixMatch(grantUri.uri)) { if (DEBUG_URI_PERMISSION) Slog.v(TAG_URI_PERMISSION, "Revoking non-owned " + perm.targetUid + " permission to " + perm.uri); persistChanged |= perm.revokeModes( modeFlags | Intent.FLAG_GRANT_PERSISTABLE_URI_PERMISSION, false); if (perm.modeFlags == 0) { perms.removeAt(i); } } } if (perms.isEmpty()) { mGrantedUriPermissions.remove(callingUid); } if (persistChanged) { schedulePersistUriGrants(); } } return; } boolean persistChanged = false; // Go through all of the permissions and remove any that match. for (int i = mGrantedUriPermissions.size()-1; i >= 0; i--) { final int targetUid = mGrantedUriPermissions.keyAt(i); final ArrayMap perms = mGrantedUriPermissions.valueAt(i); for (int j = perms.size()-1; j >= 0; j--) { final UriPermission perm = perms.valueAt(j); if (targetPackage != null && !targetPackage.equals(perm.targetPkg)) { continue; } if (perm.uri.sourceUserId == grantUri.sourceUserId && perm.uri.uri.isPathPrefixMatch(grantUri.uri)) { if (DEBUG_URI_PERMISSION) Slog.v(TAG_URI_PERMISSION, "Revoking " + perm.targetUid + " permission to " + perm.uri); persistChanged |= perm.revokeModes( modeFlags | Intent.FLAG_GRANT_PERSISTABLE_URI_PERMISSION, targetPackage == null); if (perm.modeFlags == 0) { perms.removeAt(j); } } } if (perms.isEmpty()) { mGrantedUriPermissions.removeAt(i); } } if (persistChanged) { schedulePersistUriGrants(); } } /** * @param uri This uri must NOT contain an embedded userId. * @param userId The userId in which the uri is to be resolved. */ @Override public void revokeUriPermission(IApplicationThread caller, String targetPackage, Uri uri, final int modeFlags, int userId) { enforceNotIsolatedCaller("revokeUriPermission"); synchronized(this) { final ProcessRecord r = getRecordForAppLocked(caller); if (r == null) { throw new SecurityException("Unable to find app for caller " + caller + " when revoking permission to uri " + uri); } if (uri == null) { Slog.w(TAG, "revokeUriPermission: null uri"); return; } if (!Intent.isAccessUriMode(modeFlags)) { return; } final String authority = uri.getAuthority(); final ProviderInfo pi = getProviderInfoLocked(authority, userId, MATCH_DIRECT_BOOT_AWARE | MATCH_DIRECT_BOOT_UNAWARE); if (pi == null) { Slog.w(TAG, "No content provider found for permission revoke: " + uri.toSafeString()); return; } revokeUriPermissionLocked(targetPackage, r.uid, new GrantUri(userId, uri, false), modeFlags); } } /** * Remove any {@link UriPermission} granted from or to the * given package. * * @param packageName Package name to match, or {@code null} to apply to all * packages. * @param userHandle User to match, or {@link UserHandle#USER_ALL} to apply * to all users. * @param persistable If persistable grants should be removed. */ private void removeUriPermissionsForPackageLocked( String packageName, int userHandle, boolean persistable) { if (userHandle == UserHandle.USER_ALL && packageName == null) { throw new IllegalArgumentException("Must narrow by either package or user"); } boolean persistChanged = false; int N = mGrantedUriPermissions.size(); for (int i = 0; i < N; i++) { final int targetUid = mGrantedUriPermissions.keyAt(i); final ArrayMap perms = mGrantedUriPermissions.valueAt(i); // Only inspect grants matching user if (userHandle == UserHandle.USER_ALL || userHandle == UserHandle.getUserId(targetUid)) { for (Iterator it = perms.values().iterator(); it.hasNext();) { final UriPermission perm = it.next(); // Only inspect grants matching package if (packageName == null || perm.sourcePkg.equals(packageName) || perm.targetPkg.equals(packageName)) { // Hacky solution as part of fixing a security bug; ignore // grants associated with DownloadManager so we don't have // to immediately launch it to regrant the permissions if (Downloads.Impl.AUTHORITY.equals(perm.uri.uri.getAuthority()) && !persistable) continue; persistChanged |= perm.revokeModes(persistable ? ~0 : ~Intent.FLAG_GRANT_PERSISTABLE_URI_PERMISSION, true); // Only remove when no modes remain; any persisted grants // will keep this alive. if (perm.modeFlags == 0) { it.remove(); } } } if (perms.isEmpty()) { mGrantedUriPermissions.remove(targetUid); N--; i--; } } } if (persistChanged) { schedulePersistUriGrants(); } } @Override public IBinder newUriPermissionOwner(String name) { enforceNotIsolatedCaller("newUriPermissionOwner"); synchronized(this) { UriPermissionOwner owner = new UriPermissionOwner(this, name); return owner.getExternalTokenLocked(); } } @Override public IBinder getUriPermissionOwnerForActivity(IBinder activityToken) { enforceNotIsolatedCaller("getUriPermissionOwnerForActivity"); synchronized(this) { ActivityRecord r = ActivityRecord.isInStackLocked(activityToken); if (r == null) { throw new IllegalArgumentException("Activity does not exist; token=" + activityToken); } return r.getUriPermissionsLocked().getExternalTokenLocked(); } } /** * @param uri This uri must NOT contain an embedded userId. * @param sourceUserId The userId in which the uri is to be resolved. * @param targetUserId The userId of the app that receives the grant. */ @Override public void grantUriPermissionFromOwner(IBinder token, int fromUid, String targetPkg, Uri uri, final int modeFlags, int sourceUserId, int targetUserId) { targetUserId = mUserController.handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(), targetUserId, false, ALLOW_FULL_ONLY, "grantUriPermissionFromOwner", null); synchronized(this) { UriPermissionOwner owner = UriPermissionOwner.fromExternalToken(token); if (owner == null) { throw new IllegalArgumentException("Unknown owner: " + token); } if (fromUid != Binder.getCallingUid()) { if (Binder.getCallingUid() != myUid()) { // Only system code can grant URI permissions on behalf // of other users. throw new SecurityException("nice try"); } } if (targetPkg == null) { throw new IllegalArgumentException("null target"); } if (uri == null) { throw new IllegalArgumentException("null uri"); } grantUriPermissionLocked(fromUid, targetPkg, new GrantUri(sourceUserId, uri, false), modeFlags, owner, targetUserId); } } /** * @param uri This uri must NOT contain an embedded userId. * @param userId The userId in which the uri is to be resolved. */ @Override public void revokeUriPermissionFromOwner(IBinder token, Uri uri, int mode, int userId) { synchronized(this) { UriPermissionOwner owner = UriPermissionOwner.fromExternalToken(token); if (owner == null) { throw new IllegalArgumentException("Unknown owner: " + token); } if (uri == null) { owner.removeUriPermissionsLocked(mode); } else { final boolean prefix = (mode & Intent.FLAG_GRANT_PREFIX_URI_PERMISSION) != 0; owner.removeUriPermissionLocked(new GrantUri(userId, uri, prefix), mode); } } } private void schedulePersistUriGrants() { if (!mHandler.hasMessages(PERSIST_URI_GRANTS_MSG)) { mHandler.sendMessageDelayed(mHandler.obtainMessage(PERSIST_URI_GRANTS_MSG), 10 * DateUtils.SECOND_IN_MILLIS); } } private void writeGrantedUriPermissions() { if (DEBUG_URI_PERMISSION) Slog.v(TAG_URI_PERMISSION, "writeGrantedUriPermissions()"); // Snapshot permissions so we can persist without lock ArrayList persist = Lists.newArrayList(); synchronized (this) { final int size = mGrantedUriPermissions.size(); for (int i = 0; i < size; i++) { final ArrayMap perms = mGrantedUriPermissions.valueAt(i); for (UriPermission perm : perms.values()) { if (perm.persistedModeFlags != 0) { persist.add(perm.snapshot()); } } } } FileOutputStream fos = null; try { fos = mGrantFile.startWrite(); XmlSerializer out = new FastXmlSerializer(); out.setOutput(fos, StandardCharsets.UTF_8.name()); out.startDocument(null, true); out.startTag(null, TAG_URI_GRANTS); for (UriPermission.Snapshot perm : persist) { out.startTag(null, TAG_URI_GRANT); writeIntAttribute(out, ATTR_SOURCE_USER_ID, perm.uri.sourceUserId); writeIntAttribute(out, ATTR_TARGET_USER_ID, perm.targetUserId); out.attribute(null, ATTR_SOURCE_PKG, perm.sourcePkg); out.attribute(null, ATTR_TARGET_PKG, perm.targetPkg); out.attribute(null, ATTR_URI, String.valueOf(perm.uri.uri)); writeBooleanAttribute(out, ATTR_PREFIX, perm.uri.prefix); writeIntAttribute(out, ATTR_MODE_FLAGS, perm.persistedModeFlags); writeLongAttribute(out, ATTR_CREATED_TIME, perm.persistedCreateTime); out.endTag(null, TAG_URI_GRANT); } out.endTag(null, TAG_URI_GRANTS); out.endDocument(); mGrantFile.finishWrite(fos); } catch (IOException e) { if (fos != null) { mGrantFile.failWrite(fos); } } } private void readGrantedUriPermissionsLocked() { if (DEBUG_URI_PERMISSION) Slog.v(TAG_URI_PERMISSION, "readGrantedUriPermissions()"); final long now = System.currentTimeMillis(); FileInputStream fis = null; try { fis = mGrantFile.openRead(); final XmlPullParser in = Xml.newPullParser(); in.setInput(fis, StandardCharsets.UTF_8.name()); int type; while ((type = in.next()) != END_DOCUMENT) { final String tag = in.getName(); if (type == START_TAG) { if (TAG_URI_GRANT.equals(tag)) { final int sourceUserId; final int targetUserId; final int userHandle = readIntAttribute(in, ATTR_USER_HANDLE, UserHandle.USER_NULL); if (userHandle != UserHandle.USER_NULL) { // For backwards compatibility. sourceUserId = userHandle; targetUserId = userHandle; } else { sourceUserId = readIntAttribute(in, ATTR_SOURCE_USER_ID); targetUserId = readIntAttribute(in, ATTR_TARGET_USER_ID); } final String sourcePkg = in.getAttributeValue(null, ATTR_SOURCE_PKG); final String targetPkg = in.getAttributeValue(null, ATTR_TARGET_PKG); final Uri uri = Uri.parse(in.getAttributeValue(null, ATTR_URI)); final boolean prefix = readBooleanAttribute(in, ATTR_PREFIX); final int modeFlags = readIntAttribute(in, ATTR_MODE_FLAGS); final long createdTime = readLongAttribute(in, ATTR_CREATED_TIME, now); // Sanity check that provider still belongs to source package // Both direct boot aware and unaware packages are fine as we // will do filtering at query time to avoid multiple parsing. final ProviderInfo pi = getProviderInfoLocked( uri.getAuthority(), sourceUserId, MATCH_DIRECT_BOOT_AWARE | MATCH_DIRECT_BOOT_UNAWARE); if (pi != null && sourcePkg.equals(pi.packageName)) { int targetUid = -1; try { targetUid = AppGlobals.getPackageManager().getPackageUid( targetPkg, MATCH_UNINSTALLED_PACKAGES, targetUserId); } catch (RemoteException e) { } if (targetUid != -1) { final UriPermission perm = findOrCreateUriPermissionLocked( sourcePkg, targetPkg, targetUid, new GrantUri(sourceUserId, uri, prefix)); perm.initPersistedModes(modeFlags, createdTime); } } else { Slog.w(TAG, "Persisted grant for " + uri + " had source " + sourcePkg + " but instead found " + pi); } } } } } catch (FileNotFoundException e) { // Missing grants is okay } catch (IOException e) { Slog.wtf(TAG, "Failed reading Uri grants", e); } catch (XmlPullParserException e) { Slog.wtf(TAG, "Failed reading Uri grants", e); } finally { IoUtils.closeQuietly(fis); } } /** * @param uri This uri must NOT contain an embedded userId. * @param userId The userId in which the uri is to be resolved. */ @Override public void takePersistableUriPermission(Uri uri, final int modeFlags, int userId) { enforceNotIsolatedCaller("takePersistableUriPermission"); Preconditions.checkFlagsArgument(modeFlags, Intent.FLAG_GRANT_READ_URI_PERMISSION | Intent.FLAG_GRANT_WRITE_URI_PERMISSION); synchronized (this) { final int callingUid = Binder.getCallingUid(); boolean persistChanged = false; GrantUri grantUri = new GrantUri(userId, uri, false); UriPermission exactPerm = findUriPermissionLocked(callingUid, new GrantUri(userId, uri, false)); UriPermission prefixPerm = findUriPermissionLocked(callingUid, new GrantUri(userId, uri, true)); final boolean exactValid = (exactPerm != null) && ((modeFlags & exactPerm.persistableModeFlags) == modeFlags); final boolean prefixValid = (prefixPerm != null) && ((modeFlags & prefixPerm.persistableModeFlags) == modeFlags); if (!(exactValid || prefixValid)) { throw new SecurityException("No persistable permission grants found for UID " + callingUid + " and Uri " + grantUri.toSafeString()); } if (exactValid) { persistChanged |= exactPerm.takePersistableModes(modeFlags); } if (prefixValid) { persistChanged |= prefixPerm.takePersistableModes(modeFlags); } persistChanged |= maybePrunePersistedUriGrantsLocked(callingUid); if (persistChanged) { schedulePersistUriGrants(); } } } /** * @param uri This uri must NOT contain an embedded userId. * @param userId The userId in which the uri is to be resolved. */ @Override public void releasePersistableUriPermission(Uri uri, final int modeFlags, int userId) { enforceNotIsolatedCaller("releasePersistableUriPermission"); Preconditions.checkFlagsArgument(modeFlags, Intent.FLAG_GRANT_READ_URI_PERMISSION | Intent.FLAG_GRANT_WRITE_URI_PERMISSION); synchronized (this) { final int callingUid = Binder.getCallingUid(); boolean persistChanged = false; UriPermission exactPerm = findUriPermissionLocked(callingUid, new GrantUri(userId, uri, false)); UriPermission prefixPerm = findUriPermissionLocked(callingUid, new GrantUri(userId, uri, true)); if (exactPerm == null && prefixPerm == null) { throw new SecurityException("No permission grants found for UID " + callingUid + " and Uri " + uri.toSafeString()); } if (exactPerm != null) { persistChanged |= exactPerm.releasePersistableModes(modeFlags); removeUriPermissionIfNeededLocked(exactPerm); } if (prefixPerm != null) { persistChanged |= prefixPerm.releasePersistableModes(modeFlags); removeUriPermissionIfNeededLocked(prefixPerm); } if (persistChanged) { schedulePersistUriGrants(); } } } /** * Prune any older {@link UriPermission} for the given UID until outstanding * persisted grants are below {@link #MAX_PERSISTED_URI_GRANTS}. * * @return if any mutations occured that require persisting. */ private boolean maybePrunePersistedUriGrantsLocked(int uid) { final ArrayMap perms = mGrantedUriPermissions.get(uid); if (perms == null) return false; if (perms.size() < MAX_PERSISTED_URI_GRANTS) return false; final ArrayList persisted = Lists.newArrayList(); for (UriPermission perm : perms.values()) { if (perm.persistedModeFlags != 0) { persisted.add(perm); } } final int trimCount = persisted.size() - MAX_PERSISTED_URI_GRANTS; if (trimCount <= 0) return false; Collections.sort(persisted, new UriPermission.PersistedTimeComparator()); for (int i = 0; i < trimCount; i++) { final UriPermission perm = persisted.get(i); if (DEBUG_URI_PERMISSION) Slog.v(TAG_URI_PERMISSION, "Trimming grant created at " + perm.persistedCreateTime); perm.releasePersistableModes(~0); removeUriPermissionIfNeededLocked(perm); } return true; } @Override public ParceledListSlice getPersistedUriPermissions( String packageName, boolean incoming) { enforceNotIsolatedCaller("getPersistedUriPermissions"); Preconditions.checkNotNull(packageName, "packageName"); final int callingUid = Binder.getCallingUid(); final int callingUserId = UserHandle.getUserId(callingUid); final IPackageManager pm = AppGlobals.getPackageManager(); try { final int packageUid = pm.getPackageUid(packageName, MATCH_DIRECT_BOOT_AWARE | MATCH_DIRECT_BOOT_UNAWARE, callingUserId); if (packageUid != callingUid) { throw new SecurityException( "Package " + packageName + " does not belong to calling UID " + callingUid); } } catch (RemoteException e) { throw new SecurityException("Failed to verify package name ownership"); } final ArrayList result = Lists.newArrayList(); synchronized (this) { if (incoming) { final ArrayMap perms = mGrantedUriPermissions.get( callingUid); if (perms == null) { Slog.w(TAG, "No permission grants found for " + packageName); } else { for (UriPermission perm : perms.values()) { if (packageName.equals(perm.targetPkg) && perm.persistedModeFlags != 0) { result.add(perm.buildPersistedPublicApiObject()); } } } } else { final int size = mGrantedUriPermissions.size(); for (int i = 0; i < size; i++) { final ArrayMap perms = mGrantedUriPermissions.valueAt(i); for (UriPermission perm : perms.values()) { if (packageName.equals(perm.sourcePkg) && perm.persistedModeFlags != 0) { result.add(perm.buildPersistedPublicApiObject()); } } } } } return new ParceledListSlice(result); } @Override public ParceledListSlice getGrantedUriPermissions( String packageName, int userId) { enforceCallingPermission(android.Manifest.permission.GET_APP_GRANTED_URI_PERMISSIONS, "getGrantedUriPermissions"); final ArrayList result = Lists.newArrayList(); synchronized (this) { final int size = mGrantedUriPermissions.size(); for (int i = 0; i < size; i++) { final ArrayMap perms = mGrantedUriPermissions.valueAt(i); for (UriPermission perm : perms.values()) { if (packageName.equals(perm.targetPkg) && perm.targetUserId == userId && perm.persistedModeFlags != 0) { result.add(perm.buildPersistedPublicApiObject()); } } } } return new ParceledListSlice(result); } @Override public void clearGrantedUriPermissions(String packageName, int userId) { enforceCallingPermission(android.Manifest.permission.CLEAR_APP_GRANTED_URI_PERMISSIONS, "clearGrantedUriPermissions"); removeUriPermissionsForPackageLocked(packageName, userId, true); } @Override public void showWaitingForDebugger(IApplicationThread who, boolean waiting) { synchronized (this) { ProcessRecord app = who != null ? getRecordForAppLocked(who) : null; if (app == null) return; Message msg = Message.obtain(); msg.what = WAIT_FOR_DEBUGGER_UI_MSG; msg.obj = app; msg.arg1 = waiting ? 1 : 0; mUiHandler.sendMessage(msg); } } @Override public void getMemoryInfo(ActivityManager.MemoryInfo outInfo) { final long homeAppMem = mProcessList.getMemLevel(ProcessList.HOME_APP_ADJ); final long cachedAppMem = mProcessList.getMemLevel(ProcessList.CACHED_APP_MIN_ADJ); outInfo.availMem = getFreeMemory(); outInfo.totalMem = getTotalMemory(); outInfo.threshold = homeAppMem; outInfo.lowMemory = outInfo.availMem < (homeAppMem + ((cachedAppMem-homeAppMem)/2)); outInfo.hiddenAppThreshold = cachedAppMem; outInfo.secondaryServerThreshold = mProcessList.getMemLevel( ProcessList.SERVICE_ADJ); outInfo.visibleAppThreshold = mProcessList.getMemLevel( ProcessList.VISIBLE_APP_ADJ); outInfo.foregroundAppThreshold = mProcessList.getMemLevel( ProcessList.FOREGROUND_APP_ADJ); } // ========================================================= // TASK MANAGEMENT // ========================================================= @Override public List getAppTasks(String callingPackage) { int callingUid = Binder.getCallingUid(); long ident = Binder.clearCallingIdentity(); try { synchronized(this) { return mRecentTasks.getAppTasksList(callingUid, callingPackage); } } finally { Binder.restoreCallingIdentity(ident); } } @Override public List getTasks(int maxNum) { return getFilteredTasks(maxNum, ACTIVITY_TYPE_UNDEFINED, WINDOWING_MODE_UNDEFINED); } @Override public List getFilteredTasks(int maxNum, @ActivityType int ignoreActivityType, @WindowingMode int ignoreWindowingMode) { final int callingUid = Binder.getCallingUid(); ArrayList list = new ArrayList<>(); synchronized(this) { if (DEBUG_ALL) Slog.v(TAG, "getTasks: max=" + maxNum); final boolean allowed = isGetTasksAllowed("getTasks", Binder.getCallingPid(), callingUid); mStackSupervisor.getRunningTasks(maxNum, list, ignoreActivityType, ignoreWindowingMode, callingUid, allowed); } return list; } private boolean isGetTasksAllowed(String caller, int callingPid, int callingUid) { if (mRecentTasks.isCallerRecents(callingUid)) { // Always allow the recents component to get tasks return true; } boolean allowed = checkPermission(android.Manifest.permission.REAL_GET_TASKS, callingPid, callingUid) == PackageManager.PERMISSION_GRANTED; if (!allowed) { if (checkPermission(android.Manifest.permission.GET_TASKS, callingPid, callingUid) == PackageManager.PERMISSION_GRANTED) { // Temporary compatibility: some existing apps on the system image may // still be requesting the old permission and not switched to the new // one; if so, we'll still allow them full access. This means we need // to see if they are holding the old permission and are a system app. try { if (AppGlobals.getPackageManager().isUidPrivileged(callingUid)) { allowed = true; if (DEBUG_TASKS) Slog.w(TAG, caller + ": caller " + callingUid + " is using old GET_TASKS but privileged; allowing"); } } catch (RemoteException e) { } } } if (!allowed) { if (DEBUG_TASKS) Slog.w(TAG, caller + ": caller " + callingUid + " does not hold REAL_GET_TASKS; limiting output"); } return allowed; } @Override public ParceledListSlice getRecentTasks(int maxNum, int flags, int userId) { final int callingUid = Binder.getCallingUid(); userId = mUserController.handleIncomingUser(Binder.getCallingPid(), callingUid, userId, false, ALLOW_FULL_ONLY, "getRecentTasks", null); final boolean allowed = isGetTasksAllowed("getRecentTasks", Binder.getCallingPid(), callingUid); final boolean detailed = checkCallingPermission( android.Manifest.permission.GET_DETAILED_TASKS) == PackageManager.PERMISSION_GRANTED; synchronized (this) { return mRecentTasks.getRecentTasks(maxNum, flags, allowed, detailed, userId, callingUid); } } @Override public ActivityManager.TaskDescription getTaskDescription(int id) { synchronized (this) { enforceCallerIsRecentsOrHasPermission(MANAGE_ACTIVITY_STACKS, "getTaskDescription()"); final TaskRecord tr = mStackSupervisor.anyTaskForIdLocked(id, MATCH_TASK_IN_STACKS_OR_RECENT_TASKS); if (tr != null) { return tr.lastTaskDescription; } } return null; } @Override public int addAppTask(IBinder activityToken, Intent intent, ActivityManager.TaskDescription description, Bitmap thumbnail) throws RemoteException { final int callingUid = Binder.getCallingUid(); final long callingIdent = Binder.clearCallingIdentity(); try { synchronized (this) { ActivityRecord r = ActivityRecord.isInStackLocked(activityToken); if (r == null) { throw new IllegalArgumentException("Activity does not exist; token=" + activityToken); } ComponentName comp = intent.getComponent(); if (comp == null) { throw new IllegalArgumentException("Intent " + intent + " must specify explicit component"); } if (thumbnail.getWidth() != mThumbnailWidth || thumbnail.getHeight() != mThumbnailHeight) { throw new IllegalArgumentException("Bad thumbnail size: got " + thumbnail.getWidth() + "x" + thumbnail.getHeight() + ", require " + mThumbnailWidth + "x" + mThumbnailHeight); } if (intent.getSelector() != null) { intent.setSelector(null); } if (intent.getSourceBounds() != null) { intent.setSourceBounds(null); } if ((intent.getFlags()&Intent.FLAG_ACTIVITY_NEW_DOCUMENT) != 0) { if ((intent.getFlags()&Intent.FLAG_ACTIVITY_RETAIN_IN_RECENTS) == 0) { // The caller has added this as an auto-remove task... that makes no // sense, so turn off auto-remove. intent.addFlags(Intent.FLAG_ACTIVITY_RETAIN_IN_RECENTS); } } if (!comp.equals(mLastAddedTaskComponent) || callingUid != mLastAddedTaskUid) { mLastAddedTaskActivity = null; } ActivityInfo ainfo = mLastAddedTaskActivity; if (ainfo == null) { ainfo = mLastAddedTaskActivity = AppGlobals.getPackageManager().getActivityInfo( comp, 0, UserHandle.getUserId(callingUid)); if (ainfo.applicationInfo.uid != callingUid) { throw new SecurityException( "Can't add task for another application: target uid=" + ainfo.applicationInfo.uid + ", calling uid=" + callingUid); } } TaskRecord task = new TaskRecord(this, mStackSupervisor.getNextTaskIdForUserLocked(r.userId), ainfo, intent, description); if (!mRecentTasks.addToBottom(task)) { return INVALID_TASK_ID; } r.getStack().addTask(task, !ON_TOP, "addAppTask"); // TODO: Send the thumbnail to WM to store it. return task.taskId; } } finally { Binder.restoreCallingIdentity(callingIdent); } } @Override public Point getAppTaskThumbnailSize() { synchronized (this) { return new Point(mThumbnailWidth, mThumbnailHeight); } } @Override public void setTaskDescription(IBinder token, ActivityManager.TaskDescription td) { synchronized (this) { ActivityRecord r = ActivityRecord.isInStackLocked(token); if (r != null) { r.setTaskDescription(td); final TaskRecord task = r.getTask(); task.updateTaskDescription(); mTaskChangeNotificationController.notifyTaskDescriptionChanged(task.taskId, td); } } } @Override public void setTaskResizeable(int taskId, int resizeableMode) { synchronized (this) { final TaskRecord task = mStackSupervisor.anyTaskForIdLocked( taskId, MATCH_TASK_IN_STACKS_OR_RECENT_TASKS); if (task == null) { Slog.w(TAG, "setTaskResizeable: taskId=" + taskId + " not found"); return; } task.setResizeMode(resizeableMode); } } @Override public void resizeTask(int taskId, Rect bounds, int resizeMode) { enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "resizeTask()"); long ident = Binder.clearCallingIdentity(); try { synchronized (this) { TaskRecord task = mStackSupervisor.anyTaskForIdLocked(taskId); if (task == null) { Slog.w(TAG, "resizeTask: taskId=" + taskId + " not found"); return; } // Place the task in the right stack if it isn't there already based on // the requested bounds. // The stack transition logic is: // - a null bounds on a freeform task moves that task to fullscreen // - a non-null bounds on a non-freeform (fullscreen OR docked) task moves // that task to freeform // - otherwise the task is not moved ActivityStack stack = task.getStack(); if (!task.getWindowConfiguration().canResizeTask()) { throw new IllegalArgumentException("resizeTask not allowed on task=" + task); } if (bounds == null && stack.getWindowingMode() == WINDOWING_MODE_FREEFORM) { stack = stack.getDisplay().getOrCreateStack( WINDOWING_MODE_FULLSCREEN, stack.getActivityType(), ON_TOP); } else if (bounds != null && stack.getWindowingMode() != WINDOWING_MODE_FREEFORM) { stack = stack.getDisplay().getOrCreateStack( WINDOWING_MODE_FREEFORM, stack.getActivityType(), ON_TOP); } // Reparent the task to the right stack if necessary boolean preserveWindow = (resizeMode & RESIZE_MODE_PRESERVE_WINDOW) != 0; if (stack != task.getStack()) { // Defer resume until the task is resized below task.reparent(stack, ON_TOP, REPARENT_KEEP_STACK_AT_FRONT, ANIMATE, DEFER_RESUME, "resizeTask"); preserveWindow = false; } // After reparenting (which only resizes the task to the stack bounds), resize the // task to the actual bounds provided task.resize(bounds, resizeMode, preserveWindow, !DEFER_RESUME); } } finally { Binder.restoreCallingIdentity(ident); } } @Override public Rect getTaskBounds(int taskId) { enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "getTaskBounds()"); long ident = Binder.clearCallingIdentity(); Rect rect = new Rect(); try { synchronized (this) { final TaskRecord task = mStackSupervisor.anyTaskForIdLocked(taskId, MATCH_TASK_IN_STACKS_OR_RECENT_TASKS); if (task == null) { Slog.w(TAG, "getTaskBounds: taskId=" + taskId + " not found"); return rect; } if (task.getStack() != null) { // Return the bounds from window manager since it will be adjusted for various // things like the presense of a docked stack for tasks that aren't resizeable. task.getWindowContainerBounds(rect); } else { // Task isn't in window manager yet since it isn't associated with a stack. // Return the persist value from activity manager if (task.mBounds != null) { rect.set(task.mBounds); } else if (task.mLastNonFullscreenBounds != null) { rect.set(task.mLastNonFullscreenBounds); } } } } finally { Binder.restoreCallingIdentity(ident); } return rect; } @Override public void cancelTaskWindowTransition(int taskId) { enforceCallerIsRecentsOrHasPermission(MANAGE_ACTIVITY_STACKS, "cancelTaskWindowTransition()"); final long ident = Binder.clearCallingIdentity(); try { synchronized (this) { final TaskRecord task = mStackSupervisor.anyTaskForIdLocked(taskId, MATCH_TASK_IN_STACKS_ONLY); if (task == null) { Slog.w(TAG, "cancelTaskWindowTransition: taskId=" + taskId + " not found"); return; } task.cancelWindowTransition(); } } finally { Binder.restoreCallingIdentity(ident); } } @Override public void cancelTaskThumbnailTransition(int taskId) { enforceCallerIsRecentsOrHasPermission(MANAGE_ACTIVITY_STACKS, "cancelTaskThumbnailTransition()"); final long ident = Binder.clearCallingIdentity(); try { synchronized (this) { final TaskRecord task = mStackSupervisor.anyTaskForIdLocked(taskId, MATCH_TASK_IN_STACKS_ONLY); if (task == null) { Slog.w(TAG, "cancelTaskThumbnailTransition: taskId=" + taskId + " not found"); return; } task.cancelThumbnailTransition(); } } finally { Binder.restoreCallingIdentity(ident); } } @Override public TaskSnapshot getTaskSnapshot(int taskId, boolean reducedResolution) { enforceCallerIsRecentsOrHasPermission(READ_FRAME_BUFFER, "getTaskSnapshot()"); final long ident = Binder.clearCallingIdentity(); try { final TaskRecord task; synchronized (this) { task = mStackSupervisor.anyTaskForIdLocked(taskId, MATCH_TASK_IN_STACKS_OR_RECENT_TASKS); if (task == null) { Slog.w(TAG, "getTaskSnapshot: taskId=" + taskId + " not found"); return null; } } // Don't call this while holding the lock as this operation might hit the disk. return task.getSnapshot(reducedResolution); } finally { Binder.restoreCallingIdentity(ident); } } @Override public Bitmap getTaskDescriptionIcon(String filePath, int userId) { if (userId != UserHandle.getCallingUserId()) { enforceCallingPermission(android.Manifest.permission.INTERACT_ACROSS_USERS_FULL, "getTaskDescriptionIcon"); } final File passedIconFile = new File(filePath); final File legitIconFile = new File(TaskPersister.getUserImagesDir(userId), passedIconFile.getName()); if (!legitIconFile.getPath().equals(filePath) || !filePath.contains(ActivityRecord.ACTIVITY_ICON_SUFFIX)) { throw new IllegalArgumentException("Bad file path: " + filePath + " passed for userId " + userId); } return mRecentTasks.getTaskDescriptionIcon(filePath); } @Override public void startInPlaceAnimationOnFrontMostApplication(Bundle opts) throws RemoteException { final ActivityOptions activityOptions = ActivityOptions.fromBundle(opts); if (activityOptions.getAnimationType() != ActivityOptions.ANIM_CUSTOM_IN_PLACE || activityOptions.getCustomInPlaceResId() == 0) { throw new IllegalArgumentException("Expected in-place ActivityOption " + "with valid animation"); } mWindowManager.prepareAppTransition(TRANSIT_TASK_IN_PLACE, false); mWindowManager.overridePendingAppTransitionInPlace(activityOptions.getPackageName(), activityOptions.getCustomInPlaceResId()); mWindowManager.executeAppTransition(); } @Override public void removeStack(int stackId) { enforceCallerIsRecentsOrHasPermission(MANAGE_ACTIVITY_STACKS, "removeStack()"); synchronized (this) { final long ident = Binder.clearCallingIdentity(); try { final ActivityStack stack = mStackSupervisor.getStack(stackId); if (stack == null) { Slog.w(TAG, "removeStack: No stack with id=" + stackId); return; } if (!stack.isActivityTypeStandardOrUndefined()) { throw new IllegalArgumentException( "Removing non-standard stack is not allowed."); } mStackSupervisor.removeStack(stack); } finally { Binder.restoreCallingIdentity(ident); } } } /** * Removes stacks in the input windowing modes from the system if they are of activity type * ACTIVITY_TYPE_STANDARD or ACTIVITY_TYPE_UNDEFINED */ @Override public void removeStacksInWindowingModes(int[] windowingModes) { enforceCallerIsRecentsOrHasPermission(MANAGE_ACTIVITY_STACKS, "removeStacksInWindowingModes()"); synchronized (this) { final long ident = Binder.clearCallingIdentity(); try { mStackSupervisor.removeStacksInWindowingModes(windowingModes); } finally { Binder.restoreCallingIdentity(ident); } } } @Override public void removeStacksWithActivityTypes(int[] activityTypes) { enforceCallerIsRecentsOrHasPermission(MANAGE_ACTIVITY_STACKS, "removeStacksWithActivityTypes()"); synchronized (this) { final long ident = Binder.clearCallingIdentity(); try { mStackSupervisor.removeStacksWithActivityTypes(activityTypes); } finally { Binder.restoreCallingIdentity(ident); } } } @Override public void moveStackToDisplay(int stackId, int displayId) { enforceCallingPermission(INTERNAL_SYSTEM_WINDOW, "moveStackToDisplay()"); synchronized (this) { final long ident = Binder.clearCallingIdentity(); try { if (DEBUG_STACK) Slog.d(TAG_STACK, "moveStackToDisplay: moving stackId=" + stackId + " to displayId=" + displayId); mStackSupervisor.moveStackToDisplayLocked(stackId, displayId, ON_TOP); } finally { Binder.restoreCallingIdentity(ident); } } } @Override public boolean removeTask(int taskId) { enforceCallerIsRecentsOrHasPermission(REMOVE_TASKS, "removeTask()"); synchronized (this) { final long ident = Binder.clearCallingIdentity(); try { return mStackSupervisor.removeTaskByIdLocked(taskId, true, REMOVE_FROM_RECENTS); } finally { Binder.restoreCallingIdentity(ident); } } } /** * TODO: Add mController hook */ @Override public void moveTaskToFront(int taskId, int flags, Bundle bOptions) { enforceCallingPermission(android.Manifest.permission.REORDER_TASKS, "moveTaskToFront()"); if (DEBUG_STACK) Slog.d(TAG_STACK, "moveTaskToFront: moving taskId=" + taskId); synchronized(this) { moveTaskToFrontLocked(taskId, flags, bOptions, false /* fromRecents */); } } void moveTaskToFrontLocked(int taskId, int flags, Bundle bOptions, boolean fromRecents) { ActivityOptions options = ActivityOptions.fromBundle(bOptions); if (!checkAppSwitchAllowedLocked(Binder.getCallingPid(), Binder.getCallingUid(), -1, -1, "Task to front")) { ActivityOptions.abort(options); return; } final long origId = Binder.clearCallingIdentity(); try { final TaskRecord task = mStackSupervisor.anyTaskForIdLocked(taskId); if (task == null) { Slog.d(TAG, "Could not find task for id: "+ taskId); return; } if (mLockTaskController.isLockTaskModeViolation(task)) { Slog.e(TAG, "moveTaskToFront: Attempt to violate Lock Task Mode"); return; } mStackSupervisor.findTaskToMoveToFront(task, flags, options, "moveTaskToFront", false /* forceNonResizable */); final ActivityRecord topActivity = task.getTopActivity(); if (topActivity != null) { // We are reshowing a task, use a starting window to hide the initial draw delay // so the transition can start earlier. topActivity.showStartingWindow(null /* prev */, false /* newTask */, true /* taskSwitch */, fromRecents); } } finally { Binder.restoreCallingIdentity(origId); } ActivityOptions.abort(options); } /** * Attempts to move a task backwards in z-order (the order of activities within the task is * unchanged). * * There are several possible results of this call: * - if the task is locked, then we will show the lock toast * - if there is a task behind the provided task, then that task is made visible and resumed as * this task is moved to the back * - otherwise, if there are no other tasks in the stack: * - if this task is in the pinned stack, then we remove the stack completely, which will * have the effect of moving the task to the top or bottom of the fullscreen stack * (depending on whether it is visible) * - otherwise, we simply return home and hide this task * * @param token A reference to the activity we wish to move * @param nonRoot If false then this only works if the activity is the root * of a task; if true it will work for any activity in a task. * @return Returns true if the move completed, false if not. */ @Override public boolean moveActivityTaskToBack(IBinder token, boolean nonRoot) { enforceNotIsolatedCaller("moveActivityTaskToBack"); synchronized(this) { final long origId = Binder.clearCallingIdentity(); try { int taskId = ActivityRecord.getTaskForActivityLocked(token, !nonRoot); final TaskRecord task = mStackSupervisor.anyTaskForIdLocked(taskId); if (task != null) { return ActivityRecord.getStackLocked(token).moveTaskToBackLocked(taskId); } } finally { Binder.restoreCallingIdentity(origId); } } return false; } @Override public void moveTaskBackwards(int task) { enforceCallingPermission(android.Manifest.permission.REORDER_TASKS, "moveTaskBackwards()"); synchronized(this) { if (!checkAppSwitchAllowedLocked(Binder.getCallingPid(), Binder.getCallingUid(), -1, -1, "Task backwards")) { return; } final long origId = Binder.clearCallingIdentity(); moveTaskBackwardsLocked(task); Binder.restoreCallingIdentity(origId); } } private final void moveTaskBackwardsLocked(int task) { Slog.e(TAG, "moveTaskBackwards not yet implemented!"); } @Override public int createStackOnDisplay(int displayId) throws RemoteException { enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "createStackOnDisplay()"); synchronized (this) { final ActivityDisplay display = mStackSupervisor.getActivityDisplayOrCreateLocked(displayId); if (display == null) { return INVALID_STACK_ID; } // TODO(multi-display): Have the caller pass in the windowing mode and activity type. final ActivityStack stack = display.createStack( WINDOWING_MODE_FULLSCREEN_OR_SPLIT_SCREEN_SECONDARY, ACTIVITY_TYPE_STANDARD, ON_TOP); return (stack != null) ? stack.mStackId : INVALID_STACK_ID; } } @Override public int getActivityDisplayId(IBinder activityToken) throws RemoteException { synchronized (this) { final ActivityStack stack = ActivityRecord.getStackLocked(activityToken); if (stack != null && stack.mDisplayId != INVALID_DISPLAY) { return stack.mDisplayId; } return DEFAULT_DISPLAY; } } @Override public void exitFreeformMode(IBinder token) throws RemoteException { synchronized (this) { long ident = Binder.clearCallingIdentity(); try { final ActivityRecord r = ActivityRecord.forTokenLocked(token); if (r == null) { throw new IllegalArgumentException( "exitFreeformMode: No activity record matching token=" + token); } final ActivityStack stack = r.getStack(); if (stack == null || !stack.inFreeformWindowingMode()) { throw new IllegalStateException( "exitFreeformMode: You can only go fullscreen from freeform."); } final ActivityStack fullscreenStack = stack.getDisplay().getOrCreateStack( WINDOWING_MODE_FULLSCREEN, stack.getActivityType(), ON_TOP); if (DEBUG_STACK) Slog.d(TAG_STACK, "exitFreeformMode: " + r); // TODO: Should just change windowing mode vs. re-parenting... r.getTask().reparent(fullscreenStack, ON_TOP, REPARENT_KEEP_STACK_AT_FRONT, ANIMATE, !DEFER_RESUME, "exitFreeformMode"); } finally { Binder.restoreCallingIdentity(ident); } } } @Override public void setTaskWindowingMode(int taskId, int windowingMode, boolean toTop) { enforceCallerIsRecentsOrHasPermission(MANAGE_ACTIVITY_STACKS, "setTaskWindowingMode()"); synchronized (this) { final long ident = Binder.clearCallingIdentity(); try { final TaskRecord task = mStackSupervisor.anyTaskForIdLocked(taskId); if (task == null) { Slog.w(TAG, "setTaskWindowingMode: No task for id=" + taskId); return; } if (DEBUG_STACK) Slog.d(TAG_STACK, "setTaskWindowingMode: moving task=" + taskId + " to windowingMode=" + windowingMode + " toTop=" + toTop); if (windowingMode == WINDOWING_MODE_SPLIT_SCREEN_PRIMARY) { mWindowManager.setDockedStackCreateState(DOCKED_STACK_CREATE_MODE_TOP_OR_LEFT, null /* initialBounds */); } if (!task.isActivityTypeStandardOrUndefined()) { throw new IllegalArgumentException("setTaskWindowingMode: Attempt to move task " + taskId + " to non-standard windowin mode=" + windowingMode); } final ActivityDisplay display = task.getStack().getDisplay(); final ActivityStack stack = display.getOrCreateStack(windowingMode, task.getStack().getActivityType(), toTop); // TODO: We should just change the windowing mode for the task vs. creating and // moving it to a stack. task.reparent(stack, toTop, REPARENT_KEEP_STACK_AT_FRONT, ANIMATE, !DEFER_RESUME, "moveTaskToStack"); } finally { Binder.restoreCallingIdentity(ident); } } } @Override public void moveTaskToStack(int taskId, int stackId, boolean toTop) { enforceCallerIsRecentsOrHasPermission(MANAGE_ACTIVITY_STACKS, "moveTaskToStack()"); synchronized (this) { long ident = Binder.clearCallingIdentity(); try { final TaskRecord task = mStackSupervisor.anyTaskForIdLocked(taskId); if (task == null) { Slog.w(TAG, "moveTaskToStack: No task for id=" + taskId); return; } if (DEBUG_STACK) Slog.d(TAG_STACK, "moveTaskToStack: moving task=" + taskId + " to stackId=" + stackId + " toTop=" + toTop); final ActivityStack stack = mStackSupervisor.getStack(stackId); if (stack == null) { throw new IllegalStateException( "moveTaskToStack: No stack for stackId=" + stackId); } if (!stack.isActivityTypeStandardOrUndefined()) { throw new IllegalArgumentException("moveTaskToStack: Attempt to move task " + taskId + " to stack " + stackId); } if (stack.inSplitScreenPrimaryWindowingMode()) { mWindowManager.setDockedStackCreateState( DOCKED_STACK_CREATE_MODE_TOP_OR_LEFT, null /* initialBounds */); } task.reparent(stack, toTop, REPARENT_KEEP_STACK_AT_FRONT, ANIMATE, !DEFER_RESUME, "moveTaskToStack"); } finally { Binder.restoreCallingIdentity(ident); } } } /** * Moves the input task to the docked stack. * * @param taskId Id of task to move. * @param createMode The mode the docked stack should be created in if it doesn't exist * already. See * {@link android.app.ActivityManager#DOCKED_STACK_CREATE_MODE_TOP_OR_LEFT} * and * {@link android.app.ActivityManager#DOCKED_STACK_CREATE_MODE_BOTTOM_OR_RIGHT} * @param toTop If the task and stack should be moved to the top. * @param animate Whether we should play an animation for the moving the task * @param initialBounds If the docked stack gets created, it will use these bounds for the * docked stack. Pass {@code null} to use default bounds. */ @Override public boolean moveTaskToDockedStack(int taskId, int createMode, boolean toTop, boolean animate, Rect initialBounds) { enforceCallerIsRecentsOrHasPermission(MANAGE_ACTIVITY_STACKS, "moveTaskToDockedStack()"); synchronized (this) { long ident = Binder.clearCallingIdentity(); try { final TaskRecord task = mStackSupervisor.anyTaskForIdLocked(taskId); if (task == null) { Slog.w(TAG, "moveTaskToDockedStack: No task for id=" + taskId); return false; } if (DEBUG_STACK) Slog.d(TAG_STACK, "moveTaskToDockedStack: moving task=" + taskId + " to createMode=" + createMode + " toTop=" + toTop); mWindowManager.setDockedStackCreateState(createMode, initialBounds); final ActivityDisplay display = task.getStack().getDisplay(); final ActivityStack stack = display.getOrCreateStack( WINDOWING_MODE_SPLIT_SCREEN_PRIMARY, task.getStack().getActivityType(), toTop); // Defer resuming until we move the home stack to the front below // TODO: Should just change windowing mode vs. re-parenting... final boolean moved = task.reparent(stack, toTop, REPARENT_KEEP_STACK_AT_FRONT, animate, !DEFER_RESUME, "moveTaskToDockedStack"); if (moved) { mStackSupervisor.ensureActivitiesVisibleLocked(null, 0, !PRESERVE_WINDOWS); } return moved; } finally { Binder.restoreCallingIdentity(ident); } } } /** * Dismisses split-screen multi-window mode. * @param toTop If true the current primary split-screen stack will be placed or left on top. */ @Override public void dismissSplitScreenMode(boolean toTop) { enforceCallerIsRecentsOrHasPermission(MANAGE_ACTIVITY_STACKS, "dismissSplitScreenMode()"); final long ident = Binder.clearCallingIdentity(); try { synchronized (this) { final ActivityStack stack = mStackSupervisor.getDefaultDisplay().getSplitScreenPrimaryStack(); if (stack == null) { Slog.w(TAG, "dismissSplitScreenMode: primary split-screen stack not found."); return; } if (toTop) { mStackSupervisor.resizeStackLocked(stack, null /* destBounds */, null /* tempTaskBounds */, null /* tempTaskInsetBounds */, true /* preserveWindows */, true /* allowResizeInDockedMode */, !DEFER_RESUME); } else { mStackSupervisor.moveTasksToFullscreenStackLocked(stack, false /* onTop */); } } } finally { Binder.restoreCallingIdentity(ident); } } /** * Dismisses Pip * @param animate True if the dismissal should be animated. * @param animationDuration The duration of the resize animation in milliseconds or -1 if the * default animation duration should be used. */ @Override public void dismissPip(boolean animate, int animationDuration) { enforceCallerIsRecentsOrHasPermission(MANAGE_ACTIVITY_STACKS, "dismissPip()"); final long ident = Binder.clearCallingIdentity(); try { synchronized (this) { final PinnedActivityStack stack = mStackSupervisor.getDefaultDisplay().getPinnedStack(); if (stack == null) { Slog.w(TAG, "dismissPip: pinned stack not found."); return; } if (stack.getWindowingMode() != WINDOWING_MODE_PINNED) { throw new IllegalArgumentException("Stack: " + stack + " doesn't support animated resize."); } if (animate) { stack.animateResizePinnedStack(null /* sourceHintBounds */, null /* destBounds */, animationDuration, false /* fromFullscreen */); } else { mStackSupervisor.moveTasksToFullscreenStackLocked(stack, true /* onTop */); } } } finally { Binder.restoreCallingIdentity(ident); } } /** * Moves the top activity in the input stackId to the pinned stack. * * @param stackId Id of stack to move the top activity to pinned stack. * @param bounds Bounds to use for pinned stack. * * @return True if the top activity of the input stack was successfully moved to the pinned * stack. */ @Override public boolean moveTopActivityToPinnedStack(int stackId, Rect bounds) { enforceCallerIsRecentsOrHasPermission(MANAGE_ACTIVITY_STACKS, "moveTopActivityToPinnedStack()"); synchronized (this) { if (!mSupportsPictureInPicture) { throw new IllegalStateException("moveTopActivityToPinnedStack:" + "Device doesn't support picture-in-picture mode"); } long ident = Binder.clearCallingIdentity(); try { return mStackSupervisor.moveTopStackActivityToPinnedStackLocked(stackId, bounds); } finally { Binder.restoreCallingIdentity(ident); } } } @Override public void resizeStack(int stackId, Rect destBounds, boolean allowResizeInDockedMode, boolean preserveWindows, boolean animate, int animationDuration) { enforceCallerIsRecentsOrHasPermission(MANAGE_ACTIVITY_STACKS, "resizeStack()"); long ident = Binder.clearCallingIdentity(); try { synchronized (this) { if (animate) { final PinnedActivityStack stack = mStackSupervisor.getStack(stackId); if (stack == null) { Slog.w(TAG, "resizeStack: stackId " + stackId + " not found."); return; } if (stack.getWindowingMode() != WINDOWING_MODE_PINNED) { throw new IllegalArgumentException("Stack: " + stackId + " doesn't support animated resize."); } stack.animateResizePinnedStack(null /* sourceHintBounds */, destBounds, animationDuration, false /* fromFullscreen */); } else { final ActivityStack stack = mStackSupervisor.getStack(stackId); if (stack == null) { Slog.w(TAG, "resizeStack: stackId " + stackId + " not found."); return; } mStackSupervisor.resizeStackLocked(stack, destBounds, null /* tempTaskBounds */, null /* tempTaskInsetBounds */, preserveWindows, allowResizeInDockedMode, !DEFER_RESUME); } } } finally { Binder.restoreCallingIdentity(ident); } } @Override public void resizeDockedStack(Rect dockedBounds, Rect tempDockedTaskBounds, Rect tempDockedTaskInsetBounds, Rect tempOtherTaskBounds, Rect tempOtherTaskInsetBounds) { enforceCallerIsRecentsOrHasPermission(MANAGE_ACTIVITY_STACKS, "resizeDockedStack()"); long ident = Binder.clearCallingIdentity(); try { synchronized (this) { mStackSupervisor.resizeDockedStackLocked(dockedBounds, tempDockedTaskBounds, tempDockedTaskInsetBounds, tempOtherTaskBounds, tempOtherTaskInsetBounds, PRESERVE_WINDOWS); } } finally { Binder.restoreCallingIdentity(ident); } } @Override public void resizePinnedStack(Rect pinnedBounds, Rect tempPinnedTaskBounds) { enforceCallerIsRecentsOrHasPermission(MANAGE_ACTIVITY_STACKS, "resizePinnedStack()"); final long ident = Binder.clearCallingIdentity(); try { synchronized (this) { mStackSupervisor.resizePinnedStackLocked(pinnedBounds, tempPinnedTaskBounds); } } finally { Binder.restoreCallingIdentity(ident); } } /** * Try to place task to provided position. The final position might be different depending on * current user and stacks state. The task will be moved to target stack if it's currently in * different stack. */ @Override public void positionTaskInStack(int taskId, int stackId, int position) { enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "positionTaskInStack()"); synchronized (this) { long ident = Binder.clearCallingIdentity(); try { if (DEBUG_STACK) Slog.d(TAG_STACK, "positionTaskInStack: positioning task=" + taskId + " in stackId=" + stackId + " at position=" + position); final TaskRecord task = mStackSupervisor.anyTaskForIdLocked(taskId); if (task == null) { throw new IllegalArgumentException("positionTaskInStack: no task for id=" + taskId); } final ActivityStack stack = mStackSupervisor.getStack(stackId); if (stack == null) { throw new IllegalArgumentException("positionTaskInStack: no stack for id=" + stackId); } if (!stack.isActivityTypeStandardOrUndefined()) { throw new IllegalArgumentException("positionTaskInStack: Attempt to change" + " the position of task " + taskId + " in/to non-standard stack"); } // TODO: Have the callers of this API call a separate reparent method if that is // what they intended to do vs. having this method also do reparenting. if (task.getStack() == stack) { // Change position in current stack. stack.positionChildAt(task, position); } else { // Reparent to new stack. task.reparent(stack, position, REPARENT_LEAVE_STACK_IN_PLACE, !ANIMATE, !DEFER_RESUME, "positionTaskInStack"); } } finally { Binder.restoreCallingIdentity(ident); } } } @Override public List getAllStackInfos() { enforceCallerIsRecentsOrHasPermission(MANAGE_ACTIVITY_STACKS, "getAllStackInfos()"); long ident = Binder.clearCallingIdentity(); try { synchronized (this) { return mStackSupervisor.getAllStackInfosLocked(); } } finally { Binder.restoreCallingIdentity(ident); } } @Override public StackInfo getStackInfo(int windowingMode, int activityType) { enforceCallerIsRecentsOrHasPermission(MANAGE_ACTIVITY_STACKS, "getStackInfo()"); long ident = Binder.clearCallingIdentity(); try { synchronized (this) { return mStackSupervisor.getStackInfo(windowingMode, activityType); } } finally { Binder.restoreCallingIdentity(ident); } } @Override public int getTaskForActivity(IBinder token, boolean onlyRoot) { synchronized(this) { return ActivityRecord.getTaskForActivityLocked(token, onlyRoot); } } @Override public void updateDeviceOwner(String packageName) { final int callingUid = Binder.getCallingUid(); if (callingUid != 0 && callingUid != SYSTEM_UID) { throw new SecurityException("updateDeviceOwner called from non-system process"); } synchronized (this) { mDeviceOwnerName = packageName; } } @Override public void updateLockTaskPackages(int userId, String[] packages) { final int callingUid = Binder.getCallingUid(); if (callingUid != 0 && callingUid != SYSTEM_UID) { enforceCallingPermission(android.Manifest.permission.UPDATE_LOCK_TASK_PACKAGES, "updateLockTaskPackages()"); } synchronized (this) { if (DEBUG_LOCKTASK) Slog.w(TAG_LOCKTASK, "Whitelisting " + userId + ":" + Arrays.toString(packages)); mLockTaskController.updateLockTaskPackages(userId, packages); } } private void startLockTaskModeLocked(@Nullable TaskRecord task, boolean isAppPinning) { if (DEBUG_LOCKTASK) Slog.w(TAG_LOCKTASK, "startLockTaskModeLocked: " + task); if (task == null || task.mLockTaskAuth == LOCK_TASK_AUTH_DONT_LOCK) { return; } final ActivityStack stack = mStackSupervisor.getFocusedStack(); if (stack == null || task != stack.topTask()) { throw new IllegalArgumentException("Invalid task, not in foreground"); } // When a task is locked, dismiss the pinned stack if it exists mStackSupervisor.removeStacksInWindowingModes(WINDOWING_MODE_PINNED); // isAppPinning is used to distinguish between locked and pinned mode, as pinned mode // is initiated by system after the pinning request was shown and locked mode is initiated // by an authorized app directly final int callingUid = Binder.getCallingUid(); long ident = Binder.clearCallingIdentity(); try { mLockTaskController.startLockTaskMode(task, isAppPinning, callingUid); } finally { Binder.restoreCallingIdentity(ident); } } @Override public void startLockTaskModeByToken(IBinder token) { synchronized (this) { final ActivityRecord r = ActivityRecord.forTokenLocked(token); if (r == null) { return; } startLockTaskModeLocked(r.getTask(), false /* not system initiated */); } } @Override public void startSystemLockTaskMode(int taskId) throws RemoteException { enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "startSystemLockTaskMode"); // This makes inner call to look as if it was initiated by system. long ident = Binder.clearCallingIdentity(); try { synchronized (this) { startLockTaskModeLocked(mStackSupervisor.anyTaskForIdLocked(taskId), true /* system initiated */); } } finally { Binder.restoreCallingIdentity(ident); } } @Override public void stopLockTaskMode() { stopLockTaskModeInternal(false /* not system initiated */); } /** * This API should be called by SystemUI only when user perform certain action to dismiss * lock task mode. We should only dismiss pinned lock task mode in this case. */ @Override public void stopSystemLockTaskMode() throws RemoteException { enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "stopSystemLockTaskMode"); stopLockTaskModeInternal(true /* system initiated */); } private void stopLockTaskModeInternal(boolean isSystemRequest) { final int callingUid = Binder.getCallingUid(); long ident = Binder.clearCallingIdentity(); try { synchronized (this) { mLockTaskController.stopLockTaskMode(isSystemRequest, callingUid); } // Launch in-call UI if a call is ongoing. This is necessary to allow stopping the lock // task and jumping straight into a call in the case of emergency call back. TelecomManager tm = (TelecomManager) mContext.getSystemService(Context.TELECOM_SERVICE); if (tm != null) { tm.showInCallScreen(false); } } finally { Binder.restoreCallingIdentity(ident); } } @Override public boolean isInLockTaskMode() { return getLockTaskModeState() != LOCK_TASK_MODE_NONE; } @Override public int getLockTaskModeState() { synchronized (this) { return mLockTaskController.getLockTaskModeState(); } } @Override public void showLockTaskEscapeMessage(IBinder token) { synchronized (this) { final ActivityRecord r = ActivityRecord.forTokenLocked(token); if (r == null) { return; } mLockTaskController.showLockTaskToast(); } } @Override public void setDisablePreviewScreenshots(IBinder token, boolean disable) throws RemoteException { synchronized (this) { final ActivityRecord r = ActivityRecord.isInStackLocked(token); if (r == null) { Slog.w(TAG, "setDisablePreviewScreenshots: Unable to find activity for token=" + token); return; } final long origId = Binder.clearCallingIdentity(); try { r.setDisablePreviewScreenshots(disable); } finally { Binder.restoreCallingIdentity(origId); } } } // ========================================================= // CONTENT PROVIDERS // ========================================================= private final List generateApplicationProvidersLocked(ProcessRecord app) { List providers = null; try { providers = AppGlobals.getPackageManager() .queryContentProviders(app.processName, app.uid, STOCK_PM_FLAGS | PackageManager.GET_URI_PERMISSION_PATTERNS | MATCH_DEBUG_TRIAGED_MISSING, /*metadastaKey=*/ null) .getList(); } catch (RemoteException ex) { } if (DEBUG_MU) Slog.v(TAG_MU, "generateApplicationProvidersLocked, app.info.uid = " + app.uid); int userId = app.userId; if (providers != null) { int N = providers.size(); app.pubProviders.ensureCapacity(N + app.pubProviders.size()); for (int i=0; i 0) { i--; PathPermission pp = pps[i]; String pprperm = pp.getReadPermission(); if (pprperm != null && checkComponentPermission(pprperm, callingPid, callingUid, cpi.applicationInfo.uid, cpi.exported) == PackageManager.PERMISSION_GRANTED) { return null; } String ppwperm = pp.getWritePermission(); if (ppwperm != null && checkComponentPermission(ppwperm, callingPid, callingUid, cpi.applicationInfo.uid, cpi.exported) == PackageManager.PERMISSION_GRANTED) { return null; } } } if (!checkedGrants && checkAuthorityGrants(callingUid, cpi, userId, checkUser)) { return null; } final String suffix; if (!cpi.exported) { suffix = " that is not exported from UID " + cpi.applicationInfo.uid; } else if (android.Manifest.permission.MANAGE_DOCUMENTS.equals(cpi.readPermission)) { suffix = " requires that you obtain access using ACTION_OPEN_DOCUMENT or related APIs"; } else { suffix = " requires " + cpi.readPermission + " or " + cpi.writePermission; } final String msg = "Permission Denial: opening provider " + cpi.name + " from " + (r != null ? r : "(null)") + " (pid=" + callingPid + ", uid=" + callingUid + ")" + suffix; Slog.w(TAG, msg); return msg; } /** * Returns if the ContentProvider has granted a uri to callingUid */ boolean checkAuthorityGrants(int callingUid, ProviderInfo cpi, int userId, boolean checkUser) { final ArrayMap perms = mGrantedUriPermissions.get(callingUid); if (perms != null) { for (int i=perms.size()-1; i>=0; i--) { GrantUri grantUri = perms.keyAt(i); if (grantUri.sourceUserId == userId || !checkUser) { if (matchesProvider(grantUri.uri, cpi)) { return true; } } } } return false; } /** * Returns true if the uri authority is one of the authorities specified in the provider. */ boolean matchesProvider(Uri uri, ProviderInfo cpi) { String uriAuth = uri.getAuthority(); String cpiAuth = cpi.authority; if (cpiAuth.indexOf(';') == -1) { return cpiAuth.equals(uriAuth); } String[] cpiAuths = cpiAuth.split(";"); int length = cpiAuths.length; for (int i = 0; i < length; i++) { if (cpiAuths[i].equals(uriAuth)) return true; } return false; } ContentProviderConnection incProviderCountLocked(ProcessRecord r, final ContentProviderRecord cpr, IBinder externalProcessToken, boolean stable) { if (r != null) { for (int i=0; i providers) { if (providers == null) { return; } enforceNotIsolatedCaller("publishContentProviders"); synchronized (this) { final ProcessRecord r = getRecordForAppLocked(caller); if (DEBUG_MU) Slog.v(TAG_MU, "ProcessRecord uid = " + r.uid); if (r == null) { throw new SecurityException( "Unable to find app for caller " + caller + " (pid=" + Binder.getCallingPid() + ") when publishing content providers"); } final long origId = Binder.clearCallingIdentity(); final int N = providers.size(); for (int i = 0; i < N; i++) { ContentProviderHolder src = providers.get(i); if (src == null || src.info == null || src.provider == null) { continue; } ContentProviderRecord dst = r.pubProviders.get(src.info.name); if (DEBUG_MU) Slog.v(TAG_MU, "ContentProviderRecord uid = " + dst.uid); if (dst != null) { ComponentName comp = new ComponentName(dst.info.packageName, dst.info.name); mProviderMap.putProviderByClass(comp, dst); String names[] = dst.info.authority.split(";"); for (int j = 0; j < names.length; j++) { mProviderMap.putProviderByName(names[j], dst); } int launchingCount = mLaunchingProviders.size(); int j; boolean wasInLaunchingProviders = false; for (j = 0; j < launchingCount; j++) { if (mLaunchingProviders.get(j) == dst) { mLaunchingProviders.remove(j); wasInLaunchingProviders = true; j--; launchingCount--; } } if (wasInLaunchingProviders) { mHandler.removeMessages(CONTENT_PROVIDER_PUBLISH_TIMEOUT_MSG, r); } synchronized (dst) { dst.provider = src.provider; dst.proc = r; dst.notifyAll(); } updateOomAdjLocked(r, true); maybeUpdateProviderUsageStatsLocked(r, src.info.packageName, src.info.authority); } } Binder.restoreCallingIdentity(origId); } } public boolean refContentProvider(IBinder connection, int stable, int unstable) { ContentProviderConnection conn; try { conn = (ContentProviderConnection)connection; } catch (ClassCastException e) { String msg ="refContentProvider: " + connection + " not a ContentProviderConnection"; Slog.w(TAG, msg); throw new IllegalArgumentException(msg); } if (conn == null) { throw new NullPointerException("connection is null"); } synchronized (this) { if (stable > 0) { conn.numStableIncs += stable; } stable = conn.stableCount + stable; if (stable < 0) { throw new IllegalStateException("stableCount < 0: " + stable); } if (unstable > 0) { conn.numUnstableIncs += unstable; } unstable = conn.unstableCount + unstable; if (unstable < 0) { throw new IllegalStateException("unstableCount < 0: " + unstable); } if ((stable+unstable) <= 0) { throw new IllegalStateException("ref counts can't go to zero here: stable=" + stable + " unstable=" + unstable); } conn.stableCount = stable; conn.unstableCount = unstable; return !conn.dead; } } public void unstableProviderDied(IBinder connection) { ContentProviderConnection conn; try { conn = (ContentProviderConnection)connection; } catch (ClassCastException e) { String msg ="refContentProvider: " + connection + " not a ContentProviderConnection"; Slog.w(TAG, msg); throw new IllegalArgumentException(msg); } if (conn == null) { throw new NullPointerException("connection is null"); } // Safely retrieve the content provider associated with the connection. IContentProvider provider; synchronized (this) { provider = conn.provider.provider; } if (provider == null) { // Um, yeah, we're way ahead of you. return; } // Make sure the caller is being honest with us. if (provider.asBinder().pingBinder()) { // Er, no, still looks good to us. synchronized (this) { Slog.w(TAG, "unstableProviderDied: caller " + Binder.getCallingUid() + " says " + conn + " died, but we don't agree"); return; } } // Well look at that! It's dead! synchronized (this) { if (conn.provider.provider != provider) { // But something changed... good enough. return; } ProcessRecord proc = conn.provider.proc; if (proc == null || proc.thread == null) { // Seems like the process is already cleaned up. return; } // As far as we're concerned, this is just like receiving a // death notification... just a bit prematurely. Slog.i(TAG, "Process " + proc.processName + " (pid " + proc.pid + ") early provider death"); final long ident = Binder.clearCallingIdentity(); try { appDiedLocked(proc); } finally { Binder.restoreCallingIdentity(ident); } } } @Override public void appNotRespondingViaProvider(IBinder connection) { enforceCallingPermission(REMOVE_TASKS, "appNotRespondingViaProvider()"); final ContentProviderConnection conn = (ContentProviderConnection) connection; if (conn == null) { Slog.w(TAG, "ContentProviderConnection is null"); return; } final ProcessRecord host = conn.provider.proc; if (host == null) { Slog.w(TAG, "Failed to find hosting ProcessRecord"); return; } mHandler.post(new Runnable() { @Override public void run() { mAppErrors.appNotResponding(host, null, null, false, "ContentProvider not responding"); } }); } public final void installSystemProviders() { List providers; synchronized (this) { ProcessRecord app = mProcessNames.get("system", SYSTEM_UID); providers = generateApplicationProvidersLocked(app); if (providers != null) { for (int i=providers.size()-1; i>=0; i--) { ProviderInfo pi = (ProviderInfo)providers.get(i); if ((pi.applicationInfo.flags&ApplicationInfo.FLAG_SYSTEM) == 0) { Slog.w(TAG, "Not installing system proc provider " + pi.name + ": not system .apk"); providers.remove(i); } } } } if (providers != null) { mSystemThread.installSystemProviders(providers); } mConstants.start(mContext.getContentResolver()); mCoreSettingsObserver = new CoreSettingsObserver(this); mFontScaleSettingObserver = new FontScaleSettingObserver(); // Now that the settings provider is published we can consider sending // in a rescue party. RescueParty.onSettingsProviderPublished(mContext); //mUsageStatsService.monitorPackages(); } void startPersistentApps(int matchFlags) { if (mFactoryTest == FactoryTest.FACTORY_TEST_LOW_LEVEL) return; synchronized (this) { try { final List apps = AppGlobals.getPackageManager() .getPersistentApplications(STOCK_PM_FLAGS | matchFlags).getList(); for (ApplicationInfo app : apps) { if (!"android".equals(app.packageName)) { addAppLocked(app, null, false, null /* ABI override */); } } } catch (RemoteException ex) { } } } /** * When a user is unlocked, we need to install encryption-unaware providers * belonging to any running apps. */ void installEncryptionUnawareProviders(int userId) { // We're only interested in providers that are encryption unaware, and // we don't care about uninstalled apps, since there's no way they're // running at this point. final int matchFlags = GET_PROVIDERS | MATCH_DIRECT_BOOT_UNAWARE; synchronized (this) { final int NP = mProcessNames.getMap().size(); for (int ip = 0; ip < NP; ip++) { final SparseArray apps = mProcessNames.getMap().valueAt(ip); final int NA = apps.size(); for (int ia = 0; ia < NA; ia++) { final ProcessRecord app = apps.valueAt(ia); if (app.userId != userId || app.thread == null || app.unlocked) continue; final int NG = app.pkgList.size(); for (int ig = 0; ig < NG; ig++) { try { final String pkgName = app.pkgList.keyAt(ig); final PackageInfo pkgInfo = AppGlobals.getPackageManager() .getPackageInfo(pkgName, matchFlags, userId); if (pkgInfo != null && !ArrayUtils.isEmpty(pkgInfo.providers)) { for (ProviderInfo pi : pkgInfo.providers) { // TODO: keep in sync with generateApplicationProvidersLocked final boolean processMatch = Objects.equals(pi.processName, app.processName) || pi.multiprocess; final boolean userMatch = isSingleton(pi.processName, pi.applicationInfo, pi.name, pi.flags) ? (app.userId == UserHandle.USER_SYSTEM) : true; if (processMatch && userMatch) { Log.v(TAG, "Installing " + pi); app.thread.scheduleInstallProvider(pi); } else { Log.v(TAG, "Skipping " + pi); } } } } catch (RemoteException ignored) { } } } } } } /** * Allows apps to retrieve the MIME type of a URI. * If an app is in the same user as the ContentProvider, or if it is allowed to interact across * users, then it does not need permission to access the ContentProvider. * Either, it needs cross-user uri grants. * * CTS tests for this functionality can be run with "runtest cts-appsecurity". * * Test cases are at cts/tests/appsecurity-tests/test-apps/UsePermissionDiffCert/ * src/com/android/cts/usespermissiondiffcertapp/AccessPermissionWithDiffSigTest.java */ public String getProviderMimeType(Uri uri, int userId) { enforceNotIsolatedCaller("getProviderMimeType"); final String name = uri.getAuthority(); int callingUid = Binder.getCallingUid(); int callingPid = Binder.getCallingPid(); long ident = 0; boolean clearedIdentity = false; userId = mUserController.unsafeConvertIncomingUser(userId); if (canClearIdentity(callingPid, callingUid, userId)) { clearedIdentity = true; ident = Binder.clearCallingIdentity(); } ContentProviderHolder holder = null; try { holder = getContentProviderExternalUnchecked(name, null, userId); if (holder != null) { return holder.provider.getType(uri); } } catch (RemoteException e) { Log.w(TAG, "Content provider dead retrieving " + uri, e); return null; } catch (Exception e) { Log.w(TAG, "Exception while determining type of " + uri, e); return null; } finally { // We need to clear the identity to call removeContentProviderExternalUnchecked if (!clearedIdentity) { ident = Binder.clearCallingIdentity(); } try { if (holder != null) { removeContentProviderExternalUnchecked(name, null, userId); } } finally { Binder.restoreCallingIdentity(ident); } } return null; } private boolean canClearIdentity(int callingPid, int callingUid, int userId) { if (UserHandle.getUserId(callingUid) == userId) { return true; } if (checkComponentPermission(INTERACT_ACROSS_USERS, callingPid, callingUid, -1, true) == PackageManager.PERMISSION_GRANTED || checkComponentPermission(INTERACT_ACROSS_USERS_FULL, callingPid, callingUid, -1, true) == PackageManager.PERMISSION_GRANTED) { return true; } return false; } // ========================================================= // GLOBAL MANAGEMENT // ========================================================= final ProcessRecord newProcessRecordLocked(ApplicationInfo info, String customProcess, boolean isolated, int isolatedUid) { String proc = customProcess != null ? customProcess : info.processName; BatteryStatsImpl stats = mBatteryStatsService.getActiveStatistics(); final int userId = UserHandle.getUserId(info.uid); int uid = info.uid; if (isolated) { if (isolatedUid == 0) { int stepsLeft = LAST_ISOLATED_UID - FIRST_ISOLATED_UID + 1; while (true) { if (mNextIsolatedProcessUid < FIRST_ISOLATED_UID || mNextIsolatedProcessUid > LAST_ISOLATED_UID) { mNextIsolatedProcessUid = FIRST_ISOLATED_UID; } uid = UserHandle.getUid(userId, mNextIsolatedProcessUid); mNextIsolatedProcessUid++; if (mIsolatedProcesses.indexOfKey(uid) < 0) { // No process for this uid, use it. break; } stepsLeft--; if (stepsLeft <= 0) { return null; } } } else { // Special case for startIsolatedProcess (internal only), where // the uid of the isolated process is specified by the caller. uid = isolatedUid; } getPackageManagerInternalLocked().addIsolatedUid(uid, info.uid); // Register the isolated UID with this application so BatteryStats knows to // attribute resource usage to the application. // // NOTE: This is done here before addProcessNameLocked, which will tell BatteryStats // about the process state of the isolated UID *before* it is registered with the // owning application. mBatteryStatsService.addIsolatedUid(uid, info.uid); } final ProcessRecord r = new ProcessRecord(stats, info, proc, uid); if (!mBooted && !mBooting && userId == UserHandle.USER_SYSTEM && (info.flags & PERSISTENT_MASK) == PERSISTENT_MASK) { r.persistent = true; r.maxAdj = ProcessList.PERSISTENT_PROC_ADJ; } if (isolated && isolatedUid != 0) { // Special case for startIsolatedProcess (internal only) - assume the process // is required by the system server to prevent it being killed. r.maxAdj = ProcessList.PERSISTENT_SERVICE_ADJ; } addProcessNameLocked(r); return r; } private boolean uidOnBackgroundWhitelist(final int uid) { final int appId = UserHandle.getAppId(uid); final int[] whitelist = mBackgroundAppIdWhitelist; final int N = whitelist.length; for (int i = 0; i < N; i++) { if (appId == whitelist[i]) { return true; } } return false; } @Override public void backgroundWhitelistUid(final int uid) { if (Binder.getCallingUid() != Process.SYSTEM_UID) { throw new SecurityException("Only the OS may call backgroundWhitelistUid()"); } if (DEBUG_BACKGROUND_CHECK) { Slog.i(TAG, "Adding uid " + uid + " to bg uid whitelist"); } synchronized (this) { final int N = mBackgroundAppIdWhitelist.length; int[] newList = new int[N+1]; System.arraycopy(mBackgroundAppIdWhitelist, 0, newList, 0, N); newList[N] = UserHandle.getAppId(uid); mBackgroundAppIdWhitelist = newList; } } final ProcessRecord addAppLocked(ApplicationInfo info, String customProcess, boolean isolated, String abiOverride) { ProcessRecord app; if (!isolated) { app = getProcessRecordLocked(customProcess != null ? customProcess : info.processName, info.uid, true); } else { app = null; } if (app == null) { app = newProcessRecordLocked(info, customProcess, isolated, 0); updateLruProcessLocked(app, false, null); updateOomAdjLocked(); } // This package really, really can not be stopped. try { AppGlobals.getPackageManager().setPackageStoppedState( info.packageName, false, UserHandle.getUserId(app.uid)); } catch (RemoteException e) { } catch (IllegalArgumentException e) { Slog.w(TAG, "Failed trying to unstop package " + info.packageName + ": " + e); } if ((info.flags & PERSISTENT_MASK) == PERSISTENT_MASK) { app.persistent = true; app.maxAdj = ProcessList.PERSISTENT_PROC_ADJ; } if (app.thread == null && mPersistentStartingProcesses.indexOf(app) < 0) { mPersistentStartingProcesses.add(app); startProcessLocked(app, "added application", customProcess != null ? customProcess : app.processName, abiOverride); } return app; } public void unhandledBack() { enforceCallingPermission(android.Manifest.permission.FORCE_BACK, "unhandledBack()"); synchronized(this) { final long origId = Binder.clearCallingIdentity(); try { getFocusedStack().unhandledBackLocked(); } finally { Binder.restoreCallingIdentity(origId); } } } public ParcelFileDescriptor openContentUri(String uriString) throws RemoteException { enforceNotIsolatedCaller("openContentUri"); final int userId = UserHandle.getCallingUserId(); final Uri uri = Uri.parse(uriString); String name = uri.getAuthority(); ContentProviderHolder cph = getContentProviderExternalUnchecked(name, null, userId); ParcelFileDescriptor pfd = null; if (cph != null) { // We record the binder invoker's uid in thread-local storage before // going to the content provider to open the file. Later, in the code // that handles all permissions checks, we look for this uid and use // that rather than the Activity Manager's own uid. The effect is that // we do the check against the caller's permissions even though it looks // to the content provider like the Activity Manager itself is making // the request. Binder token = new Binder(); sCallerIdentity.set(new Identity( token, Binder.getCallingPid(), Binder.getCallingUid())); try { pfd = cph.provider.openFile(null, uri, "r", null, token); } catch (FileNotFoundException e) { // do nothing; pfd will be returned null } finally { // Ensure that whatever happens, we clean up the identity state sCallerIdentity.remove(); // Ensure we're done with the provider. removeContentProviderExternalUnchecked(name, null, userId); } } else { Slog.d(TAG, "Failed to get provider for authority '" + name + "'"); } return pfd; } // Actually is sleeping or shutting down or whatever else in the future // is an inactive state. boolean isSleepingOrShuttingDownLocked() { return isSleepingLocked() || mShuttingDown; } boolean isShuttingDownLocked() { return mShuttingDown; } boolean isSleepingLocked() { return mSleeping; } void onWakefulnessChanged(int wakefulness) { synchronized(this) { boolean wasAwake = mWakefulness == PowerManagerInternal.WAKEFULNESS_AWAKE; boolean isAwake = wakefulness == PowerManagerInternal.WAKEFULNESS_AWAKE; mWakefulness = wakefulness; if (wasAwake != isAwake) { // Also update state in a special way for running foreground services UI. mServices.updateScreenStateLocked(isAwake); sendNotifyVrManagerOfSleepState(!isAwake); } } } void finishRunningVoiceLocked() { if (mRunningVoice != null) { mRunningVoice = null; mVoiceWakeLock.release(); updateSleepIfNeededLocked(); } } void startTimeTrackingFocusedActivityLocked() { final ActivityRecord resumedActivity = mStackSupervisor.getResumedActivityLocked(); if (!mSleeping && mCurAppTimeTracker != null && resumedActivity != null) { mCurAppTimeTracker.start(resumedActivity.packageName); } } void updateSleepIfNeededLocked() { final boolean shouldSleep = !mStackSupervisor.hasAwakeDisplay(); final boolean wasSleeping = mSleeping; if (!shouldSleep) { // If wasSleeping is true, we need to wake up activity manager state from when // we started sleeping. In either case, we need to apply the sleep tokens, which // will wake up stacks or put them to sleep as appropriate. if (wasSleeping) { mSleeping = false; startTimeTrackingFocusedActivityLocked(); mTopProcessState = ActivityManager.PROCESS_STATE_TOP; mStackSupervisor.comeOutOfSleepIfNeededLocked(); } mStackSupervisor.applySleepTokensLocked(true /* applyToStacks */); if (wasSleeping) { updateOomAdjLocked(); } } else if (!mSleeping && shouldSleep) { mSleeping = true; if (mCurAppTimeTracker != null) { mCurAppTimeTracker.stop(); } mTopProcessState = ActivityManager.PROCESS_STATE_TOP_SLEEPING; mStackSupervisor.goingToSleepLocked(); updateOomAdjLocked(); } } /** Pokes the task persister. */ void notifyTaskPersisterLocked(TaskRecord task, boolean flush) { mRecentTasks.notifyTaskPersisterLocked(task, flush); } /** * Notifies all listeners when the pinned stack animation starts. */ @Override public void notifyPinnedStackAnimationStarted() { mTaskChangeNotificationController.notifyPinnedStackAnimationStarted(); } /** * Notifies all listeners when the pinned stack animation ends. */ @Override public void notifyPinnedStackAnimationEnded() { mTaskChangeNotificationController.notifyPinnedStackAnimationEnded(); } @Override public void notifyCleartextNetwork(int uid, byte[] firstPacket) { mHandler.obtainMessage(NOTIFY_CLEARTEXT_NETWORK_MSG, uid, 0, firstPacket).sendToTarget(); } @Override public boolean shutdown(int timeout) { if (checkCallingPermission(android.Manifest.permission.SHUTDOWN) != PackageManager.PERMISSION_GRANTED) { throw new SecurityException("Requires permission " + android.Manifest.permission.SHUTDOWN); } // TODO: Where should the corresponding '1' (start) write go? StatsLog.write(StatsLog.DEVICE_ON_STATUS_CHANGED, 0); boolean timedout = false; synchronized(this) { mShuttingDown = true; mStackSupervisor.prepareForShutdownLocked(); updateEventDispatchingLocked(); timedout = mStackSupervisor.shutdownLocked(timeout); } mAppOpsService.shutdown(); if (mUsageStatsService != null) { mUsageStatsService.prepareShutdown(); } mBatteryStatsService.shutdown(); synchronized (this) { mProcessStats.shutdownLocked(); notifyTaskPersisterLocked(null, true); } return timedout; } public final void activitySlept(IBinder token) { if (DEBUG_ALL) Slog.v(TAG, "Activity slept: token=" + token); final long origId = Binder.clearCallingIdentity(); synchronized (this) { final ActivityRecord r = ActivityRecord.isInStackLocked(token); if (r != null) { mStackSupervisor.activitySleptLocked(r); } } Binder.restoreCallingIdentity(origId); } void startRunningVoiceLocked(IVoiceInteractionSession session, int targetUid) { Slog.d(TAG, "<<< startRunningVoiceLocked()"); mVoiceWakeLock.setWorkSource(new WorkSource(targetUid)); if (mRunningVoice == null || mRunningVoice.asBinder() != session.asBinder()) { boolean wasRunningVoice = mRunningVoice != null; mRunningVoice = session; if (!wasRunningVoice) { mVoiceWakeLock.acquire(); updateSleepIfNeededLocked(); } } } private void updateEventDispatchingLocked() { mWindowManager.setEventDispatching(mBooted && !mShuttingDown); } @Override public void setLockScreenShown(boolean showing, int secondaryDisplayShowing) { if (checkCallingPermission(android.Manifest.permission.DEVICE_POWER) != PackageManager.PERMISSION_GRANTED) { throw new SecurityException("Requires permission " + android.Manifest.permission.DEVICE_POWER); } synchronized(this) { long ident = Binder.clearCallingIdentity(); try { mKeyguardController.setKeyguardShown(showing, secondaryDisplayShowing); } finally { Binder.restoreCallingIdentity(ident); } } sendNotifyVrManagerOfKeyguardState(showing); } @Override public void notifyLockedProfile(@UserIdInt int userId) { try { if (!AppGlobals.getPackageManager().isUidPrivileged(Binder.getCallingUid())) { throw new SecurityException("Only privileged app can call notifyLockedProfile"); } } catch (RemoteException ex) { throw new SecurityException("Fail to check is caller a privileged app", ex); } synchronized (this) { final long ident = Binder.clearCallingIdentity(); try { if (mUserController.shouldConfirmCredentials(userId)) { if (mKeyguardController.isKeyguardLocked()) { // Showing launcher to avoid user entering credential twice. final int currentUserId = mUserController.getCurrentUserId(); startHomeActivityLocked(currentUserId, "notifyLockedProfile"); } mStackSupervisor.lockAllProfileTasks(userId); } } finally { Binder.restoreCallingIdentity(ident); } } } @Override public void startConfirmDeviceCredentialIntent(Intent intent, Bundle options) { enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "startConfirmDeviceCredentialIntent"); synchronized (this) { final long ident = Binder.clearCallingIdentity(); try { mActivityStarter.startConfirmCredentialIntent(intent, options); } finally { Binder.restoreCallingIdentity(ident); } } } @Override public void stopAppSwitches() { if (checkCallingPermission(android.Manifest.permission.STOP_APP_SWITCHES) != PackageManager.PERMISSION_GRANTED) { throw new SecurityException("viewquires permission " + android.Manifest.permission.STOP_APP_SWITCHES); } synchronized(this) { mAppSwitchesAllowedTime = SystemClock.uptimeMillis() + APP_SWITCH_DELAY_TIME; mDidAppSwitch = false; mHandler.removeMessages(DO_PENDING_ACTIVITY_LAUNCHES_MSG); Message msg = mHandler.obtainMessage(DO_PENDING_ACTIVITY_LAUNCHES_MSG); mHandler.sendMessageDelayed(msg, APP_SWITCH_DELAY_TIME); } } public void resumeAppSwitches() { if (checkCallingPermission(android.Manifest.permission.STOP_APP_SWITCHES) != PackageManager.PERMISSION_GRANTED) { throw new SecurityException("Requires permission " + android.Manifest.permission.STOP_APP_SWITCHES); } synchronized(this) { // Note that we don't execute any pending app switches... we will // let those wait until either the timeout, or the next start // activity request. mAppSwitchesAllowedTime = 0; } } boolean checkAppSwitchAllowedLocked(int sourcePid, int sourceUid, int callingPid, int callingUid, String name) { if (mAppSwitchesAllowedTime < SystemClock.uptimeMillis()) { return true; } int perm = checkComponentPermission( android.Manifest.permission.STOP_APP_SWITCHES, sourcePid, sourceUid, -1, true); if (perm == PackageManager.PERMISSION_GRANTED) { return true; } // If the actual IPC caller is different from the logical source, then // also see if they are allowed to control app switches. if (callingUid != -1 && callingUid != sourceUid) { perm = checkComponentPermission( android.Manifest.permission.STOP_APP_SWITCHES, callingPid, callingUid, -1, true); if (perm == PackageManager.PERMISSION_GRANTED) { return true; } } Slog.w(TAG, name + " request from " + sourceUid + " stopped"); return false; } public void setDebugApp(String packageName, boolean waitForDebugger, boolean persistent) { enforceCallingPermission(android.Manifest.permission.SET_DEBUG_APP, "setDebugApp()"); long ident = Binder.clearCallingIdentity(); try { // Note that this is not really thread safe if there are multiple // callers into it at the same time, but that's not a situation we // care about. if (persistent) { final ContentResolver resolver = mContext.getContentResolver(); Settings.Global.putString( resolver, Settings.Global.DEBUG_APP, packageName); Settings.Global.putInt( resolver, Settings.Global.WAIT_FOR_DEBUGGER, waitForDebugger ? 1 : 0); } synchronized (this) { if (!persistent) { mOrigDebugApp = mDebugApp; mOrigWaitForDebugger = mWaitForDebugger; } mDebugApp = packageName; mWaitForDebugger = waitForDebugger; mDebugTransient = !persistent; if (packageName != null) { forceStopPackageLocked(packageName, -1, false, false, true, true, false, UserHandle.USER_ALL, "set debug app"); } } } finally { Binder.restoreCallingIdentity(ident); } } void setTrackAllocationApp(ApplicationInfo app, String processName) { synchronized (this) { boolean isDebuggable = "1".equals(SystemProperties.get(SYSTEM_DEBUGGABLE, "0")); if (!isDebuggable) { if ((app.flags & ApplicationInfo.FLAG_DEBUGGABLE) == 0) { throw new SecurityException("Process not debuggable: " + app.packageName); } } mTrackAllocationApp = processName; } } void setProfileApp(ApplicationInfo app, String processName, ProfilerInfo profilerInfo) { synchronized (this) { boolean isDebuggable = "1".equals(SystemProperties.get(SYSTEM_DEBUGGABLE, "0")); if (!isDebuggable) { if ((app.flags & ApplicationInfo.FLAG_DEBUGGABLE) == 0) { throw new SecurityException("Process not debuggable: " + app.packageName); } } mProfileApp = processName; if (mProfilerInfo != null) { if (mProfilerInfo.profileFd != null) { try { mProfilerInfo.profileFd.close(); } catch (IOException e) { } } } mProfilerInfo = new ProfilerInfo(profilerInfo); mProfileType = 0; } } void setNativeDebuggingAppLocked(ApplicationInfo app, String processName) { boolean isDebuggable = "1".equals(SystemProperties.get(SYSTEM_DEBUGGABLE, "0")); if (!isDebuggable) { if ((app.flags & ApplicationInfo.FLAG_DEBUGGABLE) == 0) { throw new SecurityException("Process not debuggable: " + app.packageName); } } mNativeDebuggingApp = processName; } @Override public void setAlwaysFinish(boolean enabled) { enforceCallingPermission(android.Manifest.permission.SET_ALWAYS_FINISH, "setAlwaysFinish()"); long ident = Binder.clearCallingIdentity(); try { Settings.Global.putInt( mContext.getContentResolver(), Settings.Global.ALWAYS_FINISH_ACTIVITIES, enabled ? 1 : 0); synchronized (this) { mAlwaysFinishActivities = enabled; } } finally { Binder.restoreCallingIdentity(ident); } } @Override public void setActivityController(IActivityController controller, boolean imAMonkey) { enforceCallingPermission(android.Manifest.permission.SET_ACTIVITY_WATCHER, "setActivityController()"); synchronized (this) { mController = controller; mControllerIsAMonkey = imAMonkey; Watchdog.getInstance().setActivityController(controller); } } @Override public void setUserIsMonkey(boolean userIsMonkey) { synchronized (this) { synchronized (mPidsSelfLocked) { final int callingPid = Binder.getCallingPid(); ProcessRecord proc = mPidsSelfLocked.get(callingPid); if (proc == null) { throw new SecurityException("Unknown process: " + callingPid); } if (proc.instr == null || proc.instr.mUiAutomationConnection == null) { throw new SecurityException("Only an instrumentation process " + "with a UiAutomation can call setUserIsMonkey"); } } mUserIsMonkey = userIsMonkey; } } @Override public boolean isUserAMonkey() { synchronized (this) { // If there is a controller also implies the user is a monkey. return (mUserIsMonkey || (mController != null && mControllerIsAMonkey)); } } /** * @deprecated This method is only used by a few internal components and it will soon be * replaced by a proper bug report API (which will be restricted to a few, pre-defined apps). * No new code should be calling it. */ @Deprecated @Override public void requestBugReport(int bugreportType) { String extraOptions = null; switch (bugreportType) { case ActivityManager.BUGREPORT_OPTION_FULL: // Default options. break; case ActivityManager.BUGREPORT_OPTION_INTERACTIVE: extraOptions = "bugreportplus"; break; case ActivityManager.BUGREPORT_OPTION_REMOTE: extraOptions = "bugreportremote"; break; case ActivityManager.BUGREPORT_OPTION_WEAR: extraOptions = "bugreportwear"; break; case ActivityManager.BUGREPORT_OPTION_TELEPHONY: extraOptions = "bugreporttelephony"; break; default: throw new IllegalArgumentException("Provided bugreport type is not correct, value: " + bugreportType); } // Always log caller, even if it does not have permission to dump. String type = extraOptions == null ? "bugreport" : extraOptions; Slog.i(TAG, type + " requested by UID " + Binder.getCallingUid()); enforceCallingPermission(android.Manifest.permission.DUMP, "requestBugReport"); if (extraOptions != null) { SystemProperties.set("dumpstate.options", extraOptions); } SystemProperties.set("ctl.start", "bugreport"); } /** * @deprecated This method is only used by a few internal components and it will soon be * replaced by a proper bug report API (which will be restricted to a few, pre-defined apps). * No new code should be calling it. */ @Deprecated @Override public void requestTelephonyBugReport(String shareTitle, String shareDescription) { if (!TextUtils.isEmpty(shareTitle)) { if (shareTitle.length() > MAX_BUGREPORT_TITLE_SIZE) { String errorStr = "shareTitle should be less than " + MAX_BUGREPORT_TITLE_SIZE + " characters"; throw new IllegalArgumentException(errorStr); } else { if (!TextUtils.isEmpty(shareDescription)) { int length; try { length = shareDescription.getBytes("UTF-8").length; } catch (UnsupportedEncodingException e) { String errorStr = "shareDescription: UnsupportedEncodingException"; throw new IllegalArgumentException(errorStr); } if (length > SystemProperties.PROP_VALUE_MAX) { String errorStr = "shareTitle should be less than " + SystemProperties.PROP_VALUE_MAX + " bytes"; throw new IllegalArgumentException(errorStr); } else { SystemProperties.set("dumpstate.options.description", shareDescription); } } SystemProperties.set("dumpstate.options.title", shareTitle); } } Slog.d(TAG, "Bugreport notification title " + shareTitle + " description " + shareDescription); requestBugReport(ActivityManager.BUGREPORT_OPTION_TELEPHONY); } public static long getInputDispatchingTimeoutLocked(ActivityRecord r) { return r != null ? getInputDispatchingTimeoutLocked(r.app) : KEY_DISPATCHING_TIMEOUT; } public static long getInputDispatchingTimeoutLocked(ProcessRecord r) { if (r != null && (r.instr != null || r.usingWrapper)) { return INSTRUMENTATION_KEY_DISPATCHING_TIMEOUT; } return KEY_DISPATCHING_TIMEOUT; } @Override public long inputDispatchingTimedOut(int pid, final boolean aboveSystem, String reason) { if (checkCallingPermission(android.Manifest.permission.FILTER_EVENTS) != PackageManager.PERMISSION_GRANTED) { throw new SecurityException("Requires permission " + android.Manifest.permission.FILTER_EVENTS); } ProcessRecord proc; long timeout; synchronized (this) { synchronized (mPidsSelfLocked) { proc = mPidsSelfLocked.get(pid); } timeout = getInputDispatchingTimeoutLocked(proc); } if (inputDispatchingTimedOut(proc, null, null, aboveSystem, reason)) { return -1; } return timeout; } /** * Handle input dispatching timeouts. * Returns whether input dispatching should be aborted or not. */ public boolean inputDispatchingTimedOut(final ProcessRecord proc, final ActivityRecord activity, final ActivityRecord parent, final boolean aboveSystem, String reason) { if (checkCallingPermission(android.Manifest.permission.FILTER_EVENTS) != PackageManager.PERMISSION_GRANTED) { throw new SecurityException("Requires permission " + android.Manifest.permission.FILTER_EVENTS); } final String annotation; if (reason == null) { annotation = "Input dispatching timed out"; } else { annotation = "Input dispatching timed out (" + reason + ")"; } if (proc != null) { synchronized (this) { if (proc.debugging) { return false; } if (proc.instr != null) { Bundle info = new Bundle(); info.putString("shortMsg", "keyDispatchingTimedOut"); info.putString("longMsg", annotation); finishInstrumentationLocked(proc, Activity.RESULT_CANCELED, info); return true; } } mHandler.post(new Runnable() { @Override public void run() { mAppErrors.appNotResponding(proc, activity, parent, aboveSystem, annotation); } }); } return true; } @Override public Bundle getAssistContextExtras(int requestType) { PendingAssistExtras pae = enqueueAssistContext(requestType, null, null, null, null, null, true /* focused */, true /* newSessionId */, UserHandle.getCallingUserId(), null, PENDING_ASSIST_EXTRAS_TIMEOUT, 0); if (pae == null) { return null; } synchronized (pae) { while (!pae.haveResult) { try { pae.wait(); } catch (InterruptedException e) { } } } synchronized (this) { buildAssistBundleLocked(pae, pae.result); mPendingAssistExtras.remove(pae); mUiHandler.removeCallbacks(pae); } return pae.extras; } @Override public boolean isAssistDataAllowedOnCurrentActivity() { int userId; synchronized (this) { final ActivityStack focusedStack = getFocusedStack(); if (focusedStack == null || focusedStack.isActivityTypeAssistant()) { return false; } final ActivityRecord activity = focusedStack.topActivity(); if (activity == null) { return false; } userId = activity.userId; } DevicePolicyManager dpm = (DevicePolicyManager) mContext.getSystemService( Context.DEVICE_POLICY_SERVICE); return (dpm == null) || (!dpm.getScreenCaptureDisabled(null, userId)); } @Override public boolean showAssistFromActivity(IBinder token, Bundle args) { long ident = Binder.clearCallingIdentity(); try { synchronized (this) { ActivityRecord caller = ActivityRecord.forTokenLocked(token); ActivityRecord top = getFocusedStack().topActivity(); if (top != caller) { Slog.w(TAG, "showAssistFromActivity failed: caller " + caller + " is not current top " + top); return false; } if (!top.nowVisible) { Slog.w(TAG, "showAssistFromActivity failed: caller " + caller + " is not visible"); return false; } } return mAssistUtils.showSessionForActiveService(args, SHOW_SOURCE_APPLICATION, null, token); } finally { Binder.restoreCallingIdentity(ident); } } @Override public boolean requestAssistContextExtras(int requestType, IResultReceiver receiver, Bundle receiverExtras, IBinder activityToken, boolean focused, boolean newSessionId) { return enqueueAssistContext(requestType, null, null, receiver, receiverExtras, activityToken, focused, newSessionId, UserHandle.getCallingUserId(), null, PENDING_ASSIST_EXTRAS_LONG_TIMEOUT, 0) != null; } @Override public boolean requestAutofillData(IResultReceiver receiver, Bundle receiverExtras, IBinder activityToken, int flags) { return enqueueAssistContext(ActivityManager.ASSIST_CONTEXT_AUTOFILL, null, null, receiver, receiverExtras, activityToken, true, true, UserHandle.getCallingUserId(), null, PENDING_AUTOFILL_ASSIST_STRUCTURE_TIMEOUT, flags) != null; } private PendingAssistExtras enqueueAssistContext(int requestType, Intent intent, String hint, IResultReceiver receiver, Bundle receiverExtras, IBinder activityToken, boolean focused, boolean newSessionId, int userHandle, Bundle args, long timeout, int flags) { enforceCallingPermission(android.Manifest.permission.GET_TOP_ACTIVITY_INFO, "enqueueAssistContext()"); synchronized (this) { ActivityRecord activity = getFocusedStack().topActivity(); if (activity == null) { Slog.w(TAG, "getAssistContextExtras failed: no top activity"); return null; } if (activity.app == null || activity.app.thread == null) { Slog.w(TAG, "getAssistContextExtras failed: no process for " + activity); return null; } if (focused) { if (activityToken != null) { ActivityRecord caller = ActivityRecord.forTokenLocked(activityToken); if (activity != caller) { Slog.w(TAG, "enqueueAssistContext failed: caller " + caller + " is not current top " + activity); return null; } } } else { activity = ActivityRecord.forTokenLocked(activityToken); if (activity == null) { Slog.w(TAG, "enqueueAssistContext failed: activity for token=" + activityToken + " couldn't be found"); return null; } if (activity.app == null || activity.app.thread == null) { Slog.w(TAG, "enqueueAssistContext failed: no process for " + activity); return null; } } PendingAssistExtras pae; Bundle extras = new Bundle(); if (args != null) { extras.putAll(args); } extras.putString(Intent.EXTRA_ASSIST_PACKAGE, activity.packageName); extras.putInt(Intent.EXTRA_ASSIST_UID, activity.app.uid); pae = new PendingAssistExtras(activity, extras, intent, hint, receiver, receiverExtras, userHandle); pae.isHome = activity.isActivityTypeHome(); // Increment the sessionId if necessary if (newSessionId) { mViSessionId++; } try { activity.app.thread.requestAssistContextExtras(activity.appToken, pae, requestType, mViSessionId, flags); mPendingAssistExtras.add(pae); mUiHandler.postDelayed(pae, timeout); } catch (RemoteException e) { Slog.w(TAG, "getAssistContextExtras failed: crash calling " + activity); return null; } return pae; } } void pendingAssistExtrasTimedOut(PendingAssistExtras pae) { IResultReceiver receiver; synchronized (this) { mPendingAssistExtras.remove(pae); receiver = pae.receiver; } if (receiver != null) { // Caller wants result sent back to them. Bundle sendBundle = new Bundle(); // At least return the receiver extras sendBundle.putBundle(VoiceInteractionSession.KEY_RECEIVER_EXTRAS, pae.receiverExtras); try { pae.receiver.send(0, sendBundle); } catch (RemoteException e) { } } } private void buildAssistBundleLocked(PendingAssistExtras pae, Bundle result) { if (result != null) { pae.extras.putBundle(Intent.EXTRA_ASSIST_CONTEXT, result); } if (pae.hint != null) { pae.extras.putBoolean(pae.hint, true); } } /** Called from an app when assist data is ready. */ @Override public void reportAssistContextExtras(IBinder token, Bundle extras, AssistStructure structure, AssistContent content, Uri referrer) { PendingAssistExtras pae = (PendingAssistExtras)token; synchronized (pae) { pae.result = extras; pae.structure = structure; pae.content = content; if (referrer != null) { pae.extras.putParcelable(Intent.EXTRA_REFERRER, referrer); } if (structure != null) { structure.setHomeActivity(pae.isHome); } pae.haveResult = true; pae.notifyAll(); if (pae.intent == null && pae.receiver == null) { // Caller is just waiting for the result. return; } } // We are now ready to launch the assist activity. IResultReceiver sendReceiver = null; Bundle sendBundle = null; synchronized (this) { buildAssistBundleLocked(pae, extras); boolean exists = mPendingAssistExtras.remove(pae); mUiHandler.removeCallbacks(pae); if (!exists) { // Timed out. return; } if ((sendReceiver=pae.receiver) != null) { // Caller wants result sent back to them. sendBundle = new Bundle(); sendBundle.putBundle(VoiceInteractionSession.KEY_DATA, pae.extras); sendBundle.putParcelable(VoiceInteractionSession.KEY_STRUCTURE, pae.structure); sendBundle.putParcelable(VoiceInteractionSession.KEY_CONTENT, pae.content); sendBundle.putBundle(VoiceInteractionSession.KEY_RECEIVER_EXTRAS, pae.receiverExtras); } } if (sendReceiver != null) { try { sendReceiver.send(0, sendBundle); } catch (RemoteException e) { } return; } final long ident = Binder.clearCallingIdentity(); try { if (TextUtils.equals(pae.intent.getAction(), android.service.voice.VoiceInteractionService.SERVICE_INTERFACE)) { pae.intent.putExtras(pae.extras); mContext.startServiceAsUser(pae.intent, new UserHandle(pae.userHandle)); } else { pae.intent.replaceExtras(pae.extras); pae.intent.setFlags(Intent.FLAG_ACTIVITY_NEW_TASK | Intent.FLAG_ACTIVITY_SINGLE_TOP | Intent.FLAG_ACTIVITY_CLEAR_TOP); closeSystemDialogs("assist"); try { mContext.startActivityAsUser(pae.intent, new UserHandle(pae.userHandle)); } catch (ActivityNotFoundException e) { Slog.w(TAG, "No activity to handle assist action.", e); } } } finally { Binder.restoreCallingIdentity(ident); } } public boolean launchAssistIntent(Intent intent, int requestType, String hint, int userHandle, Bundle args) { return enqueueAssistContext(requestType, intent, hint, null, null, null, true /* focused */, true /* newSessionId */, userHandle, args, PENDING_ASSIST_EXTRAS_TIMEOUT, 0) != null; } public void registerProcessObserver(IProcessObserver observer) { enforceCallingPermission(android.Manifest.permission.SET_ACTIVITY_WATCHER, "registerProcessObserver()"); synchronized (this) { mProcessObservers.register(observer); } } @Override public void unregisterProcessObserver(IProcessObserver observer) { synchronized (this) { mProcessObservers.unregister(observer); } } @Override public int getUidProcessState(int uid, String callingPackage) { if (!hasUsageStatsPermission(callingPackage)) { enforceCallingPermission(android.Manifest.permission.PACKAGE_USAGE_STATS, "getUidProcessState"); } synchronized (this) { UidRecord uidRec = mActiveUids.get(uid); return uidRec != null ? uidRec.curProcState : ActivityManager.PROCESS_STATE_NONEXISTENT; } } @Override public void registerUidObserver(IUidObserver observer, int which, int cutpoint, String callingPackage) { if (!hasUsageStatsPermission(callingPackage)) { enforceCallingPermission(android.Manifest.permission.PACKAGE_USAGE_STATS, "registerUidObserver"); } synchronized (this) { mUidObservers.register(observer, new UidObserverRegistration(Binder.getCallingUid(), callingPackage, which, cutpoint)); } } @Override public void unregisterUidObserver(IUidObserver observer) { synchronized (this) { mUidObservers.unregister(observer); } } @Override public boolean convertFromTranslucent(IBinder token) { final long origId = Binder.clearCallingIdentity(); try { synchronized (this) { final ActivityRecord r = ActivityRecord.isInStackLocked(token); if (r == null) { return false; } final boolean translucentChanged = r.changeWindowTranslucency(true); if (translucentChanged) { mStackSupervisor.ensureActivitiesVisibleLocked(null, 0, !PRESERVE_WINDOWS); } mWindowManager.setAppFullscreen(token, true); return translucentChanged; } } finally { Binder.restoreCallingIdentity(origId); } } @Override public boolean convertToTranslucent(IBinder token, Bundle options) { final long origId = Binder.clearCallingIdentity(); try { synchronized (this) { final ActivityRecord r = ActivityRecord.isInStackLocked(token); if (r == null) { return false; } final TaskRecord task = r.getTask(); int index = task.mActivities.lastIndexOf(r); if (index > 0) { ActivityRecord under = task.mActivities.get(index - 1); under.returningOptions = ActivityOptions.fromBundle(options); } final boolean translucentChanged = r.changeWindowTranslucency(false); if (translucentChanged) { r.getStack().convertActivityToTranslucent(r); } mStackSupervisor.ensureActivitiesVisibleLocked(null, 0, !PRESERVE_WINDOWS); mWindowManager.setAppFullscreen(token, false); return translucentChanged; } } finally { Binder.restoreCallingIdentity(origId); } } @Override public Bundle getActivityOptions(IBinder token) { final long origId = Binder.clearCallingIdentity(); try { synchronized (this) { final ActivityRecord r = ActivityRecord.isInStackLocked(token); if (r != null) { final ActivityOptions activityOptions = r.takeOptionsLocked(); return activityOptions == null ? null : activityOptions.toBundle(); } return null; } } finally { Binder.restoreCallingIdentity(origId); } } @Override public void setImmersive(IBinder token, boolean immersive) { synchronized(this) { final ActivityRecord r = ActivityRecord.isInStackLocked(token); if (r == null) { throw new IllegalArgumentException(); } r.immersive = immersive; // update associated state if we're frontmost if (r == mStackSupervisor.getResumedActivityLocked()) { if (DEBUG_IMMERSIVE) Slog.d(TAG_IMMERSIVE, "Frontmost changed immersion: "+ r); applyUpdateLockStateLocked(r); } } } @Override public boolean isImmersive(IBinder token) { synchronized (this) { ActivityRecord r = ActivityRecord.isInStackLocked(token); if (r == null) { throw new IllegalArgumentException(); } return r.immersive; } } @Override public void setVrThread(int tid) { enforceSystemHasVrFeature(); synchronized (this) { synchronized (mPidsSelfLocked) { final int pid = Binder.getCallingPid(); final ProcessRecord proc = mPidsSelfLocked.get(pid); mVrController.setVrThreadLocked(tid, pid, proc); } } } @Override public void setPersistentVrThread(int tid) { if (checkCallingPermission(permission.RESTRICTED_VR_ACCESS) != PERMISSION_GRANTED) { final String msg = "Permission Denial: setPersistentVrThread() from pid=" + Binder.getCallingPid() + ", uid=" + Binder.getCallingUid() + " requires " + permission.RESTRICTED_VR_ACCESS; Slog.w(TAG, msg); throw new SecurityException(msg); } enforceSystemHasVrFeature(); synchronized (this) { synchronized (mPidsSelfLocked) { final int pid = Binder.getCallingPid(); final ProcessRecord proc = mPidsSelfLocked.get(pid); mVrController.setPersistentVrThreadLocked(tid, pid, proc); } } } /** * Schedule the given thread a normal scheduling priority. * * @param tid the tid of the thread to adjust the scheduling of. * @param suppressLogs {@code true} if any error logging should be disabled. * * @return {@code true} if this succeeded. */ static boolean scheduleAsRegularPriority(int tid, boolean suppressLogs) { try { Process.setThreadScheduler(tid, Process.SCHED_OTHER, 0); return true; } catch (IllegalArgumentException e) { if (!suppressLogs) { Slog.w(TAG, "Failed to set scheduling policy, thread does not exist:\n" + e); } } catch (SecurityException e) { if (!suppressLogs) { Slog.w(TAG, "Failed to set scheduling policy, not allowed:\n" + e); } } return false; } /** * Schedule the given thread an FIFO scheduling priority. * * @param tid the tid of the thread to adjust the scheduling of. * @param suppressLogs {@code true} if any error logging should be disabled. * * @return {@code true} if this succeeded. */ static boolean scheduleAsFifoPriority(int tid, boolean suppressLogs) { try { Process.setThreadScheduler(tid, Process.SCHED_FIFO | Process.SCHED_RESET_ON_FORK, 1); return true; } catch (IllegalArgumentException e) { if (!suppressLogs) { Slog.w(TAG, "Failed to set scheduling policy, thread does not exist:\n" + e); } } catch (SecurityException e) { if (!suppressLogs) { Slog.w(TAG, "Failed to set scheduling policy, not allowed:\n" + e); } } return false; } /** * Check that we have the features required for VR-related API calls, and throw an exception if * not. */ private void enforceSystemHasVrFeature() { if (!mContext.getPackageManager().hasSystemFeature(PackageManager.FEATURE_VR_MODE)) { throw new UnsupportedOperationException("VR mode not supported on this device!"); } } @Override public void setRenderThread(int tid) { synchronized (this) { ProcessRecord proc; int pid = Binder.getCallingPid(); if (pid == Process.myPid()) { demoteSystemServerRenderThread(tid); return; } synchronized (mPidsSelfLocked) { proc = mPidsSelfLocked.get(pid); if (proc != null && proc.renderThreadTid == 0 && tid > 0) { // ensure the tid belongs to the process if (!isThreadInProcess(pid, tid)) { throw new IllegalArgumentException( "Render thread does not belong to process"); } proc.renderThreadTid = tid; if (DEBUG_OOM_ADJ) { Slog.d("UI_FIFO", "Set RenderThread tid " + tid + " for pid " + pid); } // promote to FIFO now if (proc.curSchedGroup == ProcessList.SCHED_GROUP_TOP_APP) { if (DEBUG_OOM_ADJ) Slog.d("UI_FIFO", "Promoting " + tid + "out of band"); if (mUseFifoUiScheduling) { setThreadScheduler(proc.renderThreadTid, SCHED_FIFO | SCHED_RESET_ON_FORK, 1); } else { setThreadPriority(proc.renderThreadTid, TOP_APP_PRIORITY_BOOST); } } } else { if (DEBUG_OOM_ADJ) { Slog.d("UI_FIFO", "Didn't set thread from setRenderThread? " + "PID: " + pid + ", TID: " + tid + " FIFO: " + mUseFifoUiScheduling); } } } } } /** * We only use RenderThread in system_server to store task snapshots to the disk, which should * happen in the background. Thus, demote render thread from system_server to a lower priority. * * @param tid the tid of the RenderThread */ private void demoteSystemServerRenderThread(int tid) { setThreadPriority(tid, Process.THREAD_PRIORITY_BACKGROUND); } @Override public int setVrMode(IBinder token, boolean enabled, ComponentName packageName) { if (!mContext.getPackageManager().hasSystemFeature(PackageManager.FEATURE_VR_MODE)) { throw new UnsupportedOperationException("VR mode not supported on this device!"); } final VrManagerInternal vrService = LocalServices.getService(VrManagerInternal.class); ActivityRecord r; synchronized (this) { r = ActivityRecord.isInStackLocked(token); } if (r == null) { throw new IllegalArgumentException(); } int err; if ((err = vrService.hasVrPackage(packageName, r.userId)) != VrManagerInternal.NO_ERROR) { return err; } synchronized(this) { r.requestedVrComponent = (enabled) ? packageName : null; // Update associated state if this activity is currently focused if (r == mStackSupervisor.getResumedActivityLocked()) { applyUpdateVrModeLocked(r); } return 0; } } @Override public boolean isVrModePackageEnabled(ComponentName packageName) { if (!mContext.getPackageManager().hasSystemFeature(PackageManager.FEATURE_VR_MODE)) { throw new UnsupportedOperationException("VR mode not supported on this device!"); } final VrManagerInternal vrService = LocalServices.getService(VrManagerInternal.class); return vrService.hasVrPackage(packageName, UserHandle.getCallingUserId()) == VrManagerInternal.NO_ERROR; } public boolean isTopActivityImmersive() { enforceNotIsolatedCaller("startActivity"); synchronized (this) { ActivityRecord r = getFocusedStack().topRunningActivityLocked(); return (r != null) ? r.immersive : false; } } /** * @return whether the system should disable UI modes incompatible with VR mode. */ boolean shouldDisableNonVrUiLocked() { return mVrController.shouldDisableNonVrUiLocked(); } @Override public boolean isTopOfTask(IBinder token) { synchronized (this) { ActivityRecord r = ActivityRecord.isInStackLocked(token); if (r == null) { throw new IllegalArgumentException(); } return r.getTask().getTopActivity() == r; } } @Override public void setHasTopUi(boolean hasTopUi) throws RemoteException { if (checkCallingPermission(permission.INTERNAL_SYSTEM_WINDOW) != PERMISSION_GRANTED) { String msg = "Permission Denial: setHasTopUi() from pid=" + Binder.getCallingPid() + ", uid=" + Binder.getCallingUid() + " requires " + permission.INTERNAL_SYSTEM_WINDOW; Slog.w(TAG, msg); throw new SecurityException(msg); } final int pid = Binder.getCallingPid(); final long origId = Binder.clearCallingIdentity(); try { synchronized (this) { boolean changed = false; ProcessRecord pr; synchronized (mPidsSelfLocked) { pr = mPidsSelfLocked.get(pid); if (pr == null) { Slog.w(TAG, "setHasTopUi called on unknown pid: " + pid); return; } if (pr.hasTopUi != hasTopUi) { if (DEBUG_OOM_ADJ) { Slog.d(TAG, "Setting hasTopUi=" + hasTopUi + " for pid=" + pid); } pr.hasTopUi = hasTopUi; changed = true; } } if (changed) { updateOomAdjLocked(pr, true); } } } finally { Binder.restoreCallingIdentity(origId); } } public final void enterSafeMode() { synchronized(this) { // It only makes sense to do this before the system is ready // and started launching other packages. if (!mSystemReady) { try { AppGlobals.getPackageManager().enterSafeMode(); } catch (RemoteException e) { } } mSafeMode = true; } } public final void showSafeModeOverlay() { View v = LayoutInflater.from(mContext).inflate( com.android.internal.R.layout.safe_mode, null); WindowManager.LayoutParams lp = new WindowManager.LayoutParams(); lp.type = WindowManager.LayoutParams.TYPE_SECURE_SYSTEM_OVERLAY; lp.width = WindowManager.LayoutParams.WRAP_CONTENT; lp.height = WindowManager.LayoutParams.WRAP_CONTENT; lp.gravity = Gravity.BOTTOM | Gravity.START; lp.format = v.getBackground().getOpacity(); lp.flags = WindowManager.LayoutParams.FLAG_NOT_FOCUSABLE | WindowManager.LayoutParams.FLAG_NOT_TOUCHABLE; lp.privateFlags |= WindowManager.LayoutParams.PRIVATE_FLAG_SHOW_FOR_ALL_USERS; ((WindowManager)mContext.getSystemService( Context.WINDOW_SERVICE)).addView(v, lp); } public void noteWakeupAlarm(IIntentSender sender, int sourceUid, String sourcePkg, String tag) { if (sender != null && !(sender instanceof PendingIntentRecord)) { return; } final PendingIntentRecord rec = (PendingIntentRecord)sender; final BatteryStatsImpl stats = mBatteryStatsService.getActiveStatistics(); synchronized (stats) { if (mBatteryStatsService.isOnBattery()) { mBatteryStatsService.enforceCallingPermission(); int MY_UID = Binder.getCallingUid(); final int uid; if (sender == null) { uid = sourceUid; } else { uid = rec.uid == MY_UID ? SYSTEM_UID : rec.uid; } BatteryStatsImpl.Uid.Pkg pkg = stats.getPackageStatsLocked(sourceUid >= 0 ? sourceUid : uid, sourcePkg != null ? sourcePkg : rec.key.packageName); pkg.noteWakeupAlarmLocked(tag); StatsLog.write(StatsLog.WAKEUP_ALARM_OCCURRED, sourceUid >= 0 ? sourceUid : uid); } } } public void noteAlarmStart(IIntentSender sender, int sourceUid, String tag) { if (sender != null && !(sender instanceof PendingIntentRecord)) { return; } final PendingIntentRecord rec = (PendingIntentRecord)sender; final BatteryStatsImpl stats = mBatteryStatsService.getActiveStatistics(); synchronized (stats) { mBatteryStatsService.enforceCallingPermission(); int MY_UID = Binder.getCallingUid(); final int uid; if (sender == null) { uid = sourceUid; } else { uid = rec.uid == MY_UID ? SYSTEM_UID : rec.uid; } mBatteryStatsService.noteAlarmStart(tag, sourceUid >= 0 ? sourceUid : uid); } } public void noteAlarmFinish(IIntentSender sender, int sourceUid, String tag) { if (sender != null && !(sender instanceof PendingIntentRecord)) { return; } final PendingIntentRecord rec = (PendingIntentRecord)sender; final BatteryStatsImpl stats = mBatteryStatsService.getActiveStatistics(); synchronized (stats) { mBatteryStatsService.enforceCallingPermission(); int MY_UID = Binder.getCallingUid(); final int uid; if (sender == null) { uid = sourceUid; } else { uid = rec.uid == MY_UID ? SYSTEM_UID : rec.uid; } mBatteryStatsService.noteAlarmFinish(tag, sourceUid >= 0 ? sourceUid : uid); } } public boolean killPids(int[] pids, String pReason, boolean secure) { if (Binder.getCallingUid() != SYSTEM_UID) { throw new SecurityException("killPids only available to the system"); } String reason = (pReason == null) ? "Unknown" : pReason; // XXX Note: don't acquire main activity lock here, because the window // manager calls in with its locks held. boolean killed = false; synchronized (mPidsSelfLocked) { int worstType = 0; for (int i=0; i worstType) { worstType = type; } } } // If the worst oom_adj is somewhere in the cached proc LRU range, // then constrain it so we will kill all cached procs. if (worstType < ProcessList.CACHED_APP_MAX_ADJ && worstType > ProcessList.CACHED_APP_MIN_ADJ) { worstType = ProcessList.CACHED_APP_MIN_ADJ; } // If this is not a secure call, don't let it kill processes that // are important. if (!secure && worstType < ProcessList.SERVICE_ADJ) { worstType = ProcessList.SERVICE_ADJ; } Slog.w(TAG, "Killing processes " + reason + " at adjustment " + worstType); for (int i=0; i= worstType && !proc.killedByAm) { proc.kill(reason, true); killed = true; } } } return killed; } @Override public void killUid(int appId, int userId, String reason) { enforceCallingPermission(Manifest.permission.KILL_UID, "killUid"); synchronized (this) { final long identity = Binder.clearCallingIdentity(); try { killPackageProcessesLocked(null, appId, userId, ProcessList.PERSISTENT_PROC_ADJ, false, true, true, true, reason != null ? reason : "kill uid"); } finally { Binder.restoreCallingIdentity(identity); } } } @Override public boolean killProcessesBelowForeground(String reason) { if (Binder.getCallingUid() != SYSTEM_UID) { throw new SecurityException("killProcessesBelowForeground() only available to system"); } return killProcessesBelowAdj(ProcessList.FOREGROUND_APP_ADJ, reason); } private boolean killProcessesBelowAdj(int belowAdj, String reason) { if (Binder.getCallingUid() != SYSTEM_UID) { throw new SecurityException("killProcessesBelowAdj() only available to system"); } boolean killed = false; synchronized (mPidsSelfLocked) { final int size = mPidsSelfLocked.size(); for (int i = 0; i < size; i++) { final int pid = mPidsSelfLocked.keyAt(i); final ProcessRecord proc = mPidsSelfLocked.valueAt(i); if (proc == null) continue; final int adj = proc.setAdj; if (adj > belowAdj && !proc.killedByAm) { proc.kill(reason, true); killed = true; } } } return killed; } @Override public void hang(final IBinder who, boolean allowRestart) { if (checkCallingPermission(android.Manifest.permission.SET_ACTIVITY_WATCHER) != PackageManager.PERMISSION_GRANTED) { throw new SecurityException("Requires permission " + android.Manifest.permission.SET_ACTIVITY_WATCHER); } final IBinder.DeathRecipient death = new DeathRecipient() { @Override public void binderDied() { synchronized (this) { notifyAll(); } } }; try { who.linkToDeath(death, 0); } catch (RemoteException e) { Slog.w(TAG, "hang: given caller IBinder is already dead."); return; } synchronized (this) { Watchdog.getInstance().setAllowRestart(allowRestart); Slog.i(TAG, "Hanging system process at request of pid " + Binder.getCallingPid()); synchronized (death) { while (who.isBinderAlive()) { try { death.wait(); } catch (InterruptedException e) { } } } Watchdog.getInstance().setAllowRestart(true); } } @Override public void restart() { if (checkCallingPermission(android.Manifest.permission.SET_ACTIVITY_WATCHER) != PackageManager.PERMISSION_GRANTED) { throw new SecurityException("Requires permission " + android.Manifest.permission.SET_ACTIVITY_WATCHER); } Log.i(TAG, "Sending shutdown broadcast..."); BroadcastReceiver br = new BroadcastReceiver() { @Override public void onReceive(Context context, Intent intent) { // Now the broadcast is done, finish up the low-level shutdown. Log.i(TAG, "Shutting down activity manager..."); shutdown(10000); Log.i(TAG, "Shutdown complete, restarting!"); killProcess(myPid()); System.exit(10); } }; // First send the high-level shut down broadcast. Intent intent = new Intent(Intent.ACTION_SHUTDOWN); intent.addFlags(Intent.FLAG_RECEIVER_FOREGROUND); intent.putExtra(Intent.EXTRA_SHUTDOWN_USERSPACE_ONLY, true); /* For now we are not doing a clean shutdown, because things seem to get unhappy. mContext.sendOrderedBroadcastAsUser(intent, UserHandle.ALL, null, br, mHandler, 0, null, null); */ br.onReceive(mContext, intent); } private long getLowRamTimeSinceIdle(long now) { return mLowRamTimeSinceLastIdle + (mLowRamStartTime > 0 ? (now-mLowRamStartTime) : 0); } @Override public void performIdleMaintenance() { if (checkCallingPermission(android.Manifest.permission.SET_ACTIVITY_WATCHER) != PackageManager.PERMISSION_GRANTED) { throw new SecurityException("Requires permission " + android.Manifest.permission.SET_ACTIVITY_WATCHER); } synchronized (this) { final long now = SystemClock.uptimeMillis(); final long timeSinceLastIdle = now - mLastIdleTime; final long lowRamSinceLastIdle = getLowRamTimeSinceIdle(now); mLastIdleTime = now; mLowRamTimeSinceLastIdle = 0; if (mLowRamStartTime != 0) { mLowRamStartTime = now; } StringBuilder sb = new StringBuilder(128); sb.append("Idle maintenance over "); TimeUtils.formatDuration(timeSinceLastIdle, sb); sb.append(" low RAM for "); TimeUtils.formatDuration(lowRamSinceLastIdle, sb); Slog.i(TAG, sb.toString()); // If at least 1/3 of our time since the last idle period has been spent // with RAM low, then we want to kill processes. boolean doKilling = lowRamSinceLastIdle > (timeSinceLastIdle/3); for (int i = mLruProcesses.size() - 1 ; i >= 0 ; i--) { ProcessRecord proc = mLruProcesses.get(i); if (proc.notCachedSinceIdle) { if (proc.setProcState != ActivityManager.PROCESS_STATE_TOP_SLEEPING && proc.setProcState >= ActivityManager.PROCESS_STATE_FOREGROUND_SERVICE && proc.setProcState <= ActivityManager.PROCESS_STATE_SERVICE) { if (doKilling && proc.initialIdlePss != 0 && proc.lastPss > ((proc.initialIdlePss*3)/2)) { sb = new StringBuilder(128); sb.append("Kill"); sb.append(proc.processName); sb.append(" in idle maint: pss="); sb.append(proc.lastPss); sb.append(", swapPss="); sb.append(proc.lastSwapPss); sb.append(", initialPss="); sb.append(proc.initialIdlePss); sb.append(", period="); TimeUtils.formatDuration(timeSinceLastIdle, sb); sb.append(", lowRamPeriod="); TimeUtils.formatDuration(lowRamSinceLastIdle, sb); Slog.wtfQuiet(TAG, sb.toString()); proc.kill("idle maint (pss " + proc.lastPss + " from " + proc.initialIdlePss + ")", true); } } } else if (proc.setProcState < ActivityManager.PROCESS_STATE_HOME && proc.setProcState >= ActivityManager.PROCESS_STATE_PERSISTENT) { proc.notCachedSinceIdle = true; proc.initialIdlePss = 0; proc.nextPssTime = ProcessList.computeNextPssTime(proc.setProcState, true, mTestPssMode, isSleepingLocked(), now); } } mHandler.removeMessages(REQUEST_ALL_PSS_MSG); mHandler.sendEmptyMessageDelayed(REQUEST_ALL_PSS_MSG, 2*60*1000); } } @Override public void sendIdleJobTrigger() { if (checkCallingPermission(android.Manifest.permission.SET_ACTIVITY_WATCHER) != PackageManager.PERMISSION_GRANTED) { throw new SecurityException("Requires permission " + android.Manifest.permission.SET_ACTIVITY_WATCHER); } final long ident = Binder.clearCallingIdentity(); try { Intent intent = new Intent(ACTION_TRIGGER_IDLE) .setPackage("android") .addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY); broadcastIntent(null, intent, null, null, 0, null, null, null, android.app.AppOpsManager.OP_NONE, null, true, false, UserHandle.USER_ALL); } finally { Binder.restoreCallingIdentity(ident); } } private void retrieveSettings() { final ContentResolver resolver = mContext.getContentResolver(); final boolean freeformWindowManagement = mContext.getPackageManager().hasSystemFeature(FEATURE_FREEFORM_WINDOW_MANAGEMENT) || Settings.Global.getInt( resolver, DEVELOPMENT_ENABLE_FREEFORM_WINDOWS_SUPPORT, 0) != 0; final boolean supportsMultiWindow = ActivityManager.supportsMultiWindow(mContext); final boolean supportsPictureInPicture = supportsMultiWindow && mContext.getPackageManager().hasSystemFeature(FEATURE_PICTURE_IN_PICTURE); final boolean supportsSplitScreenMultiWindow = ActivityManager.supportsSplitScreenMultiWindow(mContext); final boolean supportsMultiDisplay = mContext.getPackageManager() .hasSystemFeature(FEATURE_ACTIVITIES_ON_SECONDARY_DISPLAYS); final String debugApp = Settings.Global.getString(resolver, DEBUG_APP); final boolean waitForDebugger = Settings.Global.getInt(resolver, WAIT_FOR_DEBUGGER, 0) != 0; final boolean alwaysFinishActivities = Settings.Global.getInt(resolver, ALWAYS_FINISH_ACTIVITIES, 0) != 0; final boolean forceRtl = Settings.Global.getInt(resolver, DEVELOPMENT_FORCE_RTL, 0) != 0; final boolean forceResizable = Settings.Global.getInt( resolver, DEVELOPMENT_FORCE_RESIZABLE_ACTIVITIES, 0) != 0; final long waitForNetworkTimeoutMs = Settings.Global.getLong(resolver, NETWORK_ACCESS_TIMEOUT_MS, NETWORK_ACCESS_TIMEOUT_DEFAULT_MS); final boolean supportsLeanbackOnly = mContext.getPackageManager().hasSystemFeature(FEATURE_LEANBACK_ONLY); // Transfer any global setting for forcing RTL layout, into a System Property SystemProperties.set(DEVELOPMENT_FORCE_RTL, forceRtl ? "1":"0"); final Configuration configuration = new Configuration(); Settings.System.getConfiguration(resolver, configuration); if (forceRtl) { // This will take care of setting the correct layout direction flags configuration.setLayoutDirection(configuration.locale); } synchronized (this) { mDebugApp = mOrigDebugApp = debugApp; mWaitForDebugger = mOrigWaitForDebugger = waitForDebugger; mAlwaysFinishActivities = alwaysFinishActivities; mSupportsLeanbackOnly = supportsLeanbackOnly; mForceResizableActivities = forceResizable; final boolean multiWindowFormEnabled = freeformWindowManagement || supportsSplitScreenMultiWindow || supportsPictureInPicture || supportsMultiDisplay; if ((supportsMultiWindow || forceResizable) && multiWindowFormEnabled) { mSupportsMultiWindow = true; mSupportsFreeformWindowManagement = freeformWindowManagement; mSupportsSplitScreenMultiWindow = supportsSplitScreenMultiWindow; mSupportsPictureInPicture = supportsPictureInPicture; mSupportsMultiDisplay = supportsMultiDisplay; } else { mSupportsMultiWindow = false; mSupportsFreeformWindowManagement = false; mSupportsSplitScreenMultiWindow = false; mSupportsPictureInPicture = false; mSupportsMultiDisplay = false; } mWindowManager.setForceResizableTasks(mForceResizableActivities); mWindowManager.setSupportsPictureInPicture(mSupportsPictureInPicture); // This happens before any activities are started, so we can change global configuration // in-place. updateConfigurationLocked(configuration, null, true); final Configuration globalConfig = getGlobalConfiguration(); if (DEBUG_CONFIGURATION) Slog.v(TAG_CONFIGURATION, "Initial config: " + globalConfig); // Load resources only after the current configuration has been set. final Resources res = mContext.getResources(); mThumbnailWidth = res.getDimensionPixelSize( com.android.internal.R.dimen.thumbnail_width); mThumbnailHeight = res.getDimensionPixelSize( com.android.internal.R.dimen.thumbnail_height); mAppErrors.loadAppsNotReportingCrashesFromConfigLocked(res.getString( com.android.internal.R.string.config_appsNotReportingCrashes)); mUserController.mUserSwitchUiEnabled = !res.getBoolean( com.android.internal.R.bool.config_customUserSwitchUi); if ((globalConfig.uiMode & UI_MODE_TYPE_TELEVISION) == UI_MODE_TYPE_TELEVISION) { mFullscreenThumbnailScale = (float) res .getInteger(com.android.internal.R.integer.thumbnail_width_tv) / (float) globalConfig.screenWidthDp; } else { mFullscreenThumbnailScale = res.getFraction( com.android.internal.R.fraction.thumbnail_fullscreen_scale, 1, 1); } mWaitForNetworkTimeoutMs = waitForNetworkTimeoutMs; } } public void systemReady(final Runnable goingCallback, TimingsTraceLog traceLog) { traceLog.traceBegin("PhaseActivityManagerReady"); synchronized(this) { if (mSystemReady) { // If we're done calling all the receivers, run the next "boot phase" passed in // by the SystemServer if (goingCallback != null) { goingCallback.run(); } return; } mLocalDeviceIdleController = LocalServices.getService(DeviceIdleController.LocalService.class); mAssistUtils = new AssistUtils(mContext); mVrController.onSystemReady(); // Make sure we have the current profile info, since it is needed for security checks. mUserController.onSystemReady(); mRecentTasks.onSystemReadyLocked(); mAppOpsService.systemReady(); mSystemReady = true; } try { sTheRealBuildSerial = IDeviceIdentifiersPolicyService.Stub.asInterface( ServiceManager.getService(Context.DEVICE_IDENTIFIERS_SERVICE)) .getSerial(); } catch (RemoteException e) {} ArrayList procsToKill = null; synchronized(mPidsSelfLocked) { for (int i=mPidsSelfLocked.size()-1; i>=0; i--) { ProcessRecord proc = mPidsSelfLocked.valueAt(i); if (!isAllowedWhileBooting(proc.info)){ if (procsToKill == null) { procsToKill = new ArrayList(); } procsToKill.add(proc); } } } synchronized(this) { if (procsToKill != null) { for (int i=procsToKill.size()-1; i>=0; i--) { ProcessRecord proc = procsToKill.get(i); Slog.i(TAG, "Removing system update proc: " + proc); removeProcessLocked(proc, true, false, "system update done"); } } // Now that we have cleaned up any update processes, we // are ready to start launching real processes and know that // we won't trample on them any more. mProcessesReady = true; } Slog.i(TAG, "System now ready"); EventLog.writeEvent(EventLogTags.BOOT_PROGRESS_AMS_READY, SystemClock.uptimeMillis()); synchronized(this) { // Make sure we have no pre-ready processes sitting around. if (mFactoryTest == FactoryTest.FACTORY_TEST_LOW_LEVEL) { ResolveInfo ri = mContext.getPackageManager() .resolveActivity(new Intent(Intent.ACTION_FACTORY_TEST), STOCK_PM_FLAGS); CharSequence errorMsg = null; if (ri != null) { ActivityInfo ai = ri.activityInfo; ApplicationInfo app = ai.applicationInfo; if ((app.flags&ApplicationInfo.FLAG_SYSTEM) != 0) { mTopAction = Intent.ACTION_FACTORY_TEST; mTopData = null; mTopComponent = new ComponentName(app.packageName, ai.name); } else { errorMsg = mContext.getResources().getText( com.android.internal.R.string.factorytest_not_system); } } else { errorMsg = mContext.getResources().getText( com.android.internal.R.string.factorytest_no_action); } if (errorMsg != null) { mTopAction = null; mTopData = null; mTopComponent = null; Message msg = Message.obtain(); msg.what = SHOW_FACTORY_ERROR_UI_MSG; msg.getData().putCharSequence("msg", errorMsg); mUiHandler.sendMessage(msg); } } } retrieveSettings(); final int currentUserId = mUserController.getCurrentUserId(); synchronized (this) { readGrantedUriPermissionsLocked(); } if (goingCallback != null) goingCallback.run(); traceLog.traceBegin("ActivityManagerStartApps"); mBatteryStatsService.noteEvent(BatteryStats.HistoryItem.EVENT_USER_RUNNING_START, Integer.toString(currentUserId), currentUserId); mBatteryStatsService.noteEvent(BatteryStats.HistoryItem.EVENT_USER_FOREGROUND_START, Integer.toString(currentUserId), currentUserId); mSystemServiceManager.startUser(currentUserId); synchronized (this) { // Only start up encryption-aware persistent apps; once user is // unlocked we'll come back around and start unaware apps startPersistentApps(PackageManager.MATCH_DIRECT_BOOT_AWARE); // Start up initial activity. mBooting = true; // Enable home activity for system user, so that the system can always boot. We don't // do this when the system user is not setup since the setup wizard should be the one // to handle home activity in this case. if (UserManager.isSplitSystemUser() && Settings.Secure.getInt(mContext.getContentResolver(), Settings.Secure.USER_SETUP_COMPLETE, 0) != 0) { ComponentName cName = new ComponentName(mContext, SystemUserHomeActivity.class); try { AppGlobals.getPackageManager().setComponentEnabledSetting(cName, PackageManager.COMPONENT_ENABLED_STATE_ENABLED, 0, UserHandle.USER_SYSTEM); } catch (RemoteException e) { throw e.rethrowAsRuntimeException(); } } startHomeActivityLocked(currentUserId, "systemReady"); try { if (AppGlobals.getPackageManager().hasSystemUidErrors()) { Slog.e(TAG, "UIDs on the system are inconsistent, you need to wipe your" + " data partition or your device will be unstable."); mUiHandler.obtainMessage(SHOW_UID_ERROR_UI_MSG).sendToTarget(); } } catch (RemoteException e) { } if (!Build.isBuildConsistent()) { Slog.e(TAG, "Build fingerprint is not consistent, warning user"); mUiHandler.obtainMessage(SHOW_FINGERPRINT_ERROR_UI_MSG).sendToTarget(); } long ident = Binder.clearCallingIdentity(); try { Intent intent = new Intent(Intent.ACTION_USER_STARTED); intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY | Intent.FLAG_RECEIVER_FOREGROUND); intent.putExtra(Intent.EXTRA_USER_HANDLE, currentUserId); broadcastIntentLocked(null, null, intent, null, null, 0, null, null, null, AppOpsManager.OP_NONE, null, false, false, MY_PID, SYSTEM_UID, currentUserId); intent = new Intent(Intent.ACTION_USER_STARTING); intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY); intent.putExtra(Intent.EXTRA_USER_HANDLE, currentUserId); broadcastIntentLocked(null, null, intent, null, new IIntentReceiver.Stub() { @Override public void performReceive(Intent intent, int resultCode, String data, Bundle extras, boolean ordered, boolean sticky, int sendingUser) throws RemoteException { } }, 0, null, null, new String[] {INTERACT_ACROSS_USERS}, AppOpsManager.OP_NONE, null, true, false, MY_PID, SYSTEM_UID, UserHandle.USER_ALL); } catch (Throwable t) { Slog.wtf(TAG, "Failed sending first user broadcasts", t); } finally { Binder.restoreCallingIdentity(ident); } mStackSupervisor.resumeFocusedStackTopActivityLocked(); mUserController.sendUserSwitchBroadcasts(-1, currentUserId); BinderInternal.nSetBinderProxyCountEnabled(true); BinderInternal.setBinderProxyCountCallback( new BinderInternal.BinderProxyLimitListener() { @Override public void onLimitReached(int uid) { Slog.wtf(TAG, "Uid " + uid + " sent too many Binders to uid " + Process.myUid()); if (uid == Process.SYSTEM_UID) { Slog.i(TAG, "Skipping kill (uid is SYSTEM)"); } else { killUid(UserHandle.getAppId(uid), UserHandle.getUserId(uid), "Too many Binders sent to SYSTEM"); } } }, mHandler); traceLog.traceEnd(); // ActivityManagerStartApps traceLog.traceEnd(); // PhaseActivityManagerReady } } void killAppAtUsersRequest(ProcessRecord app, Dialog fromDialog) { synchronized (this) { mAppErrors.killAppAtUserRequestLocked(app, fromDialog); } } void skipCurrentReceiverLocked(ProcessRecord app) { for (BroadcastQueue queue : mBroadcastQueues) { queue.skipCurrentReceiverLocked(app); } } /** * Used by {@link com.android.internal.os.RuntimeInit} to report when an application crashes. * The application process will exit immediately after this call returns. * @param app object of the crashing app, null for the system server * @param crashInfo describing the exception */ public void handleApplicationCrash(IBinder app, ApplicationErrorReport.ParcelableCrashInfo crashInfo) { ProcessRecord r = findAppProcess(app, "Crash"); final String processName = app == null ? "system_server" : (r == null ? "unknown" : r.processName); handleApplicationCrashInner("crash", r, processName, crashInfo); } /* Native crash reporting uses this inner version because it needs to be somewhat * decoupled from the AM-managed cleanup lifecycle */ void handleApplicationCrashInner(String eventType, ProcessRecord r, String processName, ApplicationErrorReport.CrashInfo crashInfo) { EventLog.writeEvent(EventLogTags.AM_CRASH, Binder.getCallingPid(), UserHandle.getUserId(Binder.getCallingUid()), processName, r == null ? -1 : r.info.flags, crashInfo.exceptionClassName, crashInfo.exceptionMessage, crashInfo.throwFileName, crashInfo.throwLineNumber); addErrorToDropBox(eventType, r, processName, null, null, null, null, null, crashInfo); mAppErrors.crashApplication(r, crashInfo); } public void handleApplicationStrictModeViolation( IBinder app, int violationMask, StrictMode.ViolationInfo info) { ProcessRecord r = findAppProcess(app, "StrictMode"); if (r == null) { return; } if ((violationMask & StrictMode.PENALTY_DROPBOX) != 0) { Integer stackFingerprint = info.hashCode(); boolean logIt = true; synchronized (mAlreadyLoggedViolatedStacks) { if (mAlreadyLoggedViolatedStacks.contains(stackFingerprint)) { logIt = false; // TODO: sub-sample into EventLog for these, with // the info.durationMillis? Then we'd get // the relative pain numbers, without logging all // the stack traces repeatedly. We'd want to do // likewise in the client code, which also does // dup suppression, before the Binder call. } else { if (mAlreadyLoggedViolatedStacks.size() >= MAX_DUP_SUPPRESSED_STACKS) { mAlreadyLoggedViolatedStacks.clear(); } mAlreadyLoggedViolatedStacks.add(stackFingerprint); } } if (logIt) { logStrictModeViolationToDropBox(r, info); } } if ((violationMask & StrictMode.PENALTY_DIALOG) != 0) { AppErrorResult result = new AppErrorResult(); synchronized (this) { final long origId = Binder.clearCallingIdentity(); Message msg = Message.obtain(); msg.what = SHOW_STRICT_MODE_VIOLATION_UI_MSG; HashMap data = new HashMap(); data.put("result", result); data.put("app", r); data.put("violationMask", violationMask); data.put("info", info); msg.obj = data; mUiHandler.sendMessage(msg); Binder.restoreCallingIdentity(origId); } int res = result.get(); Slog.w(TAG, "handleApplicationStrictModeViolation; res=" + res); } } // Depending on the policy in effect, there could be a bunch of // these in quick succession so we try to batch these together to // minimize disk writes, number of dropbox entries, and maximize // compression, by having more fewer, larger records. private void logStrictModeViolationToDropBox( ProcessRecord process, StrictMode.ViolationInfo info) { if (info == null) { return; } final boolean isSystemApp = process == null || (process.info.flags & (ApplicationInfo.FLAG_SYSTEM | ApplicationInfo.FLAG_UPDATED_SYSTEM_APP)) != 0; final String processName = process == null ? "unknown" : process.processName; final String dropboxTag = isSystemApp ? "system_app_strictmode" : "data_app_strictmode"; final DropBoxManager dbox = (DropBoxManager) mContext.getSystemService(Context.DROPBOX_SERVICE); // Exit early if the dropbox isn't configured to accept this report type. if (dbox == null || !dbox.isTagEnabled(dropboxTag)) return; boolean bufferWasEmpty; boolean needsFlush; final StringBuilder sb = isSystemApp ? mStrictModeBuffer : new StringBuilder(1024); synchronized (sb) { bufferWasEmpty = sb.length() == 0; appendDropBoxProcessHeaders(process, processName, sb); sb.append("Build: ").append(Build.FINGERPRINT).append("\n"); sb.append("System-App: ").append(isSystemApp).append("\n"); sb.append("Uptime-Millis: ").append(info.violationUptimeMillis).append("\n"); if (info.violationNumThisLoop != 0) { sb.append("Loop-Violation-Number: ").append(info.violationNumThisLoop).append("\n"); } if (info.numAnimationsRunning != 0) { sb.append("Animations-Running: ").append(info.numAnimationsRunning).append("\n"); } if (info.broadcastIntentAction != null) { sb.append("Broadcast-Intent-Action: ").append(info.broadcastIntentAction).append("\n"); } if (info.durationMillis != -1) { sb.append("Duration-Millis: ").append(info.durationMillis).append("\n"); } if (info.numInstances != -1) { sb.append("Instance-Count: ").append(info.numInstances).append("\n"); } if (info.tags != null) { for (String tag : info.tags) { sb.append("Span-Tag: ").append(tag).append("\n"); } } sb.append("\n"); if (info.hasStackTrace()) { sb.append(info.getStackTrace()); sb.append("\n"); } if (info.getViolationDetails() != null) { sb.append(info.getViolationDetails()); sb.append("\n"); } // Only buffer up to ~64k. Various logging bits truncate // things at 128k. needsFlush = (sb.length() > 64 * 1024); } // Flush immediately if the buffer's grown too large, or this // is a non-system app. Non-system apps are isolated with a // different tag & policy and not batched. // // Batching is useful during internal testing with // StrictMode settings turned up high. Without batching, // thousands of separate files could be created on boot. if (!isSystemApp || needsFlush) { new Thread("Error dump: " + dropboxTag) { @Override public void run() { String report; synchronized (sb) { report = sb.toString(); sb.delete(0, sb.length()); sb.trimToSize(); } if (report.length() != 0) { dbox.addText(dropboxTag, report); } } }.start(); return; } // System app batching: if (!bufferWasEmpty) { // An existing dropbox-writing thread is outstanding, so // we don't need to start it up. The existing thread will // catch the buffer appends we just did. return; } // Worker thread to both batch writes and to avoid blocking the caller on I/O. // (After this point, we shouldn't access AMS internal data structures.) new Thread("Error dump: " + dropboxTag) { @Override public void run() { // 5 second sleep to let stacks arrive and be batched together try { Thread.sleep(5000); // 5 seconds } catch (InterruptedException e) {} String errorReport; synchronized (mStrictModeBuffer) { errorReport = mStrictModeBuffer.toString(); if (errorReport.length() == 0) { return; } mStrictModeBuffer.delete(0, mStrictModeBuffer.length()); mStrictModeBuffer.trimToSize(); } dbox.addText(dropboxTag, errorReport); } }.start(); } /** * Used by {@link Log} via {@link com.android.internal.os.RuntimeInit} to report serious errors. * @param app object of the crashing app, null for the system server * @param tag reported by the caller * @param system whether this wtf is coming from the system * @param crashInfo describing the context of the error * @return true if the process should exit immediately (WTF is fatal) */ public boolean handleApplicationWtf(final IBinder app, final String tag, boolean system, final ApplicationErrorReport.ParcelableCrashInfo crashInfo) { final int callingUid = Binder.getCallingUid(); final int callingPid = Binder.getCallingPid(); if (system) { // If this is coming from the system, we could very well have low-level // system locks held, so we want to do this all asynchronously. And we // never want this to become fatal, so there is that too. mHandler.post(new Runnable() { @Override public void run() { handleApplicationWtfInner(callingUid, callingPid, app, tag, crashInfo); } }); return false; } final ProcessRecord r = handleApplicationWtfInner(callingUid, callingPid, app, tag, crashInfo); final boolean isFatal = Build.IS_ENG || Settings.Global .getInt(mContext.getContentResolver(), Settings.Global.WTF_IS_FATAL, 0) != 0; final boolean isSystem = (r == null) || r.persistent; if (isFatal && !isSystem) { mAppErrors.crashApplication(r, crashInfo); return true; } else { return false; } } ProcessRecord handleApplicationWtfInner(int callingUid, int callingPid, IBinder app, String tag, final ApplicationErrorReport.CrashInfo crashInfo) { final ProcessRecord r = findAppProcess(app, "WTF"); final String processName = app == null ? "system_server" : (r == null ? "unknown" : r.processName); EventLog.writeEvent(EventLogTags.AM_WTF, UserHandle.getUserId(callingUid), callingPid, processName, r == null ? -1 : r.info.flags, tag, crashInfo.exceptionMessage); addErrorToDropBox("wtf", r, processName, null, null, tag, null, null, crashInfo); return r; } /** * @param app object of some object (as stored in {@link com.android.internal.os.RuntimeInit}) * @return the corresponding {@link ProcessRecord} object, or null if none could be found */ private ProcessRecord findAppProcess(IBinder app, String reason) { if (app == null) { return null; } synchronized (this) { final int NP = mProcessNames.getMap().size(); for (int ip=0; ip apps = mProcessNames.getMap().valueAt(ip); final int NA = apps.size(); for (int ia=0; ia 10 * DateUtils.SECOND_IN_MILLIS) { mWtfClusterStart = now; mWtfClusterCount = 1; } else { if (mWtfClusterCount++ >= 5) return; } final StringBuilder sb = new StringBuilder(1024); appendDropBoxProcessHeaders(process, processName, sb); if (process != null) { sb.append("Foreground: ") .append(process.isInterestingToUserLocked() ? "Yes" : "No") .append("\n"); } if (activity != null) { sb.append("Activity: ").append(activity.shortComponentName).append("\n"); } if (parent != null && parent.app != null && parent.app.pid != process.pid) { sb.append("Parent-Process: ").append(parent.app.processName).append("\n"); } if (parent != null && parent != activity) { sb.append("Parent-Activity: ").append(parent.shortComponentName).append("\n"); } if (subject != null) { sb.append("Subject: ").append(subject).append("\n"); } sb.append("Build: ").append(Build.FINGERPRINT).append("\n"); if (Debug.isDebuggerConnected()) { sb.append("Debugger: Connected\n"); } sb.append("\n"); // Do the rest in a worker thread to avoid blocking the caller on I/O // (After this point, we shouldn't access AMS internal data structures.) Thread worker = new Thread("Error dump: " + dropboxTag) { @Override public void run() { if (report != null) { sb.append(report); } String setting = Settings.Global.ERROR_LOGCAT_PREFIX + dropboxTag; int lines = Settings.Global.getInt(mContext.getContentResolver(), setting, 0); int maxDataFileSize = DROPBOX_MAX_SIZE - sb.length() - lines * RESERVED_BYTES_PER_LOGCAT_LINE; if (dataFile != null && maxDataFileSize > 0) { try { sb.append(FileUtils.readTextFile(dataFile, maxDataFileSize, "\n\n[[TRUNCATED]]")); } catch (IOException e) { Slog.e(TAG, "Error reading " + dataFile, e); } } if (crashInfo != null && crashInfo.stackTrace != null) { sb.append(crashInfo.stackTrace); } if (lines > 0) { sb.append("\n"); // Merge several logcat streams, and take the last N lines InputStreamReader input = null; try { java.lang.Process logcat = new ProcessBuilder( "/system/bin/timeout", "-k", "15s", "10s", "/system/bin/logcat", "-v", "threadtime", "-b", "events", "-b", "system", "-b", "main", "-b", "crash", "-t", String.valueOf(lines)) .redirectErrorStream(true).start(); try { logcat.getOutputStream().close(); } catch (IOException e) {} try { logcat.getErrorStream().close(); } catch (IOException e) {} input = new InputStreamReader(logcat.getInputStream()); int num; char[] buf = new char[8192]; while ((num = input.read(buf)) > 0) sb.append(buf, 0, num); } catch (IOException e) { Slog.e(TAG, "Error running logcat", e); } finally { if (input != null) try { input.close(); } catch (IOException e) {} } } dbox.addText(dropboxTag, sb.toString()); } }; if (process == null) { // If process is null, we are being called from some internal code // and may be about to die -- run this synchronously. worker.run(); } else { worker.start(); } } @Override public List getProcessesInErrorState() { enforceNotIsolatedCaller("getProcessesInErrorState"); // assume our apps are happy - lazy create the list List errList = null; final boolean allUsers = ActivityManager.checkUidPermission(INTERACT_ACROSS_USERS_FULL, Binder.getCallingUid()) == PackageManager.PERMISSION_GRANTED; int userId = UserHandle.getUserId(Binder.getCallingUid()); synchronized (this) { // iterate across all processes for (int i=mLruProcesses.size()-1; i>=0; i--) { ProcessRecord app = mLruProcesses.get(i); if (!allUsers && app.userId != userId) { continue; } if ((app.thread != null) && (app.crashing || app.notResponding)) { // This one's in trouble, so we'll generate a report for it // crashes are higher priority (in case there's a crash *and* an anr) ActivityManager.ProcessErrorStateInfo report = null; if (app.crashing) { report = app.crashingReport; } else if (app.notResponding) { report = app.notRespondingReport; } if (report != null) { if (errList == null) { errList = new ArrayList(1); } errList.add(report); } else { Slog.w(TAG, "Missing app error report, app = " + app.processName + " crashing = " + app.crashing + " notResponding = " + app.notResponding); } } } } return errList; } static int procStateToImportance(int procState, int memAdj, ActivityManager.RunningAppProcessInfo currApp, int clientTargetSdk) { int imp = ActivityManager.RunningAppProcessInfo.procStateToImportanceForTargetSdk( procState, clientTargetSdk); if (imp == ActivityManager.RunningAppProcessInfo.IMPORTANCE_BACKGROUND) { currApp.lru = memAdj; } else { currApp.lru = 0; } return imp; } private void fillInProcMemInfo(ProcessRecord app, ActivityManager.RunningAppProcessInfo outInfo, int clientTargetSdk) { outInfo.pid = app.pid; outInfo.uid = app.info.uid; if (mHeavyWeightProcess == app) { outInfo.flags |= ActivityManager.RunningAppProcessInfo.FLAG_CANT_SAVE_STATE; } if (app.persistent) { outInfo.flags |= ActivityManager.RunningAppProcessInfo.FLAG_PERSISTENT; } if (app.activities.size() > 0) { outInfo.flags |= ActivityManager.RunningAppProcessInfo.FLAG_HAS_ACTIVITIES; } outInfo.lastTrimLevel = app.trimMemoryLevel; int adj = app.curAdj; int procState = app.curProcState; outInfo.importance = procStateToImportance(procState, adj, outInfo, clientTargetSdk); outInfo.importanceReasonCode = app.adjTypeCode; outInfo.processState = app.curProcState; } @Override public List getRunningAppProcesses() { enforceNotIsolatedCaller("getRunningAppProcesses"); final int callingUid = Binder.getCallingUid(); final int clientTargetSdk = mPackageManagerInt.getUidTargetSdkVersion(callingUid); // Lazy instantiation of list List runList = null; final boolean allUsers = ActivityManager.checkUidPermission(INTERACT_ACROSS_USERS_FULL, callingUid) == PackageManager.PERMISSION_GRANTED; final int userId = UserHandle.getUserId(callingUid); final boolean allUids = isGetTasksAllowed( "getRunningAppProcesses", Binder.getCallingPid(), callingUid); synchronized (this) { // Iterate across all processes for (int i = mLruProcesses.size() - 1; i >= 0; i--) { ProcessRecord app = mLruProcesses.get(i); if ((!allUsers && app.userId != userId) || (!allUids && app.uid != callingUid)) { continue; } if ((app.thread != null) && (!app.crashing && !app.notResponding)) { // Generate process state info for running application ActivityManager.RunningAppProcessInfo currApp = new ActivityManager.RunningAppProcessInfo(app.processName, app.pid, app.getPackageList()); fillInProcMemInfo(app, currApp, clientTargetSdk); if (app.adjSource instanceof ProcessRecord) { currApp.importanceReasonPid = ((ProcessRecord)app.adjSource).pid; currApp.importanceReasonImportance = ActivityManager.RunningAppProcessInfo.procStateToImportance( app.adjSourceProcState); } else if (app.adjSource instanceof ActivityRecord) { ActivityRecord r = (ActivityRecord)app.adjSource; if (r.app != null) currApp.importanceReasonPid = r.app.pid; } if (app.adjTarget instanceof ComponentName) { currApp.importanceReasonComponent = (ComponentName)app.adjTarget; } //Slog.v(TAG, "Proc " + app.processName + ": imp=" + currApp.importance // + " lru=" + currApp.lru); if (runList == null) { runList = new ArrayList<>(); } runList.add(currApp); } } } return runList; } @Override public List getRunningExternalApplications() { enforceNotIsolatedCaller("getRunningExternalApplications"); List runningApps = getRunningAppProcesses(); List retList = new ArrayList(); if (runningApps != null && runningApps.size() > 0) { Set extList = new HashSet(); for (ActivityManager.RunningAppProcessInfo app : runningApps) { if (app.pkgList != null) { for (String pkg : app.pkgList) { extList.add(pkg); } } } IPackageManager pm = AppGlobals.getPackageManager(); for (String pkg : extList) { try { ApplicationInfo info = pm.getApplicationInfo(pkg, 0, UserHandle.getCallingUserId()); if ((info.flags & ApplicationInfo.FLAG_EXTERNAL_STORAGE) != 0) { retList.add(info); } } catch (RemoteException e) { } } } return retList; } @Override public void getMyMemoryState(ActivityManager.RunningAppProcessInfo outInfo) { enforceNotIsolatedCaller("getMyMemoryState"); final int callingUid = Binder.getCallingUid(); final int clientTargetSdk = mPackageManagerInt.getUidTargetSdkVersion(callingUid); synchronized (this) { ProcessRecord proc; synchronized (mPidsSelfLocked) { proc = mPidsSelfLocked.get(Binder.getCallingPid()); } fillInProcMemInfo(proc, outInfo, clientTargetSdk); } } @Override public int getMemoryTrimLevel() { enforceNotIsolatedCaller("getMyMemoryState"); synchronized (this) { return mLastMemoryLevel; } } @Override public void onShellCommand(FileDescriptor in, FileDescriptor out, FileDescriptor err, String[] args, ShellCallback callback, ResultReceiver resultReceiver) { (new ActivityManagerShellCommand(this, false)).exec( this, in, out, err, args, callback, resultReceiver); } SleepToken acquireSleepToken(String tag, int displayId) { synchronized (this) { final SleepToken token = mStackSupervisor.createSleepTokenLocked(tag, displayId); updateSleepIfNeededLocked(); return token; } } @Override protected void dump(FileDescriptor fd, PrintWriter pw, String[] args) { PriorityDump.dump(mPriorityDumper, fd, pw, args); } /** * Wrapper function to print out debug data filtered by specified arguments. */ private void doDump(FileDescriptor fd, PrintWriter pw, String[] args, boolean useProto) { if (!DumpUtils.checkDumpAndUsageStatsPermission(mContext, TAG, pw)) return; boolean dumpAll = false; boolean dumpClient = false; boolean dumpCheckin = false; boolean dumpCheckinFormat = false; boolean dumpVisibleStacksOnly = false; boolean dumpFocusedStackOnly = false; String dumpPackage = null; int opti = 0; while (opti < args.length) { String opt = args[opti]; if (opt == null || opt.length() <= 0 || opt.charAt(0) != '-') { break; } opti++; if ("-a".equals(opt)) { dumpAll = true; } else if ("-c".equals(opt)) { dumpClient = true; } else if ("-v".equals(opt)) { dumpVisibleStacksOnly = true; } else if ("-f".equals(opt)) { dumpFocusedStackOnly = true; } else if ("-p".equals(opt)) { if (opti < args.length) { dumpPackage = args[opti]; opti++; } else { pw.println("Error: -p option requires package argument"); return; } dumpClient = true; } else if ("--checkin".equals(opt)) { dumpCheckin = dumpCheckinFormat = true; } else if ("-C".equals(opt)) { dumpCheckinFormat = true; } else if ("-h".equals(opt)) { ActivityManagerShellCommand.dumpHelp(pw, true); return; } else { pw.println("Unknown argument: " + opt + "; use -h for help"); } } long origId = Binder.clearCallingIdentity(); if (useProto) { final ProtoOutputStream proto = new ProtoOutputStream(fd); String cmd = opti < args.length ? args[opti] : ""; opti++; if ("activities".equals(cmd) || "a".equals(cmd)) { // output proto is ActivityStackSupervisorProto synchronized (this) { writeActivitiesToProtoLocked(proto); } } else if ("broadcasts".equals(cmd) || "b".equals(cmd)) { // output proto is BroadcastProto synchronized (this) { writeBroadcastsToProtoLocked(proto); } } else { // default option, dump everything, output is ActivityManagerServiceProto synchronized (this) { long activityToken = proto.start(ActivityManagerServiceProto.ACTIVITIES); writeActivitiesToProtoLocked(proto); proto.end(activityToken); long broadcastToken = proto.start(ActivityManagerServiceProto.BROADCASTS); writeBroadcastsToProtoLocked(proto); proto.end(broadcastToken); } } proto.flush(); Binder.restoreCallingIdentity(origId); return; } boolean more = false; // Is the caller requesting to dump a particular piece of data? if (opti < args.length) { String cmd = args[opti]; opti++; if ("activities".equals(cmd) || "a".equals(cmd)) { synchronized (this) { dumpActivitiesLocked(fd, pw, args, opti, true, dumpClient, dumpPackage); } } else if ("lastanr".equals(cmd)) { synchronized (this) { dumpLastANRLocked(pw); } } else if ("starter".equals(cmd)) { synchronized (this) { dumpActivityStarterLocked(pw, dumpPackage); } } else if ("containers".equals(cmd)) { synchronized (this) { dumpActivityContainersLocked(pw); } } else if ("recents".equals(cmd) || "r".equals(cmd)) { synchronized (this) { if (mRecentTasks != null) { mRecentTasks.dump(pw, true /* dumpAll */, dumpPackage); } } } else if ("binder-proxies".equals(cmd)) { if (opti >= args.length) { dumpBinderProxiesCounts(pw, BinderInternal.nGetBinderProxyPerUidCounts(), "Counts of Binder Proxies held by SYSTEM"); } else { String uid = args[opti]; opti++; // Ensure Binder Proxy Count is as up to date as possible System.gc(); System.runFinalization(); System.gc(); pw.println(BinderInternal.nGetBinderProxyCount(Integer.parseInt(uid))); } } else if ("broadcasts".equals(cmd) || "b".equals(cmd)) { String[] newArgs; String name; if (opti >= args.length) { name = null; newArgs = EMPTY_STRING_ARRAY; } else { dumpPackage = args[opti]; opti++; newArgs = new String[args.length - opti]; if (args.length > 2) System.arraycopy(args, opti, newArgs, 0, args.length - opti); } synchronized (this) { dumpBroadcastsLocked(fd, pw, args, opti, true, dumpPackage); } } else if ("broadcast-stats".equals(cmd)) { String[] newArgs; String name; if (opti >= args.length) { name = null; newArgs = EMPTY_STRING_ARRAY; } else { dumpPackage = args[opti]; opti++; newArgs = new String[args.length - opti]; if (args.length > 2) System.arraycopy(args, opti, newArgs, 0, args.length - opti); } synchronized (this) { if (dumpCheckinFormat) { dumpBroadcastStatsCheckinLocked(fd, pw, args, opti, dumpCheckin, dumpPackage); } else { dumpBroadcastStatsLocked(fd, pw, args, opti, true, dumpPackage); } } } else if ("intents".equals(cmd) || "i".equals(cmd)) { String[] newArgs; String name; if (opti >= args.length) { name = null; newArgs = EMPTY_STRING_ARRAY; } else { dumpPackage = args[opti]; opti++; newArgs = new String[args.length - opti]; if (args.length > 2) System.arraycopy(args, opti, newArgs, 0, args.length - opti); } synchronized (this) { dumpPendingIntentsLocked(fd, pw, args, opti, true, dumpPackage); } } else if ("processes".equals(cmd) || "p".equals(cmd)) { String[] newArgs; String name; if (opti >= args.length) { name = null; newArgs = EMPTY_STRING_ARRAY; } else { dumpPackage = args[opti]; opti++; newArgs = new String[args.length - opti]; if (args.length > 2) System.arraycopy(args, opti, newArgs, 0, args.length - opti); } synchronized (this) { dumpProcessesLocked(fd, pw, args, opti, true, dumpPackage); } } else if ("oom".equals(cmd) || "o".equals(cmd)) { synchronized (this) { dumpOomLocked(fd, pw, args, opti, true); } } else if ("permissions".equals(cmd) || "perm".equals(cmd)) { synchronized (this) { dumpPermissionsLocked(fd, pw, args, opti, true, null); } } else if ("provider".equals(cmd)) { String[] newArgs; String name; if (opti >= args.length) { name = null; newArgs = EMPTY_STRING_ARRAY; } else { name = args[opti]; opti++; newArgs = new String[args.length - opti]; if (args.length > 2) System.arraycopy(args, opti, newArgs, 0, args.length - opti); } if (!dumpProvider(fd, pw, name, newArgs, 0, dumpAll)) { pw.println("No providers match: " + name); pw.println("Use -h for help."); } } else if ("providers".equals(cmd) || "prov".equals(cmd)) { synchronized (this) { dumpProvidersLocked(fd, pw, args, opti, true, null); } } else if ("service".equals(cmd)) { String[] newArgs; String name; if (opti >= args.length) { name = null; newArgs = EMPTY_STRING_ARRAY; } else { name = args[opti]; opti++; newArgs = new String[args.length - opti]; if (args.length > 2) System.arraycopy(args, opti, newArgs, 0, args.length - opti); } if (!mServices.dumpService(fd, pw, name, newArgs, 0, dumpAll)) { pw.println("No services match: " + name); pw.println("Use -h for help."); } } else if ("package".equals(cmd)) { String[] newArgs; if (opti >= args.length) { pw.println("package: no package name specified"); pw.println("Use -h for help."); } else { dumpPackage = args[opti]; opti++; newArgs = new String[args.length - opti]; if (args.length > 2) System.arraycopy(args, opti, newArgs, 0, args.length - opti); args = newArgs; opti = 0; more = true; } } else if ("associations".equals(cmd) || "as".equals(cmd)) { synchronized (this) { dumpAssociationsLocked(fd, pw, args, opti, true, dumpClient, dumpPackage); } } else if ("settings".equals(cmd)) { synchronized (this) { mConstants.dump(pw); } } else if ("services".equals(cmd) || "s".equals(cmd)) { if (dumpClient) { ActiveServices.ServiceDumper dumper; synchronized (this) { dumper = mServices.newServiceDumperLocked(fd, pw, args, opti, true, dumpPackage); } dumper.dumpWithClient(); } else { synchronized (this) { mServices.newServiceDumperLocked(fd, pw, args, opti, true, dumpPackage).dumpLocked(); } } } else if ("locks".equals(cmd)) { LockGuard.dump(fd, pw, args); } else { // Dumping a single activity? if (!dumpActivity(fd, pw, cmd, args, opti, dumpAll, dumpVisibleStacksOnly, dumpFocusedStackOnly)) { ActivityManagerShellCommand shell = new ActivityManagerShellCommand(this, true); int res = shell.exec(this, null, fd, null, args, null, new ResultReceiver(null)); if (res < 0) { pw.println("Bad activity command, or no activities match: " + cmd); pw.println("Use -h for help."); } } } if (!more) { Binder.restoreCallingIdentity(origId); return; } } // No piece of data specified, dump everything. if (dumpCheckinFormat) { dumpBroadcastStatsCheckinLocked(fd, pw, args, opti, dumpCheckin, dumpPackage); } else if (dumpClient) { ActiveServices.ServiceDumper sdumper; synchronized (this) { mConstants.dump(pw); pw.println(); if (dumpAll) { pw.println("-------------------------------------------------------------------------------"); } dumpPendingIntentsLocked(fd, pw, args, opti, dumpAll, dumpPackage); pw.println(); if (dumpAll) { pw.println("-------------------------------------------------------------------------------"); } dumpBroadcastsLocked(fd, pw, args, opti, dumpAll, dumpPackage); pw.println(); if (dumpAll) { pw.println("-------------------------------------------------------------------------------"); } if (dumpAll || dumpPackage != null) { dumpBroadcastStatsLocked(fd, pw, args, opti, dumpAll, dumpPackage); pw.println(); if (dumpAll) { pw.println("-------------------------------------------------------------------------------"); } } dumpProvidersLocked(fd, pw, args, opti, dumpAll, dumpPackage); pw.println(); if (dumpAll) { pw.println("-------------------------------------------------------------------------------"); } dumpPermissionsLocked(fd, pw, args, opti, dumpAll, dumpPackage); pw.println(); if (dumpAll) { pw.println("-------------------------------------------------------------------------------"); } sdumper = mServices.newServiceDumperLocked(fd, pw, args, opti, dumpAll, dumpPackage); } sdumper.dumpWithClient(); pw.println(); synchronized (this) { if (dumpAll) { pw.println("-------------------------------------------------------------------------------"); } if (mRecentTasks != null) { mRecentTasks.dump(pw, dumpAll, dumpPackage); } pw.println(); if (dumpAll) { pw.println("-------------------------------------------------------------------------------"); } dumpLastANRLocked(pw); pw.println(); if (dumpAll) { pw.println("-------------------------------------------------------------------------------"); } dumpActivityStarterLocked(pw, dumpPackage); pw.println(); if (dumpAll) { pw.println("-------------------------------------------------------------------------------"); } dumpActivityContainersLocked(pw); pw.println(); if (dumpAll) { pw.println("-------------------------------------------------------------------------------"); } dumpActivitiesLocked(fd, pw, args, opti, dumpAll, dumpClient, dumpPackage); if (mAssociations.size() > 0) { pw.println(); if (dumpAll) { pw.println("-------------------------------------------------------------------------------"); } dumpAssociationsLocked(fd, pw, args, opti, dumpAll, dumpClient, dumpPackage); } pw.println(); if (dumpAll) { pw.println("-------------------------------------------------------------------------------"); } dumpProcessesLocked(fd, pw, args, opti, dumpAll, dumpPackage); } } else { synchronized (this) { mConstants.dump(pw); pw.println(); if (dumpAll) { pw.println("-------------------------------------------------------------------------------"); } dumpPendingIntentsLocked(fd, pw, args, opti, dumpAll, dumpPackage); pw.println(); if (dumpAll) { pw.println("-------------------------------------------------------------------------------"); } dumpBroadcastsLocked(fd, pw, args, opti, dumpAll, dumpPackage); pw.println(); if (dumpAll) { pw.println("-------------------------------------------------------------------------------"); } if (dumpAll || dumpPackage != null) { dumpBroadcastStatsLocked(fd, pw, args, opti, dumpAll, dumpPackage); pw.println(); if (dumpAll) { pw.println("-------------------------------------------------------------------------------"); } } dumpProvidersLocked(fd, pw, args, opti, dumpAll, dumpPackage); pw.println(); if (dumpAll) { pw.println("-------------------------------------------------------------------------------"); } dumpPermissionsLocked(fd, pw, args, opti, dumpAll, dumpPackage); pw.println(); if (dumpAll) { pw.println("-------------------------------------------------------------------------------"); } mServices.newServiceDumperLocked(fd, pw, args, opti, dumpAll, dumpPackage) .dumpLocked(); pw.println(); if (dumpAll) { pw.println("-------------------------------------------------------------------------------"); } if (mRecentTasks != null) { mRecentTasks.dump(pw, dumpAll, dumpPackage); } pw.println(); if (dumpAll) { pw.println("-------------------------------------------------------------------------------"); } dumpLastANRLocked(pw); pw.println(); if (dumpAll) { pw.println("-------------------------------------------------------------------------------"); } dumpActivityStarterLocked(pw, dumpPackage); pw.println(); if (dumpAll) { pw.println("-------------------------------------------------------------------------------"); } dumpActivityContainersLocked(pw); pw.println(); if (dumpAll) { pw.println("-------------------------------------------------------------------------------"); } dumpActivitiesLocked(fd, pw, args, opti, dumpAll, dumpClient, dumpPackage); if (mAssociations.size() > 0) { pw.println(); if (dumpAll) { pw.println("-------------------------------------------------------------------------------"); } dumpAssociationsLocked(fd, pw, args, opti, dumpAll, dumpClient, dumpPackage); } pw.println(); if (dumpAll) { pw.println("-------------------------------------------------------------------------------"); } dumpProcessesLocked(fd, pw, args, opti, dumpAll, dumpPackage); } } Binder.restoreCallingIdentity(origId); } private void writeActivitiesToProtoLocked(ProtoOutputStream proto) { // The output proto of "activity --proto activities" is ActivityStackSupervisorProto mStackSupervisor.writeToProto(proto); } private void dumpLastANRLocked(PrintWriter pw) { pw.println("ACTIVITY MANAGER LAST ANR (dumpsys activity lastanr)"); if (mLastANRState == null) { pw.println(" "); } else { pw.println(mLastANRState); } } private void dumpActivityContainersLocked(PrintWriter pw) { pw.println("ACTIVITY MANAGER STARTER (dumpsys activity containers)"); mStackSupervisor.dumpChildrenNames(pw, " "); pw.println(" "); } private void dumpActivityStarterLocked(PrintWriter pw, String dumpPackage) { pw.println("ACTIVITY MANAGER STARTER (dumpsys activity starter)"); mActivityStarter.dump(pw, "", dumpPackage); } void dumpActivitiesLocked(FileDescriptor fd, PrintWriter pw, String[] args, int opti, boolean dumpAll, boolean dumpClient, String dumpPackage) { dumpActivitiesLocked(fd, pw, args, opti, dumpAll, dumpClient, dumpPackage, "ACTIVITY MANAGER ACTIVITIES (dumpsys activity activities)"); } void dumpActivitiesLocked(FileDescriptor fd, PrintWriter pw, String[] args, int opti, boolean dumpAll, boolean dumpClient, String dumpPackage, String header) { pw.println(header); boolean printedAnything = mStackSupervisor.dumpActivitiesLocked(fd, pw, dumpAll, dumpClient, dumpPackage); boolean needSep = printedAnything; boolean printed = ActivityStackSupervisor.printThisActivity(pw, mStackSupervisor.getResumedActivityLocked(), dumpPackage, needSep, " ResumedActivity: "); if (printed) { printedAnything = true; needSep = false; } if (dumpPackage == null) { if (needSep) { pw.println(); } printedAnything = true; mStackSupervisor.dump(pw, " "); } if (!printedAnything) { pw.println(" (nothing)"); } } void dumpAssociationsLocked(FileDescriptor fd, PrintWriter pw, String[] args, int opti, boolean dumpAll, boolean dumpClient, String dumpPackage) { pw.println("ACTIVITY MANAGER ASSOCIATIONS (dumpsys activity associations)"); int dumpUid = 0; if (dumpPackage != null) { IPackageManager pm = AppGlobals.getPackageManager(); try { dumpUid = pm.getPackageUid(dumpPackage, MATCH_ANY_USER, 0); } catch (RemoteException e) { } } boolean printedAnything = false; final long now = SystemClock.uptimeMillis(); for (int i1=0, N1=mAssociations.size(); i1>> targetComponents = mAssociations.valueAt(i1); for (int i2=0, N2=targetComponents.size(); i2> sourceUids = targetComponents.valueAt(i2); for (int i3=0, N3=sourceUids.size(); i3 sourceProcesses = sourceUids.valueAt(i3); for (int i4=0, N4=sourceProcesses.size(); i4 0) { dur += now - ass.mStartTime; } TimeUtils.formatDuration(dur, pw); pw.print(" ("); pw.print(ass.mCount); pw.print(" times)"); pw.print(" "); for (int i=0; i 0) { pw.print(" Currently active: "); TimeUtils.formatDuration(now - ass.mStartTime, pw); pw.println(); } } } } } if (!printedAnything) { pw.println(" (nothing)"); } } boolean dumpUids(PrintWriter pw, String dumpPackage, SparseArray uids, String header, boolean needSep) { boolean printed = false; int whichAppId = -1; if (dumpPackage != null) { try { ApplicationInfo info = mContext.getPackageManager().getApplicationInfo( dumpPackage, 0); whichAppId = UserHandle.getAppId(info.uid); } catch (NameNotFoundException e) { e.printStackTrace(); } } for (int i=0; i procs = mProcessNames.getMap().valueAt(ip); final int NA = procs.size(); for (int ia=0; ia 0) { boolean printed = false; for (int i=0; i 0) { boolean printed = false; for (int i=0; i 0) { if (dumpUids(pw, dumpPackage, mActiveUids, "UID states:", needSep)) { printedAnything = needSep = true; } } if (dumpAll) { if (mValidateUids.size() > 0) { if (dumpUids(pw, dumpPackage, mValidateUids, "UID validation:", needSep)) { printedAnything = needSep = true; } } } if (mLruProcesses.size() > 0) { if (needSep) { pw.println(); } pw.print(" Process LRU list (sorted by oom_adj, "); pw.print(mLruProcesses.size()); pw.print(" total, non-act at "); pw.print(mLruProcesses.size()-mLruProcessActivityStart); pw.print(", non-svc at "); pw.print(mLruProcesses.size()-mLruProcessServiceStart); pw.println("):"); dumpProcessOomList(pw, this, mLruProcesses, " ", "Proc", "PERS", false, dumpPackage); needSep = true; printedAnything = true; } if (dumpAll || dumpPackage != null) { synchronized (mPidsSelfLocked) { boolean printed = false; for (int i=0; i 0) { synchronized (mPidsSelfLocked) { boolean printed = false; for (int i = 0; i< mImportantProcesses.size(); i++) { ProcessRecord r = mPidsSelfLocked.get( mImportantProcesses.valueAt(i).pid); if (dumpPackage != null && (r == null || !r.pkgList.containsKey(dumpPackage))) { continue; } if (!printed) { if (needSep) pw.println(); needSep = true; pw.println(" Foreground Processes:"); printed = true; printedAnything = true; } pw.print(" PID #"); pw.print(mImportantProcesses.keyAt(i)); pw.print(": "); pw.println(mImportantProcesses.valueAt(i)); } } } if (mPersistentStartingProcesses.size() > 0) { if (needSep) pw.println(); needSep = true; printedAnything = true; pw.println(" Persisent processes that are starting:"); dumpProcessList(pw, this, mPersistentStartingProcesses, " ", "Starting Norm", "Restarting PERS", dumpPackage); } if (mRemovedProcesses.size() > 0) { if (needSep) pw.println(); needSep = true; printedAnything = true; pw.println(" Processes that are being removed:"); dumpProcessList(pw, this, mRemovedProcesses, " ", "Removed Norm", "Removed PERS", dumpPackage); } if (mProcessesOnHold.size() > 0) { if (needSep) pw.println(); needSep = true; printedAnything = true; pw.println(" Processes that are on old until the system is ready:"); dumpProcessList(pw, this, mProcessesOnHold, " ", "OnHold Norm", "OnHold PERS", dumpPackage); } needSep = dumpProcessesToGc(fd, pw, args, opti, needSep, dumpAll, dumpPackage); needSep = mAppErrors.dumpLocked(fd, pw, needSep, dumpPackage); if (needSep) { printedAnything = true; } if (dumpPackage == null) { pw.println(); needSep = false; mUserController.dump(pw, dumpAll); } if (mHomeProcess != null && (dumpPackage == null || mHomeProcess.pkgList.containsKey(dumpPackage))) { if (needSep) { pw.println(); needSep = false; } pw.println(" mHomeProcess: " + mHomeProcess); } if (mPreviousProcess != null && (dumpPackage == null || mPreviousProcess.pkgList.containsKey(dumpPackage))) { if (needSep) { pw.println(); needSep = false; } pw.println(" mPreviousProcess: " + mPreviousProcess); } if (dumpAll && (mPreviousProcess == null || dumpPackage == null || mPreviousProcess.pkgList.containsKey(dumpPackage))) { StringBuilder sb = new StringBuilder(128); sb.append(" mPreviousProcessVisibleTime: "); TimeUtils.formatDuration(mPreviousProcessVisibleTime, sb); pw.println(sb); } if (mHeavyWeightProcess != null && (dumpPackage == null || mHeavyWeightProcess.pkgList.containsKey(dumpPackage))) { if (needSep) { pw.println(); needSep = false; } pw.println(" mHeavyWeightProcess: " + mHeavyWeightProcess); } if (dumpPackage == null) { pw.println(" mGlobalConfiguration: " + getGlobalConfiguration()); mStackSupervisor.dumpDisplayConfigs(pw, " "); } if (dumpAll) { if (dumpPackage == null) { pw.println(" mConfigWillChange: " + getFocusedStack().mConfigWillChange); } if (mCompatModePackages.getPackages().size() > 0) { boolean printed = false; for (Map.Entry entry : mCompatModePackages.getPackages().entrySet()) { String pkg = entry.getKey(); int mode = entry.getValue(); if (dumpPackage != null && !dumpPackage.equals(pkg)) { continue; } if (!printed) { pw.println(" mScreenCompatPackages:"); printed = true; } pw.print(" "); pw.print(pkg); pw.print(": "); pw.print(mode); pw.println(); } } final int NI = mUidObservers.getRegisteredCallbackCount(); boolean printed = false; for (int i=0; i 0) { pw.println(" Mem watch processes:"); final ArrayMap>> procs = mMemWatchProcesses.getMap(); for (int i=0; i> uids = procs.valueAt(i); for (int j=0; j val = uids.valueAt(j); sb.append(": "); DebugUtils.sizeValueToString(val.first, sb); if (val.second != null) { sb.append(", report to ").append(val.second); } pw.println(sb.toString()); } } pw.print(" mMemWatchDumpProcName="); pw.println(mMemWatchDumpProcName); pw.print(" mMemWatchDumpFile="); pw.println(mMemWatchDumpFile); pw.print(" mMemWatchDumpPid="); pw.print(mMemWatchDumpPid); pw.print(" mMemWatchDumpUid="); pw.println(mMemWatchDumpUid); } if (mTrackAllocationApp != null) { if (dumpPackage == null || dumpPackage.equals(mTrackAllocationApp)) { if (needSep) { pw.println(); needSep = false; } pw.println(" mTrackAllocationApp=" + mTrackAllocationApp); } } if (mProfileApp != null || mProfileProc != null || (mProfilerInfo != null && (mProfilerInfo.profileFile != null || mProfilerInfo.profileFd != null))) { if (dumpPackage == null || dumpPackage.equals(mProfileApp)) { if (needSep) { pw.println(); needSep = false; } pw.println(" mProfileApp=" + mProfileApp + " mProfileProc=" + mProfileProc); if (mProfilerInfo != null) { pw.println(" mProfileFile=" + mProfilerInfo.profileFile + " mProfileFd=" + mProfilerInfo.profileFd); pw.println(" mSamplingInterval=" + mProfilerInfo.samplingInterval + " mAutoStopProfiler=" + mProfilerInfo.autoStopProfiler + " mStreamingOutput=" + mProfilerInfo.streamingOutput); pw.println(" mProfileType=" + mProfileType); } } } if (mNativeDebuggingApp != null) { if (dumpPackage == null || dumpPackage.equals(mNativeDebuggingApp)) { if (needSep) { pw.println(); needSep = false; } pw.println(" mNativeDebuggingApp=" + mNativeDebuggingApp); } } if (dumpPackage == null) { if (mAlwaysFinishActivities) { pw.println(" mAlwaysFinishActivities=" + mAlwaysFinishActivities); } if (mController != null) { pw.println(" mController=" + mController + " mControllerIsAMonkey=" + mControllerIsAMonkey); } if (dumpAll) { pw.println(" Total persistent processes: " + numPers); pw.println(" mProcessesReady=" + mProcessesReady + " mSystemReady=" + mSystemReady + " mBooted=" + mBooted + " mFactoryTest=" + mFactoryTest); pw.println(" mBooting=" + mBooting + " mCallFinishBooting=" + mCallFinishBooting + " mBootAnimationComplete=" + mBootAnimationComplete); pw.print(" mLastPowerCheckUptime="); TimeUtils.formatDuration(mLastPowerCheckUptime, pw); pw.println(""); pw.println(" mGoingToSleep=" + mStackSupervisor.mGoingToSleep); pw.println(" mLaunchingActivity=" + mStackSupervisor.mLaunchingActivity); pw.println(" mAdjSeq=" + mAdjSeq + " mLruSeq=" + mLruSeq); pw.println(" mNumNonCachedProcs=" + mNumNonCachedProcs + " (" + mLruProcesses.size() + " total)" + " mNumCachedHiddenProcs=" + mNumCachedHiddenProcs + " mNumServiceProcs=" + mNumServiceProcs + " mNewNumServiceProcs=" + mNewNumServiceProcs); pw.println(" mAllowLowerMemLevel=" + mAllowLowerMemLevel + " mLastMemoryLevel=" + mLastMemoryLevel + " mLastNumProcesses=" + mLastNumProcesses); long now = SystemClock.uptimeMillis(); pw.print(" mLastIdleTime="); TimeUtils.formatDuration(now, mLastIdleTime, pw); pw.print(" mLowRamSinceLastIdle="); TimeUtils.formatDuration(getLowRamTimeSinceIdle(now), pw); pw.println(); } } if (!printedAnything) { pw.println(" (nothing)"); } } boolean dumpProcessesToGc(FileDescriptor fd, PrintWriter pw, String[] args, int opti, boolean needSep, boolean dumpAll, String dumpPackage) { if (mProcessesToGc.size() > 0) { boolean printed = false; long now = SystemClock.uptimeMillis(); for (int i=0; i= 0) { pw.print(' '); if (adj < 10) pw.print(' '); } else { if (adj > -10) pw.print(' '); } pw.print(adj); pw.print(": "); pw.print(name); pw.print(" ("); pw.print(stringifySize(mProcessList.getMemLevel(adj), 1024)); pw.println(")"); } boolean dumpOomLocked(FileDescriptor fd, PrintWriter pw, String[] args, int opti, boolean dumpAll) { boolean needSep = false; if (mLruProcesses.size() > 0) { if (needSep) pw.println(); needSep = true; pw.println(" OOM levels:"); printOomLevel(pw, "SYSTEM_ADJ", ProcessList.SYSTEM_ADJ); printOomLevel(pw, "PERSISTENT_PROC_ADJ", ProcessList.PERSISTENT_PROC_ADJ); printOomLevel(pw, "PERSISTENT_SERVICE_ADJ", ProcessList.PERSISTENT_SERVICE_ADJ); printOomLevel(pw, "FOREGROUND_APP_ADJ", ProcessList.FOREGROUND_APP_ADJ); printOomLevel(pw, "VISIBLE_APP_ADJ", ProcessList.VISIBLE_APP_ADJ); printOomLevel(pw, "PERCEPTIBLE_APP_ADJ", ProcessList.PERCEPTIBLE_APP_ADJ); printOomLevel(pw, "BACKUP_APP_ADJ", ProcessList.BACKUP_APP_ADJ); printOomLevel(pw, "HEAVY_WEIGHT_APP_ADJ", ProcessList.HEAVY_WEIGHT_APP_ADJ); printOomLevel(pw, "SERVICE_ADJ", ProcessList.SERVICE_ADJ); printOomLevel(pw, "HOME_APP_ADJ", ProcessList.HOME_APP_ADJ); printOomLevel(pw, "PREVIOUS_APP_ADJ", ProcessList.PREVIOUS_APP_ADJ); printOomLevel(pw, "SERVICE_B_ADJ", ProcessList.SERVICE_B_ADJ); printOomLevel(pw, "CACHED_APP_MIN_ADJ", ProcessList.CACHED_APP_MIN_ADJ); printOomLevel(pw, "CACHED_APP_MAX_ADJ", ProcessList.CACHED_APP_MAX_ADJ); if (needSep) pw.println(); pw.print(" Process OOM control ("); pw.print(mLruProcesses.size()); pw.print(" total, non-act at "); pw.print(mLruProcesses.size()-mLruProcessActivityStart); pw.print(", non-svc at "); pw.print(mLruProcesses.size()-mLruProcessServiceStart); pw.println("):"); dumpProcessOomList(pw, this, mLruProcesses, " ", "Proc", "PERS", true, null); needSep = true; } dumpProcessesToGc(fd, pw, args, opti, needSep, dumpAll, null); pw.println(); pw.println(" mHomeProcess: " + mHomeProcess); pw.println(" mPreviousProcess: " + mPreviousProcess); if (mHeavyWeightProcess != null) { pw.println(" mHeavyWeightProcess: " + mHeavyWeightProcess); } return true; } /** * There are three ways to call this: * - no provider specified: dump all the providers * - a flattened component name that matched an existing provider was specified as the * first arg: dump that one provider * - the first arg isn't the flattened component name of an existing provider: * dump all providers whose component contains the first arg as a substring */ protected boolean dumpProvider(FileDescriptor fd, PrintWriter pw, String name, String[] args, int opti, boolean dumpAll) { return mProviderMap.dumpProvider(fd, pw, name, args, opti, dumpAll); } static class ItemMatcher { ArrayList components; ArrayList strings; ArrayList objects; boolean all; ItemMatcher() { all = true; } void build(String name) { ComponentName componentName = ComponentName.unflattenFromString(name); if (componentName != null) { if (components == null) { components = new ArrayList(); } components.add(componentName); all = false; } else { int objectId = 0; // Not a '/' separated full component name; maybe an object ID? try { objectId = Integer.parseInt(name, 16); if (objects == null) { objects = new ArrayList(); } objects.add(objectId); all = false; } catch (RuntimeException e) { // Not an integer; just do string match. if (strings == null) { strings = new ArrayList(); } strings.add(name); all = false; } } } int build(String[] args, int opti) { for (; opti activities; synchronized (this) { activities = mStackSupervisor.getDumpActivitiesLocked(name, dumpVisibleStacksOnly, dumpFocusedStackOnly); } if (activities.size() <= 0) { return false; } String[] newArgs = new String[args.length - opti]; System.arraycopy(args, opti, newArgs, 0, args.length - opti); TaskRecord lastTask = null; boolean needSep = false; for (int i=activities.size()-1; i>=0; i--) { ActivityRecord r = activities.get(i); if (needSep) { pw.println(); } needSep = true; synchronized (this) { final TaskRecord task = r.getTask(); if (lastTask != task) { lastTask = task; pw.print("TASK "); pw.print(lastTask.affinity); pw.print(" id="); pw.print(lastTask.taskId); pw.print(" userId="); pw.println(lastTask.userId); if (dumpAll) { lastTask.dump(pw, " "); } } } dumpActivity(" ", fd, pw, activities.get(i), newArgs, dumpAll); } return true; } /** * Invokes IApplicationThread.dumpActivity() on the thread of the specified activity if * there is a thread associated with the activity. */ private void dumpActivity(String prefix, FileDescriptor fd, PrintWriter pw, final ActivityRecord r, String[] args, boolean dumpAll) { String innerPrefix = prefix + " "; synchronized (this) { pw.print(prefix); pw.print("ACTIVITY "); pw.print(r.shortComponentName); pw.print(" "); pw.print(Integer.toHexString(System.identityHashCode(r))); pw.print(" pid="); if (r.app != null) pw.println(r.app.pid); else pw.println("(not running)"); if (dumpAll) { r.dump(pw, innerPrefix); } } if (r.app != null && r.app.thread != null) { // flush anything that is already in the PrintWriter since the thread is going // to write to the file descriptor directly pw.flush(); try { TransferPipe tp = new TransferPipe(); try { r.app.thread.dumpActivity(tp.getWriteFd(), r.appToken, innerPrefix, args); tp.go(fd); } finally { tp.kill(); } } catch (IOException e) { pw.println(innerPrefix + "Failure while dumping the activity: " + e); } catch (RemoteException e) { pw.println(innerPrefix + "Got a RemoteException while dumping the activity"); } } } void writeBroadcastsToProtoLocked(ProtoOutputStream proto) { if (mRegisteredReceivers.size() > 0) { Iterator it = mRegisteredReceivers.values().iterator(); while (it.hasNext()) { ReceiverList r = (ReceiverList)it.next(); r.writeToProto(proto, BroadcastProto.RECEIVER_LIST); } } mReceiverResolver.writeToProto(proto, BroadcastProto.RECEIVER_RESOLVER); for (BroadcastQueue q : mBroadcastQueues) { q.writeToProto(proto, BroadcastProto.BROADCAST_QUEUE); } for (int user=0; user> ent : mStickyBroadcasts.valueAt(user).entrySet()) { long actionToken = proto.start(StickyBroadcastProto.ACTIONS); proto.write(StickyBroadcastProto.StickyAction.NAME, ent.getKey()); for (Intent intent : ent.getValue()) { intent.writeToProto(proto, StickyBroadcastProto.StickyAction.INTENTS, false, true, true, false); } proto.end(actionToken); } proto.end(token); } long handlerToken = proto.start(BroadcastProto.HANDLER); proto.write(BroadcastProto.MainHandler.HANDLER, mHandler.toString()); mHandler.getLooper().writeToProto(proto, BroadcastProto.MainHandler.LOOPER); proto.end(handlerToken); } void dumpBroadcastsLocked(FileDescriptor fd, PrintWriter pw, String[] args, int opti, boolean dumpAll, String dumpPackage) { boolean needSep = false; boolean onlyHistory = false; boolean printedAnything = false; if ("history".equals(dumpPackage)) { if (opti < args.length && "-s".equals(args[opti])) { dumpAll = false; } onlyHistory = true; dumpPackage = null; } pw.println("ACTIVITY MANAGER BROADCAST STATE (dumpsys activity broadcasts)"); if (!onlyHistory && dumpAll) { if (mRegisteredReceivers.size() > 0) { boolean printed = false; Iterator it = mRegisteredReceivers.values().iterator(); while (it.hasNext()) { ReceiverList r = (ReceiverList)it.next(); if (dumpPackage != null && (r.app == null || !dumpPackage.equals(r.app.info.packageName))) { continue; } if (!printed) { pw.println(" Registered Receivers:"); needSep = true; printed = true; printedAnything = true; } pw.print(" * "); pw.println(r); r.dump(pw, " "); } } if (mReceiverResolver.dump(pw, needSep ? "\n Receiver Resolver Table:" : " Receiver Resolver Table:", " ", dumpPackage, false, false)) { needSep = true; printedAnything = true; } } for (BroadcastQueue q : mBroadcastQueues) { needSep = q.dumpLocked(fd, pw, args, opti, dumpAll, dumpPackage, needSep); printedAnything |= needSep; } needSep = true; if (!onlyHistory && mStickyBroadcasts != null && dumpPackage == null) { for (int user=0; user> ent : mStickyBroadcasts.valueAt(user).entrySet()) { pw.print(" * Sticky action "); pw.print(ent.getKey()); if (dumpAll) { pw.println(":"); ArrayList intents = ent.getValue(); final int N = intents.size(); for (int i=0; i 0) { boolean printed = false; for (int i=mLaunchingProviders.size()-1; i>=0; i--) { ContentProviderRecord r = mLaunchingProviders.get(i); if (dumpPackage != null && !dumpPackage.equals(r.name.getPackageName())) { continue; } if (!printed) { if (needSep) pw.println(); needSep = true; pw.println(" Launching content providers:"); printed = true; printedAnything = true; } pw.print(" Launching #"); pw.print(i); pw.print(": "); pw.println(r); } } if (!printedAnything) { pw.println(" (nothing)"); } } void dumpPermissionsLocked(FileDescriptor fd, PrintWriter pw, String[] args, int opti, boolean dumpAll, String dumpPackage) { boolean needSep = false; boolean printedAnything = false; pw.println("ACTIVITY MANAGER URI PERMISSIONS (dumpsys activity permissions)"); if (mGrantedUriPermissions.size() > 0) { boolean printed = false; int dumpUid = -2; if (dumpPackage != null) { try { dumpUid = mContext.getPackageManager().getPackageUidAsUser(dumpPackage, MATCH_ANY_USER, 0); } catch (NameNotFoundException e) { dumpUid = -1; } } for (int i=0; i= -1 && UserHandle.getAppId(uid) != dumpUid) { continue; } final ArrayMap perms = mGrantedUriPermissions.valueAt(i); if (!printed) { if (needSep) pw.println(); needSep = true; pw.println(" Granted Uri Permissions:"); printed = true; printedAnything = true; } pw.print(" * UID "); pw.print(uid); pw.println(" holds:"); for (UriPermission perm : perms.values()) { pw.print(" "); pw.println(perm); if (dumpAll) { perm.dump(pw, " "); } } } } if (!printedAnything) { pw.println(" (nothing)"); } } void dumpPendingIntentsLocked(FileDescriptor fd, PrintWriter pw, String[] args, int opti, boolean dumpAll, String dumpPackage) { boolean printed = false; pw.println("ACTIVITY MANAGER PENDING INTENTS (dumpsys activity intents)"); if (mIntentSenderRecords.size() > 0) { // Organize these by package name, so they are easier to read. final ArrayMap> byPackage = new ArrayMap<>(); final ArrayList> weakRefs = new ArrayList<>(); final Iterator> it = mIntentSenderRecords.values().iterator(); while (it.hasNext()) { WeakReference ref = it.next(); PendingIntentRecord rec = ref != null ? ref.get() : null; if (rec == null) { weakRefs.add(ref); continue; } if (dumpPackage != null && !dumpPackage.equals(rec.key.packageName)) { continue; } ArrayList list = byPackage.get(rec.key.packageName); if (list == null) { list = new ArrayList<>(); byPackage.put(rec.key.packageName, list); } list.add(rec); } for (int i = 0; i < byPackage.size(); i++) { ArrayList intents = byPackage.valueAt(i); printed = true; pw.print(" * "); pw.print(byPackage.keyAt(i)); pw.print(": "); pw.print(intents.size()); pw.println(" items"); for (int j = 0; j < intents.size(); j++) { pw.print(" #"); pw.print(j); pw.print(": "); pw.println(intents.get(j)); if (dumpAll) { intents.get(j).dump(pw, " "); } } } if (weakRefs.size() > 0) { printed = true; pw.println(" * WEAK REFS:"); for (int i = 0; i < weakRefs.size(); i++) { pw.print(" #"); pw.print(i); pw.print(": "); pw.println(weakRefs.get(i)); } } } if (!printed) { pw.println(" (nothing)"); } } private static final int dumpProcessList(PrintWriter pw, ActivityManagerService service, List list, String prefix, String normalLabel, String persistentLabel, String dumpPackage) { int numPers = 0; final int N = list.size()-1; for (int i=N; i>=0; i--) { ProcessRecord r = (ProcessRecord)list.get(i); if (dumpPackage != null && !dumpPackage.equals(r.info.packageName)) { continue; } pw.println(String.format("%s%s #%2d: %s", prefix, (r.persistent ? persistentLabel : normalLabel), i, r.toString())); if (r.persistent) { numPers++; } } return numPers; } private static final boolean dumpProcessOomList(PrintWriter pw, ActivityManagerService service, List origList, String prefix, String normalLabel, String persistentLabel, boolean inclDetails, String dumpPackage) { ArrayList> list = new ArrayList>(origList.size()); for (int i=0; i(origList.get(i), i)); } if (list.size() <= 0) { return false; } Comparator> comparator = new Comparator>() { @Override public int compare(Pair object1, Pair object2) { if (object1.first.setAdj != object2.first.setAdj) { return object1.first.setAdj > object2.first.setAdj ? -1 : 1; } if (object1.first.setProcState != object2.first.setProcState) { return object1.first.setProcState > object2.first.setProcState ? -1 : 1; } if (object1.second.intValue() != object2.second.intValue()) { return object1.second.intValue() > object2.second.intValue() ? -1 : 1; } return 0; } }; Collections.sort(list, comparator); final long curUptime = SystemClock.uptimeMillis(); final long uptimeSince = curUptime - service.mLastPowerCheckUptime; for (int i=list.size()-1; i>=0; i--) { ProcessRecord r = list.get(i).first; String oomAdj = ProcessList.makeOomAdjString(r.setAdj); char schedGroup; switch (r.setSchedGroup) { case ProcessList.SCHED_GROUP_BACKGROUND: schedGroup = 'B'; break; case ProcessList.SCHED_GROUP_DEFAULT: schedGroup = 'F'; break; case ProcessList.SCHED_GROUP_TOP_APP: schedGroup = 'T'; break; default: schedGroup = '?'; break; } char foreground; if (r.foregroundActivities) { foreground = 'A'; } else if (r.foregroundServices) { foreground = 'S'; } else { foreground = ' '; } String procState = ProcessList.makeProcStateString(r.curProcState); pw.print(prefix); pw.print(r.persistent ? persistentLabel : normalLabel); pw.print(" #"); int num = (origList.size()-1)-list.get(i).second; if (num < 10) pw.print(' '); pw.print(num); pw.print(": "); pw.print(oomAdj); pw.print(' '); pw.print(schedGroup); pw.print('/'); pw.print(foreground); pw.print('/'); pw.print(procState); pw.print(" trm:"); if (r.trimMemoryLevel < 10) pw.print(' '); pw.print(r.trimMemoryLevel); pw.print(' '); pw.print(r.toShortString()); pw.print(" ("); pw.print(r.adjType); pw.println(')'); if (r.adjSource != null || r.adjTarget != null) { pw.print(prefix); pw.print(" "); if (r.adjTarget instanceof ComponentName) { pw.print(((ComponentName)r.adjTarget).flattenToShortString()); } else if (r.adjTarget != null) { pw.print(r.adjTarget.toString()); } else { pw.print("{null}"); } pw.print("<="); if (r.adjSource instanceof ProcessRecord) { pw.print("Proc{"); pw.print(((ProcessRecord)r.adjSource).toShortString()); pw.println("}"); } else if (r.adjSource != null) { pw.println(r.adjSource.toString()); } else { pw.println("{null}"); } } if (inclDetails) { pw.print(prefix); pw.print(" "); pw.print("oom: max="); pw.print(r.maxAdj); pw.print(" curRaw="); pw.print(r.curRawAdj); pw.print(" setRaw="); pw.print(r.setRawAdj); pw.print(" cur="); pw.print(r.curAdj); pw.print(" set="); pw.println(r.setAdj); pw.print(prefix); pw.print(" "); pw.print("state: cur="); pw.print(ProcessList.makeProcStateString(r.curProcState)); pw.print(" set="); pw.print(ProcessList.makeProcStateString(r.setProcState)); pw.print(" lastPss="); DebugUtils.printSizeValue(pw, r.lastPss*1024); pw.print(" lastSwapPss="); DebugUtils.printSizeValue(pw, r.lastSwapPss*1024); pw.print(" lastCachedPss="); DebugUtils.printSizeValue(pw, r.lastCachedPss*1024); pw.println(); pw.print(prefix); pw.print(" "); pw.print("cached="); pw.print(r.cached); pw.print(" empty="); pw.print(r.empty); pw.print(" hasAboveClient="); pw.println(r.hasAboveClient); if (r.setProcState >= ActivityManager.PROCESS_STATE_SERVICE) { if (r.lastCpuTime != 0) { long timeUsed = r.curCpuTime - r.lastCpuTime; pw.print(prefix); pw.print(" "); pw.print("run cpu over "); TimeUtils.formatDuration(uptimeSince, pw); pw.print(" used "); TimeUtils.formatDuration(timeUsed, pw); pw.print(" ("); pw.print((timeUsed*100)/uptimeSince); pw.println("%)"); } } } } return true; } ArrayList collectProcesses(PrintWriter pw, int start, boolean allPkgs, String[] args) { ArrayList procs; synchronized (this) { if (args != null && args.length > start && args[start].charAt(0) != '-') { procs = new ArrayList(); int pid = -1; try { pid = Integer.parseInt(args[start]); } catch (NumberFormatException e) { } for (int i=mLruProcesses.size()-1; i>=0; i--) { ProcessRecord proc = mLruProcesses.get(i); if (proc.pid == pid) { procs.add(proc); } else if (allPkgs && proc.pkgList != null && proc.pkgList.containsKey(args[start])) { procs.add(proc); } else if (proc.processName.equals(args[start])) { procs.add(proc); } } if (procs.size() <= 0) { return null; } } else { procs = new ArrayList(mLruProcesses); } } return procs; } final void dumpGraphicsHardwareUsage(FileDescriptor fd, PrintWriter pw, String[] args) { ArrayList procs = collectProcesses(pw, 0, false, args); if (procs == null) { pw.println("No process found for: " + args[0]); return; } long uptime = SystemClock.uptimeMillis(); long realtime = SystemClock.elapsedRealtime(); pw.println("Applications Graphics Acceleration Info:"); pw.println("Uptime: " + uptime + " Realtime: " + realtime); for (int i = procs.size() - 1 ; i >= 0 ; i--) { ProcessRecord r = procs.get(i); if (r.thread != null) { pw.println("\n** Graphics info for pid " + r.pid + " [" + r.processName + "] **"); pw.flush(); try { TransferPipe tp = new TransferPipe(); try { r.thread.dumpGfxInfo(tp.getWriteFd(), args); tp.go(fd); } finally { tp.kill(); } } catch (IOException e) { pw.println("Failure while dumping the app: " + r); pw.flush(); } catch (RemoteException e) { pw.println("Got a RemoteException while dumping the app " + r); pw.flush(); } } } } final void dumpDbInfo(FileDescriptor fd, PrintWriter pw, String[] args) { ArrayList procs = collectProcesses(pw, 0, false, args); if (procs == null) { pw.println("No process found for: " + args[0]); return; } pw.println("Applications Database Info:"); for (int i = procs.size() - 1 ; i >= 0 ; i--) { ProcessRecord r = procs.get(i); if (r.thread != null) { pw.println("\n** Database info for pid " + r.pid + " [" + r.processName + "] **"); pw.flush(); try { TransferPipe tp = new TransferPipe(); try { r.thread.dumpDbInfo(tp.getWriteFd(), args); tp.go(fd); } finally { tp.kill(); } } catch (IOException e) { pw.println("Failure while dumping the app: " + r); pw.flush(); } catch (RemoteException e) { pw.println("Got a RemoteException while dumping the app " + r); pw.flush(); } } } } final static class MemItem { final boolean isProc; final String label; final String shortLabel; final long pss; final long swapPss; final int id; final boolean hasActivities; ArrayList subitems; public MemItem(String _label, String _shortLabel, long _pss, long _swapPss, int _id, boolean _hasActivities) { isProc = true; label = _label; shortLabel = _shortLabel; pss = _pss; swapPss = _swapPss; id = _id; hasActivities = _hasActivities; } public MemItem(String _label, String _shortLabel, long _pss, long _swapPss, int _id) { isProc = false; label = _label; shortLabel = _shortLabel; pss = _pss; swapPss = _swapPss; id = _id; hasActivities = false; } } static final void dumpMemItems(PrintWriter pw, String prefix, String tag, ArrayList items, boolean sort, boolean isCompact, boolean dumpSwapPss) { if (sort && !isCompact) { Collections.sort(items, new Comparator() { @Override public int compare(MemItem lhs, MemItem rhs) { if (lhs.pss < rhs.pss) { return 1; } else if (lhs.pss > rhs.pss) { return -1; } return 0; } }); } for (int i=0; i= 0) start++; else start = 0; int end = label.length(); for (int i=0; i= memKB) { long bucket = DUMP_MEM_BUCKETS[i]/1024; out.append(bucket); out.append(stackLike ? "MB." : "MB "); out.append(label, start, end); return; } } out.append(memKB/1024); out.append(stackLike ? "MB." : "MB "); out.append(label, start, end); } static final int[] DUMP_MEM_OOM_ADJ = new int[] { ProcessList.NATIVE_ADJ, ProcessList.SYSTEM_ADJ, ProcessList.PERSISTENT_PROC_ADJ, ProcessList.PERSISTENT_SERVICE_ADJ, ProcessList.FOREGROUND_APP_ADJ, ProcessList.VISIBLE_APP_ADJ, ProcessList.PERCEPTIBLE_APP_ADJ, ProcessList.BACKUP_APP_ADJ, ProcessList.HEAVY_WEIGHT_APP_ADJ, ProcessList.SERVICE_ADJ, ProcessList.HOME_APP_ADJ, ProcessList.PREVIOUS_APP_ADJ, ProcessList.SERVICE_B_ADJ, ProcessList.CACHED_APP_MIN_ADJ }; static final String[] DUMP_MEM_OOM_LABEL = new String[] { "Native", "System", "Persistent", "Persistent Service", "Foreground", "Visible", "Perceptible", "Heavy Weight", "Backup", "A Services", "Home", "Previous", "B Services", "Cached" }; static final String[] DUMP_MEM_OOM_COMPACT_LABEL = new String[] { "native", "sys", "pers", "persvc", "fore", "vis", "percept", "heavy", "backup", "servicea", "home", "prev", "serviceb", "cached" }; private final void dumpApplicationMemoryUsageHeader(PrintWriter pw, long uptime, long realtime, boolean isCheckinRequest, boolean isCompact) { if (isCompact) { pw.print("version,"); pw.println(MEMINFO_COMPACT_VERSION); } if (isCheckinRequest || isCompact) { // short checkin version pw.print("time,"); pw.print(uptime); pw.print(","); pw.println(realtime); } else { pw.println("Applications Memory Usage (in Kilobytes):"); pw.println("Uptime: " + uptime + " Realtime: " + realtime); } } private static final int KSM_SHARED = 0; private static final int KSM_SHARING = 1; private static final int KSM_UNSHARED = 2; private static final int KSM_VOLATILE = 3; private final long[] getKsmInfo() { long[] longOut = new long[4]; final int[] SINGLE_LONG_FORMAT = new int[] { PROC_SPACE_TERM| PROC_OUT_LONG }; long[] longTmp = new long[1]; readProcFile("/sys/kernel/mm/ksm/pages_shared", SINGLE_LONG_FORMAT, null, longTmp, null); longOut[KSM_SHARED] = longTmp[0] * ProcessList.PAGE_SIZE / 1024; longTmp[0] = 0; readProcFile("/sys/kernel/mm/ksm/pages_sharing", SINGLE_LONG_FORMAT, null, longTmp, null); longOut[KSM_SHARING] = longTmp[0] * ProcessList.PAGE_SIZE / 1024; longTmp[0] = 0; readProcFile("/sys/kernel/mm/ksm/pages_unshared", SINGLE_LONG_FORMAT, null, longTmp, null); longOut[KSM_UNSHARED] = longTmp[0] * ProcessList.PAGE_SIZE / 1024; longTmp[0] = 0; readProcFile("/sys/kernel/mm/ksm/pages_volatile", SINGLE_LONG_FORMAT, null, longTmp, null); longOut[KSM_VOLATILE] = longTmp[0] * ProcessList.PAGE_SIZE / 1024; return longOut; } private static String stringifySize(long size, int order) { Locale locale = Locale.US; switch (order) { case 1: return String.format(locale, "%,13d", size); case 1024: return String.format(locale, "%,9dK", size / 1024); case 1024 * 1024: return String.format(locale, "%,5dM", size / 1024 / 1024); case 1024 * 1024 * 1024: return String.format(locale, "%,1dG", size / 1024 / 1024 / 1024); default: throw new IllegalArgumentException("Invalid size order"); } } private static String stringifyKBSize(long size) { return stringifySize(size * 1024, 1024); } // Update this version number in case you change the 'compact' format private static final int MEMINFO_COMPACT_VERSION = 1; final void dumpApplicationMemoryUsage(FileDescriptor fd, PrintWriter pw, String prefix, String[] args, boolean brief, PrintWriter categoryPw) { boolean dumpDetails = false; boolean dumpFullDetails = false; boolean dumpDalvik = false; boolean dumpSummaryOnly = false; boolean dumpUnreachable = false; boolean oomOnly = false; boolean isCompact = false; boolean localOnly = false; boolean packages = false; boolean isCheckinRequest = false; boolean dumpSwapPss = false; int opti = 0; while (opti < args.length) { String opt = args[opti]; if (opt == null || opt.length() <= 0 || opt.charAt(0) != '-') { break; } opti++; if ("-a".equals(opt)) { dumpDetails = true; dumpFullDetails = true; dumpDalvik = true; dumpSwapPss = true; } else if ("-d".equals(opt)) { dumpDalvik = true; } else if ("-c".equals(opt)) { isCompact = true; } else if ("-s".equals(opt)) { dumpDetails = true; dumpSummaryOnly = true; } else if ("-S".equals(opt)) { dumpSwapPss = true; } else if ("--unreachable".equals(opt)) { dumpUnreachable = true; } else if ("--oom".equals(opt)) { oomOnly = true; } else if ("--local".equals(opt)) { localOnly = true; } else if ("--package".equals(opt)) { packages = true; } else if ("--checkin".equals(opt)) { isCheckinRequest = true; } else if ("-h".equals(opt)) { pw.println("meminfo dump options: [-a] [-d] [-c] [-s] [--oom] [process]"); pw.println(" -a: include all available information for each process."); pw.println(" -d: include dalvik details."); pw.println(" -c: dump in a compact machine-parseable representation."); pw.println(" -s: dump only summary of application memory usage."); pw.println(" -S: dump also SwapPss."); pw.println(" --oom: only show processes organized by oom adj."); pw.println(" --local: only collect details locally, don't call process."); pw.println(" --package: interpret process arg as package, dumping all"); pw.println(" processes that have loaded that package."); pw.println(" --checkin: dump data for a checkin"); pw.println("If [process] is specified it can be the name or "); pw.println("pid of a specific process to dump."); return; } else { pw.println("Unknown argument: " + opt + "; use -h for help"); } } long uptime = SystemClock.uptimeMillis(); long realtime = SystemClock.elapsedRealtime(); final long[] tmpLong = new long[1]; ArrayList procs = collectProcesses(pw, opti, packages, args); if (procs == null) { // No Java processes. Maybe they want to print a native process. if (args != null && args.length > opti && args[opti].charAt(0) != '-') { ArrayList nativeProcs = new ArrayList(); updateCpuStatsNow(); int findPid = -1; try { findPid = Integer.parseInt(args[opti]); } catch (NumberFormatException e) { } synchronized (mProcessCpuTracker) { final int N = mProcessCpuTracker.countStats(); for (int i=0; i 0) { dumpApplicationMemoryUsageHeader(pw, uptime, realtime, isCheckinRequest, isCompact); Debug.MemoryInfo mi = null; for (int i = nativeProcs.size() - 1 ; i >= 0 ; i--) { final ProcessCpuTracker.Stats r = nativeProcs.get(i); final int pid = r.pid; if (!isCheckinRequest && dumpDetails) { pw.println("\n** MEMINFO in pid " + pid + " [" + r.baseName + "] **"); } if (mi == null) { mi = new Debug.MemoryInfo(); } if (dumpDetails || (!brief && !oomOnly)) { Debug.getMemoryInfo(pid, mi); } else { mi.dalvikPss = (int)Debug.getPss(pid, tmpLong, null); mi.dalvikPrivateDirty = (int)tmpLong[0]; } ActivityThread.dumpMemInfoTable(pw, mi, isCheckinRequest, dumpFullDetails, dumpDalvik, dumpSummaryOnly, pid, r.baseName, 0, 0, 0, 0, 0, 0); if (isCheckinRequest) { pw.println(); } } return; } } pw.println("No process found for: " + args[opti]); return; } if (!brief && !oomOnly && (procs.size() == 1 || isCheckinRequest || packages)) { dumpDetails = true; } dumpApplicationMemoryUsageHeader(pw, uptime, realtime, isCheckinRequest, isCompact); String[] innerArgs = new String[args.length-opti]; System.arraycopy(args, opti, innerArgs, 0, args.length-opti); ArrayList procMems = new ArrayList(); final SparseArray procMemsMap = new SparseArray(); long nativePss = 0; long nativeSwapPss = 0; long dalvikPss = 0; long dalvikSwapPss = 0; long[] dalvikSubitemPss = dumpDalvik ? new long[Debug.MemoryInfo.NUM_DVK_STATS] : EmptyArray.LONG; long[] dalvikSubitemSwapPss = dumpDalvik ? new long[Debug.MemoryInfo.NUM_DVK_STATS] : EmptyArray.LONG; long otherPss = 0; long otherSwapPss = 0; long[] miscPss = new long[Debug.MemoryInfo.NUM_OTHER_STATS]; long[] miscSwapPss = new long[Debug.MemoryInfo.NUM_OTHER_STATS]; long oomPss[] = new long[DUMP_MEM_OOM_LABEL.length]; long oomSwapPss[] = new long[DUMP_MEM_OOM_LABEL.length]; ArrayList[] oomProcs = (ArrayList[]) new ArrayList[DUMP_MEM_OOM_LABEL.length]; long totalPss = 0; long totalSwapPss = 0; long cachedPss = 0; long cachedSwapPss = 0; boolean hasSwapPss = false; Debug.MemoryInfo mi = null; for (int i = procs.size() - 1 ; i >= 0 ; i--) { final ProcessRecord r = procs.get(i); final IApplicationThread thread; final int pid; final int oomAdj; final boolean hasActivities; synchronized (this) { thread = r.thread; pid = r.pid; oomAdj = r.getSetAdjWithServices(); hasActivities = r.activities.size() > 0; } if (thread != null) { if (!isCheckinRequest && dumpDetails) { pw.println("\n** MEMINFO in pid " + pid + " [" + r.processName + "] **"); } if (mi == null) { mi = new Debug.MemoryInfo(); } if (dumpDetails || (!brief && !oomOnly)) { Debug.getMemoryInfo(pid, mi); hasSwapPss = mi.hasSwappedOutPss; } else { mi.dalvikPss = (int)Debug.getPss(pid, tmpLong, null); mi.dalvikPrivateDirty = (int)tmpLong[0]; } if (dumpDetails) { if (localOnly) { ActivityThread.dumpMemInfoTable(pw, mi, isCheckinRequest, dumpFullDetails, dumpDalvik, dumpSummaryOnly, pid, r.processName, 0, 0, 0, 0, 0, 0); if (isCheckinRequest) { pw.println(); } } else { pw.flush(); try { TransferPipe tp = new TransferPipe(); try { thread.dumpMemInfo(tp.getWriteFd(), mi, isCheckinRequest, dumpFullDetails, dumpDalvik, dumpSummaryOnly, dumpUnreachable, innerArgs); tp.go(fd); } finally { tp.kill(); } } catch (IOException e) { if (!isCheckinRequest) { pw.println("Got IoException! " + e); pw.flush(); } } catch (RemoteException e) { if (!isCheckinRequest) { pw.println("Got RemoteException! " + e); pw.flush(); } } } } final long myTotalPss = mi.getTotalPss(); final long myTotalUss = mi.getTotalUss(); final long myTotalSwapPss = mi.getTotalSwappedOutPss(); synchronized (this) { if (r.thread != null && oomAdj == r.getSetAdjWithServices()) { // Record this for posterity if the process has been stable. r.baseProcessTracker.addPss(myTotalPss, myTotalUss, true, r.pkgList); } } if (!isCheckinRequest && mi != null) { totalPss += myTotalPss; totalSwapPss += myTotalSwapPss; MemItem pssItem = new MemItem(r.processName + " (pid " + pid + (hasActivities ? " / activities)" : ")"), r.processName, myTotalPss, myTotalSwapPss, pid, hasActivities); procMems.add(pssItem); procMemsMap.put(pid, pssItem); nativePss += mi.nativePss; nativeSwapPss += mi.nativeSwappedOutPss; dalvikPss += mi.dalvikPss; dalvikSwapPss += mi.dalvikSwappedOutPss; for (int j=0; j= ProcessList.CACHED_APP_MIN_ADJ) { cachedPss += myTotalPss; cachedSwapPss += myTotalSwapPss; } for (int oomIndex=0; oomIndex= DUMP_MEM_OOM_ADJ[oomIndex] && oomAdj < DUMP_MEM_OOM_ADJ[oomIndex + 1])) { oomPss[oomIndex] += myTotalPss; oomSwapPss[oomIndex] += myTotalSwapPss; if (oomProcs[oomIndex] == null) { oomProcs[oomIndex] = new ArrayList(); } oomProcs[oomIndex].add(pssItem); break; } } } } } long nativeProcTotalPss = 0; if (!isCheckinRequest && procs.size() > 1 && !packages) { // If we are showing aggregations, also look for native processes to // include so that our aggregations are more accurate. updateCpuStatsNow(); mi = null; synchronized (mProcessCpuTracker) { final int N = mProcessCpuTracker.countStats(); for (int i=0; i 0 && procMemsMap.indexOfKey(st.pid) < 0) { if (mi == null) { mi = new Debug.MemoryInfo(); } if (!brief && !oomOnly) { Debug.getMemoryInfo(st.pid, mi); } else { mi.nativePss = (int)Debug.getPss(st.pid, tmpLong, null); mi.nativePrivateDirty = (int)tmpLong[0]; } final long myTotalPss = mi.getTotalPss(); final long myTotalSwapPss = mi.getTotalSwappedOutPss(); totalPss += myTotalPss; nativeProcTotalPss += myTotalPss; MemItem pssItem = new MemItem(st.name + " (pid " + st.pid + ")", st.name, myTotalPss, mi.getSummaryTotalSwapPss(), st.pid, false); procMems.add(pssItem); nativePss += mi.nativePss; nativeSwapPss += mi.nativeSwappedOutPss; dalvikPss += mi.dalvikPss; dalvikSwapPss += mi.dalvikSwappedOutPss; for (int j=0; j(); } oomProcs[0].add(pssItem); } } } ArrayList catMems = new ArrayList(); catMems.add(new MemItem("Native", "Native", nativePss, nativeSwapPss, -1)); final int dalvikId = -2; catMems.add(new MemItem("Dalvik", "Dalvik", dalvikPss, dalvikSwapPss, dalvikId)); catMems.add(new MemItem("Unknown", "Unknown", otherPss, otherSwapPss, -3)); for (int j=0; j 0) { // Add dalvik subitems. for (MemItem memItem : catMems) { int memItemStart = 0, memItemEnd = 0; if (memItem.id == dalvikId) { memItemStart = Debug.MemoryInfo.OTHER_DVK_STAT_DALVIK_START; memItemEnd = Debug.MemoryInfo.OTHER_DVK_STAT_DALVIK_END; } else if (memItem.id == Debug.MemoryInfo.OTHER_DALVIK_OTHER) { memItemStart = Debug.MemoryInfo.OTHER_DVK_STAT_DALVIK_OTHER_START; memItemEnd = Debug.MemoryInfo.OTHER_DVK_STAT_DALVIK_OTHER_END; } else if (memItem.id == Debug.MemoryInfo.OTHER_DEX) { memItemStart = Debug.MemoryInfo.OTHER_DVK_STAT_DEX_START; memItemEnd = Debug.MemoryInfo.OTHER_DVK_STAT_DEX_END; } else if (memItem.id == Debug.MemoryInfo.OTHER_ART) { memItemStart = Debug.MemoryInfo.OTHER_DVK_STAT_ART_START; memItemEnd = Debug.MemoryInfo.OTHER_DVK_STAT_ART_END; } else { continue; // No subitems, continue. } memItem.subitems = new ArrayList(); for (int j=memItemStart; j<=memItemEnd; j++) { final String name = Debug.MemoryInfo.getOtherLabel( Debug.MemoryInfo.NUM_OTHER_STATS + j); memItem.subitems.add(new MemItem(name, name, dalvikSubitemPss[j], dalvikSubitemSwapPss[j], j)); } } } ArrayList oomMems = new ArrayList(); for (int j=0; j 0) { synchronized (this) { final long cachedKb = memInfo.getCachedSizeKb(); final long freeKb = memInfo.getFreeSizeKb(); final long zramKb = memInfo.getZramTotalSizeKb(); final long kernelKb = memInfo.getKernelUsedSizeKb(); EventLogTags.writeAmMeminfo(cachedKb*1024, freeKb*1024, zramKb*1024, kernelKb*1024, nativeProcTotalPss*1024); mProcessStats.addSysMemUsageLocked(cachedKb, freeKb, zramKb, kernelKb, nativeProcTotalPss); } } if (!brief) { if (!isCompact) { pw.print("Total RAM: "); pw.print(stringifyKBSize(memInfo.getTotalSizeKb())); pw.print(" (status "); switch (mLastMemoryLevel) { case ProcessStats.ADJ_MEM_FACTOR_NORMAL: pw.println("normal)"); break; case ProcessStats.ADJ_MEM_FACTOR_MODERATE: pw.println("moderate)"); break; case ProcessStats.ADJ_MEM_FACTOR_LOW: pw.println("low)"); break; case ProcessStats.ADJ_MEM_FACTOR_CRITICAL: pw.println("critical)"); break; default: pw.print(mLastMemoryLevel); pw.println(")"); break; } pw.print(" Free RAM: "); pw.print(stringifyKBSize(cachedPss + memInfo.getCachedSizeKb() + memInfo.getFreeSizeKb())); pw.print(" ("); pw.print(stringifyKBSize(cachedPss)); pw.print(" cached pss + "); pw.print(stringifyKBSize(memInfo.getCachedSizeKb())); pw.print(" cached kernel + "); pw.print(stringifyKBSize(memInfo.getFreeSizeKb())); pw.println(" free)"); } else { pw.print("ram,"); pw.print(memInfo.getTotalSizeKb()); pw.print(","); pw.print(cachedPss + memInfo.getCachedSizeKb() + memInfo.getFreeSizeKb()); pw.print(","); pw.println(totalPss - cachedPss); } } long lostRAM = memInfo.getTotalSizeKb() - (totalPss - totalSwapPss) - memInfo.getFreeSizeKb() - memInfo.getCachedSizeKb() - memInfo.getKernelUsedSizeKb() - memInfo.getZramTotalSizeKb(); if (!isCompact) { pw.print(" Used RAM: "); pw.print(stringifyKBSize(totalPss - cachedPss + memInfo.getKernelUsedSizeKb())); pw.print(" ("); pw.print(stringifyKBSize(totalPss - cachedPss)); pw.print(" used pss + "); pw.print(stringifyKBSize(memInfo.getKernelUsedSizeKb())); pw.print(" kernel)\n"); pw.print(" Lost RAM: "); pw.println(stringifyKBSize(lostRAM)); } else { pw.print("lostram,"); pw.println(lostRAM); } if (!brief) { if (memInfo.getZramTotalSizeKb() != 0) { if (!isCompact) { pw.print(" ZRAM: "); pw.print(stringifyKBSize(memInfo.getZramTotalSizeKb())); pw.print(" physical used for "); pw.print(stringifyKBSize(memInfo.getSwapTotalSizeKb() - memInfo.getSwapFreeSizeKb())); pw.print(" in swap ("); pw.print(stringifyKBSize(memInfo.getSwapTotalSizeKb())); pw.println(" total swap)"); } else { pw.print("zram,"); pw.print(memInfo.getZramTotalSizeKb()); pw.print(","); pw.print(memInfo.getSwapTotalSizeKb()); pw.print(","); pw.println(memInfo.getSwapFreeSizeKb()); } } final long[] ksm = getKsmInfo(); if (!isCompact) { if (ksm[KSM_SHARING] != 0 || ksm[KSM_SHARED] != 0 || ksm[KSM_UNSHARED] != 0 || ksm[KSM_VOLATILE] != 0) { pw.print(" KSM: "); pw.print(stringifyKBSize(ksm[KSM_SHARING])); pw.print(" saved from shared "); pw.print(stringifyKBSize(ksm[KSM_SHARED])); pw.print(" "); pw.print(stringifyKBSize(ksm[KSM_UNSHARED])); pw.print(" unshared; "); pw.print(stringifyKBSize( ksm[KSM_VOLATILE])); pw.println(" volatile"); } pw.print(" Tuning: "); pw.print(ActivityManager.staticGetMemoryClass()); pw.print(" (large "); pw.print(ActivityManager.staticGetLargeMemoryClass()); pw.print("), oom "); pw.print(stringifySize( mProcessList.getMemLevel(ProcessList.CACHED_APP_MAX_ADJ), 1024)); pw.print(", restore limit "); pw.print(stringifyKBSize(mProcessList.getCachedRestoreThresholdKb())); if (ActivityManager.isLowRamDeviceStatic()) { pw.print(" (low-ram)"); } if (ActivityManager.isHighEndGfx()) { pw.print(" (high-end-gfx)"); } pw.println(); } else { pw.print("ksm,"); pw.print(ksm[KSM_SHARING]); pw.print(","); pw.print(ksm[KSM_SHARED]); pw.print(","); pw.print(ksm[KSM_UNSHARED]); pw.print(","); pw.println(ksm[KSM_VOLATILE]); pw.print("tuning,"); pw.print(ActivityManager.staticGetMemoryClass()); pw.print(','); pw.print(ActivityManager.staticGetLargeMemoryClass()); pw.print(','); pw.print(mProcessList.getMemLevel(ProcessList.CACHED_APP_MAX_ADJ)/1024); if (ActivityManager.isLowRamDeviceStatic()) { pw.print(",low-ram"); } if (ActivityManager.isHighEndGfx()) { pw.print(",high-end-gfx"); } pw.println(); } } } } private void appendBasicMemEntry(StringBuilder sb, int oomAdj, int procState, long pss, long memtrack, String name) { sb.append(" "); sb.append(ProcessList.makeOomAdjString(oomAdj)); sb.append(' '); sb.append(ProcessList.makeProcStateString(procState)); sb.append(' '); ProcessList.appendRamKb(sb, pss); sb.append(": "); sb.append(name); if (memtrack > 0) { sb.append(" ("); sb.append(stringifyKBSize(memtrack)); sb.append(" memtrack)"); } } private void appendMemInfo(StringBuilder sb, ProcessMemInfo mi) { appendBasicMemEntry(sb, mi.oomAdj, mi.procState, mi.pss, mi.memtrack, mi.name); sb.append(" (pid "); sb.append(mi.pid); sb.append(") "); sb.append(mi.adjType); sb.append('\n'); if (mi.adjReason != null) { sb.append(" "); sb.append(mi.adjReason); sb.append('\n'); } } void reportMemUsage(ArrayList memInfos) { final SparseArray infoMap = new SparseArray<>(memInfos.size()); for (int i=0, N=memInfos.size(); i stats; // Get a list of Stats that have vsize > 0 synchronized (mProcessCpuTracker) { stats = mProcessCpuTracker.getStats((st) -> { return st.vsize > 0; }); } final int statsCount = stats.size(); for (int i = 0; i < statsCount; i++) { ProcessCpuTracker.Stats st = stats.get(i); long pss = Debug.getPss(st.pid, null, memtrackTmp); if (pss > 0) { if (infoMap.indexOfKey(st.pid) < 0) { ProcessMemInfo mi = new ProcessMemInfo(st.name, st.pid, ProcessList.NATIVE_ADJ, -1, "native", null); mi.pss = pss; mi.memtrack = memtrackTmp[0]; memInfos.add(mi); } } } long totalPss = 0; long totalMemtrack = 0; for (int i=0, N=memInfos.size(); i() { @Override public int compare(ProcessMemInfo lhs, ProcessMemInfo rhs) { if (lhs.oomAdj != rhs.oomAdj) { return lhs.oomAdj < rhs.oomAdj ? -1 : 1; } if (lhs.pss != rhs.pss) { return lhs.pss < rhs.pss ? 1 : -1; } return 0; } }); StringBuilder tag = new StringBuilder(128); StringBuilder stack = new StringBuilder(128); tag.append("Low on memory -- "); appendMemBucket(tag, totalPss, "total", false); appendMemBucket(stack, totalPss, "total", true); StringBuilder fullNativeBuilder = new StringBuilder(1024); StringBuilder shortNativeBuilder = new StringBuilder(1024); StringBuilder fullJavaBuilder = new StringBuilder(1024); boolean firstLine = true; int lastOomAdj = Integer.MIN_VALUE; long extraNativeRam = 0; long extraNativeMemtrack = 0; long cachedPss = 0; for (int i=0, N=memInfos.size(); i= ProcessList.CACHED_APP_MIN_ADJ) { cachedPss += mi.pss; } if (mi.oomAdj != ProcessList.NATIVE_ADJ && (mi.oomAdj < ProcessList.SERVICE_ADJ || mi.oomAdj == ProcessList.HOME_APP_ADJ || mi.oomAdj == ProcessList.PREVIOUS_APP_ADJ)) { if (lastOomAdj != mi.oomAdj) { lastOomAdj = mi.oomAdj; if (mi.oomAdj <= ProcessList.FOREGROUND_APP_ADJ) { tag.append(" / "); } if (mi.oomAdj >= ProcessList.FOREGROUND_APP_ADJ) { if (firstLine) { stack.append(":"); firstLine = false; } stack.append("\n\t at "); } else { stack.append("$"); } } else { tag.append(" "); stack.append("$"); } if (mi.oomAdj <= ProcessList.FOREGROUND_APP_ADJ) { appendMemBucket(tag, mi.pss, mi.name, false); } appendMemBucket(stack, mi.pss, mi.name, true); if (mi.oomAdj >= ProcessList.FOREGROUND_APP_ADJ && ((i+1) >= N || memInfos.get(i+1).oomAdj != lastOomAdj)) { stack.append("("); for (int k=0; k= 512K. if (mi.pss >= 512) { appendMemInfo(shortNativeBuilder, mi); } else { extraNativeRam += mi.pss; extraNativeMemtrack += mi.memtrack; } } else { // Short form has all other details, but if we have collected RAM // from smaller native processes let's dump a summary of that. if (extraNativeRam > 0) { appendBasicMemEntry(shortNativeBuilder, ProcessList.NATIVE_ADJ, -1, extraNativeRam, extraNativeMemtrack, "(Other native)"); shortNativeBuilder.append('\n'); extraNativeRam = 0; } appendMemInfo(fullJavaBuilder, mi); } } fullJavaBuilder.append(" "); ProcessList.appendRamKb(fullJavaBuilder, totalPss); fullJavaBuilder.append(": TOTAL"); if (totalMemtrack > 0) { fullJavaBuilder.append(" ("); fullJavaBuilder.append(stringifyKBSize(totalMemtrack)); fullJavaBuilder.append(" memtrack)"); } else { } fullJavaBuilder.append("\n"); MemInfoReader memInfo = new MemInfoReader(); memInfo.readMemInfo(); final long[] infos = memInfo.getRawInfo(); StringBuilder memInfoBuilder = new StringBuilder(1024); Debug.getMemInfo(infos); memInfoBuilder.append(" MemInfo: "); memInfoBuilder.append(stringifyKBSize(infos[Debug.MEMINFO_SLAB])).append(" slab, "); memInfoBuilder.append(stringifyKBSize(infos[Debug.MEMINFO_SHMEM])).append(" shmem, "); memInfoBuilder.append(stringifyKBSize( infos[Debug.MEMINFO_VM_ALLOC_USED])).append(" vm alloc, "); memInfoBuilder.append(stringifyKBSize( infos[Debug.MEMINFO_PAGE_TABLES])).append(" page tables "); memInfoBuilder.append(stringifyKBSize( infos[Debug.MEMINFO_KERNEL_STACK])).append(" kernel stack\n"); memInfoBuilder.append(" "); memInfoBuilder.append(stringifyKBSize(infos[Debug.MEMINFO_BUFFERS])).append(" buffers, "); memInfoBuilder.append(stringifyKBSize(infos[Debug.MEMINFO_CACHED])).append(" cached, "); memInfoBuilder.append(stringifyKBSize(infos[Debug.MEMINFO_MAPPED])).append(" mapped, "); memInfoBuilder.append(stringifyKBSize(infos[Debug.MEMINFO_FREE])).append(" free\n"); if (infos[Debug.MEMINFO_ZRAM_TOTAL] != 0) { memInfoBuilder.append(" ZRAM: "); memInfoBuilder.append(stringifyKBSize(infos[Debug.MEMINFO_ZRAM_TOTAL])); memInfoBuilder.append(" RAM, "); memInfoBuilder.append(stringifyKBSize(infos[Debug.MEMINFO_SWAP_TOTAL])); memInfoBuilder.append(" swap total, "); memInfoBuilder.append(stringifyKBSize(infos[Debug.MEMINFO_SWAP_FREE])); memInfoBuilder.append(" swap free\n"); } final long[] ksm = getKsmInfo(); if (ksm[KSM_SHARING] != 0 || ksm[KSM_SHARED] != 0 || ksm[KSM_UNSHARED] != 0 || ksm[KSM_VOLATILE] != 0) { memInfoBuilder.append(" KSM: "); memInfoBuilder.append(stringifyKBSize(ksm[KSM_SHARING])); memInfoBuilder.append(" saved from shared "); memInfoBuilder.append(stringifyKBSize(ksm[KSM_SHARED])); memInfoBuilder.append("\n "); memInfoBuilder.append(stringifyKBSize(ksm[KSM_UNSHARED])); memInfoBuilder.append(" unshared; "); memInfoBuilder.append(stringifyKBSize(ksm[KSM_VOLATILE])); memInfoBuilder.append(" volatile\n"); } memInfoBuilder.append(" Free RAM: "); memInfoBuilder.append(stringifyKBSize(cachedPss + memInfo.getCachedSizeKb() + memInfo.getFreeSizeKb())); memInfoBuilder.append("\n"); memInfoBuilder.append(" Used RAM: "); memInfoBuilder.append(stringifyKBSize( totalPss - cachedPss + memInfo.getKernelUsedSizeKb())); memInfoBuilder.append("\n"); memInfoBuilder.append(" Lost RAM: "); memInfoBuilder.append(stringifyKBSize(memInfo.getTotalSizeKb() - totalPss - memInfo.getFreeSizeKb() - memInfo.getCachedSizeKb() - memInfo.getKernelUsedSizeKb() - memInfo.getZramTotalSizeKb())); memInfoBuilder.append("\n"); Slog.i(TAG, "Low on memory:"); Slog.i(TAG, shortNativeBuilder.toString()); Slog.i(TAG, fullJavaBuilder.toString()); Slog.i(TAG, memInfoBuilder.toString()); StringBuilder dropBuilder = new StringBuilder(1024); /* StringWriter oomSw = new StringWriter(); PrintWriter oomPw = new FastPrintWriter(oomSw, false, 256); StringWriter catSw = new StringWriter(); PrintWriter catPw = new FastPrintWriter(catSw, false, 256); String[] emptyArgs = new String[] { }; dumpApplicationMemoryUsage(null, oomPw, " ", emptyArgs, true, catPw); oomPw.flush(); String oomString = oomSw.toString(); */ dropBuilder.append("Low on memory:"); dropBuilder.append(stack); dropBuilder.append('\n'); dropBuilder.append(fullNativeBuilder); dropBuilder.append(fullJavaBuilder); dropBuilder.append('\n'); dropBuilder.append(memInfoBuilder); dropBuilder.append('\n'); /* dropBuilder.append(oomString); dropBuilder.append('\n'); */ StringWriter catSw = new StringWriter(); synchronized (ActivityManagerService.this) { PrintWriter catPw = new FastPrintWriter(catSw, false, 256); String[] emptyArgs = new String[] { }; catPw.println(); dumpProcessesLocked(null, catPw, emptyArgs, 0, false, null); catPw.println(); mServices.newServiceDumperLocked(null, catPw, emptyArgs, 0, false, null).dumpLocked(); catPw.println(); dumpActivitiesLocked(null, catPw, emptyArgs, 0, false, false, null); catPw.flush(); } dropBuilder.append(catSw.toString()); addErrorToDropBox("lowmem", null, "system_server", null, null, tag.toString(), dropBuilder.toString(), null, null); //Slog.i(TAG, "Sent to dropbox:"); //Slog.i(TAG, dropBuilder.toString()); synchronized (ActivityManagerService.this) { long now = SystemClock.uptimeMillis(); if (mLastMemUsageReportTime < now) { mLastMemUsageReportTime = now; } } } /** * Searches array of arguments for the specified string * @param args array of argument strings * @param value value to search for * @return true if the value is contained in the array */ private static boolean scanArgs(String[] args, String value) { if (args != null) { for (String arg : args) { if (value.equals(arg)) { return true; } } } return false; } private final boolean removeDyingProviderLocked(ProcessRecord proc, ContentProviderRecord cpr, boolean always) { final boolean inLaunching = mLaunchingProviders.contains(cpr); if (!inLaunching || always) { synchronized (cpr) { cpr.launchingApp = null; cpr.notifyAll(); } mProviderMap.removeProviderByClass(cpr.name, UserHandle.getUserId(cpr.uid)); String names[] = cpr.info.authority.split(";"); for (int j = 0; j < names.length; j++) { mProviderMap.removeProviderByName(names[j], UserHandle.getUserId(cpr.uid)); } } for (int i = cpr.connections.size() - 1; i >= 0; i--) { ContentProviderConnection conn = cpr.connections.get(i); if (conn.waiting) { // If this connection is waiting for the provider, then we don't // need to mess with its process unless we are always removing // or for some reason the provider is not currently launching. if (inLaunching && !always) { continue; } } ProcessRecord capp = conn.client; conn.dead = true; if (conn.stableCount > 0) { if (!capp.persistent && capp.thread != null && capp.pid != 0 && capp.pid != MY_PID) { capp.kill("depends on provider " + cpr.name.flattenToShortString() + " in dying proc " + (proc != null ? proc.processName : "??") + " (adj " + (proc != null ? proc.setAdj : "??") + ")", true); } } else if (capp.thread != null && conn.provider.provider != null) { try { capp.thread.unstableProviderDied(conn.provider.provider.asBinder()); } catch (RemoteException e) { } // In the protocol here, we don't expect the client to correctly // clean up this connection, we'll just remove it. cpr.connections.remove(i); if (conn.client.conProviders.remove(conn)) { stopAssociationLocked(capp.uid, capp.processName, cpr.uid, cpr.name); } } } if (inLaunching && always) { mLaunchingProviders.remove(cpr); } return inLaunching; } /** * Main code for cleaning up a process when it has gone away. This is * called both as a result of the process dying, or directly when stopping * a process when running in single process mode. * * @return Returns true if the given process has been restarted, so the * app that was passed in must remain on the process lists. */ private final boolean cleanUpApplicationRecordLocked(ProcessRecord app, boolean restarting, boolean allowRestart, int index, boolean replacingPid) { if (index >= 0) { removeLruProcessLocked(app); ProcessList.remove(app.pid); } mProcessesToGc.remove(app); mPendingPssProcesses.remove(app); // Dismiss any open dialogs. if (app.crashDialog != null && !app.forceCrashReport) { app.crashDialog.dismiss(); app.crashDialog = null; } if (app.anrDialog != null) { app.anrDialog.dismiss(); app.anrDialog = null; } if (app.waitDialog != null) { app.waitDialog.dismiss(); app.waitDialog = null; } app.crashing = false; app.notResponding = false; app.resetPackageList(mProcessStats); app.unlinkDeathRecipient(); app.makeInactive(mProcessStats); app.waitingToKill = null; app.forcingToImportant = null; updateProcessForegroundLocked(app, false, false); app.foregroundActivities = false; app.hasShownUi = false; app.treatLikeActivity = false; app.hasAboveClient = false; app.hasClientActivities = false; mServices.killServicesLocked(app, allowRestart); boolean restart = false; // Remove published content providers. for (int i = app.pubProviders.size() - 1; i >= 0; i--) { ContentProviderRecord cpr = app.pubProviders.valueAt(i); final boolean always = app.bad || !allowRestart; boolean inLaunching = removeDyingProviderLocked(app, cpr, always); if ((inLaunching || always) && cpr.hasConnectionOrHandle()) { // We left the provider in the launching list, need to // restart it. restart = true; } cpr.provider = null; cpr.proc = null; } app.pubProviders.clear(); // Take care of any launching providers waiting for this process. if (cleanupAppInLaunchingProvidersLocked(app, false)) { restart = true; } // Unregister from connected content providers. if (!app.conProviders.isEmpty()) { for (int i = app.conProviders.size() - 1; i >= 0; i--) { ContentProviderConnection conn = app.conProviders.get(i); conn.provider.connections.remove(conn); stopAssociationLocked(app.uid, app.processName, conn.provider.uid, conn.provider.name); } app.conProviders.clear(); } // At this point there may be remaining entries in mLaunchingProviders // where we were the only one waiting, so they are no longer of use. // Look for these and clean up if found. // XXX Commented out for now. Trying to figure out a way to reproduce // the actual situation to identify what is actually going on. if (false) { for (int i = mLaunchingProviders.size() - 1; i >= 0; i--) { ContentProviderRecord cpr = mLaunchingProviders.get(i); if (cpr.connections.size() <= 0 && !cpr.hasExternalProcessHandles()) { synchronized (cpr) { cpr.launchingApp = null; cpr.notifyAll(); } } } } skipCurrentReceiverLocked(app); // Unregister any receivers. for (int i = app.receivers.size() - 1; i >= 0; i--) { removeReceiverLocked(app.receivers.valueAt(i)); } app.receivers.clear(); // If the app is undergoing backup, tell the backup manager about it if (mBackupTarget != null && app.pid == mBackupTarget.app.pid) { if (DEBUG_BACKUP || DEBUG_CLEANUP) Slog.d(TAG_CLEANUP, "App " + mBackupTarget.appInfo + " died during backup"); mHandler.post(new Runnable() { @Override public void run(){ try { IBackupManager bm = IBackupManager.Stub.asInterface( ServiceManager.getService(Context.BACKUP_SERVICE)); bm.agentDisconnected(app.info.packageName); } catch (RemoteException e) { // can't happen; backup manager is local } } }); } for (int i = mPendingProcessChanges.size() - 1; i >= 0; i--) { ProcessChangeItem item = mPendingProcessChanges.get(i); if (item.pid == app.pid) { mPendingProcessChanges.remove(i); mAvailProcessChanges.add(item); } } mUiHandler.obtainMessage(DISPATCH_PROCESS_DIED_UI_MSG, app.pid, app.info.uid, null).sendToTarget(); // If the caller is restarting this app, then leave it in its // current lists and let the caller take care of it. if (restarting) { return false; } if (!app.persistent || app.isolated) { if (DEBUG_PROCESSES || DEBUG_CLEANUP) Slog.v(TAG_CLEANUP, "Removing non-persistent process during cleanup: " + app); if (!replacingPid) { removeProcessNameLocked(app.processName, app.uid, app); } if (mHeavyWeightProcess == app) { mHandler.sendMessage(mHandler.obtainMessage(CANCEL_HEAVY_NOTIFICATION_MSG, mHeavyWeightProcess.userId, 0)); mHeavyWeightProcess = null; } } else if (!app.removed) { // This app is persistent, so we need to keep its record around. // If it is not already on the pending app list, add it there // and start a new process for it. if (mPersistentStartingProcesses.indexOf(app) < 0) { mPersistentStartingProcesses.add(app); restart = true; } } if ((DEBUG_PROCESSES || DEBUG_CLEANUP) && mProcessesOnHold.contains(app)) Slog.v( TAG_CLEANUP, "Clean-up removing on hold: " + app); mProcessesOnHold.remove(app); if (app == mHomeProcess) { mHomeProcess = null; } if (app == mPreviousProcess) { mPreviousProcess = null; } if (restart && !app.isolated) { // We have components that still need to be running in the // process, so re-launch it. if (index < 0) { ProcessList.remove(app.pid); } addProcessNameLocked(app); startProcessLocked(app, "restart", app.processName); return true; } else if (app.pid > 0 && app.pid != MY_PID) { // Goodbye! boolean removed; synchronized (mPidsSelfLocked) { mPidsSelfLocked.remove(app.pid); mHandler.removeMessages(PROC_START_TIMEOUT_MSG, app); } mBatteryStatsService.noteProcessFinish(app.processName, app.info.uid); if (app.isolated) { mBatteryStatsService.removeIsolatedUid(app.uid, app.info.uid); } app.setPid(0); } return false; } boolean checkAppInLaunchingProvidersLocked(ProcessRecord app) { for (int i = mLaunchingProviders.size() - 1; i >= 0; i--) { ContentProviderRecord cpr = mLaunchingProviders.get(i); if (cpr.launchingApp == app) { return true; } } return false; } boolean cleanupAppInLaunchingProvidersLocked(ProcessRecord app, boolean alwaysBad) { // Look through the content providers we are waiting to have launched, // and if any run in this process then either schedule a restart of // the process or kill the client waiting for it if this process has // gone bad. boolean restart = false; for (int i = mLaunchingProviders.size() - 1; i >= 0; i--) { ContentProviderRecord cpr = mLaunchingProviders.get(i); if (cpr.launchingApp == app) { if (!alwaysBad && !app.bad && cpr.hasConnectionOrHandle()) { restart = true; } else { removeDyingProviderLocked(app, cpr, true); } } } return restart; } // ========================================================= // SERVICES // ========================================================= @Override public List getServices(int maxNum, int flags) { enforceNotIsolatedCaller("getServices"); final int callingUid = Binder.getCallingUid(); final boolean canInteractAcrossUsers = (ActivityManager.checkUidPermission( INTERACT_ACROSS_USERS_FULL, callingUid) == PERMISSION_GRANTED); final boolean allowed = isGetTasksAllowed("getServices", Binder.getCallingPid(), callingUid); synchronized (this) { return mServices.getRunningServiceInfoLocked(maxNum, flags, callingUid, allowed, canInteractAcrossUsers); } } @Override public PendingIntent getRunningServiceControlPanel(ComponentName name) { enforceNotIsolatedCaller("getRunningServiceControlPanel"); synchronized (this) { return mServices.getRunningServiceControlPanelLocked(name); } } @Override public ComponentName startService(IApplicationThread caller, Intent service, String resolvedType, boolean requireForeground, String callingPackage, int userId) throws TransactionTooLargeException { enforceNotIsolatedCaller("startService"); // Refuse possible leaked file descriptors if (service != null && service.hasFileDescriptors() == true) { throw new IllegalArgumentException("File descriptors passed in Intent"); } if (callingPackage == null) { throw new IllegalArgumentException("callingPackage cannot be null"); } if (DEBUG_SERVICE) Slog.v(TAG_SERVICE, "*** startService: " + service + " type=" + resolvedType + " fg=" + requireForeground); synchronized(this) { final int callingPid = Binder.getCallingPid(); final int callingUid = Binder.getCallingUid(); final long origId = Binder.clearCallingIdentity(); ComponentName res; try { res = mServices.startServiceLocked(caller, service, resolvedType, callingPid, callingUid, requireForeground, callingPackage, userId); } finally { Binder.restoreCallingIdentity(origId); } return res; } } ComponentName startServiceInPackage(int uid, Intent service, String resolvedType, boolean fgRequired, String callingPackage, int userId) throws TransactionTooLargeException { synchronized(this) { if (DEBUG_SERVICE) Slog.v(TAG_SERVICE, "startServiceInPackage: " + service + " type=" + resolvedType); final long origId = Binder.clearCallingIdentity(); ComponentName res; try { res = mServices.startServiceLocked(null, service, resolvedType, -1, uid, fgRequired, callingPackage, userId); } finally { Binder.restoreCallingIdentity(origId); } return res; } } @Override public int stopService(IApplicationThread caller, Intent service, String resolvedType, int userId) { enforceNotIsolatedCaller("stopService"); // Refuse possible leaked file descriptors if (service != null && service.hasFileDescriptors() == true) { throw new IllegalArgumentException("File descriptors passed in Intent"); } synchronized(this) { return mServices.stopServiceLocked(caller, service, resolvedType, userId); } } @Override public IBinder peekService(Intent service, String resolvedType, String callingPackage) { enforceNotIsolatedCaller("peekService"); // Refuse possible leaked file descriptors if (service != null && service.hasFileDescriptors() == true) { throw new IllegalArgumentException("File descriptors passed in Intent"); } if (callingPackage == null) { throw new IllegalArgumentException("callingPackage cannot be null"); } synchronized(this) { return mServices.peekServiceLocked(service, resolvedType, callingPackage); } } @Override public boolean stopServiceToken(ComponentName className, IBinder token, int startId) { synchronized(this) { return mServices.stopServiceTokenLocked(className, token, startId); } } @Override public void setServiceForeground(ComponentName className, IBinder token, int id, Notification notification, int flags) { synchronized(this) { mServices.setServiceForegroundLocked(className, token, id, notification, flags); } } @Override public int handleIncomingUser(int callingPid, int callingUid, int userId, boolean allowAll, boolean requireFull, String name, String callerPackage) { return mUserController.handleIncomingUser(callingPid, callingUid, userId, allowAll, requireFull ? ALLOW_FULL_ONLY : ALLOW_NON_FULL, name, callerPackage); } boolean isSingleton(String componentProcessName, ApplicationInfo aInfo, String className, int flags) { boolean result = false; // For apps that don't have pre-defined UIDs, check for permission if (UserHandle.getAppId(aInfo.uid) >= FIRST_APPLICATION_UID) { if ((flags & ServiceInfo.FLAG_SINGLE_USER) != 0) { if (ActivityManager.checkUidPermission( INTERACT_ACROSS_USERS, aInfo.uid) != PackageManager.PERMISSION_GRANTED) { ComponentName comp = new ComponentName(aInfo.packageName, className); String msg = "Permission Denial: Component " + comp.flattenToShortString() + " requests FLAG_SINGLE_USER, but app does not hold " + INTERACT_ACROSS_USERS; Slog.w(TAG, msg); throw new SecurityException(msg); } // Permission passed result = true; } } else if ("system".equals(componentProcessName)) { result = true; } else if ((flags & ServiceInfo.FLAG_SINGLE_USER) != 0) { // Phone app and persistent apps are allowed to export singleuser providers. result = UserHandle.isSameApp(aInfo.uid, PHONE_UID) || (aInfo.flags & ApplicationInfo.FLAG_PERSISTENT) != 0; } if (DEBUG_MU) Slog.v(TAG_MU, "isSingleton(" + componentProcessName + ", " + aInfo + ", " + className + ", 0x" + Integer.toHexString(flags) + ") = " + result); return result; } /** * Checks to see if the caller is in the same app as the singleton * component, or the component is in a special app. It allows special apps * to export singleton components but prevents exporting singleton * components for regular apps. */ boolean isValidSingletonCall(int callingUid, int componentUid) { int componentAppId = UserHandle.getAppId(componentUid); return UserHandle.isSameApp(callingUid, componentUid) || componentAppId == SYSTEM_UID || componentAppId == PHONE_UID || ActivityManager.checkUidPermission(INTERACT_ACROSS_USERS_FULL, componentUid) == PackageManager.PERMISSION_GRANTED; } public int bindService(IApplicationThread caller, IBinder token, Intent service, String resolvedType, IServiceConnection connection, int flags, String callingPackage, int userId) throws TransactionTooLargeException { enforceNotIsolatedCaller("bindService"); // Refuse possible leaked file descriptors if (service != null && service.hasFileDescriptors() == true) { throw new IllegalArgumentException("File descriptors passed in Intent"); } if (callingPackage == null) { throw new IllegalArgumentException("callingPackage cannot be null"); } synchronized(this) { return mServices.bindServiceLocked(caller, token, service, resolvedType, connection, flags, callingPackage, userId); } } public boolean unbindService(IServiceConnection connection) { synchronized (this) { return mServices.unbindServiceLocked(connection); } } public void publishService(IBinder token, Intent intent, IBinder service) { // Refuse possible leaked file descriptors if (intent != null && intent.hasFileDescriptors() == true) { throw new IllegalArgumentException("File descriptors passed in Intent"); } synchronized(this) { if (!(token instanceof ServiceRecord)) { throw new IllegalArgumentException("Invalid service token"); } mServices.publishServiceLocked((ServiceRecord)token, intent, service); } } public void unbindFinished(IBinder token, Intent intent, boolean doRebind) { // Refuse possible leaked file descriptors if (intent != null && intent.hasFileDescriptors() == true) { throw new IllegalArgumentException("File descriptors passed in Intent"); } synchronized(this) { mServices.unbindFinishedLocked((ServiceRecord)token, intent, doRebind); } } public void serviceDoneExecuting(IBinder token, int type, int startId, int res) { synchronized(this) { if (!(token instanceof ServiceRecord)) { Slog.e(TAG, "serviceDoneExecuting: Invalid service token=" + token); throw new IllegalArgumentException("Invalid service token"); } mServices.serviceDoneExecutingLocked((ServiceRecord)token, type, startId, res); } } // ========================================================= // BACKUP AND RESTORE // ========================================================= // Cause the target app to be launched if necessary and its backup agent // instantiated. The backup agent will invoke backupAgentCreated() on the // activity manager to announce its creation. public boolean bindBackupAgent(String packageName, int backupMode, int userId) { if (DEBUG_BACKUP) Slog.v(TAG, "bindBackupAgent: app=" + packageName + " mode=" + backupMode); enforceCallingPermission("android.permission.CONFIRM_FULL_BACKUP", "bindBackupAgent"); IPackageManager pm = AppGlobals.getPackageManager(); ApplicationInfo app = null; try { app = pm.getApplicationInfo(packageName, 0, userId); } catch (RemoteException e) { // can't happen; package manager is process-local } if (app == null) { Slog.w(TAG, "Unable to bind backup agent for " + packageName); return false; } int oldBackupUid; int newBackupUid; synchronized(this) { // !!! TODO: currently no check here that we're already bound BatteryStatsImpl.Uid.Pkg.Serv ss = null; BatteryStatsImpl stats = mBatteryStatsService.getActiveStatistics(); synchronized (stats) { ss = stats.getServiceStatsLocked(app.uid, app.packageName, app.name); } // Backup agent is now in use, its package can't be stopped. try { AppGlobals.getPackageManager().setPackageStoppedState( app.packageName, false, UserHandle.getUserId(app.uid)); } catch (RemoteException e) { } catch (IllegalArgumentException e) { Slog.w(TAG, "Failed trying to unstop package " + app.packageName + ": " + e); } BackupRecord r = new BackupRecord(ss, app, backupMode); ComponentName hostingName = (backupMode == ApplicationThreadConstants.BACKUP_MODE_INCREMENTAL) ? new ComponentName(app.packageName, app.backupAgentName) : new ComponentName("android", "FullBackupAgent"); // startProcessLocked() returns existing proc's record if it's already running ProcessRecord proc = startProcessLocked(app.processName, app, false, 0, "backup", hostingName, false, false, false); if (proc == null) { Slog.e(TAG, "Unable to start backup agent process " + r); return false; } // If the app is a regular app (uid >= 10000) and not the system server or phone // process, etc, then mark it as being in full backup so that certain calls to the // process can be blocked. This is not reset to false anywhere because we kill the // process after the full backup is done and the ProcessRecord will vaporize anyway. if (UserHandle.isApp(app.uid) && backupMode == ApplicationThreadConstants.BACKUP_MODE_FULL) { proc.inFullBackup = true; } r.app = proc; oldBackupUid = mBackupTarget != null ? mBackupTarget.appInfo.uid : -1; newBackupUid = proc.inFullBackup ? r.appInfo.uid : -1; mBackupTarget = r; mBackupAppName = app.packageName; // Try not to kill the process during backup updateOomAdjLocked(proc, true); // If the process is already attached, schedule the creation of the backup agent now. // If it is not yet live, this will be done when it attaches to the framework. if (proc.thread != null) { if (DEBUG_BACKUP) Slog.v(TAG_BACKUP, "Agent proc already running: " + proc); try { proc.thread.scheduleCreateBackupAgent(app, compatibilityInfoForPackageLocked(app), backupMode); } catch (RemoteException e) { // Will time out on the backup manager side } } else { if (DEBUG_BACKUP) Slog.v(TAG_BACKUP, "Agent proc not running, waiting for attach"); } // Invariants: at this point, the target app process exists and the application // is either already running or in the process of coming up. mBackupTarget and // mBackupAppName describe the app, so that when it binds back to the AM we // know that it's scheduled for a backup-agent operation. } JobSchedulerInternal js = LocalServices.getService(JobSchedulerInternal.class); if (oldBackupUid != -1) { js.removeBackingUpUid(oldBackupUid); } if (newBackupUid != -1) { js.addBackingUpUid(newBackupUid); } return true; } @Override public void clearPendingBackup() { if (DEBUG_BACKUP) Slog.v(TAG_BACKUP, "clearPendingBackup"); enforceCallingPermission("android.permission.BACKUP", "clearPendingBackup"); synchronized (this) { mBackupTarget = null; mBackupAppName = null; } JobSchedulerInternal js = LocalServices.getService(JobSchedulerInternal.class); js.clearAllBackingUpUids(); } // A backup agent has just come up public void backupAgentCreated(String agentPackageName, IBinder agent) { if (DEBUG_BACKUP) Slog.v(TAG_BACKUP, "backupAgentCreated: " + agentPackageName + " = " + agent); synchronized(this) { if (!agentPackageName.equals(mBackupAppName)) { Slog.e(TAG, "Backup agent created for " + agentPackageName + " but not requested!"); return; } } long oldIdent = Binder.clearCallingIdentity(); try { IBackupManager bm = IBackupManager.Stub.asInterface( ServiceManager.getService(Context.BACKUP_SERVICE)); bm.agentConnected(agentPackageName, agent); } catch (RemoteException e) { // can't happen; the backup manager service is local } catch (Exception e) { Slog.w(TAG, "Exception trying to deliver BackupAgent binding: "); e.printStackTrace(); } finally { Binder.restoreCallingIdentity(oldIdent); } } // done with this agent public void unbindBackupAgent(ApplicationInfo appInfo) { if (DEBUG_BACKUP) Slog.v(TAG_BACKUP, "unbindBackupAgent: " + appInfo); if (appInfo == null) { Slog.w(TAG, "unbind backup agent for null app"); return; } int oldBackupUid; synchronized(this) { try { if (mBackupAppName == null) { Slog.w(TAG, "Unbinding backup agent with no active backup"); return; } if (!mBackupAppName.equals(appInfo.packageName)) { Slog.e(TAG, "Unbind of " + appInfo + " but is not the current backup target"); return; } // Not backing this app up any more; reset its OOM adjustment final ProcessRecord proc = mBackupTarget.app; updateOomAdjLocked(proc, true); proc.inFullBackup = false; oldBackupUid = mBackupTarget != null ? mBackupTarget.appInfo.uid : -1; // If the app crashed during backup, 'thread' will be null here if (proc.thread != null) { try { proc.thread.scheduleDestroyBackupAgent(appInfo, compatibilityInfoForPackageLocked(appInfo)); } catch (Exception e) { Slog.e(TAG, "Exception when unbinding backup agent:"); e.printStackTrace(); } } } finally { mBackupTarget = null; mBackupAppName = null; } } if (oldBackupUid != -1) { JobSchedulerInternal js = LocalServices.getService(JobSchedulerInternal.class); js.removeBackingUpUid(oldBackupUid); } } // ========================================================= // BROADCASTS // ========================================================= private boolean isInstantApp(ProcessRecord record, String callerPackage, int uid) { if (UserHandle.getAppId(uid) < FIRST_APPLICATION_UID) { return false; } // Easy case -- we have the app's ProcessRecord. if (record != null) { return record.info.isInstantApp(); } // Otherwise check with PackageManager. if (callerPackage == null) { Slog.e(TAG, "isInstantApp with an application's uid, no record, and no package name"); throw new IllegalArgumentException("Calling application did not provide package name"); } mAppOpsService.checkPackage(uid, callerPackage); try { IPackageManager pm = AppGlobals.getPackageManager(); return pm.isInstantApp(callerPackage, UserHandle.getUserId(uid)); } catch (RemoteException e) { Slog.e(TAG, "Error looking up if " + callerPackage + " is an instant app.", e); return true; } } boolean isPendingBroadcastProcessLocked(int pid) { return mFgBroadcastQueue.isPendingBroadcastProcessLocked(pid) || mBgBroadcastQueue.isPendingBroadcastProcessLocked(pid); } void skipPendingBroadcastLocked(int pid) { Slog.w(TAG, "Unattached app died before broadcast acknowledged, skipping"); for (BroadcastQueue queue : mBroadcastQueues) { queue.skipPendingBroadcastLocked(pid); } } // The app just attached; send any pending broadcasts that it should receive boolean sendPendingBroadcastsLocked(ProcessRecord app) { boolean didSomething = false; for (BroadcastQueue queue : mBroadcastQueues) { didSomething |= queue.sendPendingBroadcastsLocked(app); } return didSomething; } public Intent registerReceiver(IApplicationThread caller, String callerPackage, IIntentReceiver receiver, IntentFilter filter, String permission, int userId, int flags) { enforceNotIsolatedCaller("registerReceiver"); ArrayList stickyIntents = null; ProcessRecord callerApp = null; final boolean visibleToInstantApps = (flags & Context.RECEIVER_VISIBLE_TO_INSTANT_APPS) != 0; int callingUid; int callingPid; boolean instantApp; synchronized(this) { if (caller != null) { callerApp = getRecordForAppLocked(caller); if (callerApp == null) { throw new SecurityException( "Unable to find app for caller " + caller + " (pid=" + Binder.getCallingPid() + ") when registering receiver " + receiver); } if (callerApp.info.uid != SYSTEM_UID && !callerApp.pkgList.containsKey(callerPackage) && !"android".equals(callerPackage)) { throw new SecurityException("Given caller package " + callerPackage + " is not running in process " + callerApp); } callingUid = callerApp.info.uid; callingPid = callerApp.pid; } else { callerPackage = null; callingUid = Binder.getCallingUid(); callingPid = Binder.getCallingPid(); } instantApp = isInstantApp(callerApp, callerPackage, callingUid); userId = mUserController.handleIncomingUser(callingPid, callingUid, userId, true, ALLOW_FULL_ONLY, "registerReceiver", callerPackage); Iterator actions = filter.actionsIterator(); if (actions == null) { ArrayList noAction = new ArrayList(1); noAction.add(null); actions = noAction.iterator(); } // Collect stickies of users int[] userIds = { UserHandle.USER_ALL, UserHandle.getUserId(callingUid) }; while (actions.hasNext()) { String action = actions.next(); for (int id : userIds) { ArrayMap> stickies = mStickyBroadcasts.get(id); if (stickies != null) { ArrayList intents = stickies.get(action); if (intents != null) { if (stickyIntents == null) { stickyIntents = new ArrayList(); } stickyIntents.addAll(intents); } } } } } ArrayList allSticky = null; if (stickyIntents != null) { final ContentResolver resolver = mContext.getContentResolver(); // Look for any matching sticky broadcasts... for (int i = 0, N = stickyIntents.size(); i < N; i++) { Intent intent = stickyIntents.get(i); // Don't provided intents that aren't available to instant apps. if (instantApp && (intent.getFlags() & Intent.FLAG_RECEIVER_VISIBLE_TO_INSTANT_APPS) == 0) { continue; } // If intent has scheme "content", it will need to acccess // provider that needs to lock mProviderMap in ActivityThread // and also it may need to wait application response, so we // cannot lock ActivityManagerService here. if (filter.match(resolver, intent, true, TAG) >= 0) { if (allSticky == null) { allSticky = new ArrayList(); } allSticky.add(intent); } } } // The first sticky in the list is returned directly back to the client. Intent sticky = allSticky != null ? allSticky.get(0) : null; if (DEBUG_BROADCAST) Slog.v(TAG_BROADCAST, "Register receiver " + filter + ": " + sticky); if (receiver == null) { return sticky; } synchronized (this) { if (callerApp != null && (callerApp.thread == null || callerApp.thread.asBinder() != caller.asBinder())) { // Original caller already died return null; } ReceiverList rl = mRegisteredReceivers.get(receiver.asBinder()); if (rl == null) { rl = new ReceiverList(this, callerApp, callingPid, callingUid, userId, receiver); if (rl.app != null) { rl.app.receivers.add(rl); } else { try { receiver.asBinder().linkToDeath(rl, 0); } catch (RemoteException e) { return sticky; } rl.linkedToDeath = true; } mRegisteredReceivers.put(receiver.asBinder(), rl); } else if (rl.uid != callingUid) { throw new IllegalArgumentException( "Receiver requested to register for uid " + callingUid + " was previously registered for uid " + rl.uid + " callerPackage is " + callerPackage); } else if (rl.pid != callingPid) { throw new IllegalArgumentException( "Receiver requested to register for pid " + callingPid + " was previously registered for pid " + rl.pid + " callerPackage is " + callerPackage); } else if (rl.userId != userId) { throw new IllegalArgumentException( "Receiver requested to register for user " + userId + " was previously registered for user " + rl.userId + " callerPackage is " + callerPackage); } BroadcastFilter bf = new BroadcastFilter(filter, rl, callerPackage, permission, callingUid, userId, instantApp, visibleToInstantApps); rl.add(bf); if (!bf.debugCheck()) { Slog.w(TAG, "==> For Dynamic broadcast"); } mReceiverResolver.addFilter(bf); // Enqueue broadcasts for all existing stickies that match // this filter. if (allSticky != null) { ArrayList receivers = new ArrayList(); receivers.add(bf); final int stickyCount = allSticky.size(); for (int i = 0; i < stickyCount; i++) { Intent intent = allSticky.get(i); BroadcastQueue queue = broadcastQueueForIntent(intent); BroadcastRecord r = new BroadcastRecord(queue, intent, null, null, -1, -1, false, null, null, AppOpsManager.OP_NONE, null, receivers, null, 0, null, null, false, true, true, -1); queue.enqueueParallelBroadcastLocked(r); queue.scheduleBroadcastsLocked(); } } return sticky; } } public void unregisterReceiver(IIntentReceiver receiver) { if (DEBUG_BROADCAST) Slog.v(TAG_BROADCAST, "Unregister receiver: " + receiver); final long origId = Binder.clearCallingIdentity(); try { boolean doTrim = false; synchronized(this) { ReceiverList rl = mRegisteredReceivers.get(receiver.asBinder()); if (rl != null) { final BroadcastRecord r = rl.curBroadcast; if (r != null && r == r.queue.getMatchingOrderedReceiver(r)) { final boolean doNext = r.queue.finishReceiverLocked( r, r.resultCode, r.resultData, r.resultExtras, r.resultAbort, false); if (doNext) { doTrim = true; r.queue.processNextBroadcast(false); } } if (rl.app != null) { rl.app.receivers.remove(rl); } removeReceiverLocked(rl); if (rl.linkedToDeath) { rl.linkedToDeath = false; rl.receiver.asBinder().unlinkToDeath(rl, 0); } } } // If we actually concluded any broadcasts, we might now be able // to trim the recipients' apps from our working set if (doTrim) { trimApplications(); return; } } finally { Binder.restoreCallingIdentity(origId); } } void removeReceiverLocked(ReceiverList rl) { mRegisteredReceivers.remove(rl.receiver.asBinder()); for (int i = rl.size() - 1; i >= 0; i--) { mReceiverResolver.removeFilter(rl.get(i)); } } private final void sendPackageBroadcastLocked(int cmd, String[] packages, int userId) { for (int i = mLruProcesses.size() - 1 ; i >= 0 ; i--) { ProcessRecord r = mLruProcesses.get(i); if (r.thread != null && (userId == UserHandle.USER_ALL || r.userId == userId)) { try { r.thread.dispatchPackageBroadcast(cmd, packages); } catch (RemoteException ex) { } } } } private List collectReceiverComponents(Intent intent, String resolvedType, int callingUid, int[] users) { // TODO: come back and remove this assumption to triage all broadcasts int pmFlags = STOCK_PM_FLAGS | MATCH_DEBUG_TRIAGED_MISSING; List receivers = null; try { HashSet singleUserReceivers = null; boolean scannedFirstReceivers = false; for (int user : users) { // Skip users that have Shell restrictions, with exception of always permitted // Shell broadcasts if (callingUid == SHELL_UID && mUserController.hasUserRestriction( UserManager.DISALLOW_DEBUGGING_FEATURES, user) && !isPermittedShellBroadcast(intent)) { continue; } List newReceivers = AppGlobals.getPackageManager() .queryIntentReceivers(intent, resolvedType, pmFlags, user).getList(); if (user != UserHandle.USER_SYSTEM && newReceivers != null) { // If this is not the system user, we need to check for // any receivers that should be filtered out. for (int i=0; i(); } singleUserReceivers.add(cn); } } } // Add the new results to the existing results, tracking // and de-dupping single user receivers. for (int i=0; i(); } if (!singleUserReceivers.contains(cn)) { singleUserReceivers.add(cn); receivers.add(ri); } } else { receivers.add(ri); } } } } } catch (RemoteException ex) { // pm is in same process, this will never happen. } return receivers; } private boolean isPermittedShellBroadcast(Intent intent) { // remote bugreport should always be allowed to be taken return INTENT_REMOTE_BUGREPORT_FINISHED.equals(intent.getAction()); } private void checkBroadcastFromSystem(Intent intent, ProcessRecord callerApp, String callerPackage, int callingUid, boolean isProtectedBroadcast, List receivers) { if ((intent.getFlags() & Intent.FLAG_RECEIVER_FROM_SHELL) != 0) { // Don't yell about broadcasts sent via shell return; } final String action = intent.getAction(); if (isProtectedBroadcast || Intent.ACTION_CLOSE_SYSTEM_DIALOGS.equals(action) || Intent.ACTION_DISMISS_KEYBOARD_SHORTCUTS.equals(action) || Intent.ACTION_MEDIA_BUTTON.equals(action) || Intent.ACTION_MEDIA_SCANNER_SCAN_FILE.equals(action) || Intent.ACTION_SHOW_KEYBOARD_SHORTCUTS.equals(action) || Intent.ACTION_MASTER_CLEAR.equals(action) || Intent.ACTION_FACTORY_RESET.equals(action) || AppWidgetManager.ACTION_APPWIDGET_CONFIGURE.equals(action) || AppWidgetManager.ACTION_APPWIDGET_UPDATE.equals(action) || LocationManager.HIGH_POWER_REQUEST_CHANGE_ACTION.equals(action) || TelephonyIntents.ACTION_REQUEST_OMADM_CONFIGURATION_UPDATE.equals(action) || SuggestionSpan.ACTION_SUGGESTION_PICKED.equals(action) || AudioEffect.ACTION_OPEN_AUDIO_EFFECT_CONTROL_SESSION.equals(action) || AudioEffect.ACTION_CLOSE_AUDIO_EFFECT_CONTROL_SESSION.equals(action)) { // Broadcast is either protected, or it's a public action that // we've relaxed, so it's fine for system internals to send. return; } // This broadcast may be a problem... but there are often system components that // want to send an internal broadcast to themselves, which is annoying to have to // explicitly list each action as a protected broadcast, so we will check for that // one safe case and allow it: an explicit broadcast, only being received by something // that has protected itself. if (receivers != null && receivers.size() > 0 && (intent.getPackage() != null || intent.getComponent() != null)) { boolean allProtected = true; for (int i = receivers.size()-1; i >= 0; i--) { Object target = receivers.get(i); if (target instanceof ResolveInfo) { ResolveInfo ri = (ResolveInfo)target; if (ri.activityInfo.exported && ri.activityInfo.permission == null) { allProtected = false; break; } } else { BroadcastFilter bf = (BroadcastFilter)target; if (bf.requiredPermission == null) { allProtected = false; break; } } } if (allProtected) { // All safe! return; } } // The vast majority of broadcasts sent from system internals // should be protected to avoid security holes, so yell loudly // to ensure we examine these cases. if (callerApp != null) { Log.wtf(TAG, "Sending non-protected broadcast " + action + " from system " + callerApp.toShortString() + " pkg " + callerPackage, new Throwable()); } else { Log.wtf(TAG, "Sending non-protected broadcast " + action + " from system uid " + UserHandle.formatUid(callingUid) + " pkg " + callerPackage, new Throwable()); } } final int broadcastIntentLocked(ProcessRecord callerApp, String callerPackage, Intent intent, String resolvedType, IIntentReceiver resultTo, int resultCode, String resultData, Bundle resultExtras, String[] requiredPermissions, int appOp, Bundle bOptions, boolean ordered, boolean sticky, int callingPid, int callingUid, int userId) { intent = new Intent(intent); final boolean callerInstantApp = isInstantApp(callerApp, callerPackage, callingUid); // Instant Apps cannot use FLAG_RECEIVER_VISIBLE_TO_INSTANT_APPS if (callerInstantApp) { intent.setFlags(intent.getFlags() & ~Intent.FLAG_RECEIVER_VISIBLE_TO_INSTANT_APPS); } // By default broadcasts do not go to stopped apps. intent.addFlags(Intent.FLAG_EXCLUDE_STOPPED_PACKAGES); // If we have not finished booting, don't allow this to launch new processes. if (!mProcessesReady && (intent.getFlags()&Intent.FLAG_RECEIVER_BOOT_UPGRADE) == 0) { intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY); } if (DEBUG_BROADCAST_LIGHT) Slog.v(TAG_BROADCAST, (sticky ? "Broadcast sticky: ": "Broadcast: ") + intent + " ordered=" + ordered + " userid=" + userId); if ((resultTo != null) && !ordered) { Slog.w(TAG, "Broadcast " + intent + " not ordered but result callback requested!"); } userId = mUserController.handleIncomingUser(callingPid, callingUid, userId, true, ALLOW_NON_FULL, "broadcast", callerPackage); // Make sure that the user who is receiving this broadcast is running. // If not, we will just skip it. Make an exception for shutdown broadcasts // and upgrade steps. if (userId != UserHandle.USER_ALL && !mUserController.isUserRunning(userId, 0)) { if ((callingUid != SYSTEM_UID || (intent.getFlags() & Intent.FLAG_RECEIVER_BOOT_UPGRADE) == 0) && !Intent.ACTION_SHUTDOWN.equals(intent.getAction())) { Slog.w(TAG, "Skipping broadcast of " + intent + ": user " + userId + " is stopped"); return ActivityManager.BROADCAST_FAILED_USER_STOPPED; } } BroadcastOptions brOptions = null; if (bOptions != null) { brOptions = new BroadcastOptions(bOptions); if (brOptions.getTemporaryAppWhitelistDuration() > 0) { // See if the caller is allowed to do this. Note we are checking against // the actual real caller (not whoever provided the operation as say a // PendingIntent), because that who is actually supplied the arguments. if (checkComponentPermission( android.Manifest.permission.CHANGE_DEVICE_IDLE_TEMP_WHITELIST, Binder.getCallingPid(), Binder.getCallingUid(), -1, true) != PackageManager.PERMISSION_GRANTED) { String msg = "Permission Denial: " + intent.getAction() + " broadcast from " + callerPackage + " (pid=" + callingPid + ", uid=" + callingUid + ")" + " requires " + android.Manifest.permission.CHANGE_DEVICE_IDLE_TEMP_WHITELIST; Slog.w(TAG, msg); throw new SecurityException(msg); } } } // Verify that protected broadcasts are only being sent by system code, // and that system code is only sending protected broadcasts. final String action = intent.getAction(); final boolean isProtectedBroadcast; try { isProtectedBroadcast = AppGlobals.getPackageManager().isProtectedBroadcast(action); } catch (RemoteException e) { Slog.w(TAG, "Remote exception", e); return ActivityManager.BROADCAST_SUCCESS; } final boolean isCallerSystem; switch (UserHandle.getAppId(callingUid)) { case ROOT_UID: case SYSTEM_UID: case PHONE_UID: case BLUETOOTH_UID: case NFC_UID: isCallerSystem = true; break; default: isCallerSystem = (callerApp != null) && callerApp.persistent; break; } // First line security check before anything else: stop non-system apps from // sending protected broadcasts. if (!isCallerSystem) { if (isProtectedBroadcast) { String msg = "Permission Denial: not allowed to send broadcast " + action + " from pid=" + callingPid + ", uid=" + callingUid; Slog.w(TAG, msg); throw new SecurityException(msg); } else if (AppWidgetManager.ACTION_APPWIDGET_CONFIGURE.equals(action) || AppWidgetManager.ACTION_APPWIDGET_UPDATE.equals(action)) { // Special case for compatibility: we don't want apps to send this, // but historically it has not been protected and apps may be using it // to poke their own app widget. So, instead of making it protected, // just limit it to the caller. if (callerPackage == null) { String msg = "Permission Denial: not allowed to send broadcast " + action + " from unknown caller."; Slog.w(TAG, msg); throw new SecurityException(msg); } else if (intent.getComponent() != null) { // They are good enough to send to an explicit component... verify // it is being sent to the calling app. if (!intent.getComponent().getPackageName().equals( callerPackage)) { String msg = "Permission Denial: not allowed to send broadcast " + action + " to " + intent.getComponent().getPackageName() + " from " + callerPackage; Slog.w(TAG, msg); throw new SecurityException(msg); } } else { // Limit broadcast to their own package. intent.setPackage(callerPackage); } } } if (action != null) { if (getBackgroundLaunchBroadcasts().contains(action)) { if (DEBUG_BACKGROUND_CHECK) { Slog.i(TAG, "Broadcast action " + action + " forcing include-background"); } intent.addFlags(Intent.FLAG_RECEIVER_INCLUDE_BACKGROUND); } switch (action) { case Intent.ACTION_UID_REMOVED: case Intent.ACTION_PACKAGE_REMOVED: case Intent.ACTION_PACKAGE_CHANGED: case Intent.ACTION_EXTERNAL_APPLICATIONS_UNAVAILABLE: case Intent.ACTION_EXTERNAL_APPLICATIONS_AVAILABLE: case Intent.ACTION_PACKAGES_SUSPENDED: case Intent.ACTION_PACKAGES_UNSUSPENDED: // Handle special intents: if this broadcast is from the package // manager about a package being removed, we need to remove all of // its activities from the history stack. if (checkComponentPermission( android.Manifest.permission.BROADCAST_PACKAGE_REMOVED, callingPid, callingUid, -1, true) != PackageManager.PERMISSION_GRANTED) { String msg = "Permission Denial: " + intent.getAction() + " broadcast from " + callerPackage + " (pid=" + callingPid + ", uid=" + callingUid + ")" + " requires " + android.Manifest.permission.BROADCAST_PACKAGE_REMOVED; Slog.w(TAG, msg); throw new SecurityException(msg); } switch (action) { case Intent.ACTION_UID_REMOVED: final int uid = getUidFromIntent(intent); if (uid >= 0) { mBatteryStatsService.removeUid(uid); mAppOpsService.uidRemoved(uid); } break; case Intent.ACTION_EXTERNAL_APPLICATIONS_UNAVAILABLE: // If resources are unavailable just force stop all those packages // and flush the attribute cache as well. String list[] = intent.getStringArrayExtra(Intent.EXTRA_CHANGED_PACKAGE_LIST); if (list != null && list.length > 0) { for (int i = 0; i < list.length; i++) { forceStopPackageLocked(list[i], -1, false, true, true, false, false, userId, "storage unmount"); } mRecentTasks.cleanupLocked(UserHandle.USER_ALL); sendPackageBroadcastLocked( ApplicationThreadConstants.EXTERNAL_STORAGE_UNAVAILABLE, list, userId); } break; case Intent.ACTION_EXTERNAL_APPLICATIONS_AVAILABLE: mRecentTasks.cleanupLocked(UserHandle.USER_ALL); break; case Intent.ACTION_PACKAGE_REMOVED: case Intent.ACTION_PACKAGE_CHANGED: Uri data = intent.getData(); String ssp; if (data != null && (ssp=data.getSchemeSpecificPart()) != null) { boolean removed = Intent.ACTION_PACKAGE_REMOVED.equals(action); final boolean replacing = intent.getBooleanExtra(Intent.EXTRA_REPLACING, false); final boolean killProcess = !intent.getBooleanExtra(Intent.EXTRA_DONT_KILL_APP, false); final boolean fullUninstall = removed && !replacing; if (removed) { if (killProcess) { forceStopPackageLocked(ssp, UserHandle.getAppId( intent.getIntExtra(Intent.EXTRA_UID, -1)), false, true, true, false, fullUninstall, userId, removed ? "pkg removed" : "pkg changed"); } final int cmd = killProcess ? ApplicationThreadConstants.PACKAGE_REMOVED : ApplicationThreadConstants.PACKAGE_REMOVED_DONT_KILL; sendPackageBroadcastLocked(cmd, new String[] {ssp}, userId); if (fullUninstall) { mAppOpsService.packageRemoved( intent.getIntExtra(Intent.EXTRA_UID, -1), ssp); // Remove all permissions granted from/to this package removeUriPermissionsForPackageLocked(ssp, userId, true); mRecentTasks.removeTasksByPackageName(ssp, userId); mServices.forceStopPackageLocked(ssp, userId); // Hide the "unsupported display" dialog if necessary. if (mUnsupportedDisplaySizeDialog != null && ssp.equals( mUnsupportedDisplaySizeDialog.getPackageName())) { mUnsupportedDisplaySizeDialog.dismiss(); mUnsupportedDisplaySizeDialog = null; } mCompatModePackages.handlePackageUninstalledLocked(ssp); mBatteryStatsService.notePackageUninstalled(ssp); } } else { if (killProcess) { killPackageProcessesLocked(ssp, UserHandle.getAppId( intent.getIntExtra(Intent.EXTRA_UID, -1)), userId, ProcessList.INVALID_ADJ, false, true, true, false, "change " + ssp); } cleanupDisabledPackageComponentsLocked(ssp, userId, killProcess, intent.getStringArrayExtra( Intent.EXTRA_CHANGED_COMPONENT_NAME_LIST)); } } break; case Intent.ACTION_PACKAGES_SUSPENDED: case Intent.ACTION_PACKAGES_UNSUSPENDED: final boolean suspended = Intent.ACTION_PACKAGES_SUSPENDED.equals( intent.getAction()); final String[] packageNames = intent.getStringArrayExtra( Intent.EXTRA_CHANGED_PACKAGE_LIST); final int userHandle = intent.getIntExtra( Intent.EXTRA_USER_HANDLE, UserHandle.USER_NULL); synchronized(ActivityManagerService.this) { mRecentTasks.onPackagesSuspendedChanged( packageNames, suspended, userHandle); } break; } break; case Intent.ACTION_PACKAGE_REPLACED: { final Uri data = intent.getData(); final String ssp; if (data != null && (ssp = data.getSchemeSpecificPart()) != null) { ApplicationInfo aInfo = null; try { aInfo = AppGlobals.getPackageManager() .getApplicationInfo(ssp, 0 /*flags*/, userId); } catch (RemoteException ignore) {} if (aInfo == null) { Slog.w(TAG, "Dropping ACTION_PACKAGE_REPLACED for non-existent pkg:" + " ssp=" + ssp + " data=" + data); return ActivityManager.BROADCAST_SUCCESS; } mStackSupervisor.updateActivityApplicationInfoLocked(aInfo); sendPackageBroadcastLocked(ApplicationThreadConstants.PACKAGE_REPLACED, new String[] {ssp}, userId); } break; } case Intent.ACTION_PACKAGE_ADDED: { // Special case for adding a package: by default turn on compatibility mode. Uri data = intent.getData(); String ssp; if (data != null && (ssp = data.getSchemeSpecificPart()) != null) { final boolean replacing = intent.getBooleanExtra(Intent.EXTRA_REPLACING, false); mCompatModePackages.handlePackageAddedLocked(ssp, replacing); try { ApplicationInfo ai = AppGlobals.getPackageManager(). getApplicationInfo(ssp, 0, 0); mBatteryStatsService.notePackageInstalled(ssp, ai != null ? ai.versionCode : 0); } catch (RemoteException e) { } } break; } case Intent.ACTION_PACKAGE_DATA_CLEARED: { Uri data = intent.getData(); String ssp; if (data != null && (ssp = data.getSchemeSpecificPart()) != null) { // Hide the "unsupported display" dialog if necessary. if (mUnsupportedDisplaySizeDialog != null && ssp.equals( mUnsupportedDisplaySizeDialog.getPackageName())) { mUnsupportedDisplaySizeDialog.dismiss(); mUnsupportedDisplaySizeDialog = null; } mCompatModePackages.handlePackageDataClearedLocked(ssp); } break; } case Intent.ACTION_TIMEZONE_CHANGED: // If this is the time zone changed action, queue up a message that will reset // the timezone of all currently running processes. This message will get // queued up before the broadcast happens. mHandler.sendEmptyMessage(UPDATE_TIME_ZONE); break; case Intent.ACTION_TIME_CHANGED: // EXTRA_TIME_PREF_24_HOUR_FORMAT is optional so we must distinguish between // the tri-state value it may contain and "unknown". // For convenience we re-use the Intent extra values. final int NO_EXTRA_VALUE_FOUND = -1; final int timeFormatPreferenceMsgValue = intent.getIntExtra( Intent.EXTRA_TIME_PREF_24_HOUR_FORMAT, NO_EXTRA_VALUE_FOUND /* defaultValue */); // Only send a message if the time preference is available. if (timeFormatPreferenceMsgValue != NO_EXTRA_VALUE_FOUND) { Message updateTimePreferenceMsg = mHandler.obtainMessage(UPDATE_TIME_PREFERENCE_MSG, timeFormatPreferenceMsgValue, 0); mHandler.sendMessage(updateTimePreferenceMsg); } BatteryStatsImpl stats = mBatteryStatsService.getActiveStatistics(); synchronized (stats) { stats.noteCurrentTimeChangedLocked(); } break; case Intent.ACTION_CLEAR_DNS_CACHE: mHandler.sendEmptyMessage(CLEAR_DNS_CACHE_MSG); break; case Proxy.PROXY_CHANGE_ACTION: ProxyInfo proxy = intent.getParcelableExtra(Proxy.EXTRA_PROXY_INFO); mHandler.sendMessage(mHandler.obtainMessage(UPDATE_HTTP_PROXY_MSG, proxy)); break; case android.hardware.Camera.ACTION_NEW_PICTURE: case android.hardware.Camera.ACTION_NEW_VIDEO: // In N we just turned these off; in O we are turing them back on partly, // only for registered receivers. This will still address the main problem // (a spam of apps waking up when a picture is taken putting significant // memory pressure on the system at a bad point), while still allowing apps // that are already actively running to know about this happening. intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY); break; case android.security.KeyChain.ACTION_TRUST_STORE_CHANGED: mHandler.sendEmptyMessage(HANDLE_TRUST_STORAGE_UPDATE_MSG); break; case "com.android.launcher.action.INSTALL_SHORTCUT": // As of O, we no longer support this broadcasts, even for pre-O apps. // Apps should now be using ShortcutManager.pinRequestShortcut(). Log.w(TAG, "Broadcast " + action + " no longer supported. It will not be delivered."); return ActivityManager.BROADCAST_SUCCESS; } if (Intent.ACTION_PACKAGE_ADDED.equals(action) || Intent.ACTION_PACKAGE_REMOVED.equals(action) || Intent.ACTION_PACKAGE_REPLACED.equals(action)) { final int uid = getUidFromIntent(intent); if (uid != -1) { final UidRecord uidRec = mActiveUids.get(uid); if (uidRec != null) { uidRec.updateHasInternetPermission(); } } } } // Add to the sticky list if requested. if (sticky) { if (checkPermission(android.Manifest.permission.BROADCAST_STICKY, callingPid, callingUid) != PackageManager.PERMISSION_GRANTED) { String msg = "Permission Denial: broadcastIntent() requesting a sticky broadcast from pid=" + callingPid + ", uid=" + callingUid + " requires " + android.Manifest.permission.BROADCAST_STICKY; Slog.w(TAG, msg); throw new SecurityException(msg); } if (requiredPermissions != null && requiredPermissions.length > 0) { Slog.w(TAG, "Can't broadcast sticky intent " + intent + " and enforce permissions " + Arrays.toString(requiredPermissions)); return ActivityManager.BROADCAST_STICKY_CANT_HAVE_PERMISSION; } if (intent.getComponent() != null) { throw new SecurityException( "Sticky broadcasts can't target a specific component"); } // We use userId directly here, since the "all" target is maintained // as a separate set of sticky broadcasts. if (userId != UserHandle.USER_ALL) { // But first, if this is not a broadcast to all users, then // make sure it doesn't conflict with an existing broadcast to // all users. ArrayMap> stickies = mStickyBroadcasts.get( UserHandle.USER_ALL); if (stickies != null) { ArrayList list = stickies.get(intent.getAction()); if (list != null) { int N = list.size(); int i; for (i=0; i> stickies = mStickyBroadcasts.get(userId); if (stickies == null) { stickies = new ArrayMap<>(); mStickyBroadcasts.put(userId, stickies); } ArrayList list = stickies.get(intent.getAction()); if (list == null) { list = new ArrayList<>(); stickies.put(intent.getAction(), list); } final int stickiesCount = list.size(); int i; for (i = 0; i < stickiesCount; i++) { if (intent.filterEquals(list.get(i))) { // This sticky already exists, replace it. list.set(i, new Intent(intent)); break; } } if (i >= stickiesCount) { list.add(new Intent(intent)); } } int[] users; if (userId == UserHandle.USER_ALL) { // Caller wants broadcast to go to all started users. users = mUserController.getStartedUserArray(); } else { // Caller wants broadcast to go to one specific user. users = new int[] {userId}; } // Figure out who all will receive this broadcast. List receivers = null; List registeredReceivers = null; // Need to resolve the intent to interested receivers... if ((intent.getFlags()&Intent.FLAG_RECEIVER_REGISTERED_ONLY) == 0) { receivers = collectReceiverComponents(intent, resolvedType, callingUid, users); } if (intent.getComponent() == null) { if (userId == UserHandle.USER_ALL && callingUid == SHELL_UID) { // Query one target user at a time, excluding shell-restricted users for (int i = 0; i < users.length; i++) { if (mUserController.hasUserRestriction( UserManager.DISALLOW_DEBUGGING_FEATURES, users[i])) { continue; } List registeredReceiversForUser = mReceiverResolver.queryIntent(intent, resolvedType, false /*defaultOnly*/, users[i]); if (registeredReceivers == null) { registeredReceivers = registeredReceiversForUser; } else if (registeredReceiversForUser != null) { registeredReceivers.addAll(registeredReceiversForUser); } } } else { registeredReceivers = mReceiverResolver.queryIntent(intent, resolvedType, false /*defaultOnly*/, userId); } } final boolean replacePending = (intent.getFlags()&Intent.FLAG_RECEIVER_REPLACE_PENDING) != 0; if (DEBUG_BROADCAST) Slog.v(TAG_BROADCAST, "Enqueueing broadcast: " + intent.getAction() + " replacePending=" + replacePending); int NR = registeredReceivers != null ? registeredReceivers.size() : 0; if (!ordered && NR > 0) { // If we are not serializing this broadcast, then send the // registered receivers separately so they don't wait for the // components to be launched. if (isCallerSystem) { checkBroadcastFromSystem(intent, callerApp, callerPackage, callingUid, isProtectedBroadcast, registeredReceivers); } final BroadcastQueue queue = broadcastQueueForIntent(intent); BroadcastRecord r = new BroadcastRecord(queue, intent, callerApp, callerPackage, callingPid, callingUid, callerInstantApp, resolvedType, requiredPermissions, appOp, brOptions, registeredReceivers, resultTo, resultCode, resultData, resultExtras, ordered, sticky, false, userId); if (DEBUG_BROADCAST) Slog.v(TAG_BROADCAST, "Enqueueing parallel broadcast " + r); final boolean replaced = replacePending && (queue.replaceParallelBroadcastLocked(r) != null); // Note: We assume resultTo is null for non-ordered broadcasts. if (!replaced) { queue.enqueueParallelBroadcastLocked(r); queue.scheduleBroadcastsLocked(); } registeredReceivers = null; NR = 0; } // Merge into one list. int ir = 0; if (receivers != null) { // A special case for PACKAGE_ADDED: do not allow the package // being added to see this broadcast. This prevents them from // using this as a back door to get run as soon as they are // installed. Maybe in the future we want to have a special install // broadcast or such for apps, but we'd like to deliberately make // this decision. String skipPackages[] = null; if (Intent.ACTION_PACKAGE_ADDED.equals(intent.getAction()) || Intent.ACTION_PACKAGE_RESTARTED.equals(intent.getAction()) || Intent.ACTION_PACKAGE_DATA_CLEARED.equals(intent.getAction())) { Uri data = intent.getData(); if (data != null) { String pkgName = data.getSchemeSpecificPart(); if (pkgName != null) { skipPackages = new String[] { pkgName }; } } } else if (Intent.ACTION_EXTERNAL_APPLICATIONS_AVAILABLE.equals(intent.getAction())) { skipPackages = intent.getStringArrayExtra(Intent.EXTRA_CHANGED_PACKAGE_LIST); } if (skipPackages != null && (skipPackages.length > 0)) { for (String skipPackage : skipPackages) { if (skipPackage != null) { int NT = receivers.size(); for (int it=0; it= curt.priority) { // Insert this broadcast record into the final list. receivers.add(it, curr); ir++; curr = null; it++; NT++; } else { // Skip to the next ResolveInfo in the final list. it++; curt = null; } } } while (ir < NR) { if (receivers == null) { receivers = new ArrayList(); } receivers.add(registeredReceivers.get(ir)); ir++; } if (isCallerSystem) { checkBroadcastFromSystem(intent, callerApp, callerPackage, callingUid, isProtectedBroadcast, receivers); } if ((receivers != null && receivers.size() > 0) || resultTo != null) { BroadcastQueue queue = broadcastQueueForIntent(intent); BroadcastRecord r = new BroadcastRecord(queue, intent, callerApp, callerPackage, callingPid, callingUid, callerInstantApp, resolvedType, requiredPermissions, appOp, brOptions, receivers, resultTo, resultCode, resultData, resultExtras, ordered, sticky, false, userId); if (DEBUG_BROADCAST) Slog.v(TAG_BROADCAST, "Enqueueing ordered broadcast " + r + ": prev had " + queue.mOrderedBroadcasts.size()); if (DEBUG_BROADCAST) Slog.i(TAG_BROADCAST, "Enqueueing broadcast " + r.intent.getAction()); final BroadcastRecord oldRecord = replacePending ? queue.replaceOrderedBroadcastLocked(r) : null; if (oldRecord != null) { // Replaced, fire the result-to receiver. if (oldRecord.resultTo != null) { final BroadcastQueue oldQueue = broadcastQueueForIntent(oldRecord.intent); try { oldQueue.performReceiveLocked(oldRecord.callerApp, oldRecord.resultTo, oldRecord.intent, Activity.RESULT_CANCELED, null, null, false, false, oldRecord.userId); } catch (RemoteException e) { Slog.w(TAG, "Failure [" + queue.mQueueName + "] sending broadcast result of " + intent, e); } } } else { queue.enqueueOrderedBroadcastLocked(r); queue.scheduleBroadcastsLocked(); } } else { // There was nobody interested in the broadcast, but we still want to record // that it happened. if (intent.getComponent() == null && intent.getPackage() == null && (intent.getFlags()&Intent.FLAG_RECEIVER_REGISTERED_ONLY) == 0) { // This was an implicit broadcast... let's record it for posterity. addBroadcastStatLocked(intent.getAction(), callerPackage, 0, 0, 0); } } return ActivityManager.BROADCAST_SUCCESS; } /** * @return uid from the extra field {@link Intent#EXTRA_UID} if present, Otherwise -1 */ private int getUidFromIntent(Intent intent) { if (intent == null) { return -1; } final Bundle intentExtras = intent.getExtras(); return intent.hasExtra(Intent.EXTRA_UID) ? intentExtras.getInt(Intent.EXTRA_UID) : -1; } final void rotateBroadcastStatsIfNeededLocked() { final long now = SystemClock.elapsedRealtime(); if (mCurBroadcastStats == null || (mCurBroadcastStats.mStartRealtime +(24*60*60*1000) < now)) { mLastBroadcastStats = mCurBroadcastStats; if (mLastBroadcastStats != null) { mLastBroadcastStats.mEndRealtime = SystemClock.elapsedRealtime(); mLastBroadcastStats.mEndUptime = SystemClock.uptimeMillis(); } mCurBroadcastStats = new BroadcastStats(); } } final void addBroadcastStatLocked(String action, String srcPackage, int receiveCount, int skipCount, long dispatchTime) { rotateBroadcastStatsIfNeededLocked(); mCurBroadcastStats.addBroadcast(action, srcPackage, receiveCount, skipCount, dispatchTime); } final void addBackgroundCheckViolationLocked(String action, String targetPackage) { rotateBroadcastStatsIfNeededLocked(); mCurBroadcastStats.addBackgroundCheckViolation(action, targetPackage); } final Intent verifyBroadcastLocked(Intent intent) { // Refuse possible leaked file descriptors if (intent != null && intent.hasFileDescriptors() == true) { throw new IllegalArgumentException("File descriptors passed in Intent"); } int flags = intent.getFlags(); if (!mProcessesReady) { // if the caller really truly claims to know what they're doing, go // ahead and allow the broadcast without launching any receivers if ((flags&Intent.FLAG_RECEIVER_REGISTERED_ONLY_BEFORE_BOOT) != 0) { // This will be turned into a FLAG_RECEIVER_REGISTERED_ONLY later on if needed. } else if ((flags&Intent.FLAG_RECEIVER_REGISTERED_ONLY) == 0) { Slog.e(TAG, "Attempt to launch receivers of broadcast intent " + intent + " before boot completion"); throw new IllegalStateException("Cannot broadcast before boot completed"); } } if ((flags&Intent.FLAG_RECEIVER_BOOT_UPGRADE) != 0) { throw new IllegalArgumentException( "Can't use FLAG_RECEIVER_BOOT_UPGRADE here"); } if ((flags & Intent.FLAG_RECEIVER_FROM_SHELL) != 0) { switch (Binder.getCallingUid()) { case ROOT_UID: case SHELL_UID: break; default: Slog.w(TAG, "Removing FLAG_RECEIVER_FROM_SHELL because caller is UID " + Binder.getCallingUid()); intent.removeFlags(Intent.FLAG_RECEIVER_FROM_SHELL); break; } } return intent; } public final int broadcastIntent(IApplicationThread caller, Intent intent, String resolvedType, IIntentReceiver resultTo, int resultCode, String resultData, Bundle resultExtras, String[] requiredPermissions, int appOp, Bundle bOptions, boolean serialized, boolean sticky, int userId) { enforceNotIsolatedCaller("broadcastIntent"); synchronized(this) { intent = verifyBroadcastLocked(intent); final ProcessRecord callerApp = getRecordForAppLocked(caller); final int callingPid = Binder.getCallingPid(); final int callingUid = Binder.getCallingUid(); final long origId = Binder.clearCallingIdentity(); int res = broadcastIntentLocked(callerApp, callerApp != null ? callerApp.info.packageName : null, intent, resolvedType, resultTo, resultCode, resultData, resultExtras, requiredPermissions, appOp, bOptions, serialized, sticky, callingPid, callingUid, userId); Binder.restoreCallingIdentity(origId); return res; } } int broadcastIntentInPackage(String packageName, int uid, Intent intent, String resolvedType, IIntentReceiver resultTo, int resultCode, String resultData, Bundle resultExtras, String requiredPermission, Bundle bOptions, boolean serialized, boolean sticky, int userId) { synchronized(this) { intent = verifyBroadcastLocked(intent); final long origId = Binder.clearCallingIdentity(); String[] requiredPermissions = requiredPermission == null ? null : new String[] {requiredPermission}; int res = broadcastIntentLocked(null, packageName, intent, resolvedType, resultTo, resultCode, resultData, resultExtras, requiredPermissions, AppOpsManager.OP_NONE, bOptions, serialized, sticky, -1, uid, userId); Binder.restoreCallingIdentity(origId); return res; } } public final void unbroadcastIntent(IApplicationThread caller, Intent intent, int userId) { // Refuse possible leaked file descriptors if (intent != null && intent.hasFileDescriptors() == true) { throw new IllegalArgumentException("File descriptors passed in Intent"); } userId = mUserController.handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(), userId, true, ALLOW_NON_FULL, "removeStickyBroadcast", null); synchronized(this) { if (checkCallingPermission(android.Manifest.permission.BROADCAST_STICKY) != PackageManager.PERMISSION_GRANTED) { String msg = "Permission Denial: unbroadcastIntent() from pid=" + Binder.getCallingPid() + ", uid=" + Binder.getCallingUid() + " requires " + android.Manifest.permission.BROADCAST_STICKY; Slog.w(TAG, msg); throw new SecurityException(msg); } ArrayMap> stickies = mStickyBroadcasts.get(userId); if (stickies != null) { ArrayList list = stickies.get(intent.getAction()); if (list != null) { int N = list.size(); int i; for (i=0; istarting is being destroyed to match the new * configuration. * * @param userId is only used when persistent parameter is set to true to persist configuration * for that particular user */ private boolean updateConfigurationLocked(Configuration values, ActivityRecord starting, boolean initLocale, boolean persistent, int userId, boolean deferResume, UpdateConfigurationResult result) { int changes = 0; boolean kept = true; if (mWindowManager != null) { mWindowManager.deferSurfaceLayout(); } try { if (values != null) { changes = updateGlobalConfiguration(values, initLocale, persistent, userId, deferResume); } kept = ensureConfigAndVisibilityAfterUpdate(starting, changes); } finally { if (mWindowManager != null) { mWindowManager.continueSurfaceLayout(); } } if (result != null) { result.changes = changes; result.activityRelaunched = !kept; } return kept; } /** Update default (global) configuration and notify listeners about changes. */ private int updateGlobalConfiguration(@NonNull Configuration values, boolean initLocale, boolean persistent, int userId, boolean deferResume) { mTempConfig.setTo(getGlobalConfiguration()); final int changes = mTempConfig.updateFrom(values); if (changes == 0) { // Since calling to Activity.setRequestedOrientation leads to freezing the window with // setting WindowManagerService.mWaitingForConfig to true, it is important that we call // performDisplayOverrideConfigUpdate in order to send the new display configuration // (even if there are no actual changes) to unfreeze the window. performDisplayOverrideConfigUpdate(values, deferResume, DEFAULT_DISPLAY); return 0; } if (DEBUG_SWITCH || DEBUG_CONFIGURATION) Slog.i(TAG_CONFIGURATION, "Updating global configuration to: " + values); EventLog.writeEvent(EventLogTags.CONFIGURATION_CHANGED, changes); if (!initLocale && !values.getLocales().isEmpty() && values.userSetLocale) { final LocaleList locales = values.getLocales(); int bestLocaleIndex = 0; if (locales.size() > 1) { if (mSupportedSystemLocales == null) { mSupportedSystemLocales = Resources.getSystem().getAssets().getLocales(); } bestLocaleIndex = Math.max(0, locales.getFirstMatchIndex(mSupportedSystemLocales)); } SystemProperties.set("persist.sys.locale", locales.get(bestLocaleIndex).toLanguageTag()); LocaleList.setDefault(locales, bestLocaleIndex); mHandler.sendMessage(mHandler.obtainMessage(SEND_LOCALE_TO_MOUNT_DAEMON_MSG, locales.get(bestLocaleIndex))); } mConfigurationSeq = Math.max(++mConfigurationSeq, 1); mTempConfig.seq = mConfigurationSeq; // Update stored global config and notify everyone about the change. mStackSupervisor.onConfigurationChanged(mTempConfig); Slog.i(TAG, "Config changes=" + Integer.toHexString(changes) + " " + mTempConfig); // TODO(multi-display): Update UsageEvents#Event to include displayId. mUsageStatsService.reportConfigurationChange(mTempConfig, mUserController.getCurrentUserId()); // TODO: If our config changes, should we auto dismiss any currently showing dialogs? mShowDialogs = shouldShowDialogs(mTempConfig); AttributeCache ac = AttributeCache.instance(); if (ac != null) { ac.updateConfiguration(mTempConfig); } // Make sure all resources in our process are updated right now, so that anyone who is going // to retrieve resource values after we return will be sure to get the new ones. This is // especially important during boot, where the first config change needs to guarantee all // resources have that config before following boot code is executed. mSystemThread.applyConfigurationToResources(mTempConfig); // We need another copy of global config because we're scheduling some calls instead of // running them in place. We need to be sure that object we send will be handled unchanged. final Configuration configCopy = new Configuration(mTempConfig); if (persistent && Settings.System.hasInterestingConfigurationChanges(changes)) { Message msg = mHandler.obtainMessage(UPDATE_CONFIGURATION_MSG); msg.obj = configCopy; msg.arg1 = userId; mHandler.sendMessage(msg); } for (int i = mLruProcesses.size() - 1; i >= 0; i--) { ProcessRecord app = mLruProcesses.get(i); try { if (app.thread != null) { if (DEBUG_CONFIGURATION) Slog.v(TAG_CONFIGURATION, "Sending to proc " + app.processName + " new config " + configCopy); app.thread.scheduleConfigurationChanged(configCopy); } } catch (Exception e) { } } Intent intent = new Intent(Intent.ACTION_CONFIGURATION_CHANGED); intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY | Intent.FLAG_RECEIVER_REPLACE_PENDING | Intent.FLAG_RECEIVER_FOREGROUND | Intent.FLAG_RECEIVER_VISIBLE_TO_INSTANT_APPS); broadcastIntentLocked(null, null, intent, null, null, 0, null, null, null, AppOpsManager.OP_NONE, null, false, false, MY_PID, SYSTEM_UID, UserHandle.USER_ALL); if ((changes & ActivityInfo.CONFIG_LOCALE) != 0) { intent = new Intent(Intent.ACTION_LOCALE_CHANGED); intent.addFlags(Intent.FLAG_RECEIVER_FOREGROUND | Intent.FLAG_RECEIVER_INCLUDE_BACKGROUND | Intent.FLAG_RECEIVER_VISIBLE_TO_INSTANT_APPS); if (initLocale || !mProcessesReady) { intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY); } broadcastIntentLocked(null, null, intent, null, null, 0, null, null, null, AppOpsManager.OP_NONE, null, false, false, MY_PID, SYSTEM_UID, UserHandle.USER_ALL); } // Override configuration of the default display duplicates global config, so we need to // update it also. This will also notify WindowManager about changes. performDisplayOverrideConfigUpdate(mStackSupervisor.getConfiguration(), deferResume, DEFAULT_DISPLAY); return changes; } @Override public boolean updateDisplayOverrideConfiguration(Configuration values, int displayId) { enforceCallingPermission(CHANGE_CONFIGURATION, "updateDisplayOverrideConfiguration()"); synchronized (this) { // Check if display is initialized in AM. if (!mStackSupervisor.isDisplayAdded(displayId)) { // Call might come when display is not yet added or has already been removed. if (DEBUG_CONFIGURATION) { Slog.w(TAG, "Trying to update display configuration for non-existing displayId=" + displayId); } return false; } if (values == null && mWindowManager != null) { // sentinel: fetch the current configuration from the window manager values = mWindowManager.computeNewConfiguration(displayId); } if (mWindowManager != null) { // Update OOM levels based on display size. mProcessList.applyDisplaySize(mWindowManager); } final long origId = Binder.clearCallingIdentity(); try { if (values != null) { Settings.System.clearConfiguration(values); } updateDisplayOverrideConfigurationLocked(values, null /* starting */, false /* deferResume */, displayId, mTmpUpdateConfigurationResult); return mTmpUpdateConfigurationResult.changes != 0; } finally { Binder.restoreCallingIdentity(origId); } } } boolean updateDisplayOverrideConfigurationLocked(Configuration values, ActivityRecord starting, boolean deferResume, int displayId) { return updateDisplayOverrideConfigurationLocked(values, starting, deferResume /* deferResume */, displayId, null /* result */); } /** * Updates override configuration specific for the selected display. If no config is provided, * new one will be computed in WM based on current display info. */ private boolean updateDisplayOverrideConfigurationLocked(Configuration values, ActivityRecord starting, boolean deferResume, int displayId, UpdateConfigurationResult result) { int changes = 0; boolean kept = true; if (mWindowManager != null) { mWindowManager.deferSurfaceLayout(); } try { if (values != null) { if (displayId == DEFAULT_DISPLAY) { // Override configuration of the default display duplicates global config, so // we're calling global config update instead for default display. It will also // apply the correct override config. changes = updateGlobalConfiguration(values, false /* initLocale */, false /* persistent */, UserHandle.USER_NULL /* userId */, deferResume); } else { changes = performDisplayOverrideConfigUpdate(values, deferResume, displayId); } } kept = ensureConfigAndVisibilityAfterUpdate(starting, changes); } finally { if (mWindowManager != null) { mWindowManager.continueSurfaceLayout(); } } if (result != null) { result.changes = changes; result.activityRelaunched = !kept; } return kept; } private int performDisplayOverrideConfigUpdate(Configuration values, boolean deferResume, int displayId) { mTempConfig.setTo(mStackSupervisor.getDisplayOverrideConfiguration(displayId)); final int changes = mTempConfig.updateFrom(values); if (changes != 0) { Slog.i(TAG, "Override config changes=" + Integer.toHexString(changes) + " " + mTempConfig + " for displayId=" + displayId); mStackSupervisor.setDisplayOverrideConfiguration(mTempConfig, displayId); final boolean isDensityChange = (changes & ActivityInfo.CONFIG_DENSITY) != 0; if (isDensityChange && displayId == DEFAULT_DISPLAY) { // Reset the unsupported display size dialog. mUiHandler.sendEmptyMessage(SHOW_UNSUPPORTED_DISPLAY_SIZE_DIALOG_MSG); killAllBackgroundProcessesExcept(N, ActivityManager.PROCESS_STATE_FOREGROUND_SERVICE); } } // Update the configuration with WM first and check if any of the stacks need to be resized // due to the configuration change. If so, resize the stacks now and do any relaunches if // necessary. This way we don't need to relaunch again afterwards in // ensureActivityConfigurationLocked(). if (mWindowManager != null) { final int[] resizedStacks = mWindowManager.setNewDisplayOverrideConfiguration(mTempConfig, displayId); if (resizedStacks != null) { for (int stackId : resizedStacks) { resizeStackWithBoundsFromWindowManager(stackId, deferResume); } } } return changes; } /** Applies latest configuration and/or visibility updates if needed. */ private boolean ensureConfigAndVisibilityAfterUpdate(ActivityRecord starting, int changes) { boolean kept = true; final ActivityStack mainStack = mStackSupervisor.getFocusedStack(); // mainStack is null during startup. if (mainStack != null) { if (changes != 0 && starting == null) { // If the configuration changed, and the caller is not already // in the process of starting an activity, then find the top // activity to check if its configuration needs to change. starting = mainStack.topRunningActivityLocked(); } if (starting != null) { kept = starting.ensureActivityConfigurationLocked(changes, false /* preserveWindow */); // And we need to make sure at this point that all other activities // are made visible with the correct configuration. mStackSupervisor.ensureActivitiesVisibleLocked(starting, changes, !PRESERVE_WINDOWS); } } return kept; } /** Helper method that requests bounds from WM and applies them to stack. */ private void resizeStackWithBoundsFromWindowManager(int stackId, boolean deferResume) { final Rect newStackBounds = new Rect(); final ActivityStack stack = mStackSupervisor.getStack(stackId); stack.getBoundsForNewConfiguration(newStackBounds); mStackSupervisor.resizeStackLocked( stack, !newStackBounds.isEmpty() ? newStackBounds : null /* bounds */, null /* tempTaskBounds */, null /* tempTaskInsetBounds */, false /* preserveWindows */, false /* allowResizeInDockedMode */, deferResume); } /** * Decide based on the configuration whether we should show the ANR, * crash, etc dialogs. The idea is that if there is no affordance to * press the on-screen buttons, or the user experience would be more * greatly impacted than the crash itself, we shouldn't show the dialog. * * A thought: SystemUI might also want to get told about this, the Power * dialog / global actions also might want different behaviors. */ private static boolean shouldShowDialogs(Configuration config) { final boolean inputMethodExists = !(config.keyboard == Configuration.KEYBOARD_NOKEYS && config.touchscreen == Configuration.TOUCHSCREEN_NOTOUCH && config.navigation == Configuration.NAVIGATION_NONAV); int modeType = config.uiMode & Configuration.UI_MODE_TYPE_MASK; final boolean uiModeSupportsDialogs = (modeType != Configuration.UI_MODE_TYPE_CAR && !(modeType == Configuration.UI_MODE_TYPE_WATCH && Build.IS_USER) && modeType != Configuration.UI_MODE_TYPE_TELEVISION && modeType != Configuration.UI_MODE_TYPE_VR_HEADSET); return inputMethodExists && uiModeSupportsDialogs; } @Override public boolean shouldUpRecreateTask(IBinder token, String destAffinity) { synchronized (this) { ActivityRecord srec = ActivityRecord.forTokenLocked(token); if (srec != null) { return srec.getStack().shouldUpRecreateTaskLocked(srec, destAffinity); } } return false; } public boolean navigateUpTo(IBinder token, Intent destIntent, int resultCode, Intent resultData) { synchronized (this) { final ActivityRecord r = ActivityRecord.forTokenLocked(token); if (r != null) { return r.getStack().navigateUpToLocked(r, destIntent, resultCode, resultData); } return false; } } public int getLaunchedFromUid(IBinder activityToken) { ActivityRecord srec; synchronized (this) { srec = ActivityRecord.forTokenLocked(activityToken); } if (srec == null) { return -1; } return srec.launchedFromUid; } public String getLaunchedFromPackage(IBinder activityToken) { ActivityRecord srec; synchronized (this) { srec = ActivityRecord.forTokenLocked(activityToken); } if (srec == null) { return null; } return srec.launchedFromPackage; } // ========================================================= // LIFETIME MANAGEMENT // ========================================================= // Returns whether the app is receiving broadcast. // If receiving, fetch all broadcast queues which the app is // the current [or imminent] receiver on. private boolean isReceivingBroadcastLocked(ProcessRecord app, ArraySet receivingQueues) { if (!app.curReceivers.isEmpty()) { for (BroadcastRecord r : app.curReceivers) { receivingQueues.add(r.queue); } return true; } // It's not the current receiver, but it might be starting up to become one for (BroadcastQueue queue : mBroadcastQueues) { final BroadcastRecord r = queue.mPendingBroadcast; if (r != null && r.curApp == app) { // found it; report which queue it's in receivingQueues.add(queue); } } return !receivingQueues.isEmpty(); } Association startAssociationLocked(int sourceUid, String sourceProcess, int sourceState, int targetUid, ComponentName targetComponent, String targetProcess) { if (!mTrackingAssociations) { return null; } ArrayMap>> components = mAssociations.get(targetUid); if (components == null) { components = new ArrayMap<>(); mAssociations.put(targetUid, components); } SparseArray> sourceUids = components.get(targetComponent); if (sourceUids == null) { sourceUids = new SparseArray<>(); components.put(targetComponent, sourceUids); } ArrayMap sourceProcesses = sourceUids.get(sourceUid); if (sourceProcesses == null) { sourceProcesses = new ArrayMap<>(); sourceUids.put(sourceUid, sourceProcesses); } Association ass = sourceProcesses.get(sourceProcess); if (ass == null) { ass = new Association(sourceUid, sourceProcess, targetUid, targetComponent, targetProcess); sourceProcesses.put(sourceProcess, ass); } ass.mCount++; ass.mNesting++; if (ass.mNesting == 1) { ass.mStartTime = ass.mLastStateUptime = SystemClock.uptimeMillis(); ass.mLastState = sourceState; } return ass; } void stopAssociationLocked(int sourceUid, String sourceProcess, int targetUid, ComponentName targetComponent) { if (!mTrackingAssociations) { return; } ArrayMap>> components = mAssociations.get(targetUid); if (components == null) { return; } SparseArray> sourceUids = components.get(targetComponent); if (sourceUids == null) { return; } ArrayMap sourceProcesses = sourceUids.get(sourceUid); if (sourceProcesses == null) { return; } Association ass = sourceProcesses.get(sourceProcess); if (ass == null || ass.mNesting <= 0) { return; } ass.mNesting--; if (ass.mNesting == 0) { long uptime = SystemClock.uptimeMillis(); ass.mTime += uptime - ass.mStartTime; ass.mStateTimes[ass.mLastState-ActivityManager.MIN_PROCESS_STATE] += uptime - ass.mLastStateUptime; ass.mLastState = ActivityManager.MAX_PROCESS_STATE + 2; } } private void noteUidProcessState(final int uid, final int state) { mBatteryStatsService.noteUidProcessState(uid, state); if (mTrackingAssociations) { for (int i1=0, N1=mAssociations.size(); i1>> targetComponents = mAssociations.valueAt(i1); for (int i2=0, N2=targetComponents.size(); i2> sourceUids = targetComponents.valueAt(i2); ArrayMap sourceProcesses = sourceUids.get(uid); if (sourceProcesses != null) { for (int i4=0, N4=sourceProcesses.size(); i4= 1) { // currently associated long uptime = SystemClock.uptimeMillis(); ass.mStateTimes[ass.mLastState-ActivityManager.MIN_PROCESS_STATE] += uptime - ass.mLastStateUptime; ass.mLastState = state; ass.mLastStateUptime = uptime; } } } } } } } private final int computeOomAdjLocked(ProcessRecord app, int cachedAdj, ProcessRecord TOP_APP, boolean doingAll, long now) { if (mAdjSeq == app.adjSeq) { // This adjustment has already been computed. return app.curRawAdj; } if (app.thread == null) { app.adjSeq = mAdjSeq; app.curSchedGroup = ProcessList.SCHED_GROUP_BACKGROUND; app.curProcState = ActivityManager.PROCESS_STATE_CACHED_EMPTY; return (app.curAdj=app.curRawAdj=ProcessList.CACHED_APP_MAX_ADJ); } app.adjTypeCode = ActivityManager.RunningAppProcessInfo.REASON_UNKNOWN; app.adjSource = null; app.adjTarget = null; app.empty = false; app.cached = false; final int activitiesSize = app.activities.size(); if (app.maxAdj <= ProcessList.FOREGROUND_APP_ADJ) { // The max adjustment doesn't allow this app to be anything // below foreground, so it is not worth doing work for it. if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Making fixed: " + app); app.adjType = "fixed"; app.adjSeq = mAdjSeq; app.curRawAdj = app.maxAdj; app.foregroundActivities = false; app.curSchedGroup = ProcessList.SCHED_GROUP_DEFAULT; app.curProcState = ActivityManager.PROCESS_STATE_PERSISTENT; // System processes can do UI, and when they do we want to have // them trim their memory after the user leaves the UI. To // facilitate this, here we need to determine whether or not it // is currently showing UI. app.systemNoUi = true; if (app == TOP_APP) { app.systemNoUi = false; app.curSchedGroup = ProcessList.SCHED_GROUP_TOP_APP; app.adjType = "pers-top-activity"; } else if (app.hasTopUi) { app.systemNoUi = false; app.curSchedGroup = ProcessList.SCHED_GROUP_TOP_APP; app.adjType = "pers-top-ui"; } else if (activitiesSize > 0) { for (int j = 0; j < activitiesSize; j++) { final ActivityRecord r = app.activities.get(j); if (r.visible) { app.systemNoUi = false; } } } if (!app.systemNoUi) { app.curProcState = ActivityManager.PROCESS_STATE_PERSISTENT_UI; } return (app.curAdj=app.maxAdj); } app.systemNoUi = false; final int PROCESS_STATE_CUR_TOP = mTopProcessState; // Determine the importance of the process, starting with most // important to least, and assign an appropriate OOM adjustment. int adj; int schedGroup; int procState; boolean foregroundActivities = false; mTmpBroadcastQueue.clear(); if (app == TOP_APP) { // The last app on the list is the foreground app. adj = ProcessList.FOREGROUND_APP_ADJ; schedGroup = ProcessList.SCHED_GROUP_TOP_APP; app.adjType = "top-activity"; foregroundActivities = true; procState = PROCESS_STATE_CUR_TOP; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Making top: " + app); } else if (app.instr != null) { // Don't want to kill running instrumentation. adj = ProcessList.FOREGROUND_APP_ADJ; schedGroup = ProcessList.SCHED_GROUP_DEFAULT; app.adjType = "instrumentation"; procState = ActivityManager.PROCESS_STATE_FOREGROUND_SERVICE; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Making instrumentation: " + app); } else if (isReceivingBroadcastLocked(app, mTmpBroadcastQueue)) { // An app that is currently receiving a broadcast also // counts as being in the foreground for OOM killer purposes. // It's placed in a sched group based on the nature of the // broadcast as reflected by which queue it's active in. adj = ProcessList.FOREGROUND_APP_ADJ; schedGroup = (mTmpBroadcastQueue.contains(mFgBroadcastQueue)) ? ProcessList.SCHED_GROUP_DEFAULT : ProcessList.SCHED_GROUP_BACKGROUND; app.adjType = "broadcast"; procState = ActivityManager.PROCESS_STATE_RECEIVER; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Making broadcast: " + app); } else if (app.executingServices.size() > 0) { // An app that is currently executing a service callback also // counts as being in the foreground. adj = ProcessList.FOREGROUND_APP_ADJ; schedGroup = app.execServicesFg ? ProcessList.SCHED_GROUP_DEFAULT : ProcessList.SCHED_GROUP_BACKGROUND; app.adjType = "exec-service"; procState = ActivityManager.PROCESS_STATE_SERVICE; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Making exec-service: " + app); //Slog.i(TAG, "EXEC " + (app.execServicesFg ? "FG" : "BG") + ": " + app); } else { // As far as we know the process is empty. We may change our mind later. schedGroup = ProcessList.SCHED_GROUP_BACKGROUND; // At this point we don't actually know the adjustment. Use the cached adj // value that the caller wants us to. adj = cachedAdj; procState = ActivityManager.PROCESS_STATE_CACHED_EMPTY; app.cached = true; app.empty = true; app.adjType = "cch-empty"; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Making empty: " + app); } // Examine all activities if not already foreground. if (!foregroundActivities && activitiesSize > 0) { int minLayer = ProcessList.VISIBLE_APP_LAYER_MAX; for (int j = 0; j < activitiesSize; j++) { final ActivityRecord r = app.activities.get(j); if (r.app != app) { Log.e(TAG, "Found activity " + r + " in proc activity list using " + r.app + " instead of expected " + app); if (r.app == null || (r.app.uid == app.uid)) { // Only fix things up when they look sane r.app = app; } else { continue; } } if (r.visible) { // App has a visible activity; only upgrade adjustment. if (adj > ProcessList.VISIBLE_APP_ADJ) { adj = ProcessList.VISIBLE_APP_ADJ; app.adjType = "vis-activity"; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to vis-activity: " + app); } if (procState > PROCESS_STATE_CUR_TOP) { procState = PROCESS_STATE_CUR_TOP; app.adjType = "vis-activity"; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to vis-activity: " + app); } schedGroup = ProcessList.SCHED_GROUP_DEFAULT; app.cached = false; app.empty = false; foregroundActivities = true; final TaskRecord task = r.getTask(); if (task != null && minLayer > 0) { final int layer = task.mLayerRank; if (layer >= 0 && minLayer > layer) { minLayer = layer; } } break; } else if (r.state == ActivityState.PAUSING || r.state == ActivityState.PAUSED) { if (adj > ProcessList.PERCEPTIBLE_APP_ADJ) { adj = ProcessList.PERCEPTIBLE_APP_ADJ; app.adjType = "pause-activity"; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to pause-activity: " + app); } if (procState > PROCESS_STATE_CUR_TOP) { procState = PROCESS_STATE_CUR_TOP; app.adjType = "pause-activity"; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to pause-activity: " + app); } schedGroup = ProcessList.SCHED_GROUP_DEFAULT; app.cached = false; app.empty = false; foregroundActivities = true; } else if (r.state == ActivityState.STOPPING) { if (adj > ProcessList.PERCEPTIBLE_APP_ADJ) { adj = ProcessList.PERCEPTIBLE_APP_ADJ; app.adjType = "stop-activity"; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to stop-activity: " + app); } // For the process state, we will at this point consider the // process to be cached. It will be cached either as an activity // or empty depending on whether the activity is finishing. We do // this so that we can treat the process as cached for purposes of // memory trimming (determing current memory level, trim command to // send to process) since there can be an arbitrary number of stopping // processes and they should soon all go into the cached state. if (!r.finishing) { if (procState > ActivityManager.PROCESS_STATE_LAST_ACTIVITY) { procState = ActivityManager.PROCESS_STATE_LAST_ACTIVITY; app.adjType = "stop-activity"; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to stop-activity: " + app); } } app.cached = false; app.empty = false; foregroundActivities = true; } else { if (procState > ActivityManager.PROCESS_STATE_CACHED_ACTIVITY) { procState = ActivityManager.PROCESS_STATE_CACHED_ACTIVITY; app.adjType = "cch-act"; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to cached activity: " + app); } } } if (adj == ProcessList.VISIBLE_APP_ADJ) { adj += minLayer; } } if (adj > ProcessList.PERCEPTIBLE_APP_ADJ || procState > ActivityManager.PROCESS_STATE_FOREGROUND_SERVICE) { if (app.foregroundServices) { // The user is aware of this app, so make it visible. adj = ProcessList.PERCEPTIBLE_APP_ADJ; procState = ActivityManager.PROCESS_STATE_FOREGROUND_SERVICE; app.cached = false; app.adjType = "fg-service"; schedGroup = ProcessList.SCHED_GROUP_DEFAULT; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to fg service: " + app); } else if (app.hasOverlayUi) { // The process is display an overlay UI. adj = ProcessList.PERCEPTIBLE_APP_ADJ; procState = ActivityManager.PROCESS_STATE_IMPORTANT_FOREGROUND; app.cached = false; app.adjType = "has-overlay-ui"; schedGroup = ProcessList.SCHED_GROUP_DEFAULT; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to overlay ui: " + app); } } if (adj > ProcessList.PERCEPTIBLE_APP_ADJ || procState > ActivityManager.PROCESS_STATE_TRANSIENT_BACKGROUND) { if (app.forcingToImportant != null) { // This is currently used for toasts... they are not interactive, and // we don't want them to cause the app to become fully foreground (and // thus out of background check), so we yes the best background level we can. adj = ProcessList.PERCEPTIBLE_APP_ADJ; procState = ActivityManager.PROCESS_STATE_TRANSIENT_BACKGROUND; app.cached = false; app.adjType = "force-imp"; app.adjSource = app.forcingToImportant; schedGroup = ProcessList.SCHED_GROUP_DEFAULT; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to force imp: " + app); } } if (app == mHeavyWeightProcess) { if (adj > ProcessList.HEAVY_WEIGHT_APP_ADJ) { // We don't want to kill the current heavy-weight process. adj = ProcessList.HEAVY_WEIGHT_APP_ADJ; schedGroup = ProcessList.SCHED_GROUP_BACKGROUND; app.cached = false; app.adjType = "heavy"; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to heavy: " + app); } if (procState > ActivityManager.PROCESS_STATE_HEAVY_WEIGHT) { procState = ActivityManager.PROCESS_STATE_HEAVY_WEIGHT; app.adjType = "heavy"; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to heavy: " + app); } } if (app == mHomeProcess) { if (adj > ProcessList.HOME_APP_ADJ) { // This process is hosting what we currently consider to be the // home app, so we don't want to let it go into the background. adj = ProcessList.HOME_APP_ADJ; schedGroup = ProcessList.SCHED_GROUP_BACKGROUND; app.cached = false; app.adjType = "home"; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to home: " + app); } if (procState > ActivityManager.PROCESS_STATE_HOME) { procState = ActivityManager.PROCESS_STATE_HOME; app.adjType = "home"; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to home: " + app); } } if (app == mPreviousProcess && app.activities.size() > 0) { if (adj > ProcessList.PREVIOUS_APP_ADJ) { // This was the previous process that showed UI to the user. // We want to try to keep it around more aggressively, to give // a good experience around switching between two apps. adj = ProcessList.PREVIOUS_APP_ADJ; schedGroup = ProcessList.SCHED_GROUP_BACKGROUND; app.cached = false; app.adjType = "previous"; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to prev: " + app); } if (procState > ActivityManager.PROCESS_STATE_LAST_ACTIVITY) { procState = ActivityManager.PROCESS_STATE_LAST_ACTIVITY; app.adjType = "previous"; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to prev: " + app); } } if (false) Slog.i(TAG, "OOM " + app + ": initial adj=" + adj + " reason=" + app.adjType); // By default, we use the computed adjustment. It may be changed if // there are applications dependent on our services or providers, but // this gives us a baseline and makes sure we don't get into an // infinite recursion. app.adjSeq = mAdjSeq; app.curRawAdj = adj; app.hasStartedServices = false; if (mBackupTarget != null && app == mBackupTarget.app) { // If possible we want to avoid killing apps while they're being backed up if (adj > ProcessList.BACKUP_APP_ADJ) { if (DEBUG_BACKUP) Slog.v(TAG_BACKUP, "oom BACKUP_APP_ADJ for " + app); adj = ProcessList.BACKUP_APP_ADJ; if (procState > ActivityManager.PROCESS_STATE_TRANSIENT_BACKGROUND) { procState = ActivityManager.PROCESS_STATE_TRANSIENT_BACKGROUND; } app.adjType = "backup"; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to backup: " + app); app.cached = false; } if (procState > ActivityManager.PROCESS_STATE_BACKUP) { procState = ActivityManager.PROCESS_STATE_BACKUP; app.adjType = "backup"; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to backup: " + app); } } boolean mayBeTop = false; String mayBeTopType = null; Object mayBeTopSource = null; Object mayBeTopTarget = null; for (int is = app.services.size()-1; is >= 0 && (adj > ProcessList.FOREGROUND_APP_ADJ || schedGroup == ProcessList.SCHED_GROUP_BACKGROUND || procState > ActivityManager.PROCESS_STATE_TOP); is--) { ServiceRecord s = app.services.valueAt(is); if (s.startRequested) { app.hasStartedServices = true; if (procState > ActivityManager.PROCESS_STATE_SERVICE) { procState = ActivityManager.PROCESS_STATE_SERVICE; app.adjType = "started-services"; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to started service: " + app); } if (app.hasShownUi && app != mHomeProcess) { // If this process has shown some UI, let it immediately // go to the LRU list because it may be pretty heavy with // UI stuff. We'll tag it with a label just to help // debug and understand what is going on. if (adj > ProcessList.SERVICE_ADJ) { app.adjType = "cch-started-ui-services"; } } else { if (now < (s.lastActivity + mConstants.MAX_SERVICE_INACTIVITY)) { // This service has seen some activity within // recent memory, so we will keep its process ahead // of the background processes. if (adj > ProcessList.SERVICE_ADJ) { adj = ProcessList.SERVICE_ADJ; app.adjType = "started-services"; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to started service: " + app); app.cached = false; } } // If we have let the service slide into the background // state, still have some text describing what it is doing // even though the service no longer has an impact. if (adj > ProcessList.SERVICE_ADJ) { app.adjType = "cch-started-services"; } } } for (int conni = s.connections.size()-1; conni >= 0 && (adj > ProcessList.FOREGROUND_APP_ADJ || schedGroup == ProcessList.SCHED_GROUP_BACKGROUND || procState > ActivityManager.PROCESS_STATE_TOP); conni--) { ArrayList clist = s.connections.valueAt(conni); for (int i = 0; i < clist.size() && (adj > ProcessList.FOREGROUND_APP_ADJ || schedGroup == ProcessList.SCHED_GROUP_BACKGROUND || procState > ActivityManager.PROCESS_STATE_TOP); i++) { // XXX should compute this based on the max of // all connected clients. ConnectionRecord cr = clist.get(i); if (cr.binding.client == app) { // Binding to ourself is not interesting. continue; } if ((cr.flags&Context.BIND_WAIVE_PRIORITY) == 0) { ProcessRecord client = cr.binding.client; int clientAdj = computeOomAdjLocked(client, cachedAdj, TOP_APP, doingAll, now); int clientProcState = client.curProcState; if (clientProcState >= ActivityManager.PROCESS_STATE_CACHED_ACTIVITY) { // If the other app is cached for any reason, for purposes here // we are going to consider it empty. The specific cached state // doesn't propagate except under certain conditions. clientProcState = ActivityManager.PROCESS_STATE_CACHED_EMPTY; } String adjType = null; if ((cr.flags&Context.BIND_ALLOW_OOM_MANAGEMENT) != 0) { // Not doing bind OOM management, so treat // this guy more like a started service. if (app.hasShownUi && app != mHomeProcess) { // If this process has shown some UI, let it immediately // go to the LRU list because it may be pretty heavy with // UI stuff. We'll tag it with a label just to help // debug and understand what is going on. if (adj > clientAdj) { adjType = "cch-bound-ui-services"; } app.cached = false; clientAdj = adj; clientProcState = procState; } else { if (now >= (s.lastActivity + mConstants.MAX_SERVICE_INACTIVITY)) { // This service has not seen activity within // recent memory, so allow it to drop to the // LRU list if there is no other reason to keep // it around. We'll also tag it with a label just // to help debug and undertand what is going on. if (adj > clientAdj) { adjType = "cch-bound-services"; } clientAdj = adj; } } } if (adj > clientAdj) { // If this process has recently shown UI, and // the process that is binding to it is less // important than being visible, then we don't // care about the binding as much as we care // about letting this process get into the LRU // list to be killed and restarted if needed for // memory. if (app.hasShownUi && app != mHomeProcess && clientAdj > ProcessList.PERCEPTIBLE_APP_ADJ) { if (adj >= ProcessList.CACHED_APP_MIN_ADJ) { adjType = "cch-bound-ui-services"; } } else { int newAdj; if ((cr.flags&(Context.BIND_ABOVE_CLIENT |Context.BIND_IMPORTANT)) != 0) { newAdj = clientAdj >= ProcessList.PERSISTENT_SERVICE_ADJ ? clientAdj : ProcessList.PERSISTENT_SERVICE_ADJ; } else if ((cr.flags&Context.BIND_NOT_VISIBLE) != 0 && clientAdj < ProcessList.PERCEPTIBLE_APP_ADJ && adj > ProcessList.PERCEPTIBLE_APP_ADJ) { newAdj = ProcessList.PERCEPTIBLE_APP_ADJ; } else if (clientAdj >= ProcessList.PERCEPTIBLE_APP_ADJ) { newAdj = clientAdj; } else { if (adj > ProcessList.VISIBLE_APP_ADJ) { newAdj = Math.max(clientAdj, ProcessList.VISIBLE_APP_ADJ); } else { newAdj = adj; } } if (!client.cached) { app.cached = false; } if (adj > newAdj) { adj = newAdj; adjType = "service"; } } } if ((cr.flags & (Context.BIND_NOT_FOREGROUND | Context.BIND_IMPORTANT_BACKGROUND)) == 0) { // This will treat important bound services identically to // the top app, which may behave differently than generic // foreground work. if (client.curSchedGroup > schedGroup) { if ((cr.flags&Context.BIND_IMPORTANT) != 0) { schedGroup = client.curSchedGroup; } else { schedGroup = ProcessList.SCHED_GROUP_DEFAULT; } } if (clientProcState <= ActivityManager.PROCESS_STATE_TOP) { if (clientProcState == ActivityManager.PROCESS_STATE_TOP) { // Special handling of clients who are in the top state. // We *may* want to consider this process to be in the // top state as well, but only if there is not another // reason for it to be running. Being on the top is a // special state, meaning you are specifically running // for the current top app. If the process is already // running in the background for some other reason, it // is more important to continue considering it to be // in the background state. mayBeTop = true; mayBeTopType = "service"; mayBeTopSource = cr.binding.client; mayBeTopTarget = s.name; clientProcState = ActivityManager.PROCESS_STATE_CACHED_EMPTY; } else { // Special handling for above-top states (persistent // processes). These should not bring the current process // into the top state, since they are not on top. Instead // give them the best state after that. if ((cr.flags&Context.BIND_FOREGROUND_SERVICE) != 0) { clientProcState = ActivityManager.PROCESS_STATE_BOUND_FOREGROUND_SERVICE; } else if (mWakefulness == PowerManagerInternal.WAKEFULNESS_AWAKE && (cr.flags&Context.BIND_FOREGROUND_SERVICE_WHILE_AWAKE) != 0) { clientProcState = ActivityManager.PROCESS_STATE_BOUND_FOREGROUND_SERVICE; } else { clientProcState = ActivityManager.PROCESS_STATE_IMPORTANT_FOREGROUND; } } } } else if ((cr.flags & Context.BIND_IMPORTANT_BACKGROUND) == 0) { if (clientProcState < ActivityManager.PROCESS_STATE_TRANSIENT_BACKGROUND) { clientProcState = ActivityManager.PROCESS_STATE_TRANSIENT_BACKGROUND; } } else { if (clientProcState < ActivityManager.PROCESS_STATE_IMPORTANT_BACKGROUND) { clientProcState = ActivityManager.PROCESS_STATE_IMPORTANT_BACKGROUND; } } if (procState > clientProcState) { procState = clientProcState; if (adjType == null) { adjType = "service"; } } if (procState < ActivityManager.PROCESS_STATE_IMPORTANT_BACKGROUND && (cr.flags&Context.BIND_SHOWING_UI) != 0) { app.pendingUiClean = true; } if (adjType != null) { app.adjType = adjType; app.adjTypeCode = ActivityManager.RunningAppProcessInfo .REASON_SERVICE_IN_USE; app.adjSource = cr.binding.client; app.adjSourceProcState = clientProcState; app.adjTarget = s.name; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to " + adjType + ": " + app + ", due to " + cr.binding.client + " adj=" + adj + " procState=" + procState); } } if ((cr.flags&Context.BIND_TREAT_LIKE_ACTIVITY) != 0) { app.treatLikeActivity = true; } final ActivityRecord a = cr.activity; if ((cr.flags&Context.BIND_ADJUST_WITH_ACTIVITY) != 0) { if (a != null && adj > ProcessList.FOREGROUND_APP_ADJ && (a.visible || a.state == ActivityState.RESUMED || a.state == ActivityState.PAUSING)) { adj = ProcessList.FOREGROUND_APP_ADJ; if ((cr.flags&Context.BIND_NOT_FOREGROUND) == 0) { if ((cr.flags&Context.BIND_IMPORTANT) != 0) { schedGroup = ProcessList.SCHED_GROUP_TOP_APP_BOUND; } else { schedGroup = ProcessList.SCHED_GROUP_DEFAULT; } } app.cached = false; app.adjType = "service"; app.adjTypeCode = ActivityManager.RunningAppProcessInfo .REASON_SERVICE_IN_USE; app.adjSource = a; app.adjSourceProcState = procState; app.adjTarget = s.name; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to service w/activity: " + app); } } } } } for (int provi = app.pubProviders.size()-1; provi >= 0 && (adj > ProcessList.FOREGROUND_APP_ADJ || schedGroup == ProcessList.SCHED_GROUP_BACKGROUND || procState > ActivityManager.PROCESS_STATE_TOP); provi--) { ContentProviderRecord cpr = app.pubProviders.valueAt(provi); for (int i = cpr.connections.size()-1; i >= 0 && (adj > ProcessList.FOREGROUND_APP_ADJ || schedGroup == ProcessList.SCHED_GROUP_BACKGROUND || procState > ActivityManager.PROCESS_STATE_TOP); i--) { ContentProviderConnection conn = cpr.connections.get(i); ProcessRecord client = conn.client; if (client == app) { // Being our own client is not interesting. continue; } int clientAdj = computeOomAdjLocked(client, cachedAdj, TOP_APP, doingAll, now); int clientProcState = client.curProcState; if (clientProcState >= ActivityManager.PROCESS_STATE_CACHED_ACTIVITY) { // If the other app is cached for any reason, for purposes here // we are going to consider it empty. clientProcState = ActivityManager.PROCESS_STATE_CACHED_EMPTY; } String adjType = null; if (adj > clientAdj) { if (app.hasShownUi && app != mHomeProcess && clientAdj > ProcessList.PERCEPTIBLE_APP_ADJ) { adjType = "cch-ui-provider"; } else { adj = clientAdj > ProcessList.FOREGROUND_APP_ADJ ? clientAdj : ProcessList.FOREGROUND_APP_ADJ; adjType = "provider"; } app.cached &= client.cached; } if (clientProcState <= ActivityManager.PROCESS_STATE_TOP) { if (clientProcState == ActivityManager.PROCESS_STATE_TOP) { // Special handling of clients who are in the top state. // We *may* want to consider this process to be in the // top state as well, but only if there is not another // reason for it to be running. Being on the top is a // special state, meaning you are specifically running // for the current top app. If the process is already // running in the background for some other reason, it // is more important to continue considering it to be // in the background state. mayBeTop = true; clientProcState = ActivityManager.PROCESS_STATE_CACHED_EMPTY; mayBeTopType = adjType = "provider-top"; mayBeTopSource = client; mayBeTopTarget = cpr.name; } else { // Special handling for above-top states (persistent // processes). These should not bring the current process // into the top state, since they are not on top. Instead // give them the best state after that. clientProcState = ActivityManager.PROCESS_STATE_BOUND_FOREGROUND_SERVICE; if (adjType == null) { adjType = "provider"; } } } if (procState > clientProcState) { procState = clientProcState; } if (client.curSchedGroup > schedGroup) { schedGroup = ProcessList.SCHED_GROUP_DEFAULT; } if (adjType != null) { app.adjType = adjType; app.adjTypeCode = ActivityManager.RunningAppProcessInfo .REASON_PROVIDER_IN_USE; app.adjSource = client; app.adjSourceProcState = clientProcState; app.adjTarget = cpr.name; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to " + adjType + ": " + app + ", due to " + client + " adj=" + adj + " procState=" + procState); } } // If the provider has external (non-framework) process // dependencies, ensure that its adjustment is at least // FOREGROUND_APP_ADJ. if (cpr.hasExternalProcessHandles()) { if (adj > ProcessList.FOREGROUND_APP_ADJ) { adj = ProcessList.FOREGROUND_APP_ADJ; schedGroup = ProcessList.SCHED_GROUP_DEFAULT; app.cached = false; app.adjType = "ext-provider"; app.adjTarget = cpr.name; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to external provider: " + app); } if (procState > ActivityManager.PROCESS_STATE_IMPORTANT_FOREGROUND) { procState = ActivityManager.PROCESS_STATE_IMPORTANT_FOREGROUND; } } } if (app.lastProviderTime > 0 && (app.lastProviderTime+mConstants.CONTENT_PROVIDER_RETAIN_TIME) > now) { if (adj > ProcessList.PREVIOUS_APP_ADJ) { adj = ProcessList.PREVIOUS_APP_ADJ; schedGroup = ProcessList.SCHED_GROUP_BACKGROUND; app.cached = false; app.adjType = "recent-provider"; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to recent provider: " + app); } if (procState > ActivityManager.PROCESS_STATE_LAST_ACTIVITY) { procState = ActivityManager.PROCESS_STATE_LAST_ACTIVITY; app.adjType = "recent-provider"; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to recent provider: " + app); } } if (mayBeTop && procState > ActivityManager.PROCESS_STATE_TOP) { // A client of one of our services or providers is in the top state. We // *may* want to be in the top state, but not if we are already running in // the background for some other reason. For the decision here, we are going // to pick out a few specific states that we want to remain in when a client // is top (states that tend to be longer-term) and otherwise allow it to go // to the top state. switch (procState) { case ActivityManager.PROCESS_STATE_BOUND_FOREGROUND_SERVICE: // Something else is keeping it at this level, just leave it. break; case ActivityManager.PROCESS_STATE_IMPORTANT_FOREGROUND: case ActivityManager.PROCESS_STATE_IMPORTANT_BACKGROUND: case ActivityManager.PROCESS_STATE_TRANSIENT_BACKGROUND: case ActivityManager.PROCESS_STATE_SERVICE: // These all are longer-term states, so pull them up to the top // of the background states, but not all the way to the top state. procState = ActivityManager.PROCESS_STATE_BOUND_FOREGROUND_SERVICE; app.adjType = mayBeTopType; app.adjSource = mayBeTopSource; app.adjTarget = mayBeTopTarget; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "May be top raise to " + mayBeTopType + ": " + app + ", due to " + mayBeTopSource + " adj=" + adj + " procState=" + procState); break; default: // Otherwise, top is a better choice, so take it. procState = ActivityManager.PROCESS_STATE_TOP; app.adjType = mayBeTopType; app.adjSource = mayBeTopSource; app.adjTarget = mayBeTopTarget; if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "May be top raise to " + mayBeTopType + ": " + app + ", due to " + mayBeTopSource + " adj=" + adj + " procState=" + procState); break; } } if (procState >= ActivityManager.PROCESS_STATE_CACHED_EMPTY) { if (app.hasClientActivities) { // This is a cached process, but with client activities. Mark it so. procState = ActivityManager.PROCESS_STATE_CACHED_ACTIVITY_CLIENT; app.adjType = "cch-client-act"; } else if (app.treatLikeActivity) { // This is a cached process, but somebody wants us to treat it like it has // an activity, okay! procState = ActivityManager.PROCESS_STATE_CACHED_ACTIVITY; app.adjType = "cch-as-act"; } } if (adj == ProcessList.SERVICE_ADJ) { if (doingAll) { app.serviceb = mNewNumAServiceProcs > (mNumServiceProcs/3); mNewNumServiceProcs++; //Slog.i(TAG, "ADJ " + app + " serviceb=" + app.serviceb); if (!app.serviceb) { // This service isn't far enough down on the LRU list to // normally be a B service, but if we are low on RAM and it // is large we want to force it down since we would prefer to // keep launcher over it. if (mLastMemoryLevel > ProcessStats.ADJ_MEM_FACTOR_NORMAL && app.lastPss >= mProcessList.getCachedRestoreThresholdKb()) { app.serviceHighRam = true; app.serviceb = true; //Slog.i(TAG, "ADJ " + app + " high ram!"); } else { mNewNumAServiceProcs++; //Slog.i(TAG, "ADJ " + app + " not high ram!"); } } else { app.serviceHighRam = false; } } if (app.serviceb) { adj = ProcessList.SERVICE_B_ADJ; } } app.curRawAdj = adj; //Slog.i(TAG, "OOM ADJ " + app + ": pid=" + app.pid + // " adj=" + adj + " curAdj=" + app.curAdj + " maxAdj=" + app.maxAdj); if (adj > app.maxAdj) { adj = app.maxAdj; if (app.maxAdj <= ProcessList.PERCEPTIBLE_APP_ADJ) { schedGroup = ProcessList.SCHED_GROUP_DEFAULT; } } // Do final modification to adj. Everything we do between here and applying // the final setAdj must be done in this function, because we will also use // it when computing the final cached adj later. Note that we don't need to // worry about this for max adj above, since max adj will always be used to // keep it out of the cached vaues. app.curAdj = app.modifyRawOomAdj(adj); app.curSchedGroup = schedGroup; app.curProcState = procState; app.foregroundActivities = foregroundActivities; return app.curRawAdj; } /** * Record new PSS sample for a process. */ void recordPssSampleLocked(ProcessRecord proc, int procState, long pss, long uss, long swapPss, long now) { EventLogTags.writeAmPss(proc.pid, proc.uid, proc.processName, pss * 1024, uss * 1024, swapPss * 1024); proc.lastPssTime = now; proc.baseProcessTracker.addPss(pss, uss, true, proc.pkgList); if (DEBUG_PSS) Slog.d(TAG_PSS, "PSS of " + proc.toShortString() + ": " + pss + " lastPss=" + proc.lastPss + " state=" + ProcessList.makeProcStateString(procState)); if (proc.initialIdlePss == 0) { proc.initialIdlePss = pss; } proc.lastPss = pss; proc.lastSwapPss = swapPss; if (procState >= ActivityManager.PROCESS_STATE_HOME) { proc.lastCachedPss = pss; proc.lastCachedSwapPss = swapPss; } final SparseArray> watchUids = mMemWatchProcesses.getMap().get(proc.processName); Long check = null; if (watchUids != null) { Pair val = watchUids.get(proc.uid); if (val == null) { val = watchUids.get(0); } if (val != null) { check = val.first; } } if (check != null) { if ((pss * 1024) >= check && proc.thread != null && mMemWatchDumpProcName == null) { boolean isDebuggable = "1".equals(SystemProperties.get(SYSTEM_DEBUGGABLE, "0")); if (!isDebuggable) { if ((proc.info.flags&ApplicationInfo.FLAG_DEBUGGABLE) != 0) { isDebuggable = true; } } if (isDebuggable) { Slog.w(TAG, "Process " + proc + " exceeded pss limit " + check + "; reporting"); final ProcessRecord myProc = proc; final File heapdumpFile = DumpHeapProvider.getJavaFile(); mMemWatchDumpProcName = proc.processName; mMemWatchDumpFile = heapdumpFile.toString(); mMemWatchDumpPid = proc.pid; mMemWatchDumpUid = proc.uid; BackgroundThread.getHandler().post(new Runnable() { @Override public void run() { revokeUriPermission(ActivityThread.currentActivityThread() .getApplicationThread(), null, DumpHeapActivity.JAVA_URI, Intent.FLAG_GRANT_READ_URI_PERMISSION | Intent.FLAG_GRANT_WRITE_URI_PERMISSION, UserHandle.myUserId()); ParcelFileDescriptor fd = null; try { heapdumpFile.delete(); fd = ParcelFileDescriptor.open(heapdumpFile, ParcelFileDescriptor.MODE_CREATE | ParcelFileDescriptor.MODE_TRUNCATE | ParcelFileDescriptor.MODE_WRITE_ONLY | ParcelFileDescriptor.MODE_APPEND); IApplicationThread thread = myProc.thread; if (thread != null) { try { if (DEBUG_PSS) Slog.d(TAG_PSS, "Requesting dump heap from " + myProc + " to " + heapdumpFile); thread.dumpHeap(/* managed= */ true, /* mallocInfo= */ false, /* runGc= */ false, heapdumpFile.toString(), fd); } catch (RemoteException e) { } } } catch (FileNotFoundException e) { e.printStackTrace(); } finally { if (fd != null) { try { fd.close(); } catch (IOException e) { } } } } }); } else { Slog.w(TAG, "Process " + proc + " exceeded pss limit " + check + ", but debugging not enabled"); } } } } /** * Schedule PSS collection of a process. */ void requestPssLocked(ProcessRecord proc, int procState) { if (mPendingPssProcesses.contains(proc)) { return; } if (mPendingPssProcesses.size() == 0) { mBgHandler.sendEmptyMessage(COLLECT_PSS_BG_MSG); } if (DEBUG_PSS) Slog.d(TAG_PSS, "Requesting PSS of: " + proc); proc.pssProcState = procState; mPendingPssProcesses.add(proc); } /** * Schedule PSS collection of all processes. */ void requestPssAllProcsLocked(long now, boolean always, boolean memLowered) { if (!always) { if (now < (mLastFullPssTime + (memLowered ? mConstants.FULL_PSS_LOWERED_INTERVAL : mConstants.FULL_PSS_MIN_INTERVAL))) { return; } } if (DEBUG_PSS) Slog.d(TAG_PSS, "Requesting PSS of all procs! memLowered=" + memLowered); mLastFullPssTime = now; mFullPssPending = true; mPendingPssProcesses.ensureCapacity(mLruProcesses.size()); mPendingPssProcesses.clear(); for (int i = mLruProcesses.size() - 1; i >= 0; i--) { ProcessRecord app = mLruProcesses.get(i); if (app.thread == null || app.curProcState == ActivityManager.PROCESS_STATE_NONEXISTENT) { continue; } if (memLowered || now > (app.lastStateTime+ProcessList.PSS_ALL_INTERVAL)) { app.pssProcState = app.setProcState; app.nextPssTime = ProcessList.computeNextPssTime(app.curProcState, true, mTestPssMode, isSleepingLocked(), now); mPendingPssProcesses.add(app); } } mBgHandler.sendEmptyMessage(COLLECT_PSS_BG_MSG); } public void setTestPssMode(boolean enabled) { synchronized (this) { mTestPssMode = enabled; if (enabled) { // Whenever we enable the mode, we want to take a snapshot all of current // process mem use. requestPssAllProcsLocked(SystemClock.uptimeMillis(), true, true); } } } /** * Ask a given process to GC right now. */ final void performAppGcLocked(ProcessRecord app) { try { app.lastRequestedGc = SystemClock.uptimeMillis(); if (app.thread != null) { if (app.reportLowMemory) { app.reportLowMemory = false; app.thread.scheduleLowMemory(); } else { app.thread.processInBackground(); } } } catch (Exception e) { // whatever. } } /** * Returns true if things are idle enough to perform GCs. */ private final boolean canGcNowLocked() { boolean processingBroadcasts = false; for (BroadcastQueue q : mBroadcastQueues) { if (q.mParallelBroadcasts.size() != 0 || q.mOrderedBroadcasts.size() != 0) { processingBroadcasts = true; } } return !processingBroadcasts && (isSleepingLocked() || mStackSupervisor.allResumedActivitiesIdle()); } /** * Perform GCs on all processes that are waiting for it, but only * if things are idle. */ final void performAppGcsLocked() { final int N = mProcessesToGc.size(); if (N <= 0) { return; } if (canGcNowLocked()) { while (mProcessesToGc.size() > 0) { ProcessRecord proc = mProcessesToGc.remove(0); if (proc.curRawAdj > ProcessList.PERCEPTIBLE_APP_ADJ || proc.reportLowMemory) { if ((proc.lastRequestedGc+mConstants.GC_MIN_INTERVAL) <= SystemClock.uptimeMillis()) { // To avoid spamming the system, we will GC processes one // at a time, waiting a few seconds between each. performAppGcLocked(proc); scheduleAppGcsLocked(); return; } else { // It hasn't been long enough since we last GCed this // process... put it in the list to wait for its time. addProcessToGcListLocked(proc); break; } } } scheduleAppGcsLocked(); } } /** * If all looks good, perform GCs on all processes waiting for them. */ final void performAppGcsIfAppropriateLocked() { if (canGcNowLocked()) { performAppGcsLocked(); return; } // Still not idle, wait some more. scheduleAppGcsLocked(); } /** * Schedule the execution of all pending app GCs. */ final void scheduleAppGcsLocked() { mHandler.removeMessages(GC_BACKGROUND_PROCESSES_MSG); if (mProcessesToGc.size() > 0) { // Schedule a GC for the time to the next process. ProcessRecord proc = mProcessesToGc.get(0); Message msg = mHandler.obtainMessage(GC_BACKGROUND_PROCESSES_MSG); long when = proc.lastRequestedGc + mConstants.GC_MIN_INTERVAL; long now = SystemClock.uptimeMillis(); if (when < (now+mConstants.GC_TIMEOUT)) { when = now + mConstants.GC_TIMEOUT; } mHandler.sendMessageAtTime(msg, when); } } /** * Add a process to the array of processes waiting to be GCed. Keeps the * list in sorted order by the last GC time. The process can't already be * on the list. */ final void addProcessToGcListLocked(ProcessRecord proc) { boolean added = false; for (int i=mProcessesToGc.size()-1; i>=0; i--) { if (mProcessesToGc.get(i).lastRequestedGc < proc.lastRequestedGc) { added = true; mProcessesToGc.add(i+1, proc); break; } } if (!added) { mProcessesToGc.add(0, proc); } } /** * Set up to ask a process to GC itself. This will either do it * immediately, or put it on the list of processes to gc the next * time things are idle. */ final void scheduleAppGcLocked(ProcessRecord app) { long now = SystemClock.uptimeMillis(); if ((app.lastRequestedGc+mConstants.GC_MIN_INTERVAL) > now) { return; } if (!mProcessesToGc.contains(app)) { addProcessToGcListLocked(app); scheduleAppGcsLocked(); } } final void checkExcessivePowerUsageLocked() { updateCpuStatsNow(); BatteryStatsImpl stats = mBatteryStatsService.getActiveStatistics(); boolean doCpuKills = true; if (mLastPowerCheckUptime == 0) { doCpuKills = false; } final long curUptime = SystemClock.uptimeMillis(); final long uptimeSince = curUptime - mLastPowerCheckUptime; mLastPowerCheckUptime = curUptime; int i = mLruProcesses.size(); while (i > 0) { i--; ProcessRecord app = mLruProcesses.get(i); if (app.setProcState >= ActivityManager.PROCESS_STATE_HOME) { if (app.lastCpuTime <= 0) { continue; } long cputimeUsed = app.curCpuTime - app.lastCpuTime; if (DEBUG_POWER) { StringBuilder sb = new StringBuilder(128); sb.append("CPU for "); app.toShortString(sb); sb.append(": over "); TimeUtils.formatDuration(uptimeSince, sb); sb.append(" used "); TimeUtils.formatDuration(cputimeUsed, sb); sb.append(" ("); sb.append((cputimeUsed*100)/uptimeSince); sb.append("%)"); Slog.i(TAG_POWER, sb.toString()); } // If the process has used too much CPU over the last duration, the // user probably doesn't want this, so kill! if (doCpuKills && uptimeSince > 0) { // What is the limit for this process? int cpuLimit; long checkDur = curUptime - app.whenUnimportant; if (checkDur <= mConstants.POWER_CHECK_INTERVAL) { cpuLimit = mConstants.POWER_CHECK_MAX_CPU_1; } else if (checkDur <= (mConstants.POWER_CHECK_INTERVAL*2) || app.setProcState <= ActivityManager.PROCESS_STATE_HOME) { cpuLimit = mConstants.POWER_CHECK_MAX_CPU_2; } else if (checkDur <= (mConstants.POWER_CHECK_INTERVAL*3)) { cpuLimit = mConstants.POWER_CHECK_MAX_CPU_3; } else { cpuLimit = mConstants.POWER_CHECK_MAX_CPU_4; } if (((cputimeUsed*100)/uptimeSince) >= cpuLimit) { synchronized (stats) { stats.reportExcessiveCpuLocked(app.info.uid, app.processName, uptimeSince, cputimeUsed); } app.kill("excessive cpu " + cputimeUsed + " during " + uptimeSince + " dur=" + checkDur + " limit=" + cpuLimit, true); app.baseProcessTracker.reportExcessiveCpu(app.pkgList); } } app.lastCpuTime = app.curCpuTime; } } } private final boolean applyOomAdjLocked(ProcessRecord app, boolean doingAll, long now, long nowElapsed) { boolean success = true; if (app.curRawAdj != app.setRawAdj) { app.setRawAdj = app.curRawAdj; } int changes = 0; if (app.curAdj != app.setAdj) { ProcessList.setOomAdj(app.pid, app.uid, app.curAdj); if (DEBUG_SWITCH || DEBUG_OOM_ADJ || mCurOomAdjUid == app.info.uid) { String msg = "Set " + app.pid + " " + app.processName + " adj " + app.curAdj + ": " + app.adjType; reportOomAdjMessageLocked(TAG_OOM_ADJ, msg); } app.setAdj = app.curAdj; app.verifiedAdj = ProcessList.INVALID_ADJ; } if (app.setSchedGroup != app.curSchedGroup) { int oldSchedGroup = app.setSchedGroup; app.setSchedGroup = app.curSchedGroup; if (DEBUG_SWITCH || DEBUG_OOM_ADJ || mCurOomAdjUid == app.uid) { String msg = "Setting sched group of " + app.processName + " to " + app.curSchedGroup; reportOomAdjMessageLocked(TAG_OOM_ADJ, msg); } if (app.waitingToKill != null && app.curReceivers.isEmpty() && app.setSchedGroup == ProcessList.SCHED_GROUP_BACKGROUND) { app.kill(app.waitingToKill, true); success = false; } else { int processGroup; switch (app.curSchedGroup) { case ProcessList.SCHED_GROUP_BACKGROUND: processGroup = THREAD_GROUP_BG_NONINTERACTIVE; break; case ProcessList.SCHED_GROUP_TOP_APP: case ProcessList.SCHED_GROUP_TOP_APP_BOUND: processGroup = THREAD_GROUP_TOP_APP; break; default: processGroup = THREAD_GROUP_DEFAULT; break; } long oldId = Binder.clearCallingIdentity(); try { setProcessGroup(app.pid, processGroup); if (app.curSchedGroup == ProcessList.SCHED_GROUP_TOP_APP) { // do nothing if we already switched to RT if (oldSchedGroup != ProcessList.SCHED_GROUP_TOP_APP) { mVrController.onTopProcChangedLocked(app); if (mUseFifoUiScheduling) { // Switch UI pipeline for app to SCHED_FIFO app.savedPriority = Process.getThreadPriority(app.pid); scheduleAsFifoPriority(app.pid, /* suppressLogs */true); if (app.renderThreadTid != 0) { scheduleAsFifoPriority(app.renderThreadTid, /* suppressLogs */true); if (DEBUG_OOM_ADJ) { Slog.d("UI_FIFO", "Set RenderThread (TID " + app.renderThreadTid + ") to FIFO"); } } else { if (DEBUG_OOM_ADJ) { Slog.d("UI_FIFO", "Not setting RenderThread TID"); } } } else { // Boost priority for top app UI and render threads setThreadPriority(app.pid, TOP_APP_PRIORITY_BOOST); if (app.renderThreadTid != 0) { try { setThreadPriority(app.renderThreadTid, TOP_APP_PRIORITY_BOOST); } catch (IllegalArgumentException e) { // thread died, ignore } } } } } else if (oldSchedGroup == ProcessList.SCHED_GROUP_TOP_APP && app.curSchedGroup != ProcessList.SCHED_GROUP_TOP_APP) { mVrController.onTopProcChangedLocked(app); if (mUseFifoUiScheduling) { try { // Reset UI pipeline to SCHED_OTHER setThreadScheduler(app.pid, SCHED_OTHER, 0); setThreadPriority(app.pid, app.savedPriority); if (app.renderThreadTid != 0) { setThreadScheduler(app.renderThreadTid, SCHED_OTHER, 0); setThreadPriority(app.renderThreadTid, -4); } } catch (IllegalArgumentException e) { Slog.w(TAG, "Failed to set scheduling policy, thread does not exist:\n" + e); } catch (SecurityException e) { Slog.w(TAG, "Failed to set scheduling policy, not allowed:\n" + e); } } else { // Reset priority for top app UI and render threads setThreadPriority(app.pid, 0); if (app.renderThreadTid != 0) { setThreadPriority(app.renderThreadTid, 0); } } } } catch (Exception e) { if (false) { Slog.w(TAG, "Failed setting process group of " + app.pid + " to " + app.curSchedGroup); Slog.w(TAG, "at location", e); } } finally { Binder.restoreCallingIdentity(oldId); } } } if (app.repForegroundActivities != app.foregroundActivities) { app.repForegroundActivities = app.foregroundActivities; changes |= ProcessChangeItem.CHANGE_ACTIVITIES; } if (app.repProcState != app.curProcState) { app.repProcState = app.curProcState; if (app.thread != null) { try { if (false) { //RuntimeException h = new RuntimeException("here"); Slog.i(TAG, "Sending new process state " + app.repProcState + " to " + app /*, h*/); } app.thread.setProcessState(app.repProcState); } catch (RemoteException e) { } } } if (app.setProcState == ActivityManager.PROCESS_STATE_NONEXISTENT || ProcessList.procStatesDifferForMem(app.curProcState, app.setProcState)) { if (false && mTestPssMode && app.setProcState >= 0 && app.lastStateTime <= (now-200)) { // Experimental code to more aggressively collect pss while // running test... the problem is that this tends to collect // the data right when a process is transitioning between process // states, which well tend to give noisy data. long start = SystemClock.uptimeMillis(); long pss = Debug.getPss(app.pid, mTmpLong, null); recordPssSampleLocked(app, app.curProcState, pss, mTmpLong[0], mTmpLong[1], now); mPendingPssProcesses.remove(app); Slog.i(TAG, "Recorded pss for " + app + " state " + app.setProcState + " to " + app.curProcState + ": " + (SystemClock.uptimeMillis()-start) + "ms"); } app.lastStateTime = now; app.nextPssTime = ProcessList.computeNextPssTime(app.curProcState, true, mTestPssMode, isSleepingLocked(), now); if (DEBUG_PSS) Slog.d(TAG_PSS, "Process state change from " + ProcessList.makeProcStateString(app.setProcState) + " to " + ProcessList.makeProcStateString(app.curProcState) + " next pss in " + (app.nextPssTime-now) + ": " + app); } else { if (now > app.nextPssTime || (now > (app.lastPssTime+ProcessList.PSS_MAX_INTERVAL) && now > (app.lastStateTime+ProcessList.minTimeFromStateChange( mTestPssMode)))) { requestPssLocked(app, app.setProcState); app.nextPssTime = ProcessList.computeNextPssTime(app.curProcState, false, mTestPssMode, isSleepingLocked(), now); } else if (false && DEBUG_PSS) Slog.d(TAG_PSS, "Not requesting PSS of " + app + ": next=" + (app.nextPssTime-now)); } if (app.setProcState != app.curProcState) { if (DEBUG_SWITCH || DEBUG_OOM_ADJ || mCurOomAdjUid == app.uid) { String msg = "Proc state change of " + app.processName + " to " + app.curProcState; reportOomAdjMessageLocked(TAG_OOM_ADJ, msg); } boolean setImportant = app.setProcState < ActivityManager.PROCESS_STATE_SERVICE; boolean curImportant = app.curProcState < ActivityManager.PROCESS_STATE_SERVICE; if (setImportant && !curImportant) { // This app is no longer something we consider important enough to allow to // use arbitrary amounts of battery power. Note // its current CPU time to later know to kill it if // it is not behaving well. app.whenUnimportant = now; app.lastCpuTime = 0; } // Inform UsageStats of important process state change // Must be called before updating setProcState maybeUpdateUsageStatsLocked(app, nowElapsed); app.setProcState = app.curProcState; if (app.setProcState >= ActivityManager.PROCESS_STATE_HOME) { app.notCachedSinceIdle = false; } if (!doingAll) { setProcessTrackerStateLocked(app, mProcessStats.getMemFactorLocked(), now); } else { app.procStateChanged = true; } } else if (app.reportedInteraction && (nowElapsed-app.interactionEventTime) > mConstants.USAGE_STATS_INTERACTION_INTERVAL) { // For apps that sit around for a long time in the interactive state, we need // to report this at least once a day so they don't go idle. maybeUpdateUsageStatsLocked(app, nowElapsed); } if (changes != 0) { if (DEBUG_PROCESS_OBSERVERS) Slog.i(TAG_PROCESS_OBSERVERS, "Changes in " + app + ": " + changes); int i = mPendingProcessChanges.size()-1; ProcessChangeItem item = null; while (i >= 0) { item = mPendingProcessChanges.get(i); if (item.pid == app.pid) { if (DEBUG_PROCESS_OBSERVERS) Slog.i(TAG_PROCESS_OBSERVERS, "Re-using existing item: " + item); break; } i--; } if (i < 0) { // No existing item in pending changes; need a new one. final int NA = mAvailProcessChanges.size(); if (NA > 0) { item = mAvailProcessChanges.remove(NA-1); if (DEBUG_PROCESS_OBSERVERS) Slog.i(TAG_PROCESS_OBSERVERS, "Retrieving available item: " + item); } else { item = new ProcessChangeItem(); if (DEBUG_PROCESS_OBSERVERS) Slog.i(TAG_PROCESS_OBSERVERS, "Allocating new item: " + item); } item.changes = 0; item.pid = app.pid; item.uid = app.info.uid; if (mPendingProcessChanges.size() == 0) { if (DEBUG_PROCESS_OBSERVERS) Slog.i(TAG_PROCESS_OBSERVERS, "*** Enqueueing dispatch processes changed!"); mUiHandler.obtainMessage(DISPATCH_PROCESSES_CHANGED_UI_MSG).sendToTarget(); } mPendingProcessChanges.add(item); } item.changes |= changes; item.foregroundActivities = app.repForegroundActivities; if (DEBUG_PROCESS_OBSERVERS) Slog.i(TAG_PROCESS_OBSERVERS, "Item " + Integer.toHexString(System.identityHashCode(item)) + " " + app.toShortString() + ": changes=" + item.changes + " foreground=" + item.foregroundActivities + " type=" + app.adjType + " source=" + app.adjSource + " target=" + app.adjTarget); } return success; } private boolean isEphemeralLocked(int uid) { String packages[] = mContext.getPackageManager().getPackagesForUid(uid); if (packages == null || packages.length != 1) { // Ephemeral apps cannot share uid return false; } return getPackageManagerInternalLocked().isPackageEphemeral(UserHandle.getUserId(uid), packages[0]); } @VisibleForTesting final void enqueueUidChangeLocked(UidRecord uidRec, int uid, int change) { final UidRecord.ChangeItem pendingChange; if (uidRec == null || uidRec.pendingChange == null) { if (mPendingUidChanges.size() == 0) { if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS, "*** Enqueueing dispatch uid changed!"); mUiHandler.obtainMessage(DISPATCH_UIDS_CHANGED_UI_MSG).sendToTarget(); } final int NA = mAvailUidChanges.size(); if (NA > 0) { pendingChange = mAvailUidChanges.remove(NA-1); if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS, "Retrieving available item: " + pendingChange); } else { pendingChange = new UidRecord.ChangeItem(); if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS, "Allocating new item: " + pendingChange); } if (uidRec != null) { uidRec.pendingChange = pendingChange; if ((change & UidRecord.CHANGE_GONE) != 0 && !uidRec.idle) { // If this uid is going away, and we haven't yet reported it is gone, // then do so now. change |= UidRecord.CHANGE_IDLE; } } else if (uid < 0) { throw new IllegalArgumentException("No UidRecord or uid"); } pendingChange.uidRecord = uidRec; pendingChange.uid = uidRec != null ? uidRec.uid : uid; mPendingUidChanges.add(pendingChange); } else { pendingChange = uidRec.pendingChange; // If there is no change in idle or active state, then keep whatever was pending. if ((change & (UidRecord.CHANGE_IDLE | UidRecord.CHANGE_ACTIVE)) == 0) { change |= (pendingChange.change & (UidRecord.CHANGE_IDLE | UidRecord.CHANGE_ACTIVE)); } // If there is no change in cached or uncached state, then keep whatever was pending. if ((change & (UidRecord.CHANGE_CACHED | UidRecord.CHANGE_UNCACHED)) == 0) { change |= (pendingChange.change & (UidRecord.CHANGE_CACHED | UidRecord.CHANGE_UNCACHED)); } // If this is a report of the UID being gone, then we shouldn't keep any previous // report of it being active or cached. (That is, a gone uid is never active, // and never cached.) if ((change & UidRecord.CHANGE_GONE) != 0) { change &= ~(UidRecord.CHANGE_ACTIVE | UidRecord.CHANGE_CACHED); if (!uidRec.idle) { // If this uid is going away, and we haven't yet reported it is gone, // then do so now. change |= UidRecord.CHANGE_IDLE; } } } pendingChange.change = change; pendingChange.processState = uidRec != null ? uidRec.setProcState : ActivityManager.PROCESS_STATE_NONEXISTENT; pendingChange.ephemeral = uidRec != null ? uidRec.ephemeral : isEphemeralLocked(uid); pendingChange.procStateSeq = uidRec != null ? uidRec.curProcStateSeq : 0; if (uidRec != null) { uidRec.lastReportedChange = change; uidRec.updateLastDispatchedProcStateSeq(change); } // Directly update the power manager, since we sit on top of it and it is critical // it be kept in sync (so wake locks will be held as soon as appropriate). if (mLocalPowerManager != null) { // TO DO: dispatch cached/uncached changes here, so we don't need to report // all proc state changes. if ((change & UidRecord.CHANGE_ACTIVE) != 0) { mLocalPowerManager.uidActive(pendingChange.uid); } if ((change & UidRecord.CHANGE_IDLE) != 0) { mLocalPowerManager.uidIdle(pendingChange.uid); } if ((change & UidRecord.CHANGE_GONE) != 0) { mLocalPowerManager.uidGone(pendingChange.uid); } else { mLocalPowerManager.updateUidProcState(pendingChange.uid, pendingChange.processState); } } } private void maybeUpdateProviderUsageStatsLocked(ProcessRecord app, String providerPkgName, String authority) { if (app == null) return; if (app.curProcState <= ActivityManager.PROCESS_STATE_IMPORTANT_FOREGROUND) { UserState userState = mUserController.getStartedUserState(app.userId); if (userState == null) return; final long now = SystemClock.elapsedRealtime(); Long lastReported = userState.mProviderLastReportedFg.get(authority); if (lastReported == null || lastReported < now - 60 * 1000L) { if (mSystemReady) { // Cannot touch the user stats if not system ready mUsageStatsService.reportContentProviderUsage( authority, providerPkgName, app.userId); } userState.mProviderLastReportedFg.put(authority, now); } } } private void maybeUpdateUsageStatsLocked(ProcessRecord app, long nowElapsed) { if (DEBUG_USAGE_STATS) { Slog.d(TAG, "Checking proc [" + Arrays.toString(app.getPackageList()) + "] state changes: old = " + app.setProcState + ", new = " + app.curProcState); } if (mUsageStatsService == null) { return; } boolean isInteraction; // To avoid some abuse patterns, we are going to be careful about what we consider // to be an app interaction. Being the top activity doesn't count while the display // is sleeping, nor do short foreground services. if (app.curProcState <= ActivityManager.PROCESS_STATE_BOUND_FOREGROUND_SERVICE) { isInteraction = true; app.fgInteractionTime = 0; } else if (app.curProcState <= ActivityManager.PROCESS_STATE_TOP_SLEEPING) { if (app.fgInteractionTime == 0) { app.fgInteractionTime = nowElapsed; isInteraction = false; } else { isInteraction = nowElapsed > app.fgInteractionTime + mConstants.SERVICE_USAGE_INTERACTION_TIME; } } else { isInteraction = app.curProcState <= ActivityManager.PROCESS_STATE_IMPORTANT_FOREGROUND; app.fgInteractionTime = 0; } if (isInteraction && (!app.reportedInteraction || (nowElapsed-app.interactionEventTime) > mConstants.USAGE_STATS_INTERACTION_INTERVAL)) { app.interactionEventTime = nowElapsed; String[] packages = app.getPackageList(); if (packages != null) { for (int i = 0; i < packages.length; i++) { mUsageStatsService.reportEvent(packages[i], app.userId, UsageEvents.Event.SYSTEM_INTERACTION); } } } app.reportedInteraction = isInteraction; if (!isInteraction) { app.interactionEventTime = 0; } } private final void setProcessTrackerStateLocked(ProcessRecord proc, int memFactor, long now) { if (proc.thread != null) { if (proc.baseProcessTracker != null) { proc.baseProcessTracker.setState(proc.repProcState, memFactor, now, proc.pkgList); } } } private final boolean updateOomAdjLocked(ProcessRecord app, int cachedAdj, ProcessRecord TOP_APP, boolean doingAll, long now) { if (app.thread == null) { return false; } computeOomAdjLocked(app, cachedAdj, TOP_APP, doingAll, now); return applyOomAdjLocked(app, doingAll, now, SystemClock.elapsedRealtime()); } final void updateProcessForegroundLocked(ProcessRecord proc, boolean isForeground, boolean oomAdj) { if (isForeground != proc.foregroundServices) { proc.foregroundServices = isForeground; ArrayList curProcs = mForegroundPackages.get(proc.info.packageName, proc.info.uid); if (isForeground) { if (curProcs == null) { curProcs = new ArrayList(); mForegroundPackages.put(proc.info.packageName, proc.info.uid, curProcs); } if (!curProcs.contains(proc)) { curProcs.add(proc); mBatteryStatsService.noteEvent(BatteryStats.HistoryItem.EVENT_FOREGROUND_START, proc.info.packageName, proc.info.uid); } } else { if (curProcs != null) { if (curProcs.remove(proc)) { mBatteryStatsService.noteEvent( BatteryStats.HistoryItem.EVENT_FOREGROUND_FINISH, proc.info.packageName, proc.info.uid); if (curProcs.size() <= 0) { mForegroundPackages.remove(proc.info.packageName, proc.info.uid); } } } } if (oomAdj) { updateOomAdjLocked(); } } } private final ActivityRecord resumedAppLocked() { ActivityRecord act = mStackSupervisor.getResumedActivityLocked(); String pkg; int uid; if (act != null) { pkg = act.packageName; uid = act.info.applicationInfo.uid; } else { pkg = null; uid = -1; } // Has the UID or resumed package name changed? if (uid != mCurResumedUid || (pkg != mCurResumedPackage && (pkg == null || !pkg.equals(mCurResumedPackage)))) { if (mCurResumedPackage != null) { mBatteryStatsService.noteEvent(BatteryStats.HistoryItem.EVENT_TOP_FINISH, mCurResumedPackage, mCurResumedUid); } mCurResumedPackage = pkg; mCurResumedUid = uid; if (mCurResumedPackage != null) { mBatteryStatsService.noteEvent(BatteryStats.HistoryItem.EVENT_TOP_START, mCurResumedPackage, mCurResumedUid); } } return act; } /** * Update OomAdj for a specific process. * @param app The process to update * @param oomAdjAll If it's ok to call updateOomAdjLocked() for all running apps * if necessary, or skip. * @return whether updateOomAdjLocked(app) was successful. */ final boolean updateOomAdjLocked(ProcessRecord app, boolean oomAdjAll) { final ActivityRecord TOP_ACT = resumedAppLocked(); final ProcessRecord TOP_APP = TOP_ACT != null ? TOP_ACT.app : null; final boolean wasCached = app.cached; mAdjSeq++; // This is the desired cached adjusment we want to tell it to use. // If our app is currently cached, we know it, and that is it. Otherwise, // we don't know it yet, and it needs to now be cached we will then // need to do a complete oom adj. final int cachedAdj = app.curRawAdj >= ProcessList.CACHED_APP_MIN_ADJ ? app.curRawAdj : ProcessList.UNKNOWN_ADJ; boolean success = updateOomAdjLocked(app, cachedAdj, TOP_APP, false, SystemClock.uptimeMillis()); if (oomAdjAll && (wasCached != app.cached || app.curRawAdj == ProcessList.UNKNOWN_ADJ)) { // Changed to/from cached state, so apps after it in the LRU // list may also be changed. updateOomAdjLocked(); } return success; } final void updateOomAdjLocked() { final ActivityRecord TOP_ACT = resumedAppLocked(); final ProcessRecord TOP_APP = TOP_ACT != null ? TOP_ACT.app : null; final long now = SystemClock.uptimeMillis(); final long nowElapsed = SystemClock.elapsedRealtime(); final long oldTime = now - ProcessList.MAX_EMPTY_TIME; final int N = mLruProcesses.size(); if (false) { RuntimeException e = new RuntimeException(); e.fillInStackTrace(); Slog.i(TAG, "updateOomAdj: top=" + TOP_ACT, e); } // Reset state in all uid records. for (int i=mActiveUids.size()-1; i>=0; i--) { final UidRecord uidRec = mActiveUids.valueAt(i); if (false && DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS, "Starting update of " + uidRec); uidRec.reset(); } mStackSupervisor.rankTaskLayersIfNeeded(); mAdjSeq++; mNewNumServiceProcs = 0; mNewNumAServiceProcs = 0; final int emptyProcessLimit = mConstants.CUR_MAX_EMPTY_PROCESSES; final int cachedProcessLimit = mConstants.CUR_MAX_CACHED_PROCESSES - emptyProcessLimit; // Let's determine how many processes we have running vs. // how many slots we have for background processes; we may want // to put multiple processes in a slot of there are enough of // them. int numSlots = (ProcessList.CACHED_APP_MAX_ADJ - ProcessList.CACHED_APP_MIN_ADJ + 1) / 2; int numEmptyProcs = N - mNumNonCachedProcs - mNumCachedHiddenProcs; if (numEmptyProcs > cachedProcessLimit) { // If there are more empty processes than our limit on cached // processes, then use the cached process limit for the factor. // This ensures that the really old empty processes get pushed // down to the bottom, so if we are running low on memory we will // have a better chance at keeping around more cached processes // instead of a gazillion empty processes. numEmptyProcs = cachedProcessLimit; } int emptyFactor = numEmptyProcs/numSlots; if (emptyFactor < 1) emptyFactor = 1; int cachedFactor = (mNumCachedHiddenProcs > 0 ? mNumCachedHiddenProcs : 1)/numSlots; if (cachedFactor < 1) cachedFactor = 1; int stepCached = 0; int stepEmpty = 0; int numCached = 0; int numEmpty = 0; int numTrimming = 0; mNumNonCachedProcs = 0; mNumCachedHiddenProcs = 0; // First update the OOM adjustment for each of the // application processes based on their current state. int curCachedAdj = ProcessList.CACHED_APP_MIN_ADJ; int nextCachedAdj = curCachedAdj+1; int curEmptyAdj = ProcessList.CACHED_APP_MIN_ADJ; int nextEmptyAdj = curEmptyAdj+2; for (int i=N-1; i>=0; i--) { ProcessRecord app = mLruProcesses.get(i); if (!app.killedByAm && app.thread != null) { app.procStateChanged = false; computeOomAdjLocked(app, ProcessList.UNKNOWN_ADJ, TOP_APP, true, now); // If we haven't yet assigned the final cached adj // to the process, do that now. if (app.curAdj >= ProcessList.UNKNOWN_ADJ) { switch (app.curProcState) { case ActivityManager.PROCESS_STATE_CACHED_ACTIVITY: case ActivityManager.PROCESS_STATE_CACHED_ACTIVITY_CLIENT: // This process is a cached process holding activities... // assign it the next cached value for that type, and then // step that cached level. app.curRawAdj = curCachedAdj; app.curAdj = app.modifyRawOomAdj(curCachedAdj); if (DEBUG_LRU && false) Slog.d(TAG_LRU, "Assigning activity LRU #" + i + " adj: " + app.curAdj + " (curCachedAdj=" + curCachedAdj + ")"); if (curCachedAdj != nextCachedAdj) { stepCached++; if (stepCached >= cachedFactor) { stepCached = 0; curCachedAdj = nextCachedAdj; nextCachedAdj += 2; if (nextCachedAdj > ProcessList.CACHED_APP_MAX_ADJ) { nextCachedAdj = ProcessList.CACHED_APP_MAX_ADJ; } } } break; default: // For everything else, assign next empty cached process // level and bump that up. Note that this means that // long-running services that have dropped down to the // cached level will be treated as empty (since their process // state is still as a service), which is what we want. app.curRawAdj = curEmptyAdj; app.curAdj = app.modifyRawOomAdj(curEmptyAdj); if (DEBUG_LRU && false) Slog.d(TAG_LRU, "Assigning empty LRU #" + i + " adj: " + app.curAdj + " (curEmptyAdj=" + curEmptyAdj + ")"); if (curEmptyAdj != nextEmptyAdj) { stepEmpty++; if (stepEmpty >= emptyFactor) { stepEmpty = 0; curEmptyAdj = nextEmptyAdj; nextEmptyAdj += 2; if (nextEmptyAdj > ProcessList.CACHED_APP_MAX_ADJ) { nextEmptyAdj = ProcessList.CACHED_APP_MAX_ADJ; } } } break; } } applyOomAdjLocked(app, true, now, nowElapsed); // Count the number of process types. switch (app.curProcState) { case ActivityManager.PROCESS_STATE_CACHED_ACTIVITY: case ActivityManager.PROCESS_STATE_CACHED_ACTIVITY_CLIENT: mNumCachedHiddenProcs++; numCached++; if (numCached > cachedProcessLimit) { app.kill("cached #" + numCached, true); } break; case ActivityManager.PROCESS_STATE_CACHED_EMPTY: if (numEmpty > mConstants.CUR_TRIM_EMPTY_PROCESSES && app.lastActivityTime < oldTime) { app.kill("empty for " + ((oldTime + ProcessList.MAX_EMPTY_TIME - app.lastActivityTime) / 1000) + "s", true); } else { numEmpty++; if (numEmpty > emptyProcessLimit) { app.kill("empty #" + numEmpty, true); } } break; default: mNumNonCachedProcs++; break; } if (app.isolated && app.services.size() <= 0 && app.isolatedEntryPoint == null) { // If this is an isolated process, there are no services // running in it, and it's not a special process with a // custom entry point, then the process is no longer // needed. We agressively kill these because we can by // definition not re-use the same process again, and it is // good to avoid having whatever code was running in them // left sitting around after no longer needed. app.kill("isolated not needed", true); } else { // Keeping this process, update its uid. final UidRecord uidRec = app.uidRecord; if (uidRec != null) { uidRec.ephemeral = app.info.isInstantApp(); if (uidRec.curProcState > app.curProcState) { uidRec.curProcState = app.curProcState; } if (app.foregroundServices) { uidRec.foregroundServices = true; } } } if (app.curProcState >= ActivityManager.PROCESS_STATE_HOME && !app.killedByAm) { numTrimming++; } } } incrementProcStateSeqAndNotifyAppsLocked(); mNumServiceProcs = mNewNumServiceProcs; // Now determine the memory trimming level of background processes. // Unfortunately we need to start at the back of the list to do this // properly. We only do this if the number of background apps we // are managing to keep around is less than half the maximum we desire; // if we are keeping a good number around, we'll let them use whatever // memory they want. final int numCachedAndEmpty = numCached + numEmpty; int memFactor; if (numCached <= mConstants.CUR_TRIM_CACHED_PROCESSES && numEmpty <= mConstants.CUR_TRIM_EMPTY_PROCESSES) { if (numCachedAndEmpty <= ProcessList.TRIM_CRITICAL_THRESHOLD) { memFactor = ProcessStats.ADJ_MEM_FACTOR_CRITICAL; } else if (numCachedAndEmpty <= ProcessList.TRIM_LOW_THRESHOLD) { memFactor = ProcessStats.ADJ_MEM_FACTOR_LOW; } else { memFactor = ProcessStats.ADJ_MEM_FACTOR_MODERATE; } } else { memFactor = ProcessStats.ADJ_MEM_FACTOR_NORMAL; } // We always allow the memory level to go up (better). We only allow it to go // down if we are in a state where that is allowed, *and* the total number of processes // has gone down since last time. if (DEBUG_OOM_ADJ) Slog.d(TAG_OOM_ADJ, "oom: memFactor=" + memFactor + " last=" + mLastMemoryLevel + " allowLow=" + mAllowLowerMemLevel + " numProcs=" + mLruProcesses.size() + " last=" + mLastNumProcesses); if (memFactor > mLastMemoryLevel) { if (!mAllowLowerMemLevel || mLruProcesses.size() >= mLastNumProcesses) { memFactor = mLastMemoryLevel; if (DEBUG_OOM_ADJ) Slog.d(TAG_OOM_ADJ, "Keeping last mem factor!"); } } if (memFactor != mLastMemoryLevel) { EventLogTags.writeAmMemFactor(memFactor, mLastMemoryLevel); } mLastMemoryLevel = memFactor; mLastNumProcesses = mLruProcesses.size(); boolean allChanged = mProcessStats.setMemFactorLocked(memFactor, !isSleepingLocked(), now); final int trackerMemFactor = mProcessStats.getMemFactorLocked(); if (memFactor != ProcessStats.ADJ_MEM_FACTOR_NORMAL) { if (mLowRamStartTime == 0) { mLowRamStartTime = now; } int step = 0; int fgTrimLevel; switch (memFactor) { case ProcessStats.ADJ_MEM_FACTOR_CRITICAL: fgTrimLevel = ComponentCallbacks2.TRIM_MEMORY_RUNNING_CRITICAL; break; case ProcessStats.ADJ_MEM_FACTOR_LOW: fgTrimLevel = ComponentCallbacks2.TRIM_MEMORY_RUNNING_LOW; break; default: fgTrimLevel = ComponentCallbacks2.TRIM_MEMORY_RUNNING_MODERATE; break; } int factor = numTrimming/3; int minFactor = 2; if (mHomeProcess != null) minFactor++; if (mPreviousProcess != null) minFactor++; if (factor < minFactor) factor = minFactor; int curLevel = ComponentCallbacks2.TRIM_MEMORY_COMPLETE; for (int i=N-1; i>=0; i--) { ProcessRecord app = mLruProcesses.get(i); if (allChanged || app.procStateChanged) { setProcessTrackerStateLocked(app, trackerMemFactor, now); app.procStateChanged = false; } if (app.curProcState >= ActivityManager.PROCESS_STATE_HOME && !app.killedByAm) { if (app.trimMemoryLevel < curLevel && app.thread != null) { try { if (DEBUG_SWITCH || DEBUG_OOM_ADJ) Slog.v(TAG_OOM_ADJ, "Trimming memory of " + app.processName + " to " + curLevel); app.thread.scheduleTrimMemory(curLevel); } catch (RemoteException e) { } if (false) { // For now we won't do this; our memory trimming seems // to be good enough at this point that destroying // activities causes more harm than good. if (curLevel >= ComponentCallbacks2.TRIM_MEMORY_COMPLETE && app != mHomeProcess && app != mPreviousProcess) { // Need to do this on its own message because the stack may not // be in a consistent state at this point. // For these apps we will also finish their activities // to help them free memory. mStackSupervisor.scheduleDestroyAllActivities(app, "trim"); } } } app.trimMemoryLevel = curLevel; step++; if (step >= factor) { step = 0; switch (curLevel) { case ComponentCallbacks2.TRIM_MEMORY_COMPLETE: curLevel = ComponentCallbacks2.TRIM_MEMORY_MODERATE; break; case ComponentCallbacks2.TRIM_MEMORY_MODERATE: curLevel = ComponentCallbacks2.TRIM_MEMORY_BACKGROUND; break; } } } else if (app.curProcState == ActivityManager.PROCESS_STATE_HEAVY_WEIGHT) { if (app.trimMemoryLevel < ComponentCallbacks2.TRIM_MEMORY_BACKGROUND && app.thread != null) { try { if (DEBUG_SWITCH || DEBUG_OOM_ADJ) Slog.v(TAG_OOM_ADJ, "Trimming memory of heavy-weight " + app.processName + " to " + ComponentCallbacks2.TRIM_MEMORY_BACKGROUND); app.thread.scheduleTrimMemory( ComponentCallbacks2.TRIM_MEMORY_BACKGROUND); } catch (RemoteException e) { } } app.trimMemoryLevel = ComponentCallbacks2.TRIM_MEMORY_BACKGROUND; } else { if ((app.curProcState >= ActivityManager.PROCESS_STATE_IMPORTANT_BACKGROUND || app.systemNoUi) && app.pendingUiClean) { // If this application is now in the background and it // had done UI, then give it the special trim level to // have it free UI resources. final int level = ComponentCallbacks2.TRIM_MEMORY_UI_HIDDEN; if (app.trimMemoryLevel < level && app.thread != null) { try { if (DEBUG_SWITCH || DEBUG_OOM_ADJ) Slog.v(TAG_OOM_ADJ, "Trimming memory of bg-ui " + app.processName + " to " + level); app.thread.scheduleTrimMemory(level); } catch (RemoteException e) { } } app.pendingUiClean = false; } if (app.trimMemoryLevel < fgTrimLevel && app.thread != null) { try { if (DEBUG_SWITCH || DEBUG_OOM_ADJ) Slog.v(TAG_OOM_ADJ, "Trimming memory of fg " + app.processName + " to " + fgTrimLevel); app.thread.scheduleTrimMemory(fgTrimLevel); } catch (RemoteException e) { } } app.trimMemoryLevel = fgTrimLevel; } } } else { if (mLowRamStartTime != 0) { mLowRamTimeSinceLastIdle += now - mLowRamStartTime; mLowRamStartTime = 0; } for (int i=N-1; i>=0; i--) { ProcessRecord app = mLruProcesses.get(i); if (allChanged || app.procStateChanged) { setProcessTrackerStateLocked(app, trackerMemFactor, now); app.procStateChanged = false; } if ((app.curProcState >= ActivityManager.PROCESS_STATE_IMPORTANT_BACKGROUND || app.systemNoUi) && app.pendingUiClean) { if (app.trimMemoryLevel < ComponentCallbacks2.TRIM_MEMORY_UI_HIDDEN && app.thread != null) { try { if (DEBUG_SWITCH || DEBUG_OOM_ADJ) Slog.v(TAG_OOM_ADJ, "Trimming memory of ui hidden " + app.processName + " to " + ComponentCallbacks2.TRIM_MEMORY_UI_HIDDEN); app.thread.scheduleTrimMemory( ComponentCallbacks2.TRIM_MEMORY_UI_HIDDEN); } catch (RemoteException e) { } } app.pendingUiClean = false; } app.trimMemoryLevel = 0; } } if (mAlwaysFinishActivities) { // Need to do this on its own message because the stack may not // be in a consistent state at this point. mStackSupervisor.scheduleDestroyAllActivities(null, "always-finish"); } if (allChanged) { requestPssAllProcsLocked(now, false, mProcessStats.isMemFactorLowered()); } ArrayList becameIdle = null; // Update from any uid changes. if (mLocalPowerManager != null) { mLocalPowerManager.startUidChanges(); } for (int i=mActiveUids.size()-1; i>=0; i--) { final UidRecord uidRec = mActiveUids.valueAt(i); int uidChange = UidRecord.CHANGE_PROCSTATE; if (uidRec.curProcState != ActivityManager.PROCESS_STATE_NONEXISTENT && (uidRec.setProcState != uidRec.curProcState || uidRec.setWhitelist != uidRec.curWhitelist)) { if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS, "Changes in " + uidRec + ": proc state from " + uidRec.setProcState + " to " + uidRec.curProcState + ", whitelist from " + uidRec.setWhitelist + " to " + uidRec.curWhitelist); if (ActivityManager.isProcStateBackground(uidRec.curProcState) && !uidRec.curWhitelist) { // UID is now in the background (and not on the temp whitelist). Was it // previously in the foreground (or on the temp whitelist)? if (!ActivityManager.isProcStateBackground(uidRec.setProcState) || uidRec.setWhitelist) { uidRec.lastBackgroundTime = nowElapsed; if (!mHandler.hasMessages(IDLE_UIDS_MSG)) { // Note: the background settle time is in elapsed realtime, while // the handler time base is uptime. All this means is that we may // stop background uids later than we had intended, but that only // happens because the device was sleeping so we are okay anyway. mHandler.sendEmptyMessageDelayed(IDLE_UIDS_MSG, mConstants.BACKGROUND_SETTLE_TIME); } } if (uidRec.idle && !uidRec.setIdle) { uidChange = UidRecord.CHANGE_IDLE; if (becameIdle == null) { becameIdle = new ArrayList<>(); } becameIdle.add(uidRec); } } else { if (uidRec.idle) { uidChange = UidRecord.CHANGE_ACTIVE; EventLogTags.writeAmUidActive(uidRec.uid); uidRec.idle = false; } uidRec.lastBackgroundTime = 0; } final boolean wasCached = uidRec.setProcState > ActivityManager.PROCESS_STATE_RECEIVER; final boolean isCached = uidRec.curProcState > ActivityManager.PROCESS_STATE_RECEIVER; if (wasCached != isCached || uidRec.setProcState == ActivityManager.PROCESS_STATE_NONEXISTENT) { uidChange |= isCached ? UidRecord.CHANGE_CACHED : UidRecord.CHANGE_UNCACHED; } uidRec.setProcState = uidRec.curProcState; uidRec.setWhitelist = uidRec.curWhitelist; uidRec.setIdle = uidRec.idle; enqueueUidChangeLocked(uidRec, -1, uidChange); noteUidProcessState(uidRec.uid, uidRec.curProcState); if (uidRec.foregroundServices) { mServices.foregroundServiceProcStateChangedLocked(uidRec); } } } if (mLocalPowerManager != null) { mLocalPowerManager.finishUidChanges(); } if (becameIdle != null) { // If we have any new uids that became idle this time, we need to make sure // they aren't left with running services. for (int i = becameIdle.size() - 1; i >= 0; i--) { mServices.stopInBackgroundLocked(becameIdle.get(i).uid); } } if (mProcessStats.shouldWriteNowLocked(now)) { mHandler.post(new Runnable() { @Override public void run() { synchronized (ActivityManagerService.this) { mProcessStats.writeStateAsyncLocked(); } } }); } if (DEBUG_OOM_ADJ) { final long duration = SystemClock.uptimeMillis() - now; if (false) { Slog.d(TAG_OOM_ADJ, "Did OOM ADJ in " + duration + "ms", new RuntimeException("here").fillInStackTrace()); } else { Slog.d(TAG_OOM_ADJ, "Did OOM ADJ in " + duration + "ms"); } } } @Override public void makePackageIdle(String packageName, int userId) { if (checkCallingPermission(android.Manifest.permission.FORCE_STOP_PACKAGES) != PackageManager.PERMISSION_GRANTED) { String msg = "Permission Denial: makePackageIdle() from pid=" + Binder.getCallingPid() + ", uid=" + Binder.getCallingUid() + " requires " + android.Manifest.permission.FORCE_STOP_PACKAGES; Slog.w(TAG, msg); throw new SecurityException(msg); } final int callingPid = Binder.getCallingPid(); userId = mUserController.handleIncomingUser(callingPid, Binder.getCallingUid(), userId, true, ALLOW_FULL_ONLY, "makePackageIdle", null); long callingId = Binder.clearCallingIdentity(); synchronized(this) { try { IPackageManager pm = AppGlobals.getPackageManager(); int pkgUid = -1; try { pkgUid = pm.getPackageUid(packageName, MATCH_UNINSTALLED_PACKAGES | MATCH_DEBUG_TRIAGED_MISSING, UserHandle.USER_SYSTEM); } catch (RemoteException e) { } if (pkgUid == -1) { throw new IllegalArgumentException("Unknown package name " + packageName); } if (mLocalPowerManager != null) { mLocalPowerManager.startUidChanges(); } final int appId = UserHandle.getAppId(pkgUid); final int N = mActiveUids.size(); for (int i=N-1; i>=0; i--) { final UidRecord uidRec = mActiveUids.valueAt(i); final long bgTime = uidRec.lastBackgroundTime; if (bgTime > 0 && !uidRec.idle) { if (UserHandle.getAppId(uidRec.uid) == appId) { if (userId == UserHandle.USER_ALL || userId == UserHandle.getUserId(uidRec.uid)) { EventLogTags.writeAmUidIdle(uidRec.uid); uidRec.idle = true; uidRec.setIdle = true; Slog.w(TAG, "Idling uid " + UserHandle.formatUid(uidRec.uid) + " from package " + packageName + " user " + userId); doStopUidLocked(uidRec.uid, uidRec); } } } } } finally { if (mLocalPowerManager != null) { mLocalPowerManager.finishUidChanges(); } Binder.restoreCallingIdentity(callingId); } } } final void idleUids() { synchronized (this) { final int N = mActiveUids.size(); if (N <= 0) { return; } final long nowElapsed = SystemClock.elapsedRealtime(); final long maxBgTime = nowElapsed - mConstants.BACKGROUND_SETTLE_TIME; long nextTime = 0; if (mLocalPowerManager != null) { mLocalPowerManager.startUidChanges(); } for (int i=N-1; i>=0; i--) { final UidRecord uidRec = mActiveUids.valueAt(i); final long bgTime = uidRec.lastBackgroundTime; if (bgTime > 0 && !uidRec.idle) { if (bgTime <= maxBgTime) { EventLogTags.writeAmUidIdle(uidRec.uid); uidRec.idle = true; uidRec.setIdle = true; doStopUidLocked(uidRec.uid, uidRec); } else { if (nextTime == 0 || nextTime > bgTime) { nextTime = bgTime; } } } } if (mLocalPowerManager != null) { mLocalPowerManager.finishUidChanges(); } if (nextTime > 0) { mHandler.removeMessages(IDLE_UIDS_MSG); mHandler.sendEmptyMessageDelayed(IDLE_UIDS_MSG, nextTime + mConstants.BACKGROUND_SETTLE_TIME - nowElapsed); } } } /** * Checks if any uid is coming from background to foreground or vice versa and if so, increments * the {@link UidRecord#curProcStateSeq} corresponding to that uid using global seq counter * {@link #mProcStateSeqCounter} and notifies the app if it needs to block. */ @VisibleForTesting @GuardedBy("this") void incrementProcStateSeqAndNotifyAppsLocked() { if (mWaitForNetworkTimeoutMs <= 0) { return; } // Used for identifying which uids need to block for network. ArrayList blockingUids = null; for (int i = mActiveUids.size() - 1; i >= 0; --i) { final UidRecord uidRec = mActiveUids.valueAt(i); // If the network is not restricted for uid, then nothing to do here. if (!mInjector.isNetworkRestrictedForUid(uidRec.uid)) { continue; } if (!UserHandle.isApp(uidRec.uid) || !uidRec.hasInternetPermission) { continue; } // If process state is not changed, then there's nothing to do. if (uidRec.setProcState == uidRec.curProcState) { continue; } final int blockState = getBlockStateForUid(uidRec); // No need to inform the app when the blockState is NETWORK_STATE_NO_CHANGE as // there's nothing the app needs to do in this scenario. if (blockState == NETWORK_STATE_NO_CHANGE) { continue; } synchronized (uidRec.networkStateLock) { uidRec.curProcStateSeq = ++mProcStateSeqCounter; if (blockState == NETWORK_STATE_BLOCK) { if (blockingUids == null) { blockingUids = new ArrayList<>(); } blockingUids.add(uidRec.uid); } else { if (DEBUG_NETWORK) { Slog.d(TAG_NETWORK, "uid going to background, notifying all blocking" + " threads for uid: " + uidRec); } if (uidRec.waitingForNetwork) { uidRec.networkStateLock.notifyAll(); } } } } // There are no uids that need to block, so nothing more to do. if (blockingUids == null) { return; } for (int i = mLruProcesses.size() - 1; i >= 0; --i) { final ProcessRecord app = mLruProcesses.get(i); if (!blockingUids.contains(app.uid)) { continue; } if (!app.killedByAm && app.thread != null) { final UidRecord uidRec = mActiveUids.get(app.uid); try { if (DEBUG_NETWORK) { Slog.d(TAG_NETWORK, "Informing app thread that it needs to block: " + uidRec); } app.thread.setNetworkBlockSeq(uidRec.curProcStateSeq); } catch (RemoteException ignored) { } } } } /** * Checks if the uid is coming from background to foreground or vice versa and returns * appropriate block state based on this. * * @return blockState based on whether the uid is coming from background to foreground or * vice versa. If bg->fg or fg->bg, then {@link #NETWORK_STATE_BLOCK} or * {@link #NETWORK_STATE_UNBLOCK} respectively, otherwise * {@link #NETWORK_STATE_NO_CHANGE}. */ @VisibleForTesting int getBlockStateForUid(UidRecord uidRec) { // Denotes whether uid's process state is currently allowed network access. final boolean isAllowed = isProcStateAllowedWhileIdleOrPowerSaveMode(uidRec.curProcState) || isProcStateAllowedWhileOnRestrictBackground(uidRec.curProcState); // Denotes whether uid's process state was previously allowed network access. final boolean wasAllowed = isProcStateAllowedWhileIdleOrPowerSaveMode(uidRec.setProcState) || isProcStateAllowedWhileOnRestrictBackground(uidRec.setProcState); // When the uid is coming to foreground, AMS should inform the app thread that it should // block for the network rules to get updated before launching an activity. if (!wasAllowed && isAllowed) { return NETWORK_STATE_BLOCK; } // When the uid is going to background, AMS should inform the app thread that if an // activity launch is blocked for the network rules to get updated, it should be unblocked. if (wasAllowed && !isAllowed) { return NETWORK_STATE_UNBLOCK; } return NETWORK_STATE_NO_CHANGE; } final void runInBackgroundDisabled(int uid) { synchronized (this) { UidRecord uidRec = mActiveUids.get(uid); if (uidRec != null) { // This uid is actually running... should it be considered background now? if (uidRec.idle) { doStopUidLocked(uidRec.uid, uidRec); } } else { // This uid isn't actually running... still send a report about it being "stopped". doStopUidLocked(uid, null); } } } final void doStopUidLocked(int uid, final UidRecord uidRec) { mServices.stopInBackgroundLocked(uid); enqueueUidChangeLocked(uidRec, uid, UidRecord.CHANGE_IDLE); } /** * Whitelists {@code targetUid} to temporarily bypass Power Save mode. */ void tempWhitelistForPendingIntentLocked(int callerPid, int callerUid, int targetUid, long duration, String tag) { if (DEBUG_WHITELISTS) { Slog.d(TAG, "tempWhitelistForPendingIntentLocked(" + callerPid + ", " + callerUid + ", " + targetUid + ", " + duration + ")"); } synchronized (mPidsSelfLocked) { final ProcessRecord pr = mPidsSelfLocked.get(callerPid); if (pr == null) { Slog.w(TAG, "tempWhitelistForPendingIntentLocked() no ProcessRecord for pid " + callerPid); return; } if (!pr.whitelistManager) { if (checkPermission(CHANGE_DEVICE_IDLE_TEMP_WHITELIST, callerPid, callerUid) != PackageManager.PERMISSION_GRANTED) { if (DEBUG_WHITELISTS) { Slog.d(TAG, "tempWhitelistForPendingIntentLocked() for target " + targetUid + ": pid " + callerPid + " is not allowed"); } return; } } } tempWhitelistUidLocked(targetUid, duration, tag); } /** * Whitelists {@code targetUid} to temporarily bypass Power Save mode. */ void tempWhitelistUidLocked(int targetUid, long duration, String tag) { mPendingTempWhitelist.put(targetUid, new PendingTempWhitelist(targetUid, duration, tag)); setUidTempWhitelistStateLocked(targetUid, true); mUiHandler.obtainMessage(PUSH_TEMP_WHITELIST_UI_MSG).sendToTarget(); } void pushTempWhitelist() { final int N; final PendingTempWhitelist[] list; // First copy out the pending changes... we need to leave them in the map for now, // in case someone needs to check what is coming up while we don't have the lock held. synchronized(this) { N = mPendingTempWhitelist.size(); list = new PendingTempWhitelist[N]; for (int i = 0; i < N; i++) { list[i] = mPendingTempWhitelist.valueAt(i); } } // Now safely dispatch changes to device idle controller. for (int i = 0; i < N; i++) { PendingTempWhitelist ptw = list[i]; mLocalDeviceIdleController.addPowerSaveTempWhitelistAppDirect(ptw.targetUid, ptw.duration, true, ptw.tag); } // And now we can safely remove them from the map. synchronized(this) { for (int i = 0; i < N; i++) { PendingTempWhitelist ptw = list[i]; int index = mPendingTempWhitelist.indexOfKey(ptw.targetUid); if (index >= 0 && mPendingTempWhitelist.valueAt(index) == ptw) { mPendingTempWhitelist.removeAt(index); } } } } final void setAppIdTempWhitelistStateLocked(int appId, boolean onWhitelist) { boolean changed = false; for (int i=mActiveUids.size()-1; i>=0; i--) { final UidRecord uidRec = mActiveUids.valueAt(i); if (UserHandle.getAppId(uidRec.uid) == appId && uidRec.curWhitelist != onWhitelist) { uidRec.curWhitelist = onWhitelist; changed = true; } } if (changed) { updateOomAdjLocked(); } } final void setUidTempWhitelistStateLocked(int uid, boolean onWhitelist) { boolean changed = false; final UidRecord uidRec = mActiveUids.get(uid); if (uidRec != null && uidRec.curWhitelist != onWhitelist) { uidRec.curWhitelist = onWhitelist; updateOomAdjLocked(); } } final void trimApplications() { synchronized (this) { int i; // First remove any unused application processes whose package // has been removed. for (i=mRemovedProcesses.size()-1; i>=0; i--) { final ProcessRecord app = mRemovedProcesses.get(i); if (app.activities.size() == 0 && app.curReceivers.isEmpty() && app.services.size() == 0) { Slog.i( TAG, "Exiting empty application process " + app.toShortString() + " (" + (app.thread != null ? app.thread.asBinder() : null) + ")\n"); if (app.pid > 0 && app.pid != MY_PID) { app.kill("empty", false); } else { try { app.thread.scheduleExit(); } catch (Exception e) { // Ignore exceptions. } } cleanUpApplicationRecordLocked(app, false, true, -1, false /*replacingPid*/); mRemovedProcesses.remove(i); if (app.persistent) { addAppLocked(app.info, null, false, null /* ABI override */); } } } // Now update the oom adj for all processes. updateOomAdjLocked(); } } /** This method sends the specified signal to each of the persistent apps */ public void signalPersistentProcesses(int sig) throws RemoteException { if (sig != SIGNAL_USR1) { throw new SecurityException("Only SIGNAL_USR1 is allowed"); } synchronized (this) { if (checkCallingPermission(android.Manifest.permission.SIGNAL_PERSISTENT_PROCESSES) != PackageManager.PERMISSION_GRANTED) { throw new SecurityException("Requires permission " + android.Manifest.permission.SIGNAL_PERSISTENT_PROCESSES); } for (int i = mLruProcesses.size() - 1 ; i >= 0 ; i--) { ProcessRecord r = mLruProcesses.get(i); if (r.thread != null && r.persistent) { sendSignal(r.pid, sig); } } } } private void stopProfilerLocked(ProcessRecord proc, int profileType) { if (proc == null || proc == mProfileProc) { proc = mProfileProc; profileType = mProfileType; clearProfilerLocked(); } if (proc == null) { return; } try { proc.thread.profilerControl(false, null, profileType); } catch (RemoteException e) { throw new IllegalStateException("Process disappeared"); } } private void clearProfilerLocked() { if (mProfilerInfo !=null && mProfilerInfo.profileFd != null) { try { mProfilerInfo.profileFd.close(); } catch (IOException e) { } } mProfileApp = null; mProfileProc = null; mProfilerInfo = null; } public boolean profileControl(String process, int userId, boolean start, ProfilerInfo profilerInfo, int profileType) throws RemoteException { try { synchronized (this) { // note: hijacking SET_ACTIVITY_WATCHER, but should be changed to // its own permission. if (checkCallingPermission(android.Manifest.permission.SET_ACTIVITY_WATCHER) != PackageManager.PERMISSION_GRANTED) { throw new SecurityException("Requires permission " + android.Manifest.permission.SET_ACTIVITY_WATCHER); } if (start && (profilerInfo == null || profilerInfo.profileFd == null)) { throw new IllegalArgumentException("null profile info or fd"); } ProcessRecord proc = null; if (process != null) { proc = findProcessLocked(process, userId, "profileControl"); } if (start && (proc == null || proc.thread == null)) { throw new IllegalArgumentException("Unknown process: " + process); } if (start) { stopProfilerLocked(null, 0); setProfileApp(proc.info, proc.processName, profilerInfo); mProfileProc = proc; mProfileType = profileType; ParcelFileDescriptor fd = profilerInfo.profileFd; try { fd = fd.dup(); } catch (IOException e) { fd = null; } profilerInfo.profileFd = fd; proc.thread.profilerControl(start, profilerInfo, profileType); fd = null; try { mProfilerInfo.profileFd.close(); } catch (IOException e) { } mProfilerInfo.profileFd = null; } else { stopProfilerLocked(proc, profileType); if (profilerInfo != null && profilerInfo.profileFd != null) { try { profilerInfo.profileFd.close(); } catch (IOException e) { } } } return true; } } catch (RemoteException e) { throw new IllegalStateException("Process disappeared"); } finally { if (profilerInfo != null && profilerInfo.profileFd != null) { try { profilerInfo.profileFd.close(); } catch (IOException e) { } } } } private ProcessRecord findProcessLocked(String process, int userId, String callName) { userId = mUserController.handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(), userId, true, ALLOW_FULL_ONLY, callName, null); ProcessRecord proc = null; try { int pid = Integer.parseInt(process); synchronized (mPidsSelfLocked) { proc = mPidsSelfLocked.get(pid); } } catch (NumberFormatException e) { } if (proc == null) { ArrayMap> all = mProcessNames.getMap(); SparseArray procs = all.get(process); if (procs != null && procs.size() > 0) { proc = procs.valueAt(0); if (userId != UserHandle.USER_ALL && proc.userId != userId) { for (int i=1; i 0) { mMemWatchProcesses.put(processName, uid, new Pair(maxMemSize, reportPackage)); } else { if (uid != 0) { mMemWatchProcesses.remove(processName, uid); } else { mMemWatchProcesses.getMap().remove(processName); } } } } @Override public void dumpHeapFinished(String path) { synchronized (this) { if (Binder.getCallingPid() != mMemWatchDumpPid) { Slog.w(TAG, "dumpHeapFinished: Calling pid " + Binder.getCallingPid() + " does not match last pid " + mMemWatchDumpPid); return; } if (mMemWatchDumpFile == null || !mMemWatchDumpFile.equals(path)) { Slog.w(TAG, "dumpHeapFinished: Calling path " + path + " does not match last path " + mMemWatchDumpFile); return; } if (DEBUG_PSS) Slog.d(TAG_PSS, "Dump heap finished for " + path); mHandler.sendEmptyMessage(POST_DUMP_HEAP_NOTIFICATION_MSG); // Forced gc to clean up the remnant hprof fd. Runtime.getRuntime().gc(); } } /** In this method we try to acquire our lock to make sure that we have not deadlocked */ public void monitor() { synchronized (this) { } } void onCoreSettingsChange(Bundle settings) { for (int i = mLruProcesses.size() - 1; i >= 0; i--) { ProcessRecord processRecord = mLruProcesses.get(i); try { if (processRecord.thread != null) { processRecord.thread.setCoreSettings(settings); } } catch (RemoteException re) { /* ignore */ } } } // Multi-user methods /** * Start user, if its not already running, but don't bring it to foreground. */ @Override public boolean startUserInBackground(final int userId) { return mUserController.startUser(userId, /* foreground */ false); } @Override public boolean unlockUser(int userId, byte[] token, byte[] secret, IProgressListener listener) { return mUserController.unlockUser(userId, token, secret, listener); } @Override public boolean switchUser(final int targetUserId) { return mUserController.switchUser(targetUserId); } @Override public int stopUser(final int userId, boolean force, final IStopUserCallback callback) { return mUserController.stopUser(userId, force, callback); } @Override public UserInfo getCurrentUser() { return mUserController.getCurrentUser(); } String getStartedUserState(int userId) { final UserState userState = mUserController.getStartedUserState(userId); return UserState.stateToString(userState.state); } @Override public boolean isUserRunning(int userId, int flags) { if (!mUserController.isSameProfileGroup(userId, UserHandle.getCallingUserId()) && checkCallingPermission(INTERACT_ACROSS_USERS) != PackageManager.PERMISSION_GRANTED) { String msg = "Permission Denial: isUserRunning() from pid=" + Binder.getCallingPid() + ", uid=" + Binder.getCallingUid() + " requires " + INTERACT_ACROSS_USERS; Slog.w(TAG, msg); throw new SecurityException(msg); } return mUserController.isUserRunning(userId, flags); } @Override public int[] getRunningUserIds() { if (checkCallingPermission(INTERACT_ACROSS_USERS) != PackageManager.PERMISSION_GRANTED) { String msg = "Permission Denial: isUserRunning() from pid=" + Binder.getCallingPid() + ", uid=" + Binder.getCallingUid() + " requires " + INTERACT_ACROSS_USERS; Slog.w(TAG, msg); throw new SecurityException(msg); } return mUserController.getStartedUserArray(); } @Override public void registerUserSwitchObserver(IUserSwitchObserver observer, String name) { mUserController.registerUserSwitchObserver(observer, name); } @Override public void unregisterUserSwitchObserver(IUserSwitchObserver observer) { mUserController.unregisterUserSwitchObserver(observer); } ApplicationInfo getAppInfoForUser(ApplicationInfo info, int userId) { if (info == null) return null; ApplicationInfo newInfo = new ApplicationInfo(info); newInfo.initForUser(userId); return newInfo; } public boolean isUserStopped(int userId) { return mUserController.getStartedUserState(userId) == null; } ActivityInfo getActivityInfoForUser(ActivityInfo aInfo, int userId) { if (aInfo == null || (userId < 1 && aInfo.applicationInfo.uid < UserHandle.PER_USER_RANGE)) { return aInfo; } ActivityInfo info = new ActivityInfo(aInfo); info.applicationInfo = getAppInfoForUser(info.applicationInfo, userId); return info; } private boolean processSanityChecksLocked(ProcessRecord process) { if (process == null || process.thread == null) { return false; } boolean isDebuggable = "1".equals(SystemProperties.get(SYSTEM_DEBUGGABLE, "0")); if (!isDebuggable) { if ((process.info.flags&ApplicationInfo.FLAG_DEBUGGABLE) == 0) { return false; } } return true; } public boolean startBinderTracking() throws RemoteException { synchronized (this) { mBinderTransactionTrackingEnabled = true; // TODO: hijacking SET_ACTIVITY_WATCHER, but should be changed to its own // permission (same as profileControl). if (checkCallingPermission(android.Manifest.permission.SET_ACTIVITY_WATCHER) != PackageManager.PERMISSION_GRANTED) { throw new SecurityException("Requires permission " + android.Manifest.permission.SET_ACTIVITY_WATCHER); } for (int i = 0; i < mLruProcesses.size(); i++) { ProcessRecord process = mLruProcesses.get(i); if (!processSanityChecksLocked(process)) { continue; } try { process.thread.startBinderTracking(); } catch (RemoteException e) { Log.v(TAG, "Process disappared"); } } return true; } } public boolean stopBinderTrackingAndDump(ParcelFileDescriptor fd) throws RemoteException { try { synchronized (this) { mBinderTransactionTrackingEnabled = false; // TODO: hijacking SET_ACTIVITY_WATCHER, but should be changed to its own // permission (same as profileControl). if (checkCallingPermission(android.Manifest.permission.SET_ACTIVITY_WATCHER) != PackageManager.PERMISSION_GRANTED) { throw new SecurityException("Requires permission " + android.Manifest.permission.SET_ACTIVITY_WATCHER); } if (fd == null) { throw new IllegalArgumentException("null fd"); } PrintWriter pw = new FastPrintWriter(new FileOutputStream(fd.getFileDescriptor())); pw.println("Binder transaction traces for all processes.\n"); for (ProcessRecord process : mLruProcesses) { if (!processSanityChecksLocked(process)) { continue; } pw.println("Traces for process: " + process.processName); pw.flush(); try { TransferPipe tp = new TransferPipe(); try { process.thread.stopBinderTrackingAndDump(tp.getWriteFd()); tp.go(fd.getFileDescriptor()); } finally { tp.kill(); } } catch (IOException e) { pw.println("Failure while dumping IPC traces from " + process + ". Exception: " + e); pw.flush(); } catch (RemoteException e) { pw.println("Got a RemoteException while dumping IPC traces from " + process + ". Exception: " + e); pw.flush(); } } fd = null; return true; } } finally { if (fd != null) { try { fd.close(); } catch (IOException e) { } } } } @VisibleForTesting final class LocalService extends ActivityManagerInternal { @Override public void grantUriPermissionFromIntent(int callingUid, String targetPkg, Intent intent, int targetUserId) { synchronized (ActivityManagerService.this) { ActivityManagerService.this.grantUriPermissionFromIntentLocked(callingUid, targetPkg, intent, null, targetUserId); } } @Override public String checkContentProviderAccess(String authority, int userId) { return ActivityManagerService.this.checkContentProviderAccess(authority, userId); } @Override public void onWakefulnessChanged(int wakefulness) { ActivityManagerService.this.onWakefulnessChanged(wakefulness); } @Override public int startIsolatedProcess(String entryPoint, String[] entryPointArgs, String processName, String abiOverride, int uid, Runnable crashHandler) { return ActivityManagerService.this.startIsolatedProcess(entryPoint, entryPointArgs, processName, abiOverride, uid, crashHandler); } @Override public SleepToken acquireSleepToken(String tag, int displayId) { Preconditions.checkNotNull(tag); return ActivityManagerService.this.acquireSleepToken(tag, displayId); } @Override public ComponentName getHomeActivityForUser(int userId) { synchronized (ActivityManagerService.this) { ActivityRecord homeActivity = mStackSupervisor.getHomeActivityForUser(userId); return homeActivity == null ? null : homeActivity.realActivity; } } @Override public void onUserRemoved(int userId) { synchronized (ActivityManagerService.this) { ActivityManagerService.this.onUserStoppedLocked(userId); } mBatteryStatsService.onUserRemoved(userId); } @Override public void onLocalVoiceInteractionStarted(IBinder activity, IVoiceInteractionSession voiceSession, IVoiceInteractor voiceInteractor) { synchronized (ActivityManagerService.this) { ActivityManagerService.this.onLocalVoiceInteractionStartedLocked(activity, voiceSession, voiceInteractor); } } @Override public void notifyAppTransitionStarting(SparseIntArray reasons, long timestamp) { synchronized (ActivityManagerService.this) { mStackSupervisor.mActivityMetricsLogger.notifyTransitionStarting( reasons, timestamp); } } @Override public void notifyAppTransitionFinished() { synchronized (ActivityManagerService.this) { mStackSupervisor.notifyAppTransitionDone(); } } @Override public void notifyAppTransitionCancelled() { synchronized (ActivityManagerService.this) { mStackSupervisor.notifyAppTransitionDone(); } } @Override public List getTopVisibleActivities() { synchronized (ActivityManagerService.this) { return mStackSupervisor.getTopVisibleActivities(); } } @Override public void notifyDockedStackMinimizedChanged(boolean minimized) { synchronized (ActivityManagerService.this) { mStackSupervisor.setDockedStackMinimized(minimized); } } @Override public void killForegroundAppsForUser(int userHandle) { synchronized (ActivityManagerService.this) { final ArrayList procs = new ArrayList<>(); final int NP = mProcessNames.getMap().size(); for (int ip = 0; ip < NP; ip++) { final SparseArray apps = mProcessNames.getMap().valueAt(ip); final int NA = apps.size(); for (int ia = 0; ia < NA; ia++) { final ProcessRecord app = apps.valueAt(ia); if (app.persistent) { // We don't kill persistent processes. continue; } if (app.removed) { procs.add(app); } else if (app.userId == userHandle && app.foregroundActivities) { app.removed = true; procs.add(app); } } } final int N = procs.size(); for (int i = 0; i < N; i++) { removeProcessLocked(procs.get(i), false, true, "kill all fg"); } } } @Override public void setPendingIntentWhitelistDuration(IIntentSender target, IBinder whitelistToken, long duration) { if (!(target instanceof PendingIntentRecord)) { Slog.w(TAG, "markAsSentFromNotification(): not a PendingIntentRecord: " + target); return; } synchronized (ActivityManagerService.this) { ((PendingIntentRecord) target).setWhitelistDurationLocked(whitelistToken, duration); } } @Override public void setDeviceIdleWhitelist(int[] appids) { synchronized (ActivityManagerService.this) { mDeviceIdleWhitelist = appids; } } @Override public void updateDeviceIdleTempWhitelist(int[] appids, int changingAppId, boolean adding) { synchronized (ActivityManagerService.this) { mDeviceIdleTempWhitelist = appids; setAppIdTempWhitelistStateLocked(changingAppId, adding); } } @Override public void updatePersistentConfigurationForUser(@NonNull Configuration values, int userId) { Preconditions.checkNotNull(values, "Configuration must not be null"); Preconditions.checkArgumentNonnegative(userId, "userId " + userId + " not supported"); synchronized (ActivityManagerService.this) { updateConfigurationLocked(values, null, false, true, userId, false /* deferResume */); } } @Override public int startActivitiesAsPackage(String packageName, int userId, Intent[] intents, Bundle bOptions) { Preconditions.checkNotNull(intents, "intents"); final String[] resolvedTypes = new String[intents.length]; for (int i = 0; i < intents.length; i++) { resolvedTypes[i] = intents[i].resolveTypeIfNeeded(mContext.getContentResolver()); } // UID of the package on user userId. // "= 0" is needed because otherwise catch(RemoteException) would make it look like // packageUid may not be initialized. int packageUid = 0; try { packageUid = AppGlobals.getPackageManager().getPackageUid( packageName, PackageManager.MATCH_DEBUG_TRIAGED_MISSING, userId); } catch (RemoteException e) { // Shouldn't happen. } synchronized (ActivityManagerService.this) { return startActivitiesInPackage(packageUid, packageName, intents, resolvedTypes, /*resultTo*/ null, bOptions, userId); } } @Override public int getUidProcessState(int uid) { return getUidState(uid); } @Override public void notifyKeyguardFlagsChanged(@Nullable Runnable callback) { synchronized (ActivityManagerService.this) { // We might change the visibilities here, so prepare an empty app transition which // might be overridden later if we actually change visibilities. final boolean wasTransitionSet = mWindowManager.getPendingAppTransition() != TRANSIT_NONE; if (!wasTransitionSet) { mWindowManager.prepareAppTransition(TRANSIT_NONE, false /* alwaysKeepCurrent */); } mStackSupervisor.ensureActivitiesVisibleLocked(null, 0, !PRESERVE_WINDOWS); // If there was a transition set already we don't want to interfere with it as we // might be starting it too early. if (!wasTransitionSet) { mWindowManager.executeAppTransition(); } } if (callback != null) { callback.run(); } } @Override public boolean isSystemReady() { // no need to synchronize(this) just to read & return the value return mSystemReady; } @Override public void notifyKeyguardTrustedChanged() { synchronized (ActivityManagerService.this) { if (mKeyguardController.isKeyguardShowing(DEFAULT_DISPLAY)) { mStackSupervisor.ensureActivitiesVisibleLocked(null, 0, !PRESERVE_WINDOWS); } } } /** * Sets if the given pid has an overlay UI or not. * * @param pid The pid we are setting overlay UI for. * @param hasOverlayUi True if the process has overlay UI. * @see android.view.WindowManager.LayoutParams#TYPE_APPLICATION_OVERLAY */ @Override public void setHasOverlayUi(int pid, boolean hasOverlayUi) { synchronized (ActivityManagerService.this) { final ProcessRecord pr; synchronized (mPidsSelfLocked) { pr = mPidsSelfLocked.get(pid); if (pr == null) { Slog.w(TAG, "setHasOverlayUi called on unknown pid: " + pid); return; } } if (pr.hasOverlayUi == hasOverlayUi) { return; } pr.hasOverlayUi = hasOverlayUi; //Slog.i(TAG, "Setting hasOverlayUi=" + pr.hasOverlayUi + " for pid=" + pid); updateOomAdjLocked(pr, true); } } /** * Called after the network policy rules are updated by * {@link com.android.server.net.NetworkPolicyManagerService} for a specific {@param uid} * and {@param procStateSeq}. */ @Override public void notifyNetworkPolicyRulesUpdated(int uid, long procStateSeq) { if (DEBUG_NETWORK) { Slog.d(TAG_NETWORK, "Got update from NPMS for uid: " + uid + " seq: " + procStateSeq); } UidRecord record; synchronized (ActivityManagerService.this) { record = mActiveUids.get(uid); if (record == null) { if (DEBUG_NETWORK) { Slog.d(TAG_NETWORK, "No active uidRecord for uid: " + uid + " procStateSeq: " + procStateSeq); } return; } } synchronized (record.networkStateLock) { if (record.lastNetworkUpdatedProcStateSeq >= procStateSeq) { if (DEBUG_NETWORK) { Slog.d(TAG_NETWORK, "procStateSeq: " + procStateSeq + " has already" + " been handled for uid: " + uid); } return; } record.lastNetworkUpdatedProcStateSeq = procStateSeq; if (record.curProcStateSeq > procStateSeq) { if (DEBUG_NETWORK) { Slog.d(TAG_NETWORK, "No need to handle older seq no., Uid: " + uid + ", curProcstateSeq: " + record.curProcStateSeq + ", procStateSeq: " + procStateSeq); } return; } if (record.waitingForNetwork) { if (DEBUG_NETWORK) { Slog.d(TAG_NETWORK, "Notifying all blocking threads for uid: " + uid + ", procStateSeq: " + procStateSeq); } record.networkStateLock.notifyAll(); } } } /** * Called after virtual display Id is updated by * {@link com.android.server.vr.Vr2dDisplay} with a specific * {@param vrVr2dDisplayId}. */ @Override public void setVr2dDisplayId(int vr2dDisplayId) { if (DEBUG_STACK) { Slog.d(TAG, "setVr2dDisplayId called for: " + vr2dDisplayId); } synchronized (ActivityManagerService.this) { mVr2dDisplayId = vr2dDisplayId; } } @Override public void saveANRState(String reason) { synchronized (ActivityManagerService.this) { final StringWriter sw = new StringWriter(); final PrintWriter pw = new FastPrintWriter(sw, false, 1024); pw.println(" ANR time: " + DateFormat.getDateTimeInstance().format(new Date())); if (reason != null) { pw.println(" Reason: " + reason); } pw.println(); mActivityStarter.dump(pw, " ", null); pw.println(); pw.println("-------------------------------------------------------------------------------"); dumpActivitiesLocked(null /* fd */, pw, null /* args */, 0 /* opti */, true /* dumpAll */, false /* dumpClient */, null /* dumpPackage */, "" /* header */); pw.println(); pw.close(); mLastANRState = sw.toString(); } } @Override public void clearSavedANRState() { synchronized (ActivityManagerService.this) { mLastANRState = null; } } @Override public void setFocusedActivity(IBinder token) { synchronized (ActivityManagerService.this) { final ActivityRecord r = ActivityRecord.forTokenLocked(token); if (r == null) { throw new IllegalArgumentException( "setFocusedActivity: No activity record matching token=" + token); } if (mStackSupervisor.moveFocusableActivityStackToFrontLocked( r, "setFocusedActivity")) { mStackSupervisor.resumeFocusedStackTopActivityLocked(); } } } } /** * Called by app main thread to wait for the network policy rules to get updated. * * @param procStateSeq The sequence number indicating the process state change that the main * thread is interested in. */ @Override public void waitForNetworkStateUpdate(long procStateSeq) { final int callingUid = Binder.getCallingUid(); if (DEBUG_NETWORK) { Slog.d(TAG_NETWORK, "Called from " + callingUid + " to wait for seq: " + procStateSeq); } UidRecord record; synchronized (this) { record = mActiveUids.get(callingUid); if (record == null) { return; } } synchronized (record.networkStateLock) { if (record.lastDispatchedProcStateSeq < procStateSeq) { if (DEBUG_NETWORK) { Slog.d(TAG_NETWORK, "Uid state change for seq no. " + procStateSeq + " is not " + "dispatched to NPMS yet, so don't wait. Uid: " + callingUid + " lastProcStateSeqDispatchedToObservers: " + record.lastDispatchedProcStateSeq); } return; } if (record.curProcStateSeq > procStateSeq) { if (DEBUG_NETWORK) { Slog.d(TAG_NETWORK, "Ignore the wait requests for older seq numbers. Uid: " + callingUid + ", curProcStateSeq: " + record.curProcStateSeq + ", procStateSeq: " + procStateSeq); } return; } if (record.lastNetworkUpdatedProcStateSeq >= procStateSeq) { if (DEBUG_NETWORK) { Slog.d(TAG_NETWORK, "Network rules have been already updated for seq no. " + procStateSeq + ", so no need to wait. Uid: " + callingUid + ", lastProcStateSeqWithUpdatedNetworkState: " + record.lastNetworkUpdatedProcStateSeq); } return; } try { if (DEBUG_NETWORK) { Slog.d(TAG_NETWORK, "Starting to wait for the network rules update." + " Uid: " + callingUid + " procStateSeq: " + procStateSeq); } final long startTime = SystemClock.uptimeMillis(); record.waitingForNetwork = true; record.networkStateLock.wait(mWaitForNetworkTimeoutMs); record.waitingForNetwork = false; final long totalTime = SystemClock.uptimeMillis() - startTime; if (totalTime >= mWaitForNetworkTimeoutMs || DEBUG_NETWORK) { Slog.wtf(TAG_NETWORK, "Total time waited for network rules to get updated: " + totalTime + ". Uid: " + callingUid + " procStateSeq: " + procStateSeq + " UidRec: " + record + " validateUidRec: " + mValidateUids.get(callingUid)); } } catch (InterruptedException e) { Thread.currentThread().interrupt(); } } } public void waitForBroadcastIdle(PrintWriter pw) { enforceCallingPermission(permission.DUMP, "waitForBroadcastIdle()"); while (true) { boolean idle = true; synchronized (this) { for (BroadcastQueue queue : mBroadcastQueues) { if (!queue.isIdle()) { final String msg = "Waiting for queue " + queue + " to become idle..."; pw.println(msg); pw.flush(); Slog.v(TAG, msg); idle = false; } } } if (idle) { final String msg = "All broadcast queues are idle!"; pw.println(msg); pw.flush(); Slog.v(TAG, msg); return; } else { SystemClock.sleep(1000); } } } /** * Return the user id of the last resumed activity. */ @Override public @UserIdInt int getLastResumedActivityUserId() { enforceCallingPermission( permission.INTERACT_ACROSS_USERS_FULL, "getLastResumedActivityUserId()"); synchronized (this) { if (mLastResumedActivity == null) { return mUserController.getCurrentUserId(); } return mLastResumedActivity.userId; } } /** * Kill processes for the user with id userId and that depend on the package named packageName */ @Override public void killPackageDependents(String packageName, int userId) { enforceCallingPermission(android.Manifest.permission.KILL_UID, "killPackageDependents()"); if (packageName == null) { throw new NullPointerException( "Cannot kill the dependents of a package without its name."); } long callingId = Binder.clearCallingIdentity(); IPackageManager pm = AppGlobals.getPackageManager(); int pkgUid = -1; try { pkgUid = pm.getPackageUid(packageName, MATCH_DEBUG_TRIAGED_MISSING, userId); } catch (RemoteException e) { } if (userId != UserHandle.USER_ALL && pkgUid == -1) { throw new IllegalArgumentException( "Cannot kill dependents of non-existing package " + packageName); } try { synchronized(this) { killPackageProcessesLocked(packageName, UserHandle.getAppId(pkgUid), userId, ProcessList.FOREGROUND_APP_ADJ, false, true, true, false, "dep: " + packageName); } } finally { Binder.restoreCallingIdentity(callingId); } } @Override public void dismissKeyguard(IBinder token, IKeyguardDismissCallback callback) throws RemoteException { final long callingId = Binder.clearCallingIdentity(); try { mKeyguardController.dismissKeyguard(token, callback); } finally { Binder.restoreCallingIdentity(callingId); } } @Override public int restartUserInBackground(final int userId) { return mUserController.restartUser(userId, /* foreground */ false); } @Override public void scheduleApplicationInfoChanged(List packageNames, int userId) { enforceCallingPermission(android.Manifest.permission.CHANGE_CONFIGURATION, "scheduleApplicationInfoChanged()"); synchronized (this) { final long origId = Binder.clearCallingIdentity(); try { updateApplicationInfoLocked(packageNames, userId); } finally { Binder.restoreCallingIdentity(origId); } } } void updateApplicationInfoLocked(@NonNull List packagesToUpdate, int userId) { final boolean updateFrameworkRes = packagesToUpdate.contains("android"); for (int i = mLruProcesses.size() - 1; i >= 0; i--) { final ProcessRecord app = mLruProcesses.get(i); if (app.thread == null) { continue; } if (userId != UserHandle.USER_ALL && app.userId != userId) { continue; } final int packageCount = app.pkgList.size(); for (int j = 0; j < packageCount; j++) { final String packageName = app.pkgList.keyAt(j); if (updateFrameworkRes || packagesToUpdate.contains(packageName)) { try { final ApplicationInfo ai = AppGlobals.getPackageManager() .getApplicationInfo(packageName, STOCK_PM_FLAGS, app.userId); if (ai != null) { app.thread.scheduleApplicationInfoChanged(ai); } } catch (RemoteException e) { Slog.w(TAG, String.format("Failed to update %s ApplicationInfo for %s", packageName, app)); } } } } } /** * Attach an agent to the specified process (proces name or PID) */ public void attachAgent(String process, String path) { try { synchronized (this) { ProcessRecord proc = findProcessLocked(process, UserHandle.USER_SYSTEM, "attachAgent"); if (proc == null || proc.thread == null) { throw new IllegalArgumentException("Unknown process: " + process); } boolean isDebuggable = "1".equals(SystemProperties.get(SYSTEM_DEBUGGABLE, "0")); if (!isDebuggable) { if ((proc.info.flags & ApplicationInfo.FLAG_DEBUGGABLE) == 0) { throw new SecurityException("Process not debuggable: " + proc); } } proc.thread.attachAgent(path); } } catch (RemoteException e) { throw new IllegalStateException("Process disappeared"); } } @VisibleForTesting public static class Injector { private NetworkManagementInternal mNmi; public Context getContext() { return null; } public AppOpsService getAppOpsService(File file, Handler handler) { return new AppOpsService(file, handler); } public Handler getUiHandler(ActivityManagerService service) { return service.new UiHandler(); } public boolean isNetworkRestrictedForUid(int uid) { if (ensureHasNetworkManagementInternal()) { return mNmi.isNetworkRestrictedForUid(uid); } return false; } private boolean ensureHasNetworkManagementInternal() { if (mNmi == null) { mNmi = LocalServices.getService(NetworkManagementInternal.class); } return mNmi != null; } } @Override public void setShowWhenLocked(IBinder token, boolean showWhenLocked) throws RemoteException { synchronized (this) { final ActivityRecord r = ActivityRecord.isInStackLocked(token); if (r == null) { return; } final long origId = Binder.clearCallingIdentity(); try { r.setShowWhenLocked(showWhenLocked); } finally { Binder.restoreCallingIdentity(origId); } } } @Override public void setTurnScreenOn(IBinder token, boolean turnScreenOn) throws RemoteException { synchronized (this) { final ActivityRecord r = ActivityRecord.isInStackLocked(token); if (r == null) { return; } final long origId = Binder.clearCallingIdentity(); try { r.setTurnScreenOn(turnScreenOn); } finally { Binder.restoreCallingIdentity(origId); } } } }